Commit a652dd1d authored by Matus Talcik's avatar Matus Talcik
Browse files

changes

parent 268616e0
Loading
Loading
Loading
Loading
+0 −104
Original line number Diff line number Diff line
@@ -302,29 +302,6 @@ export class ContinuousTube implements HighLevelStructure {
        return this._points.length - 1;
    }

    public resetColorBorder(color: vec4): void {
        if (!this.buffer) return;

        this._colors.fill(color);
        this._colors2.fill(color);

        this._borderColors.fill(color);
        this._borderColors2.fill(color);

        const colorsArrayBuffer = new Uint8Array([
            color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255,
            color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255,
            color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255,
            color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255
        ]);

        const u8view = this.buffer.u8view;

        for (let i = 0; i < this._points.length - 1; i++) {
            u8view.set(colorsArrayBuffer, (this._roundedConesPosition + i) * LL_STRUCTURE_SIZE_BYTES + 64);
        }
    }

    public resetColor(color: vec4): void {
        this._colors.fill(color);

@@ -419,66 +396,6 @@ export class ContinuousTube implements HighLevelStructure {
        this.buffer.setModifiedBytes({ start: this._roundedConesPosition * LL_STRUCTURE_SIZE_BYTES, end: (this._roundedConesPosition + this._colors.length - 1) * LL_STRUCTURE_SIZE_BYTES });
    }

    public resetBorderColors(color: vec4): void {
        if (!this.buffer) return;

        this._borderColors.fill(color);
        this._borderColors2.fill(color);

        const colorsArrayBuffer = new Uint8Array([
            color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255,
            color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255,
        ]);

        const u8view = this.buffer.u8view;

        for (let i = 0; i < this._points.length - 1; i++) {
            u8view.set(colorsArrayBuffer, (this._roundedConesPosition + i) * LL_STRUCTURE_SIZE_BYTES + 72);
        }
    }

    public setBorderColors(borderColors: Array<vec4>): void {
        this._borderColors = borderColors;

        if (!this.buffer) {
            return;
        }

        const u8view = this.buffer.u8view;
        for (let i = 0; i < this._points.length - 1; i++) {
            const color = this._borderColors[i];
            const offset = (this._roundedConesPosition + i) * LL_STRUCTURE_SIZE_BYTES;

            u8view.set([color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255], offset + 72);
        }

        this.buffer.setModifiedBytes({ start: this._roundedConesPosition * LL_STRUCTURE_SIZE_BYTES, end: (this._roundedConesPosition + this._points.length) * LL_STRUCTURE_SIZE_BYTES });
    }

    public setBorderColors2(borderColors2: Array<vec4>): void {
        this._borderColors2 = borderColors2;

        if (!this.buffer) {
            return;
        }

        const u8view = this.buffer.u8view;
        for (let i = 0; i < this._points.length - 1; i++) {
            const color = this._borderColors2[i];
            const offset = (this._roundedConesPosition + i) * LL_STRUCTURE_SIZE_BYTES;

            u8view.set([color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255], offset + 76);
        }

        this.buffer.setModifiedBytes({ start: this._roundedConesPosition * LL_STRUCTURE_SIZE_BYTES, end: (this._roundedConesPosition + this._points.length) * LL_STRUCTURE_SIZE_BYTES });
    }

    public resetBorderColors2(color: vec4): void {
        this._borderColors2.fill(color);

        this.setBorderColors2(this._borderColors2);
    }

    public setColorsCombined(colors: Array<vec4>): void {
        if (!this.buffer) {
            return;
@@ -502,27 +419,6 @@ export class ContinuousTube implements HighLevelStructure {
        this.buffer.setModifiedBytes({ start: this._roundedConesPosition * LL_STRUCTURE_SIZE_BYTES, end: (this._roundedConesPosition + this._points.length + 1) * LL_STRUCTURE_SIZE_BYTES });
    }

    public setBorderColorsCombined(colors: Array<vec4>): void {
        if (!this.buffer || colors.length * 2 < this._points.length) {
            return;
        }

        const u8view = this.buffer.u8view;
        for (let i = 0; i < this._points.length - 1; i++) {
            const color = colors[2 * i];
            const color2 = colors[2 * i + 1];

            const offsetBytes = (this._roundedConesPosition + i) * LL_STRUCTURE_SIZE_BYTES;

            this._borderColors[i] = color;
            this._borderColors2[i] = color2;

            u8view.set([color[0] * 255, color[1] * 255, color[2] * 255, color[3] * 255, color2[0] * 255, color2[1] * 255, color2[2] * 255, color2[3] * 255], offsetBytes + 72);
        }

        this.buffer.setModifiedBytes({ start: this._roundedConesPosition * LL_STRUCTURE_SIZE_BYTES, end: (this._roundedConesPosition + this._points.length + 1) * LL_STRUCTURE_SIZE_BYTES });
    }

    public setSelectionIds(binIds: number[]): void {
        if (!this.buffer) {
            return;
+0 −24
Original line number Diff line number Diff line
@@ -167,18 +167,6 @@ export class Spheres implements HighLevelStructure {
        this.buffer.setModifiedBytes({ start: (this._spheresPosition) * LL_STRUCTURE_SIZE_BYTES, end: (this._spheresPosition + this._colors.length) * LL_STRUCTURE_SIZE_BYTES });
    }

    public resetBorderColors(color: vec4): void {
        this._borderColors.fill(color);

        if (!this.buffer) return;

        for (let i = 0; i < this._borderColors.length; i++) {
            writeSphereToArrayBuffer(this.buffer, this._spheresPosition + i, { borderColor: this._borderColors[i] });
        }

        this.buffer.setModifiedBytes({ start: (this._spheresPosition) * LL_STRUCTURE_SIZE_BYTES, end: (this._spheresPosition + this._borderColors.length) * LL_STRUCTURE_SIZE_BYTES });
    }

    public setColor(i: number, color: vec4): void {
        this._colors[i] = vec4.clone(color);

@@ -201,18 +189,6 @@ export class Spheres implements HighLevelStructure {
        this.buffer.setModifiedBytes({ start: (this._spheresPosition) * LL_STRUCTURE_SIZE_BYTES, end: (this._spheresPosition + this._colors.length) * LL_STRUCTURE_SIZE_BYTES });
    }

    public setBorderColors(colors: Array<vec4>): void {
        this._borderColors = colors.map(v => vec4.clone(v));

        if (!this.buffer) return;

        for (let i = 0; i < this._borderColors.length; i++) {
            writeSphereToArrayBuffer(this.buffer, this._spheresPosition + i, { borderColor: this._borderColors[i] });
        }

        this.buffer.setModifiedBytes({ start: (this._spheresPosition) * LL_STRUCTURE_SIZE_BYTES, end: (this._spheresPosition + this._borderColors.length) * LL_STRUCTURE_SIZE_BYTES });
    }

    public getColor(i: number): vec4 | Array<vec4> {
        return this._colors[i];
    }
+13 −53
Original line number Diff line number Diff line
@@ -4,10 +4,8 @@ import { Scene } from "../scene";
import { GraphicsLibrary } from "..";
import { Viewport3D } from ".";
import { vec2, vec3, vec4, quat } from "gl-matrix";
import { BoundingBox, BoundingBoxEmpty, BoundingBoxExtendByPoint, Hit, Ray } from "../shared";
import { quantile } from 'simple-statistics'
import { Hit, Ray } from "../shared";
import { Spline } from "../primitives/spline";
import { Plane, SectionCuts } from "../sectionCuts"

const CHROMATIN_OBJECT_NAME = 'CHROMATIN';

@@ -21,21 +19,23 @@ export type ChromatinRepresentationType = ContinuousTube | Spheres | Spline;

export class ChromatinPart {
  private _chromatinViewport: ChromatinViewport;

  private _name: string;
  private _structure: ChromatinRepresentationType;

  private _highLevelID: number;
  private _dataId: number;
  private _chromosomeIndex: number;

  private _binsPositions: Array<vec3>;
  private _binsColor: Array<vec4>;

  constructor(chromatinViewport: ChromatinViewport, name: string, structure: ChromatinRepresentationType, highLevelID: number, dataId: number, chromosomeIndex: number, binsPositions: Array<vec3>) {
  constructor(chromatinViewport: ChromatinViewport, name: string, structure: ChromatinRepresentationType, highLevelID: number, dataId: number, binsPositions: Array<vec3>) {
    this._name = name;
    this._chromatinViewport = chromatinViewport;
    this._structure = structure;
    this._highLevelID = highLevelID;
    this._dataId = dataId;
    this._chromosomeIndex = chromosomeIndex;

    this._binsPositions = binsPositions;
    this._binsColor = new Array<vec4>(this._binsPositions.length);
  }
@@ -47,7 +47,6 @@ export class ChromatinPart {
      // Calculate Intersection
      const intersection = vec3.add(vec3.create(), ray.origin, vec3.scale(vec3.create(), ray.direction, hit.distance));


      // Calculate normal
      const i = this._structure.localOffsetOf(LowLevelStructure.RoundedCone, hit.lowLevelIndex);

@@ -70,18 +69,14 @@ export class ChromatinPart {
      const lengthOnIntersection = vec3.length(vec3.sub(vec3.create(), from, vec3.sub(vec3.create(), intersection, vec3.scale(vec3.create(), normal, radius))));
      const ratio = lengthOnIntersection / capsuleLength;

      if (i == 0) {
        return 0;
      }

      if (i >= this._binsPositions.length) {
        return this._binsPositions.length - 1;
      }

      if (ratio < 0.5) {
        return i - 1;
      } else {
        return i;
      } else {
        return i + 1;
      }
    } else if (this._structure instanceof Spheres) {
      return this._structure.localOffsetOf(LowLevelStructure.Sphere, hit.lowLevelIndex);
@@ -94,11 +89,11 @@ export class ChromatinPart {

  public resetColor(color: GPUColorDict): void {
    if (this._structure instanceof ContinuousTube) {
      this._structure.resetColorBorder(vec4.fromValues(color.r, color.g, color.b, color.a));
      this._structure.resetColors(vec4.fromValues(color.r, color.g, color.b, color.a));
    } else if (this._structure instanceof Spheres) {
      this._structure.resetColors(vec4.fromValues(color.r, color.g, color.b, color.a));
    } else if (this._structure instanceof Spline) {
      this._structure.resetColorBorder(vec4.fromValues(color.r, color.g, color.b, color.a));
      this._structure.resetColors(vec4.fromValues(color.r, color.g, color.b, color.a));
    }
  }

@@ -196,10 +191,6 @@ export class ChromatinPart {
  public get highLevelID(): number {
    return this._highLevelID;
  }

  public get chromosomeIndex(): number {
    return this._chromosomeIndex;
  }
}

export type ChromatinIntersection = {
@@ -216,24 +207,9 @@ export type ChromatinIntersection = {

export class ChromatinViewport extends Viewport3D {
  public _chromatin: Array<ChromatinPart> = [];

  private maxId = 0;
  private binPositions: vec3[] = [];
  private debugRadius = 5.0;
  // private sectionCuts: { intersections: vec3[], planes: Plane[] } = {
  //   intersections: [],
  //   planes: []
  // }
  private sectionCuts: SectionCuts = new SectionCuts();
  // private box: BoundingBox = BoundingBoxEmpty();
  // private yRange = 0;

  //#region
  protected debugDisplay = {
    showBins: true,
    showPlanes: true,
    showIntersections: true
  }
  //#endregion

  constructor(
    graphicsLibrary: GraphicsLibrary,
@@ -241,7 +217,6 @@ export class ChromatinViewport extends Viewport3D {
    scene: Scene | null = null,
    camera: OrbitCamera | SmoothCamera | null = null) {
    super(graphicsLibrary, canvas, scene, camera);
    // this.calculateSectionCuts();
  }

  public clearChromatin(): void {
@@ -252,6 +227,7 @@ export class ChromatinViewport extends Viewport3D {
    for (let i = 0; i < this._chromatin.length; i++) {
      this._scene.removeStructureByID(this._chromatin[i].highLevelID);
    }

    this._chromatin = [];
  }

@@ -271,12 +247,11 @@ export class ChromatinViewport extends Viewport3D {
   * Adds a part of chromatin to the viewport
   * 
   * @param bins - sequence of points that represent bins of a chromatin part
   * @param center - whether the supplied data should be centered around point [0, 0, 0]
   * @param dataId - unique id of the supplied data
   * 
   * @returns created structure
   */
  public addPart(chromosomeName: string, bins: Array<{ x: number, y: number, z: number }>, center = false, dataId: number, chromosomeIndex: number, representation: ChromatinRepresentation, update = true): ChromatinPart {
  public addPart(chromosomeName: string, bins: Array<{ x: number, y: number, z: number }>, dataId: number, representation: ChromatinRepresentation, update = true): ChromatinPart {
    const pointsVec3 = bins.map(p => vec3.fromValues(p.x, p.y, p.z));

    this.binPositions = pointsVec3.map(p => vec3.clone(p));
@@ -316,14 +291,11 @@ export class ChromatinViewport extends Viewport3D {
      structure,
      highLevelID,
      dataId,
      chromosomeIndex,
      this.binPositions,
    ));

    this.maxId++;

    // this.calculateSectionCuts();

    return this._chromatin[this._chromatin.length - 1];
  }

@@ -343,37 +315,25 @@ export class ChromatinViewport extends Viewport3D {
    return this._chromatin;
  }

  public getChromatinPartByChromosomeIndex(chromosomeIndex: number): ChromatinPart | null {
    const chromatinPartIndex = this._chromatin.findIndex(v => v.chromosomeIndex == chromosomeIndex);

    return this._chromatin[chromatinPartIndex];
  }

  public closestIntersectionBin(screenSpacePosition: { x: number, y: number }): ChromatinIntersection | null {
    // console.time('ChromatinIntersection::closestIntersectionBin');
    const closestIntersection = this.closestIntersection(vec2.fromValues(screenSpacePosition.x, screenSpacePosition.y));

    if (closestIntersection == null) {
      // console.timeEnd('ChromatinIntersection::closestIntersectionBin');
      return null;
    }

    const chromatinPart = this._chromatin.find(chromatinPart => chromatinPart.highLevelID == closestIntersection.highLevelIndex);

    if (chromatinPart == undefined) {
      // console.timeEnd('ChromatinIntersection::closestIntersectionBin');
      return null;
    }

    const binIndex = chromatinPart.lowLevelIndexToBinIndex(closestIntersection);

    if (binIndex == null) {
      // console.timeEnd('ChromatinIntersection::closestIntersectionBin');
      return null;
    }

    // console.timeEnd('ChromatinIntersection::closestIntersectionBin');

    return {
      chromatinPart,