From 98650e1b0901605d79a06e8878825eeb0e7ca51a Mon Sep 17 00:00:00 2001
From: Gareth Tribello <gareth.tribello@gmail.com>
Date: Sat, 16 Sep 2017 12:02:56 +0200
Subject: [PATCH] Python interface (#262)

* Added first working python interface

* Tidied up python interface

* Further simplification of python

* Added example which should be deleted later

* Added functions for getting values from plumed to python

* Added regression test for python interface

* Added mechanism to return exceptions from plumed to python

* First commit of experimental stuff to catch exceptions in python correctly

* Got rid of unecessarily duplicated method in PlumedMain

* Fixed crazy MAC input encoding

* Oops, had also broken the script..

* Removed debug messages. Works on Ubuntu Linux

Linus rules. Apple sucks.

* Fixed PlumedMain passing of data from plumed to outside code

* Hard coded real precision for python interface - this should have been with the last commit

* Added first go at working makefile for python interface

* Added options to configure to build python interface from makefile

* Small changes to where loading of python interface is done

* Removed unecessary wrapper c++ function from python interface

* Made python install work in a way that is consistent with the rest of plumed

* Added pythonpath to travis.yml

* Added installation of Cython to travis.yml

* Added ifdef block to stop cppcheck throwing an error

* Using uniqu_ptr for DataFetching object in PlumedMain

* Added install command for numpy to travis

* Added string to tell me whether plumed+python is being built

* Small change in travis.yml file to see if I can get python compile working

* Compilers for cython are now specified from Makefile.conf

* Now printing stuff on environment to try to work out why linking doesn't work

* A new attempt to fix the travis-ci issues

* Got rid of troubling TRAVIS_PYTHON_FLAG

* Small change to see if we can get this to work on travis

* Now setting LDSHARED from LDSO in makefile

* Added something to print everything in the python path when we run the python test

* Fixed python path in travis.yml

* Removed stuff for debugging configuration on travis

* Customized conda install (for python) in travis.yml so that osx version is installed for osx and linux version is installed for linux

* Set TMPDIR in .travis.yml to hopefully get osx to compile PLUMED + Python

* Made it so that python interface is rebuilt when user does make install so that correct paths are used

* Made it so that python interface is rebuilt in staging area during install procedure

* Corrected regtest script so that python tests are dealt with the same as everything else
---
 .travis.yml                                 |   14 +
 Makefile                                    |    3 +-
 configure                                   |  105 +
 configure.ac                                |   10 +
 python/.gitignore                           |    9 +
 python/Makefile                             |   34 +
 python/buildPythonInterface.py              |   79 +
 python/cplumed.pxd                          |   29 +
 python/plumed.pyx                           |   80 +
 regtest/.gitignore                          |    1 +
 regtest/python/Makefile                     |    2 +
 regtest/python/rt-protein/Makefile          |    1 +
 regtest/python/rt-protein/colvar.ref        |   75 +
 regtest/python/rt-protein/config            |    4 +
 regtest/python/rt-protein/logfile.reference |   10 +
 regtest/python/rt-protein/python-script.py  |  149 ++
 regtest/python/rt-protein/template.pdb      |  258 ++
 regtest/python/rt-protein/traj.xyz          | 2580 +++++++++++++++++++
 regtest/scripts/run                         |    3 +
 sourceme.sh.in                              |    1 +
 src/.gitignore                              |    1 +
 src/cltools/Info.cpp                        |    3 +
 src/core/DataFetchingObject.cpp             |  158 ++
 src/core/DataFetchingObject.h               |   65 +
 src/core/PlumedMain.cpp                     |   25 +-
 src/core/PlumedMain.h                       |    4 +
 src/lib/Makefile                            |   11 +
 src/lib/modulefile.in                       |    1 +
 28 files changed, 3713 insertions(+), 2 deletions(-)
 create mode 100644 python/.gitignore
 create mode 100644 python/Makefile
 create mode 100644 python/buildPythonInterface.py
 create mode 100644 python/cplumed.pxd
 create mode 100644 python/plumed.pyx
 create mode 100644 regtest/python/Makefile
 create mode 100644 regtest/python/rt-protein/Makefile
 create mode 100644 regtest/python/rt-protein/colvar.ref
 create mode 100644 regtest/python/rt-protein/config
 create mode 100644 regtest/python/rt-protein/logfile.reference
 create mode 100644 regtest/python/rt-protein/python-script.py
 create mode 100644 regtest/python/rt-protein/template.pdb
 create mode 100644 regtest/python/rt-protein/traj.xyz
 create mode 100644 src/core/DataFetchingObject.cpp
 create mode 100644 src/core/DataFetchingObject.h

diff --git a/.travis.yml b/.travis.yml
index 94edbd1b9..605deb06b 100644
--- a/.travis.yml
+++ b/.travis.yml
@@ -92,6 +92,10 @@ install:
   - export INCLUDE="$HOME/opt/include:$INCLUDE"
   - export LIBRARY_PATH="$HOME/opt/lib:$LIBRARY_PATH"
   - export LD_LIBRARY_PATH="$HOME/opt/lib:$LD_LIBRARY_PATH"
+  - export PYTHONPATH="$HOME/opt/lib/plumed/python:$PYTHONPATH"
+# Setting the TMPDIR in this way allegedly prevents problems with the compilation of 
+# PLUMED + Python on macos
+  - export TMPDIR="/tmp" 
 # on travis, better dump stack trace in case there is an error
   - export PLUMED_STACK_TRACE=yes
 # build the manual, only if log contains string [makedoc]
@@ -124,6 +128,16 @@ install:
   - if test "$MAKEDOC" == yes ; then sudo apt-get install -y doxygen-latex ; fi
 # install lcov
   - if test "$MAKEDOC" == yes ; then ./.travis/install.lcov v1.13 ; fi
+# install numpy and cython for python interface
+  - if test "$TRAVIS_OS_NAME" == "linux" ; then wget https://repo.continuum.io/miniconda/Miniconda3-latest-Linux-x86_64.sh -O miniconda.sh ; fi
+  - if test "$TRAVIS_OS_NAME" == "osx" ; then wget https://repo.continuum.io/miniconda/Miniconda3-latest-MacOSX-x86_64.sh -O miniconda.sh ; fi
+  - bash miniconda.sh -b -p $HOME/miniconda
+  - export PATH="$HOME/miniconda/bin:$PATH"
+  - hash -r
+  - conda config --set always_yes yes --set changeps1 no
+  - conda update -q conda
+  - conda create -q -n test-environment python=3.6 numpy Cython
+  - source activate test-environment
 # then replace doxygen with the desided version
 # I use 1.8.10 instead of 1.8.11 since it looks like 1.8.11 have troubles with
 # non case sensitive files (it writes capitalized filenames)
diff --git a/Makefile b/Makefile
index 7be10652d..4aba51e10 100644
--- a/Makefile
+++ b/Makefile
@@ -8,7 +8,7 @@ endif
 
 
 SRCDIRS := src test
-SUBDIRS := $(SRCDIRS) user-doc developer-doc regtest macports vim astyle
+SUBDIRS := $(SRCDIRS) user-doc developer-doc regtest macports vim astyle python
 
 SUBDIRSCLEAN:=$(addsuffix .clean,$(SUBDIRS))
 
@@ -20,6 +20,7 @@ ifdef GCCDEP
 all:
 	$(MAKE) lib
 	$(MAKE) -C vim
+	$(MAKE) -C python
 
 # target useful for macports
 # it builds the code then the documentation
diff --git a/configure b/configure
index 3e7320705..971a7188e 100755
--- a/configure
+++ b/configure
@@ -632,6 +632,8 @@ doxygen
 make_doc
 readelf
 LD
+cython
+py
 OPENMP_CXXFLAGS
 EGREP
 GREP
@@ -724,6 +726,7 @@ enable_xdrfile
 enable_boost_graph
 enable_boost_serialization
 enable_fftw
+enable_python
 enable_openmp
 '
       ac_precious_vars='build_alias
@@ -1395,6 +1398,7 @@ Optional Features:
   --enable-boost_serialization
                           enable search for boost serialization, default: no
   --enable-fftw           enable search for fftw, default: no
+  --enable-python         enable search for python, default: yes
   --disable-openmp        do not use OpenMP
 
 Some influential environment variables:
@@ -2957,6 +2961,24 @@ fi
 
 
 
+python=
+# Check whether --enable-python was given.
+if test "${enable_python+set}" = set; then :
+  enableval=$enable_python; case "${enableval}" in
+             (yes) python=true ;;
+             (no)  python=false ;;
+             (*)   as_fn_error $? "wrong argument to --enable-python" "$LINENO" 5 ;;
+  esac
+else
+  case "yes" in
+             (yes) python=true ;;
+             (no)  python=false ;;
+  esac
+
+fi
+
+
+
 
 
 
@@ -7546,6 +7568,89 @@ fi
 
 
 fi
+if test $python == true ; then
+  # Extract the first word of "python", so it can be a program name with args.
+set dummy python; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_py+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$py"; then
+  ac_cv_prog_py="$py" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_py="found"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+py=$ac_cv_prog_py
+if test -n "$py"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $py" >&5
+$as_echo "$py" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  # Extract the first word of "cython", so it can be a program name with args.
+set dummy cython; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_cython+:} false; then :
+  $as_echo_n "(cached) " >&6
+else
+  if test -n "$cython"; then
+  ac_cv_prog_cython="$cython" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+  IFS=$as_save_IFS
+  test -z "$as_dir" && as_dir=.
+    for ac_exec_ext in '' $ac_executable_extensions; do
+  if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+    ac_cv_prog_cython="found"
+    $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+    break 2
+  fi
+done
+  done
+IFS=$as_save_IFS
+
+fi
+fi
+cython=$ac_cv_prog_cython
+if test -n "$cython"; then
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: $cython" >&5
+$as_echo "$cython" >&6; }
+else
+  { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+  if test "$py" == found && test "$cython" == found ; then
+     $as_echo "#define __PLUMED_HAS_PYTHON 1" >>confdefs.h
+
+  else
+     { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cannot enable python" >&5
+$as_echo "$as_me: WARNING: cannot enable python" >&2;}
+  fi
+fi
 
 
 
diff --git a/configure.ac b/configure.ac
index 708bc405c..5b580c56c 100644
--- a/configure.ac
+++ b/configure.ac
@@ -249,6 +249,7 @@ PLUMED_CONFIG_ENABLE([xdrfile],[search for xdrfile],[yes])
 PLUMED_CONFIG_ENABLE([boost_graph],[search for boost graph],[no])
 PLUMED_CONFIG_ENABLE([boost_serialization],[search for boost serialization],[no])
 PLUMED_CONFIG_ENABLE([fftw],[search for fftw],[no])
+PLUMED_CONFIG_ENABLE([python],[search for python],[yes])
 
 AC_ARG_VAR(SOEXT,[extension of dynamic libraries (so/dylib)])
 AC_ARG_VAR(STATIC_LIBS,[variables that should be linked statically directly to MD code - configure will add here -ldl if necessary ])
@@ -585,6 +586,15 @@ fi
 if test $zlib == true ; then
   PLUMED_CHECK_PACKAGE([zlib.h],[gzopen],[__PLUMED_HAS_ZLIB],[z])
 fi
+if test $python == true ; then
+  AC_CHECK_PROG([py],[python],[found])
+  AC_CHECK_PROG([cython],[cython],[found])
+  if test "$py" == found && test "$cython" == found ; then
+     AC_DEFINE([__PLUMED_HAS_PYTHON])
+  else 
+     AC_MSG_WARN([cannot enable python])
+  fi
+fi
 
 if test $gsl == true ; then
   found=ko
diff --git a/python/.gitignore b/python/.gitignore
new file mode 100644
index 000000000..bac163535
--- /dev/null
+++ b/python/.gitignore
@@ -0,0 +1,9 @@
+/*
+# in this directory, only accept source, Makefile and README
+!/.gitignore
+!/*.pxd
+!/*.py
+!/*.pyx
+!/Makefile
+!/README
+!/module.type
diff --git a/python/Makefile b/python/Makefile
new file mode 100644
index 000000000..0877e8893
--- /dev/null
+++ b/python/Makefile
@@ -0,0 +1,34 @@
+# include the machine dependent configuration
+ifneq ($(MAKECMDGOALS),clean)
+  -include ../Makefile.conf
+endif
+
+.PHONY: all clean install
+
+plumed_compiled := $(wildcard ../src/lib/plumed)
+
+ifeq ($(strip $(plumed_compiled)),)
+
+all:
+	@echo You must compile plumed before building the cython interface
+
+else
+
+ifneq (,$(findstring __PLUMED_HAS_PYTHON,$(CPPFLAGS)))
+
+all:
+	@echo Building python interface for PLUMED 
+	python buildPythonInterface.py build_ext -i
+
+else
+
+all:
+	@echo Did not find __PLUMED_HAS_PYTHON
+	@echo $(CPPFLAGS)
+
+endif
+
+endif
+
+clean:
+	rm -fr *.so plumed.cpp build
diff --git a/python/buildPythonInterface.py b/python/buildPythonInterface.py
new file mode 100644
index 000000000..72e853f69
--- /dev/null
+++ b/python/buildPythonInterface.py
@@ -0,0 +1,79 @@
+#/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
+#   Copyright (c) 2011-2016 The plumed team
+#   (see the PEOPLE file at the root of the distribution for a list of names)
+#
+#   See http://www.plumed.org for more information.
+#
+#   This file is part of plumed, version 2.
+#
+#   plumed is free software: you can redistribute it and/or modify
+#   it under the terms of the GNU Lesser General Public License as published by
+#   the Free Software Foundation, either version 3 of the License, or
+#   (at your option) any later version.
+#
+#   plumed is distributed in the hope that it will be useful,
+#   but WITHOUT ANY WARRANTY; without even the implied warranty of
+#   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#   GNU Lesser General Public License for more details.
+#
+#   You should have received a copy of the GNU Lesser General Public License
+#   along with plumed.  If not, see <http://www.gnu.org/licenses/>.
+#+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */
+#
+# This python routine builds an interface between plumed and python using cython
+#
+from distutils.core import setup
+from distutils.extension import Extension
+from Cython.Build import cythonize
+import numpy
+import subprocess
+import os
+
+# Function for checking if PLUMED is in path
+def is_exe(fpath):
+    return os.path.isfile(fpath) and os.access(fpath, os.X_OK)
+
+# Check if PLUMED is in PATH
+plumedexe = '../src/lib/plumed'
+for path in os.environ["PATH"].split(os.pathsep):
+    path = path.strip('"')
+    exe_file = os.path.join(path, 'plumed') 
+    if is_exe(exe_file) : 
+       plumedexe=exe_file
+       break
+
+# Get information on where plumed headers and libraries are installed and the version number
+print( "Plumedexe is " + plumedexe )
+plumedroot = subprocess.check_output([plumedexe, 'info', '--root']).decode("utf-8").strip("\n")
+print( "Creating interface for plumed version in " + plumedroot )
+plumedhead = subprocess.check_output([plumedexe, 'info', '--include-dir']).decode("utf-8").strip("\n") + "/plumed/wrapper/"
+print( "Using headers in " + plumedhead )
+plumedversion = subprocess.check_output([plumedexe, 'info', '--version']).decode("utf-8")
+print( "Version number for this plumed is " + plumedversion )
+# Get list containing all config variables so we can extract information on compilers to use during cython build
+plumedconfig = subprocess.check_output([plumedexe, 'info', '--configuration']).decode("utf-8").split("\n")
+
+for line in plumedconfig :
+   if "CC=" in line : os.environ["CC"] = line.replace("CC=","").replace("\n","")
+   if "CXX=" in line : os.environ["CXX"] = line.replace("CXX=","").replace("\n","")
+   if "LDSO=" in line : os.environ["LDSHARED"] = line.replace("LDSO=","").replace("\n","")
+
+print( "Building interface using CC=" + os.environ["CC"] + " , CXX=" + os.environ["CXX"] + " and LDSHARED=" + os.environ["LDSHARED"] )
+
+setup(
+  name='plumed',
+  version=plumedversion,
+  description='Python interface to PLUMED',
+  author='Gareth A. Tribello',
+  author_email='plumed-users@googlegroups.com',
+  url='http://www.plumed.org',
+  ext_modules = cythonize([
+                  Extension( name="plumed", 
+                             sources=["plumed.pyx"],
+                             library_dirs=[plumedroot, plumedroot + "/src/lib/"],
+                             libraries=["plumed"],
+                             language="c++",
+                             include_dirs=[plumedhead, numpy.get_include()]
+                           )
+                          ])
+)
diff --git a/python/cplumed.pxd b/python/cplumed.pxd
new file mode 100644
index 000000000..e0f58c121
--- /dev/null
+++ b/python/cplumed.pxd
@@ -0,0 +1,29 @@
+#/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
+#   Copyright (c) 2011-2016 The plumed team
+#   (see the PEOPLE file at the root of the distribution for a list of names)
+#
+#   See http://www.plumed.org for more information.
+#
+#   This file is part of plumed, version 2.
+#
+#   plumed is free software: you can redistribute it and/or modify
+#   it under the terms of the GNU Lesser General Public License as published by
+#   the Free Software Foundation, either version 3 of the License, or
+#   (at your option) any later version.
+#
+#   plumed is distributed in the hope that it will be useful,
+#   but WITHOUT ANY WARRANTY; without even the implied warranty of
+#   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#   GNU Lesser General Public License for more details.
+#
+#   You should have received a copy of the GNU Lesser General Public License
+#   along with plumed.  If not, see <http://www.gnu.org/licenses/>.
+#+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */
+#
+# This create cython wrappers to the main bits of the PLUMED libraray
+#
+cdef extern from "Plumed.h" :
+     ctypedef struct plumed:
+         pass
+     plumed plumed_create()
+     void plumed_cmd(plumed p, const char*key, const void*val) except + 
diff --git a/python/plumed.pyx b/python/plumed.pyx
new file mode 100644
index 000000000..de2767157
--- /dev/null
+++ b/python/plumed.pyx
@@ -0,0 +1,80 @@
+#/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
+#   Copyright (c) 2011-2016 The plumed team
+#   (see the PEOPLE file at the root of the distribution for a list of names)
+#
+#   See http://www.plumed.org for more information.
+#
+#   This file is part of plumed, version 2.
+#
+#   plumed is free software: you can redistribute it and/or modify
+#   it under the terms of the GNU Lesser General Public License as published by
+#   the Free Software Foundation, either version 3 of the License, or
+#   (at your option) any later version.
+#
+#   plumed is distributed in the hope that it will be useful,
+#   but WITHOUT ANY WARRANTY; without even the implied warranty of
+#   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+#   GNU Lesser General Public License for more details.
+#
+#   You should have received a copy of the GNU Lesser General Public License
+#   along with plumed.  If not, see <http://www.gnu.org/licenses/>.
+#+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */
+#
+# This is a cython wrapper for the main parts of the PLUMED interface - the constructor and cmd
+# The main purpose of this is to convert the python types to C types that PLUMED understands
+#
+
+cimport cplumed  # This imports information from pxd file - including contents of this file here causes name clashes
+import numpy as np
+cimport numpy as np
+
+cdef class Plumed:
+     cdef cplumed.plumed c_plumed
+     def __cinit__(self):
+         self.c_plumed = cplumed.plumed_create()   #new cplumed.Plumed()
+         cdef int pres = 8
+         cplumed.plumed_cmd(self.c_plumed, "setRealPrecision", <void*>&pres )  
+     def __dealloc__(self): 
+         pass
+         #del self.c_plumed
+
+     def cmd_ndarray_real(self, ckey, val):
+         cdef double [:] abuffer = val.ravel()
+         cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&abuffer[0])
+     def cmd_ndarray_int(self, ckey, val):
+         cdef long [:] abuffer = val.ravel()
+         cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&abuffer[0])
+     cdef cmd_float(self, ckey, double val ):
+         cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&val )
+     cdef cmd_int(self, ckey, int val):
+         cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&val)
+
+     def cmd( self, key, val=None ):
+         cdef bytes py_bytes = key.encode()
+         cdef char* ckey = py_bytes
+         cdef char* cval 
+         cdef np.int_t[:] ibuffer
+         cdef np.float64_t[:] dbuffer
+         if val is None :
+            cplumed.plumed_cmd( self.c_plumed, ckey, NULL )
+         elif isinstance(val, (int,long) ):
+            if key=="getDataRank" :
+               raise ValueError("when using cmd with getDataRank option value must a size one ndarray")
+            self.cmd_int(ckey, val)
+         elif isinstance(val, float ) :
+            if key=="getBias" :
+               raise ValueError("when using cmd with getBias option value must be a size one ndarray")
+            self.cmd_float(ckey, val) 
+         elif isinstance(val, np.ndarray) : 
+            if( val.dtype=="float64" ):
+               self.cmd_ndarray_real(ckey, val)
+            elif( val.dtype=="int64" ) : 
+               self.cmd_ndarray_int(ckey, val)
+            else :
+               raise ValueError("ndarrys should be float64 or int64")
+         elif isinstance(val, basestring ) :
+              py_bytes = val.encode()
+              cval = py_bytes 
+              cplumed.plumed_cmd( self.c_plumed, ckey, <void*>cval )
+         else :
+            raise ValueError("Unknown value type ({})".format(str(type(val))))
diff --git a/regtest/.gitignore b/regtest/.gitignore
index a19e9d680..6e747a7ce 100644
--- a/regtest/.gitignore
+++ b/regtest/.gitignore
@@ -12,6 +12,7 @@
 !/drr
 !/mapping
 !/multicolvar
+!/python
 !/secondarystructure
 !/trajectories
 !/scripts
diff --git a/regtest/python/Makefile b/regtest/python/Makefile
new file mode 100644
index 000000000..42480767a
--- /dev/null
+++ b/regtest/python/Makefile
@@ -0,0 +1,2 @@
+include ../scripts/module.make
+
diff --git a/regtest/python/rt-protein/Makefile b/regtest/python/rt-protein/Makefile
new file mode 100644
index 000000000..3703b27ce
--- /dev/null
+++ b/regtest/python/rt-protein/Makefile
@@ -0,0 +1 @@
+include ../../scripts/test.make
diff --git a/regtest/python/rt-protein/colvar.ref b/regtest/python/rt-protein/colvar.ref
new file mode 100644
index 000000000..2749c8676
--- /dev/null
+++ b/regtest/python/rt-protein/colvar.ref
@@ -0,0 +1,75 @@
+#! FIELDS time t1 t2 t3 t4 t5 t6 t7 t8 t9 t10 t11 t12 t13 t14 t15 t16 t17 t18 t19 t20 t21 t22 t23 t24 t25 t26 t27 t28 t29 t30 t31 t32
+#! SET min_t1 -pi
+#! SET max_t1 pi
+#! SET min_t2 -pi
+#! SET max_t2 pi
+#! SET min_t3 -pi
+#! SET max_t3 pi
+#! SET min_t4 -pi
+#! SET max_t4 pi
+#! SET min_t5 -pi
+#! SET max_t5 pi
+#! SET min_t6 -pi
+#! SET max_t6 pi
+#! SET min_t7 -pi
+#! SET max_t7 pi
+#! SET min_t8 -pi
+#! SET max_t8 pi
+#! SET min_t9 -pi
+#! SET max_t9 pi
+#! SET min_t10 -pi
+#! SET max_t10 pi
+#! SET min_t11 -pi
+#! SET max_t11 pi
+#! SET min_t12 -pi
+#! SET max_t12 pi
+#! SET min_t13 -pi
+#! SET max_t13 pi
+#! SET min_t14 -pi
+#! SET max_t14 pi
+#! SET min_t15 -pi
+#! SET max_t15 pi
+#! SET min_t16 -pi
+#! SET max_t16 pi
+#! SET min_t17 -pi
+#! SET max_t17 pi
+#! SET min_t18 -pi
+#! SET max_t18 pi
+#! SET min_t19 -pi
+#! SET max_t19 pi
+#! SET min_t20 -pi
+#! SET max_t20 pi
+#! SET min_t21 -pi
+#! SET max_t21 pi
+#! SET min_t22 -pi
+#! SET max_t22 pi
+#! SET min_t23 -pi
+#! SET max_t23 pi
+#! SET min_t24 -pi
+#! SET max_t24 pi
+#! SET min_t25 -pi
+#! SET max_t25 pi
+#! SET min_t26 -pi
+#! SET max_t26 pi
+#! SET min_t27 -pi
+#! SET max_t27 pi
+#! SET min_t28 -pi
+#! SET max_t28 pi
+#! SET min_t29 -pi
+#! SET max_t29 pi
+#! SET min_t30 -pi
+#! SET max_t30 pi
+#! SET min_t31 -pi
+#! SET max_t31 pi
+#! SET min_t32 -pi
+#! SET max_t32 pi
+ 0.000000   2.6673  -2.6079  -2.5276   2.5020  -1.3261   3.0525  -1.8084  -0.0736  -1.3280   2.6118  -2.0303   1.8183  -1.3815  -0.2169  -1.2568  -0.7685  -1.7450  -0.3744   1.2239   0.8575  -2.4660   2.6198  -1.8094   2.9244  -1.5597   2.8624  -1.1022   2.1081  -2.0835   0.6224  -2.1615   2.7653
+ 1.000000   2.6673  -2.6079  -2.5276   2.5020  -1.3261   3.0525  -1.8084  -0.0736  -1.3280   2.6118  -2.0303   1.8183  -1.3815  -0.2169  -1.2568  -0.7685  -1.7450  -0.3744   1.2239   0.8575  -2.4660   2.6198  -1.8094   2.9244  -1.5597   2.8624  -1.1022   2.1081  -2.0835   0.6224  -2.1615   2.7653
+ 2.000000  -0.9673   2.4119  -2.2418   2.7803  -2.3131   2.3876  -2.3286   2.3327  -1.4141   2.2393  -2.2142   2.2270  -0.9976  -0.3431  -1.0938  -0.3082  -2.2269  -0.2595   0.7807   0.4861  -2.3900   2.7449  -1.4376   2.1693  -2.3192   2.6746  -1.2204   2.4187  -1.4845  -0.1224  -2.6383  -0.5531
+ 3.000000  -1.3798   2.7585  -2.3505   2.3231  -2.4228   2.7527  -2.5022   2.4132  -1.0556   2.2403  -2.4706   2.7123  -1.4820   0.2169  -1.1392  -0.7251  -2.1587  -0.0695   1.0791   0.9229  -2.8680   2.8393  -1.0979   2.0346  -2.1888   2.3545  -1.0655   2.3049  -1.3419   0.0942  -1.1673   2.3807
+ 4.000000   1.2920  -0.7003  -2.5882   2.4760  -2.4540   2.3686  -1.4398   2.6403  -2.4205   2.0865  -1.3307   1.4736  -1.0424  -0.1993  -1.4950  -0.1059  -2.4983  -0.1105   1.0443   0.4840  -1.7222   2.4065  -1.7269   2.3143  -2.2191   2.3508  -1.1054   2.6893  -1.3528  -0.5495  -2.7595   2.9670
+ 5.000000   1.8599  -3.1274  -1.3579   2.4524  -1.9912   2.8062  -2.0123   2.1368  -1.4832   2.4309  -2.0781   2.1238  -1.3223  -0.0961  -1.5850  -0.3327  -1.9738  -0.3105   1.0355   0.7932  -2.2536   2.8352  -1.7773   2.2652  -2.0858   2.6194  -1.2476   2.5713  -1.3721  -0.3135  -2.7986  -0.5437
+ 6.000000  -1.5246  -0.2344  -2.7770   2.3525  -2.2150   2.7121  -2.1907   2.7251  -2.1034   2.8239  -2.4138   1.7869  -0.8552  -0.6065  -1.0890  -0.4862  -1.9182  -0.1710   1.1336   0.3106  -1.7386   2.5118  -1.6340   2.4873  -2.3121   2.5220  -1.2814   2.6471  -1.2469  -0.4013  -1.5424   0.0513
+ 7.000000   1.3204   2.6070  -2.5673  -3.0655  -2.0904   2.3325  -2.5554   2.6183  -1.8992   2.6116  -1.9680   2.2707  -1.3625  -0.6381  -1.3566  -0.0505  -2.2325  -0.1415   0.9845   0.5160  -1.8538   2.8091  -2.1497   2.1461  -2.3947   2.5541  -2.3627   2.4673  -1.6932   1.0496  -2.6498   2.5858
+ 8.000000  -1.0771  -3.0455  -2.5817   2.8269  -1.8861   2.3354  -2.7105   2.4447  -1.6689   2.7067  -2.4288   2.1654  -1.3553  -0.4675  -1.2710  -0.4276  -2.2087   0.0495   0.9547   0.9757  -2.3635   2.8981  -1.8110   2.6522  -2.4328   2.3552  -2.2381   2.1866  -1.0044  -0.3137  -2.0097   0.1108
+ 9.000000   1.3122  -0.2812  -1.5467   2.8023  -1.4313   2.3505  -2.4359   2.5426  -1.8438   2.8783  -2.6368   1.9558  -1.2627  -0.5596  -1.0455  -0.2465  -2.1349  -0.1464   0.9422   0.2845  -1.7008   2.9339  -2.1567   2.6516  -2.4158   2.1019  -1.7146   2.0221  -1.2844   0.3707  -1.1716   2.6711
diff --git a/regtest/python/rt-protein/config b/regtest/python/rt-protein/config
new file mode 100644
index 000000000..57dff95f9
--- /dev/null
+++ b/regtest/python/rt-protein/config
@@ -0,0 +1,4 @@
+plumed_needs=python
+# this is to test a different name
+arg="./python-script.py"
+extra_files="../../trajectories/trajectory.xyz"
diff --git a/regtest/python/rt-protein/logfile.reference b/regtest/python/rt-protein/logfile.reference
new file mode 100644
index 000000000..c46dd449a
--- /dev/null
+++ b/regtest/python/rt-protein/logfile.reference
@@ -0,0 +1,10 @@
+RUNNING ANALYSIS FOR STEP 0
+RUNNING ANALYSIS FOR STEP 1
+RUNNING ANALYSIS FOR STEP 2
+RUNNING ANALYSIS FOR STEP 3
+RUNNING ANALYSIS FOR STEP 4
+RUNNING ANALYSIS FOR STEP 5
+RUNNING ANALYSIS FOR STEP 6
+RUNNING ANALYSIS FOR STEP 7
+RUNNING ANALYSIS FOR STEP 8
+RUNNING ANALYSIS FOR STEP 9
diff --git a/regtest/python/rt-protein/python-script.py b/regtest/python/rt-protein/python-script.py
new file mode 100644
index 000000000..88edd6abb
--- /dev/null
+++ b/regtest/python/rt-protein/python-script.py
@@ -0,0 +1,149 @@
+# The numbers calculated by the following python script are compared with those output from this PLUMED input
+#
+# MOLINFO STRUCTURE=template.pdb
+# t1: TORSION ATOMS=@phi-2
+# t2: TORSION ATOMS=@psi-2
+# t3: TORSION ATOMS=@phi-3
+# t4: TORSION ATOMS=@psi-3
+# t5: TORSION ATOMS=@phi-4
+# t6: TORSION ATOMS=@psi-4
+# t7: TORSION ATOMS=@phi-5
+# t8: TORSION ATOMS=@psi-5
+# t9: TORSION ATOMS=@phi-6
+# t10: TORSION ATOMS=@psi-6
+# t11: TORSION ATOMS=@phi-7
+# t12: TORSION ATOMS=@psi-7
+# t13: TORSION ATOMS=@phi-8
+# t14: TORSION ATOMS=@psi-8
+# t15: TORSION ATOMS=@phi-9
+# t16: TORSION ATOMS=@psi-9
+# t17: TORSION ATOMS=@phi-10
+# t18: TORSION ATOMS=@psi-10
+# t19: TORSION ATOMS=@phi-11
+# t20: TORSION ATOMS=@psi-11
+# t21: TORSION ATOMS=@phi-12
+# t22: TORSION ATOMS=@psi-12
+# t23: TORSION ATOMS=@phi-13
+# t24: TORSION ATOMS=@psi-13
+# t25: TORSION ATOMS=@phi-14
+# t26: TORSION ATOMS=@psi-14
+# t27: TORSION ATOMS=@phi-15
+# t28: TORSION ATOMS=@psi-15
+# t29: TORSION ATOMS=@phi-16
+# t30: TORSION ATOMS=@psi-16
+# t31: TORSION ATOMS=@phi-17
+# t32: TORSION ATOMS=@psi-17
+#    
+# PRINT ARG=t1,t2,t3,t4,t5,t6,t7,t8,t9,t10,t11,t12,t13,t14,t15,t16,t17,t18,t19,t20,t21,t22,t23,t24,t25,t26,t27,t28,t29,t30,t31,t32 FILE=colvar.ref FMT=%8.4f
+
+import numpy as np
+import plumed
+
+def read_xyz(filename):
+   xyz = open(filename)
+   n_atoms = int(xyz.readline())
+   title, trajectory = xyz.readline(), []
+   while True :
+      atom_type, coordinates = np.zeros(n_atoms).astype(str), np.zeros([n_atoms,3]) 
+      for i in range(0,n_atoms) :
+          line = xyz.readline()
+          atom,x,y,z = line.split()
+          atom_type[i]=atom
+          coordinates[i,:]=np.array([x,y,z],dtype=np.float64)
+      trajectory.append( coordinates )
+      nextline = xyz.readline()
+      if( nextline=="" ) : break
+      c_atoms = int(nextline)
+      if( c_atoms!=n_atoms ) : break 
+      title = xyz.readline()
+   xyz.close()
+   return trajectory
+
+def create_plumed_var( p, name, command ):
+   p.cmd("readInputLine", name + ": " + command )
+   shape = np.zeros( 1, dtype=np.int_ )
+   p.cmd("getDataRank " + name, shape )
+   data = np.zeros((1))
+   p.cmd("setMemoryForData " + name, data )
+   return data
+
+# Output to four decimal places only
+np.set_printoptions(precision=4)
+# Read trajectory
+traj = read_xyz("traj.xyz")
+num_frames = len(traj)
+num_atoms = traj[0].shape[0]
+
+# Create arrays for stuff
+box=np.diag(12.41642*np.ones(3,dtype=np.float64))
+virial=np.zeros((3,3),dtype=np.float64)
+masses=np.ones(num_atoms,dtype=np.float64)
+forces=np.random.rand(num_atoms,3)
+charges=np.zeros(num_atoms,dtype=np.float64)
+
+# Create PLUMED object and read input
+p = plumed.Plumed()
+p.cmd("setMDEngine","python")
+p.cmd("setTimestep", 1.)
+p.cmd("setKbT", 1.)
+p.cmd("setNatoms",num_atoms)
+p.cmd("setLogFile","test.log")
+p.cmd("init")
+p.cmd("readInputLine","MOLINFO STRUCTURE=template.pdb")
+t1 = create_plumed_var( p, "t1", "TORSION ATOMS=@phi-2" ) 
+t2 = create_plumed_var( p, "t2", "TORSION ATOMS=@psi-2" )
+t3 = create_plumed_var( p, "t3", "TORSION ATOMS=@phi-3" )
+t4 = create_plumed_var( p, "t4", "TORSION ATOMS=@psi-3" )
+t5 = create_plumed_var( p, "t5", "TORSION ATOMS=@phi-4" )
+t6 = create_plumed_var( p, "t6", "TORSION ATOMS=@psi-4" )
+t7 = create_plumed_var( p, "t7", "TORSION ATOMS=@phi-5" )
+t8 = create_plumed_var( p, "t8", "TORSION ATOMS=@psi-5" )
+t9 = create_plumed_var( p, "t9", "TORSION ATOMS=@phi-6" )
+t10 = create_plumed_var( p, "t10", "TORSION ATOMS=@psi-6" )
+t11 = create_plumed_var( p, "t11", "TORSION ATOMS=@phi-7" )
+t12 = create_plumed_var( p, "t12", "TORSION ATOMS=@psi-7" )
+t13 = create_plumed_var( p, "t13", "TORSION ATOMS=@phi-8" )
+t14 = create_plumed_var( p, "t14", "TORSION ATOMS=@psi-8" )
+t15 = create_plumed_var( p, "t15", "TORSION ATOMS=@phi-9" )
+t16 = create_plumed_var( p, "t16", "TORSION ATOMS=@psi-9" )
+t17 = create_plumed_var( p, "t17", "TORSION ATOMS=@phi-10" )
+t18 = create_plumed_var( p, "t18", "TORSION ATOMS=@psi-10" )
+t19 = create_plumed_var( p, "t19", "TORSION ATOMS=@phi-11" )
+t20 = create_plumed_var( p, "t20", "TORSION ATOMS=@psi-11" )
+t21 = create_plumed_var( p, "t21", "TORSION ATOMS=@phi-12" )
+t22 = create_plumed_var( p, "t22", "TORSION ATOMS=@psi-12" )
+t23 = create_plumed_var( p, "t23", "TORSION ATOMS=@phi-13" )
+t24 = create_plumed_var( p, "t24", "TORSION ATOMS=@psi-13" )
+t25 = create_plumed_var( p, "t25", "TORSION ATOMS=@phi-14" )
+t26 = create_plumed_var( p, "t26", "TORSION ATOMS=@psi-14" )
+t27 = create_plumed_var( p, "t27", "TORSION ATOMS=@phi-15" )
+t28 = create_plumed_var( p, "t28", "TORSION ATOMS=@psi-15" )
+t29 = create_plumed_var( p, "t29", "TORSION ATOMS=@phi-16" )
+t30 = create_plumed_var( p, "t30", "TORSION ATOMS=@psi-16" )
+t31 = create_plumed_var( p, "t31", "TORSION ATOMS=@phi-17" )
+t32 = create_plumed_var( p, "t32", "TORSION ATOMS=@psi-17" )
+ 
+# Read in the correct answers that were calculated directly using PLUMED
+correct_torsions = np.loadtxt("colvar.ref")
+# Open an output file
+of = open("logfile", "w+")
+
+# Now analyze the trajectory
+for step in range(0,num_frames) :
+    of.write("RUNNING ANALYSIS FOR STEP " + str(step) + "\n" )
+    p.cmd("setStep",step )
+    p.cmd("setBox",box )
+    p.cmd("setMasses", masses )
+    p.cmd("setCharges", charges )
+    p.cmd("setPositions", traj[step])
+    p.cmd("setForces", forces )
+    p.cmd("setVirial", virial )
+    p.cmd("calc")
+    bias = np.zeros((1),dtype=np.float64)
+    p.cmd("getBias", bias )
+    variables = np.array([t1,t2,t3,t4,t5,t6,t7,t8,t9,t10,t11,t12,t13,t14,t15,t16,t17,t18,t19,t20,t21,t22,t23,t24,t25,t26,t27,t28,t29,t30,t31,t32]).ravel()
+    zeros = variables - correct_torsions[step,1:]
+    for data in zeros :
+        if abs(data)>1E-4 : of.write("MISMATCH BETWEEN VALUE FROM PLUMED AND VALUE FROM PYTHON")
+
+of.close()
diff --git a/regtest/python/rt-protein/template.pdb b/regtest/python/rt-protein/template.pdb
new file mode 100644
index 000000000..d6c5b487d
--- /dev/null
+++ b/regtest/python/rt-protein/template.pdb
@@ -0,0 +1,258 @@
+CRYST1   54.082   55.003   54.078  90.00  90.00  90.00 P 1           1
+ATOM      1 HH31 ACE X   1      18.200  28.300  38.920  1.01  0.00            
+ATOM      2  CH3 ACE X   1      19.200  28.640  38.660 12.01  0.00            
+ATOM      3 HH32 ACE X   1      19.800  28.800  39.560  1.01  0.00            
+ATOM      4 HH33 ACE X   1      19.260  29.480  37.940  1.01  0.00            
+ATOM      5  C   ACE X   1      19.940  27.420  38.000 12.01  0.00            
+ATOM      6  O   ACE X   1      19.260  26.460  37.780 16.00  0.00            
+ATOM      7  N   GLY X   2      21.180  27.540  37.660 14.01  0.00            
+ATOM      8  H   GLY X   2      21.620  28.380  38.000  1.01  0.00            
+ATOM      9  CA  GLY X   2      21.860  26.700  36.720 12.01  0.00            
+ATOM     10  HA1 GLY X   2      22.220  25.740  37.100  1.01  0.00            
+ATOM     11  HA2 GLY X   2      21.140  26.460  35.940  1.01  0.00            
+ATOM     12  C   GLY X   2      23.020  27.380  36.020 12.01  0.00            
+ATOM     13  O   GLY X   2      23.580  28.360  36.460 16.00  0.00            
+ATOM     14  N   GLU X   3      23.260  26.960  34.800 14.01  0.00            
+ATOM     15  H   GLU X   3      22.780  26.180  34.400  1.01  0.00            
+ATOM     16  CA  GLU X   3      24.380  27.480  33.960 12.01  0.00            
+ATOM     17  HA  GLU X   3      24.560  28.520  34.200  1.01  0.00            
+ATOM     18  CB  GLU X   3      25.580  26.560  34.280 12.01  0.00            
+ATOM     19  HB1 GLU X   3      25.640  26.340  35.340  1.01  0.00            
+ATOM     20  HB2 GLU X   3      25.400  25.620  33.760  1.01  0.00            
+ATOM     21  CG  GLU X   3      26.860  27.220  33.760 12.01  0.00            
+ATOM     22  HG1 GLU X   3      26.740  27.400  32.700  1.01  0.00            
+ATOM     23  HG2 GLU X   3      27.040  28.160  34.260  1.01  0.00            
+ATOM     24  CD  GLU X   3      28.020  26.240  33.960 12.01  0.00            
+ATOM     25  OE1 GLU X   3      28.580  26.180  35.060 16.00  0.00            
+ATOM     26  OE2 GLU X   3      28.340  25.460  33.100 16.00  0.00            
+ATOM     27  C   GLU X   3      23.920  27.520  32.500 12.01  0.00            
+ATOM     28  O   GLU X   3      23.320  26.540  32.080 16.00  0.00            
+ATOM     29  N   TRP X   4      24.300  28.520  31.640 14.01  0.00            
+ATOM     30  H   TRP X   4      24.900  29.220  32.060  1.01  0.00            
+ATOM     31  CA  TRP X   4      24.140  28.600  30.160 12.01  0.00            
+ATOM     32  HA  TRP X   4      23.180  28.120  29.920  1.01  0.00            
+ATOM     33  CB  TRP X   4      24.060  30.080  29.800 12.01  0.00            
+ATOM     34  HB1 TRP X   4      25.040  30.580  29.760  1.01  0.00            
+ATOM     35  HB2 TRP X   4      23.600  30.140  28.820  1.01  0.00            
+ATOM     36  CG  TRP X   4      23.100  30.900  30.600 12.01  0.00            
+ATOM     37  CD1 TRP X   4      23.420  32.100  31.160 12.01  0.00            
+ATOM     38  HD1 TRP X   4      24.400  32.520  30.980  1.01  0.00            
+ATOM     39  NE1 TRP X   4      22.400  32.480  32.000 14.01  0.00            
+ATOM     40  HE1 TRP X   4      22.340  33.380  32.460  1.01  0.00            
+ATOM     41  CE2 TRP X   4      21.360  31.680  31.720 12.01  0.00            
+ATOM     42  CZ2 TRP X   4      20.060  31.700  32.240 12.01  0.00            
+ATOM     43  HZ2 TRP X   4      19.760  32.500  32.880  1.01  0.00            
+ATOM     44  CH2 TRP X   4      19.160  30.740  31.760 12.01  0.00            
+ATOM     45  HH2 TRP X   4      18.140  30.800  32.100  1.01  0.00            
+ATOM     46  CZ3 TRP X   4      19.500  29.740  30.800 12.01  0.00            
+ATOM     47  HZ3 TRP X   4      18.820  29.000  30.400  1.01  0.00            
+ATOM     48  CE3 TRP X   4      20.820  29.720  30.340 12.01  0.00            
+ATOM     49  HE3 TRP X   4      21.160  29.000  29.600  1.01  0.00            
+ATOM     50  CD2 TRP X   4      21.800  30.640  30.880 12.01  0.00            
+ATOM     51  C   TRP X   4      25.140  27.720  29.320 12.01  0.00            
+ATOM     52  O   TRP X   4      26.160  27.320  29.800 16.00  0.00            
+ATOM     53  N   THR X   5      24.940  27.700  28.000 14.01  0.00            
+ATOM     54  H   THR X   5      24.020  27.860  27.640  1.01  0.00            
+ATOM     55  CA  THR X   5      25.960  27.380  26.960 12.01  0.00            
+ATOM     56  HA  THR X   5      26.800  26.860  27.420  1.01  0.00            
+ATOM     57  CB  THR X   5      25.340  26.340  26.040 12.01  0.00            
+ATOM     58  HB  THR X   5      26.020  26.080  25.220  1.01  0.00            
+ATOM     59  CG2 THR X   5      25.080  25.000  26.720 12.01  0.00            
+ATOM     60 HG21 THR X   5      24.820  24.320  25.900  1.01  0.00            
+ATOM     61 HG22 THR X   5      26.040  24.740  27.160  1.01  0.00            
+ATOM     62 HG23 THR X   5      24.300  25.140  27.480  1.01  0.00            
+ATOM     63  OG1 THR X   5      24.100  26.780  25.600 16.00  0.00            
+ATOM     64  HG1 THR X   5      23.880  26.680  24.660  1.01  0.00            
+ATOM     65  C   THR X   5      26.540  28.580  26.180 12.01  0.00            
+ATOM     66  O   THR X   5      27.360  28.340  25.280 16.00  0.00            
+ATOM     67  N   TYR X   6      26.080  29.800  26.380 14.01  0.00            
+ATOM     68  H   TYR X   6      25.280  29.900  26.980  1.01  0.00            
+ATOM     69  CA  TYR X   6      26.500  30.960  25.620 12.01  0.00            
+ATOM     70  HA  TYR X   6      26.640  30.580  24.600  1.01  0.00            
+ATOM     71  CB  TYR X   6      25.460  32.060  25.820 12.01  0.00            
+ATOM     72  HB1 TYR X   6      24.540  31.620  25.440  1.01  0.00            
+ATOM     73  HB2 TYR X   6      25.300  32.200  26.880  1.01  0.00            
+ATOM     74  CG  TYR X   6      25.720  33.340  25.140 12.01  0.00            
+ATOM     75  CD1 TYR X   6      25.760  33.500  23.740 12.01  0.00            
+ATOM     76  HD1 TYR X   6      25.560  32.600  23.180  1.01  0.00            
+ATOM     77  CE1 TYR X   6      25.940  34.720  23.100 12.01  0.00            
+ATOM     78  HE1 TYR X   6      25.860  34.780  22.020  1.01  0.00            
+ATOM     79  CZ  TYR X   6      26.200  35.860  23.860 12.01  0.00            
+ATOM     80  OH  TYR X   6      26.400  37.080  23.280 16.00  0.00            
+ATOM     81  HH  TYR X   6      25.940  37.060  22.420  1.01  0.00            
+ATOM     82  CE2 TYR X   6      26.260  35.780  25.260 12.01  0.00            
+ATOM     83  HE2 TYR X   6      26.440  36.640  25.880  1.01  0.00            
+ATOM     84  CD2 TYR X   6      26.140  34.500  25.880 12.01  0.00            
+ATOM     85  HD2 TYR X   6      26.100  34.400  26.960  1.01  0.00            
+ATOM     86  C   TYR X   6      27.900  31.380  26.120 12.01  0.00            
+ATOM     87  O   TYR X   6      28.260  31.300  27.280 16.00  0.00            
+ATOM     88  N   ASP X   7      28.680  31.960  25.180 14.01  0.00            
+ATOM     89  H   ASP X   7      28.300  32.020  24.240  1.01  0.00            
+ATOM     90  CA  ASP X   7      30.080  32.480  25.360 12.01  0.00            
+ATOM     91  HA  ASP X   7      30.400  32.400  26.400  1.01  0.00            
+ATOM     92  CB  ASP X   7      31.160  31.680  24.580 12.01  0.00            
+ATOM     93  HB1 ASP X   7      31.220  30.620  24.880  1.01  0.00            
+ATOM     94  HB2 ASP X   7      30.980  31.820  23.500  1.01  0.00            
+ATOM     95  CG  ASP X   7      32.600  32.180  24.860 12.01  0.00            
+ATOM     96  OD1 ASP X   7      33.400  32.320  23.880 16.00  0.00            
+ATOM     97  OD2 ASP X   7      32.920  32.600  26.040 16.00  0.00            
+ATOM     98  C   ASP X   7      30.140  33.980  25.140 12.01  0.00            
+ATOM     99  O   ASP X   7      30.320  34.360  24.000 16.00  0.00            
+ATOM    100  N   ASP X   8      30.240  34.740  26.200 14.01  0.00            
+ATOM    101  H   ASP X   8      30.200  34.460  27.180  1.01  0.00            
+ATOM    102  CA  ASP X   8      30.080  36.200  25.920 12.01  0.00            
+ATOM    103  HA  ASP X   8      29.280  36.320  25.200  1.01  0.00            
+ATOM    104  CB  ASP X   8      29.580  36.880  27.180 12.01  0.00            
+ATOM    105  HB1 ASP X   8      28.700  36.380  27.580  1.01  0.00            
+ATOM    106  HB2 ASP X   8      30.360  36.840  27.940  1.01  0.00            
+ATOM    107  CG  ASP X   8      29.180  38.320  26.840 12.01  0.00            
+ATOM    108  OD1 ASP X   8      28.240  38.600  26.060 16.00  0.00            
+ATOM    109  OD2 ASP X   8      29.720  39.240  27.440 16.00  0.00            
+ATOM    110  C   ASP X   8      31.360  36.920  25.320 12.01  0.00            
+ATOM    111  O   ASP X   8      31.160  37.960  24.680 16.00  0.00            
+ATOM    112  N   ALA X   9      32.520  36.240  25.360 14.01  0.00            
+ATOM    113  H   ALA X   9      32.560  35.340  25.800  1.01  0.00            
+ATOM    114  CA  ALA X   9      33.780  36.720  24.660 12.01  0.00            
+ATOM    115  HA  ALA X   9      34.020  37.740  24.940  1.01  0.00            
+ATOM    116  CB  ALA X   9      34.980  35.960  25.160 12.01  0.00            
+ATOM    117  HB1 ALA X   9      35.940  36.240  24.720  1.01  0.00            
+ATOM    118  HB2 ALA X   9      35.140  36.240  26.200  1.01  0.00            
+ATOM    119  HB3 ALA X   9      34.740  34.900  25.060  1.01  0.00            
+ATOM    120  C   ALA X   9      33.680  36.580  23.200 12.01  0.00            
+ATOM    121  O   ALA X   9      34.000  37.540  22.500 16.00  0.00            
+ATOM    122  N   THR X  10      33.160  35.420  22.640 14.01  0.00            
+ATOM    123  H   THR X  10      33.000  34.680  23.320  1.01  0.00            
+ATOM    124  CA  THR X  10      33.080  35.080  21.220 12.01  0.00            
+ATOM    125  HA  THR X  10      33.800  35.620  20.600  1.01  0.00            
+ATOM    126  CB  THR X  10      33.400  33.580  21.020 12.01  0.00            
+ATOM    127  HB  THR X  10      32.520  33.080  21.400  1.01  0.00            
+ATOM    128  CG2 THR X  10      33.520  33.060  19.640 12.01  0.00            
+ATOM    129 HG21 THR X  10      32.720  33.300  18.960  1.01  0.00            
+ATOM    130 HG22 THR X  10      34.360  33.540  19.160  1.01  0.00            
+ATOM    131 HG23 THR X  10      33.640  31.980  19.820  1.01  0.00            
+ATOM    132  OG1 THR X  10      34.600  33.280  21.740 16.00  0.00            
+ATOM    133  HG1 THR X  10      34.240  32.800  22.480  1.01  0.00            
+ATOM    134  C   THR X  10      31.700  35.320  20.620 12.01  0.00            
+ATOM    135  O   THR X  10      31.680  35.500  19.420 16.00  0.00            
+ATOM    136  N   LYS X  11      30.620  35.380  21.380 14.01  0.00            
+ATOM    137  H   LYS X  11      30.780  35.260  22.380  1.01  0.00            
+ATOM    138  CA  LYS X  11      29.160  35.520  20.960 12.01  0.00            
+ATOM    139  HA  LYS X  11      28.620  35.520  21.900  1.01  0.00            
+ATOM    140  CB  LYS X  11      28.920  36.860  20.140 12.01  0.00            
+ATOM    141  HB1 LYS X  11      29.340  36.700  19.140  1.01  0.00            
+ATOM    142  HB2 LYS X  11      27.820  36.940  20.180  1.01  0.00            
+ATOM    143  CG  LYS X  11      29.500  38.100  20.680 12.01  0.00            
+ATOM    144  HG1 LYS X  11      30.580  37.960  20.720  1.01  0.00            
+ATOM    145  HG2 LYS X  11      29.240  38.960  20.060  1.01  0.00            
+ATOM    146  CD  LYS X  11      28.880  38.480  22.000 12.01  0.00            
+ATOM    147  HD1 LYS X  11      27.840  38.740  21.820  1.01  0.00            
+ATOM    148  HD2 LYS X  11      29.000  37.620  22.660  1.01  0.00            
+ATOM    149  CE  LYS X  11      29.660  39.640  22.660 12.01  0.00            
+ATOM    150  HE1 LYS X  11      30.600  39.140  22.840  1.01  0.00            
+ATOM    151  HE2 LYS X  11      29.800  40.460  21.980  1.01  0.00            
+ATOM    152  NZ  LYS X  11      29.140  40.020  23.960 14.01  0.00            
+ATOM    153  HZ1 LYS X  11      28.200  40.380  23.980  1.01  0.00            
+ATOM    154  HZ2 LYS X  11      29.180  39.300  24.680  1.01  0.00            
+ATOM    155  HZ3 LYS X  11      29.740  40.720  24.400  1.01  0.00            
+ATOM    156  C   LYS X  11      28.560  34.300  20.280 12.01  0.00            
+ATOM    157  O   LYS X  11      27.860  34.400  19.260 16.00  0.00            
+ATOM    158  N   THR X  12      28.780  33.160  20.940 14.01  0.00            
+ATOM    159  H   THR X  12      29.380  33.160  21.760  1.01  0.00            
+ATOM    160  CA  THR X  12      28.480  31.820  20.360 12.01  0.00            
+ATOM    161  HA  THR X  12      27.660  32.000  19.660  1.01  0.00            
+ATOM    162  CB  THR X  12      29.660  31.240  19.640 12.01  0.00            
+ATOM    163  HB  THR X  12      29.480  30.240  19.240  1.01  0.00            
+ATOM    164  CG2 THR X  12      29.980  32.180  18.440 12.01  0.00            
+ATOM    165 HG21 THR X  12      30.820  31.800  17.860  1.01  0.00            
+ATOM    166 HG22 THR X  12      29.200  32.340  17.720  1.01  0.00            
+ATOM    167 HG23 THR X  12      30.340  33.100  18.900  1.01  0.00            
+ATOM    168  OG1 THR X  12      30.820  31.160  20.440 16.00  0.00            
+ATOM    169  HG1 THR X  12      31.440  30.500  20.060  1.01  0.00            
+ATOM    170  C   THR X  12      27.900  30.780  21.320 12.01  0.00            
+ATOM    171  O   THR X  12      28.200  30.740  22.460 16.00  0.00            
+ATOM    172  N   PHE X  13      27.120  29.920  20.760 14.01  0.00            
+ATOM    173  H   PHE X  13      26.940  29.940  19.760  1.01  0.00            
+ATOM    174  CA  PHE X  13      26.460  28.820  21.400 12.01  0.00            
+ATOM    175  HA  PHE X  13      26.440  28.900  22.480  1.01  0.00            
+ATOM    176  CB  PHE X  13      24.980  28.900  21.000 12.01  0.00            
+ATOM    177  HB1 PHE X  13      24.900  28.780  19.920  1.01  0.00            
+ATOM    178  HB2 PHE X  13      24.380  28.100  21.420  1.01  0.00            
+ATOM    179  CG  PHE X  13      24.260  30.140  21.420 12.01  0.00            
+ATOM    180  CD1 PHE X  13      24.100  31.300  20.580 12.01  0.00            
+ATOM    181  HD1 PHE X  13      24.740  31.300  19.720  1.01  0.00            
+ATOM    182  CE1 PHE X  13      23.400  32.420  21.020 12.01  0.00            
+ATOM    183  HE1 PHE X  13      23.580  33.380  20.560  1.01  0.00            
+ATOM    184  CZ  PHE X  13      22.780  32.320  22.220 12.01  0.00            
+ATOM    185  HZ  PHE X  13      22.280  33.200  22.600  1.01  0.00            
+ATOM    186  CE2 PHE X  13      22.700  31.140  23.000 12.01  0.00            
+ATOM    187  HE2 PHE X  13      22.300  31.140  24.000  1.01  0.00            
+ATOM    188  CD2 PHE X  13      23.520  30.060  22.600 12.01  0.00            
+ATOM    189  HD2 PHE X  13      23.520  29.100  23.080  1.01  0.00            
+ATOM    190  C   PHE X  13      27.040  27.400  21.180 12.01  0.00            
+ATOM    191  O   PHE X  13      27.840  27.200  20.280 16.00  0.00            
+ATOM    192  N   THR X  14      26.600  26.340  21.980 14.01  0.00            
+ATOM    193  H   THR X  14      25.780  26.360  22.560  1.01  0.00            
+ATOM    194  CA  THR X  14      27.100  24.900  21.680 12.01  0.00            
+ATOM    195  HA  THR X  14      28.140  24.900  21.340  1.01  0.00            
+ATOM    196  CB  THR X  14      27.120  23.960  22.920 12.01  0.00            
+ATOM    197  HB  THR X  14      27.240  22.900  22.680  1.01  0.00            
+ATOM    198  CG2 THR X  14      28.240  24.340  23.960 12.01  0.00            
+ATOM    199 HG21 THR X  14      28.300  23.660  24.820  1.01  0.00            
+ATOM    200 HG22 THR X  14      29.200  24.180  23.480  1.01  0.00            
+ATOM    201 HG23 THR X  14      28.220  25.360  24.340  1.01  0.00            
+ATOM    202  OG1 THR X  14      25.880  24.100  23.580 16.00  0.00            
+ATOM    203  HG1 THR X  14      26.080  23.480  24.300  1.01  0.00            
+ATOM    204  C   THR X  14      26.180  24.180  20.680 12.01  0.00            
+ATOM    205  O   THR X  14      25.140  24.720  20.380 16.00  0.00            
+ATOM    206  N   VAL X  15      26.560  23.080  20.040 14.01  0.00            
+ATOM    207  H   VAL X  15      27.480  22.740  20.280  1.01  0.00            
+ATOM    208  CA  VAL X  15      25.600  22.200  19.300 12.01  0.00            
+ATOM    209  HA  VAL X  15      25.120  22.800  18.520  1.01  0.00            
+ATOM    210  CB  VAL X  15      26.480  21.120  18.640 12.01  0.00            
+ATOM    211  HB  VAL X  15      27.060  20.520  19.340  1.01  0.00            
+ATOM    212  CG1 VAL X  15      25.680  20.160  17.800 12.01  0.00            
+ATOM    213 HG11 VAL X  15      25.300  19.340  18.400  1.01  0.00            
+ATOM    214 HG12 VAL X  15      24.800  20.620  17.320  1.01  0.00            
+ATOM    215 HG13 VAL X  15      26.320  19.700  17.060  1.01  0.00            
+ATOM    216  CG2 VAL X  15      27.500  21.840  17.720 12.01  0.00            
+ATOM    217 HG21 VAL X  15      28.260  22.400  18.260  1.01  0.00            
+ATOM    218 HG22 VAL X  15      27.940  21.120  17.040  1.01  0.00            
+ATOM    219 HG23 VAL X  15      27.020  22.580  17.060  1.01  0.00            
+ATOM    220  C   VAL X  15      24.540  21.560  20.240 12.01  0.00            
+ATOM    221  O   VAL X  15      24.900  20.840  21.120 16.00  0.00            
+ATOM    222  N   THR X  16      23.280  21.840  19.960 14.01  0.00            
+ATOM    223  H   THR X  16      23.140  22.480  19.200  1.01  0.00            
+ATOM    224  CA  THR X  16      22.120  21.280  20.660 12.01  0.00            
+ATOM    225  HA  THR X  16      22.520  20.560  21.380  1.01  0.00            
+ATOM    226  CB  THR X  16      21.380  22.280  21.540 12.01  0.00            
+ATOM    227  HB  THR X  16      20.500  21.800  21.980  1.01  0.00            
+ATOM    228  CG2 THR X  16      22.060  22.840  22.780 12.01  0.00            
+ATOM    229 HG21 THR X  16      22.980  23.400  22.580  1.01  0.00            
+ATOM    230 HG22 THR X  16      21.440  23.640  23.180  1.01  0.00            
+ATOM    231 HG23 THR X  16      22.200  22.080  23.560  1.01  0.00            
+ATOM    232  OG1 THR X  16      20.960  23.380  20.840 16.00  0.00            
+ATOM    233  HG1 THR X  16      20.040  23.520  21.100  1.01  0.00            
+ATOM    234  C   THR X  16      21.160  20.460  19.740 12.01  0.00            
+ATOM    235  O   THR X  16      19.920  20.460  19.880 16.00  0.00            
+ATOM    236  N   GLU X  17      21.740  19.760  18.780 14.01  0.00            
+ATOM    237  H   GLU X  17      22.740  19.620  18.820  1.01  0.00            
+ATOM    238  CA  GLU X  17      21.080  18.840  17.820 12.01  0.00            
+ATOM    239  HA  GLU X  17      20.040  18.660  18.080  1.01  0.00            
+ATOM    240  CB  GLU X  17      21.060  19.600  16.460 12.01  0.00            
+ATOM    241  HB1 GLU X  17      22.120  19.740  16.240  1.01  0.00            
+ATOM    242  HB2 GLU X  17      20.720  19.140  15.540  1.01  0.00            
+ATOM    243  CG  GLU X  17      20.260  20.940  16.520 12.01  0.00            
+ATOM    244  HG1 GLU X  17      19.320  20.760  17.060  1.01  0.00            
+ATOM    245  HG2 GLU X  17      20.900  21.620  17.080  1.01  0.00            
+ATOM    246  CD  GLU X  17      20.000  21.520  15.140 12.01  0.00            
+ATOM    247  OE1 GLU X  17      20.780  22.260  14.580 16.00  0.00            
+ATOM    248  OE2 GLU X  17      19.020  21.140  14.500 16.00  0.00            
+ATOM    249  C   GLU X  17      21.740  17.440  17.920 12.01  0.00            
+ATOM    250  O   GLU X  17      22.860  17.280  18.420 16.00  0.00            
+ATOM    251  N   NME X  18      21.020  16.380  17.480 14.01  0.00            
+ATOM    252  H   NME X  18      20.140  16.580  17.040  1.01  0.00            
+ATOM    253  CH3 NME X  18      21.320  14.940  17.660 12.01  0.00            
+ATOM    254 HH31 NME X  18      22.360  14.740  17.380  1.01  0.00            
+ATOM    255 HH32 NME X  18      20.620  14.280  17.160  1.01  0.00            
+ATOM    256 HH33 NME X  18      21.340  14.700  18.720  1.01  0.00            
+END
diff --git a/regtest/python/rt-protein/traj.xyz b/regtest/python/rt-protein/traj.xyz
new file mode 100644
index 000000000..0ee888100
--- /dev/null
+++ b/regtest/python/rt-protein/traj.xyz
@@ -0,0 +1,2580 @@
+256
+ 100.0 100.0 100.0
+ HH31       18.200001       28.299999       38.919998
+  CH3       19.200001       28.639999       38.660000
+ HH32       19.799999       28.799999       39.560001
+ HH33       19.260000       29.480000       37.939999
+  C         19.940001       27.420000       38.000000
+  O         19.260000       26.459999       37.779999
+  N         21.180000       27.540001       37.660000
+  H         21.620001       28.379999       38.000000
+  CA        21.860001       26.700001       36.720001
+  HA1       22.219999       25.740000       37.099998
+  HA2       21.139999       26.459999       35.939999
+  C         23.020000       27.379999       36.020000
+  O         23.580000       28.360001       36.459999
+  N         23.260000       26.959999       34.799999
+  H         22.780001       26.180000       34.400002
+  CA        24.379999       27.480000       33.959999
+  HA        24.559999       28.520000       34.200001
+  CB        25.580000       26.559999       34.279999
+  HB1       25.639999       26.340000       35.340000
+  HB2       25.400000       25.620001       33.759998
+  CG        26.860001       27.219999       33.759998
+  HG1       26.740000       27.400000       32.700001
+  HG2       27.040001       28.160000       34.259998
+  CD        28.020000       26.240000       33.959999
+  OE1       28.580000       26.180000       35.060001
+  OE2       28.340000       25.459999       33.099998
+  C         23.920000       27.520000       32.500000
+  O         23.320000       26.540001       32.080002
+  N         24.299999       28.520000       31.639999
+  H         24.900000       29.219999       32.060001
+  CA        24.139999       28.600000       30.160000
+  HA        23.180000       28.120001       29.920000
+  CB        24.059999       30.080000       29.799999
+  HB1       25.040001       30.580000       29.760000
+  HB2       23.600000       30.139999       28.820000
+  CG        23.100000       30.900000       30.600000
+  CD1       23.420000       32.099998       31.160000
+  HD1       24.400000       32.520000       30.980000
+  NE1       22.400000       32.480000       32.000000
+  HE1       22.340000       33.380001       32.459999
+  CE2       21.360001       31.680000       31.719999
+  CZ2       20.059999       31.700001       32.240002
+  HZ2       19.760000       32.500000       32.880001
+  CH2       19.160000       30.740000       31.760000
+  HH2       18.139999       30.799999       32.099998
+  CZ3       19.500000       29.740000       30.799999
+  HZ3       18.820000       29.000000       30.400000
+  CE3       20.820000       29.719999       30.340000
+  HE3       21.160000       29.000000       29.600000
+  CD2       21.799999       30.639999       30.879999
+  C         25.139999       27.719999       29.320000
+  O         26.160000       27.320000       29.799999
+  N         24.940001       27.700001       28.000000
+  H         24.020000       27.860001       27.639999
+  CA        25.959999       27.379999       26.959999
+  HA        26.799999       26.860001       27.420000
+  CB        25.340000       26.340000       26.040001
+  HB        26.020000       26.080000       25.219999
+  CG2       25.080000       25.000000       26.719999
+ HG21       24.820000       24.320000       25.900000
+ HG22       26.040001       24.740000       27.160000
+ HG23       24.299999       25.139999       27.480000
+  OG1       24.100000       26.780001       25.600000
+  HG1       23.879999       26.680000       24.660000
+  C         26.540001       28.580000       26.180000
+  O         27.360001       28.340000       25.280001
+  N         26.080000       29.799999       26.379999
+  H         25.280001       29.900000       26.980000
+  CA        26.500000       30.959999       25.620001
+  HA        26.639999       30.580000       24.600000
+  CB        25.459999       32.060001       25.820000
+  HB1       24.540001       31.620001       25.440001
+  HB2       25.299999       32.200001       26.879999
+  CG        25.719999       33.340000       25.139999
+  CD1       25.760000       33.500000       23.740000
+  HD1       25.559999       32.599998       23.180000
+  CE1       25.940001       34.720001       23.100000
+  HE1       25.860001       34.779999       22.020000
+  CZ        26.200001       35.860001       23.860001
+  OH        26.400000       37.080002       23.280001
+  HH        25.940001       37.060001       22.420000
+  CE2       26.260000       35.779999       25.260000
+  HE2       26.440001       36.639999       25.879999
+  CD2       26.139999       34.500000       25.879999
+  HD2       26.100000       34.400002       26.959999
+  C         27.900000       31.379999       26.120001
+  O         28.260000       31.299999       27.280001
+  N         28.680000       31.959999       25.180000
+  H         28.299999       32.020000       24.240000
+  CA        30.080000       32.480000       25.360001
+  HA        30.400000       32.400002       26.400000
+  CB        31.160000       31.680000       24.580000
+  HB1       31.219999       30.620001       24.879999
+  HB2       30.980000       31.820000       23.500000
+  CG        32.599998       32.180000       24.860001
+  OD1       33.400002       32.320000       23.879999
+  OD2       32.919998       32.599998       26.040001
+  C         30.139999       33.980000       25.139999
+  O         30.320000       34.360001       24.000000
+  N         30.240000       34.740002       26.200001
+  H         30.200001       34.459999       27.180000
+  CA        30.080000       36.200001       25.920000
+  HA        29.280001       36.320000       25.200001
+  CB        29.580000       36.880001       27.180000
+  HB1       28.700001       36.380001       27.580000
+  HB2       30.360001       36.840000       27.940001
+  CG        29.180000       38.320000       26.840000
+  OD1       28.240000       38.599998       26.059999
+  OD2       29.719999       39.240002       27.440001
+  C         31.360001       36.919998       25.320000
+  O         31.160000       37.959999       24.680000
+  N         32.520000       36.240002       25.360001
+  H         32.560001       35.340000       25.799999
+  CA        33.779999       36.720001       24.660000
+  HA        34.020000       37.740002       24.940001
+  CB        34.980000       35.959999       25.160000
+  HB1       35.939999       36.240002       24.719999
+  HB2       35.139999       36.240002       26.200001
+  HB3       34.740002       34.900002       25.059999
+  C         33.680000       36.580002       23.200001
+  O         34.000000       37.540001       22.500000
+  N         33.160000       35.419998       22.639999
+  H         33.000000       34.680000       23.320000
+  CA        33.080002       35.080002       21.219999
+  HA        33.799999       35.619999       20.600000
+  CB        33.400002       33.580002       21.020000
+  HB        32.520000       33.080002       21.400000
+  CG2       33.520000       33.060001       19.639999
+ HG21       32.720001       33.299999       18.959999
+ HG22       34.360001       33.540001       19.160000
+ HG23       33.639999       31.980000       19.820000
+  OG1       34.599998       33.279999       21.740000
+  HG1       34.240002       32.799999       22.480000
+  C         31.700001       35.320000       20.620001
+  O         31.680000       35.500000       19.420000
+  N         30.620001       35.380001       21.379999
+  H         30.780001       35.259998       22.379999
+  CA        29.160000       35.520000       20.959999
+  HA        28.620001       35.520000       21.900000
+  CB        28.920000       36.860001       20.139999
+  HB1       29.340000       36.700001       19.139999
+  HB2       27.820000       36.939999       20.180000
+  CG        29.500000       38.099998       20.680000
+  HG1       30.580000       37.959999       20.719999
+  HG2       29.240000       38.959999       20.059999
+  CD        28.879999       38.480000       22.000000
+  HD1       27.840000       38.740002       21.820000
+  HD2       29.000000       37.619999       22.660000
+  CE        29.660000       39.639999       22.660000
+  HE1       30.600000       39.139999       22.840000
+  HE2       29.799999       40.459999       21.980000
+  NZ        29.139999       40.020000       23.959999
+  HZ1       28.200001       40.380001       23.980000
+  HZ2       29.180000       39.299999       24.680000
+  HZ3       29.740000       40.720001       24.400000
+  C         28.559999       34.299999       20.280001
+  O         27.860001       34.400002       19.260000
+  N         28.780001       33.160000       20.940001
+  H         29.379999       33.160000       21.760000
+  CA        28.480000       31.820000       20.360001
+  HA        27.660000       32.000000       19.660000
+  CB        29.660000       31.240000       19.639999
+  HB        29.480000       30.240000       19.240000
+  CG2       29.980000       32.180000       18.440001
+ HG21       30.820000       31.799999       17.860001
+ HG22       29.200001       32.340000       17.719999
+ HG23       30.340000       33.099998       18.900000
+  OG1       30.820000       31.160000       20.440001
+  HG1       31.440001       30.500000       20.059999
+  C         27.900000       30.780001       21.320000
+  O         28.200001       30.740000       22.459999
+  N         27.120001       29.920000       20.760000
+  H         26.940001       29.940001       19.760000
+  CA        26.459999       28.820000       21.400000
+  HA        26.440001       28.900000       22.480000
+  CB        24.980000       28.900000       21.000000
+  HB1       24.900000       28.780001       19.920000
+  HB2       24.379999       28.100000       21.420000
+  CG        24.260000       30.139999       21.420000
+  CD1       24.100000       31.299999       20.580000
+  HD1       24.740000       31.299999       19.719999
+  CE1       23.400000       32.419998       21.020000
+  HE1       23.580000       33.380001       20.559999
+  CZ        22.780001       32.320000       22.219999
+  HZ        22.280001       33.200001       22.600000
+  CE2       22.700001       31.139999       23.000000
+  HE2       22.299999       31.139999       24.000000
+  CD2       23.520000       30.059999       22.600000
+  HD2       23.520000       29.100000       23.080000
+  C         27.040001       27.400000       21.180000
+  O         27.840000       27.200001       20.280001
+  N         26.600000       26.340000       21.980000
+  H         25.780001       26.360001       22.559999
+  CA        27.100000       24.900000       21.680000
+  HA        28.139999       24.900000       21.340000
+  CB        27.120001       23.959999       22.920000
+  HB        27.240000       22.900000       22.680000
+  CG2       28.240000       24.340000       23.959999
+ HG21       28.299999       23.660000       24.820000
+ HG22       29.200001       24.180000       23.480000
+ HG23       28.219999       25.360001       24.340000
+  OG1       25.879999       24.100000       23.580000
+  HG1       26.080000       23.480000       24.299999
+  C         26.180000       24.180000       20.680000
+  O         25.139999       24.719999       20.379999
+  N         26.559999       23.080000       20.040001
+  H         27.480000       22.740000       20.280001
+  CA        25.600000       22.200001       19.299999
+  HA        25.120001       22.799999       18.520000
+  CB        26.480000       21.120001       18.639999
+  HB        27.059999       20.520000       19.340000
+  CG1       25.680000       20.160000       17.799999
+ HG11       25.299999       19.340000       18.400000
+ HG12       24.799999       20.620001       17.320000
+ HG13       26.320000       19.700001       17.059999
+  CG2       27.500000       21.840000       17.719999
+ HG21       28.260000       22.400000       18.260000
+ HG22       27.940001       21.120001       17.040001
+ HG23       27.020000       22.580000       17.059999
+  C         24.540001       21.559999       20.240000
+  O         24.900000       20.840000       21.120001
+  N         23.280001       21.840000       19.959999
+  H         23.139999       22.480000       19.200001
+  CA        22.120001       21.280001       20.660000
+  HA        22.520000       20.559999       21.379999
+  CB        21.379999       22.280001       21.540001
+  HB        20.500000       21.799999       21.980000
+  CG2       22.059999       22.840000       22.780001
+ HG21       22.980000       23.400000       22.580000
+ HG22       21.440001       23.639999       23.180000
+ HG23       22.200001       22.080000       23.559999
+  OG1       20.959999       23.379999       20.840000
+  HG1       20.040001       23.520000       21.100000
+  C         21.160000       20.459999       19.740000
+  O         19.920000       20.459999       19.879999
+  N         21.740000       19.760000       18.780001
+  H         22.740000       19.620001       18.820000
+  CA        21.080000       18.840000       17.820000
+  HA        20.040001       18.660000       18.080000
+  CB        21.059999       19.600000       16.459999
+  HB1       22.120001       19.740000       16.240000
+  HB2       20.719999       19.139999       15.540000
+  CG        20.260000       20.940001       16.520000
+  HG1       19.320000       20.760000       17.059999
+  HG2       20.900000       21.620001       17.080000
+  CD        20.000000       21.520000       15.140000
+  OE1       20.780001       22.260000       14.580000
+  OE2       19.020000       21.139999       14.500000
+  C         21.740000       17.440001       17.920000
+  O         22.860001       17.280001       18.420000
+  N         21.020000       16.379999       17.480000
+  H         20.139999       16.580000       17.040001
+  CH3       21.320000       14.940000       17.660000
+ HH31       22.360001       14.740000       17.379999
+ HH32       20.620001       14.280000       17.160000
+ HH33       21.340000       14.700000       18.719999
+256
+ 100.0 100.0 100.0
+ HH31       18.200001       28.299999       38.919998
+  CH3       19.200001       28.639999       38.660000
+ HH32       19.799999       28.799999       39.560001
+ HH33       19.260000       29.480000       37.939999
+  C         19.940001       27.420000       38.000000
+  O         19.260000       26.459999       37.779999
+  N         21.180000       27.540001       37.660000
+  H         21.620001       28.379999       38.000000
+  CA        21.860001       26.700001       36.720001
+  HA1       22.219999       25.740000       37.099998
+  HA2       21.139999       26.459999       35.939999
+  C         23.020000       27.379999       36.020000
+  O         23.580000       28.360001       36.459999
+  N         23.260000       26.959999       34.799999
+  H         22.780001       26.180000       34.400002
+  CA        24.379999       27.480000       33.959999
+  HA        24.559999       28.520000       34.200001
+  CB        25.580000       26.559999       34.279999
+  HB1       25.639999       26.340000       35.340000
+  HB2       25.400000       25.620001       33.759998
+  CG        26.860001       27.219999       33.759998
+  HG1       26.740000       27.400000       32.700001
+  HG2       27.040001       28.160000       34.259998
+  CD        28.020000       26.240000       33.959999
+  OE1       28.580000       26.180000       35.060001
+  OE2       28.340000       25.459999       33.099998
+  C         23.920000       27.520000       32.500000
+  O         23.320000       26.540001       32.080002
+  N         24.299999       28.520000       31.639999
+  H         24.900000       29.219999       32.060001
+  CA        24.139999       28.600000       30.160000
+  HA        23.180000       28.120001       29.920000
+  CB        24.059999       30.080000       29.799999
+  HB1       25.040001       30.580000       29.760000
+  HB2       23.600000       30.139999       28.820000
+  CG        23.100000       30.900000       30.600000
+  CD1       23.420000       32.099998       31.160000
+  HD1       24.400000       32.520000       30.980000
+  NE1       22.400000       32.480000       32.000000
+  HE1       22.340000       33.380001       32.459999
+  CE2       21.360001       31.680000       31.719999
+  CZ2       20.059999       31.700001       32.240002
+  HZ2       19.760000       32.500000       32.880001
+  CH2       19.160000       30.740000       31.760000
+  HH2       18.139999       30.799999       32.099998
+  CZ3       19.500000       29.740000       30.799999
+  HZ3       18.820000       29.000000       30.400000
+  CE3       20.820000       29.719999       30.340000
+  HE3       21.160000       29.000000       29.600000
+  CD2       21.799999       30.639999       30.879999
+  C         25.139999       27.719999       29.320000
+  O         26.160000       27.320000       29.799999
+  N         24.940001       27.700001       28.000000
+  H         24.020000       27.860001       27.639999
+  CA        25.959999       27.379999       26.959999
+  HA        26.799999       26.860001       27.420000
+  CB        25.340000       26.340000       26.040001
+  HB        26.020000       26.080000       25.219999
+  CG2       25.080000       25.000000       26.719999
+ HG21       24.820000       24.320000       25.900000
+ HG22       26.040001       24.740000       27.160000
+ HG23       24.299999       25.139999       27.480000
+  OG1       24.100000       26.780001       25.600000
+  HG1       23.879999       26.680000       24.660000
+  C         26.540001       28.580000       26.180000
+  O         27.360001       28.340000       25.280001
+  N         26.080000       29.799999       26.379999
+  H         25.280001       29.900000       26.980000
+  CA        26.500000       30.959999       25.620001
+  HA        26.639999       30.580000       24.600000
+  CB        25.459999       32.060001       25.820000
+  HB1       24.540001       31.620001       25.440001
+  HB2       25.299999       32.200001       26.879999
+  CG        25.719999       33.340000       25.139999
+  CD1       25.760000       33.500000       23.740000
+  HD1       25.559999       32.599998       23.180000
+  CE1       25.940001       34.720001       23.100000
+  HE1       25.860001       34.779999       22.020000
+  CZ        26.200001       35.860001       23.860001
+  OH        26.400000       37.080002       23.280001
+  HH        25.940001       37.060001       22.420000
+  CE2       26.260000       35.779999       25.260000
+  HE2       26.440001       36.639999       25.879999
+  CD2       26.139999       34.500000       25.879999
+  HD2       26.100000       34.400002       26.959999
+  C         27.900000       31.379999       26.120001
+  O         28.260000       31.299999       27.280001
+  N         28.680000       31.959999       25.180000
+  H         28.299999       32.020000       24.240000
+  CA        30.080000       32.480000       25.360001
+  HA        30.400000       32.400002       26.400000
+  CB        31.160000       31.680000       24.580000
+  HB1       31.219999       30.620001       24.879999
+  HB2       30.980000       31.820000       23.500000
+  CG        32.599998       32.180000       24.860001
+  OD1       33.400002       32.320000       23.879999
+  OD2       32.919998       32.599998       26.040001
+  C         30.139999       33.980000       25.139999
+  O         30.320000       34.360001       24.000000
+  N         30.240000       34.740002       26.200001
+  H         30.200001       34.459999       27.180000
+  CA        30.080000       36.200001       25.920000
+  HA        29.280001       36.320000       25.200001
+  CB        29.580000       36.880001       27.180000
+  HB1       28.700001       36.380001       27.580000
+  HB2       30.360001       36.840000       27.940001
+  CG        29.180000       38.320000       26.840000
+  OD1       28.240000       38.599998       26.059999
+  OD2       29.719999       39.240002       27.440001
+  C         31.360001       36.919998       25.320000
+  O         31.160000       37.959999       24.680000
+  N         32.520000       36.240002       25.360001
+  H         32.560001       35.340000       25.799999
+  CA        33.779999       36.720001       24.660000
+  HA        34.020000       37.740002       24.940001
+  CB        34.980000       35.959999       25.160000
+  HB1       35.939999       36.240002       24.719999
+  HB2       35.139999       36.240002       26.200001
+  HB3       34.740002       34.900002       25.059999
+  C         33.680000       36.580002       23.200001
+  O         34.000000       37.540001       22.500000
+  N         33.160000       35.419998       22.639999
+  H         33.000000       34.680000       23.320000
+  CA        33.080002       35.080002       21.219999
+  HA        33.799999       35.619999       20.600000
+  CB        33.400002       33.580002       21.020000
+  HB        32.520000       33.080002       21.400000
+  CG2       33.520000       33.060001       19.639999
+ HG21       32.720001       33.299999       18.959999
+ HG22       34.360001       33.540001       19.160000
+ HG23       33.639999       31.980000       19.820000
+  OG1       34.599998       33.279999       21.740000
+  HG1       34.240002       32.799999       22.480000
+  C         31.700001       35.320000       20.620001
+  O         31.680000       35.500000       19.420000
+  N         30.620001       35.380001       21.379999
+  H         30.780001       35.259998       22.379999
+  CA        29.160000       35.520000       20.959999
+  HA        28.620001       35.520000       21.900000
+  CB        28.920000       36.860001       20.139999
+  HB1       29.340000       36.700001       19.139999
+  HB2       27.820000       36.939999       20.180000
+  CG        29.500000       38.099998       20.680000
+  HG1       30.580000       37.959999       20.719999
+  HG2       29.240000       38.959999       20.059999
+  CD        28.879999       38.480000       22.000000
+  HD1       27.840000       38.740002       21.820000
+  HD2       29.000000       37.619999       22.660000
+  CE        29.660000       39.639999       22.660000
+  HE1       30.600000       39.139999       22.840000
+  HE2       29.799999       40.459999       21.980000
+  NZ        29.139999       40.020000       23.959999
+  HZ1       28.200001       40.380001       23.980000
+  HZ2       29.180000       39.299999       24.680000
+  HZ3       29.740000       40.720001       24.400000
+  C         28.559999       34.299999       20.280001
+  O         27.860001       34.400002       19.260000
+  N         28.780001       33.160000       20.940001
+  H         29.379999       33.160000       21.760000
+  CA        28.480000       31.820000       20.360001
+  HA        27.660000       32.000000       19.660000
+  CB        29.660000       31.240000       19.639999
+  HB        29.480000       30.240000       19.240000
+  CG2       29.980000       32.180000       18.440001
+ HG21       30.820000       31.799999       17.860001
+ HG22       29.200001       32.340000       17.719999
+ HG23       30.340000       33.099998       18.900000
+  OG1       30.820000       31.160000       20.440001
+  HG1       31.440001       30.500000       20.059999
+  C         27.900000       30.780001       21.320000
+  O         28.200001       30.740000       22.459999
+  N         27.120001       29.920000       20.760000
+  H         26.940001       29.940001       19.760000
+  CA        26.459999       28.820000       21.400000
+  HA        26.440001       28.900000       22.480000
+  CB        24.980000       28.900000       21.000000
+  HB1       24.900000       28.780001       19.920000
+  HB2       24.379999       28.100000       21.420000
+  CG        24.260000       30.139999       21.420000
+  CD1       24.100000       31.299999       20.580000
+  HD1       24.740000       31.299999       19.719999
+  CE1       23.400000       32.419998       21.020000
+  HE1       23.580000       33.380001       20.559999
+  CZ        22.780001       32.320000       22.219999
+  HZ        22.280001       33.200001       22.600000
+  CE2       22.700001       31.139999       23.000000
+  HE2       22.299999       31.139999       24.000000
+  CD2       23.520000       30.059999       22.600000
+  HD2       23.520000       29.100000       23.080000
+  C         27.040001       27.400000       21.180000
+  O         27.840000       27.200001       20.280001
+  N         26.600000       26.340000       21.980000
+  H         25.780001       26.360001       22.559999
+  CA        27.100000       24.900000       21.680000
+  HA        28.139999       24.900000       21.340000
+  CB        27.120001       23.959999       22.920000
+  HB        27.240000       22.900000       22.680000
+  CG2       28.240000       24.340000       23.959999
+ HG21       28.299999       23.660000       24.820000
+ HG22       29.200001       24.180000       23.480000
+ HG23       28.219999       25.360001       24.340000
+  OG1       25.879999       24.100000       23.580000
+  HG1       26.080000       23.480000       24.299999
+  C         26.180000       24.180000       20.680000
+  O         25.139999       24.719999       20.379999
+  N         26.559999       23.080000       20.040001
+  H         27.480000       22.740000       20.280001
+  CA        25.600000       22.200001       19.299999
+  HA        25.120001       22.799999       18.520000
+  CB        26.480000       21.120001       18.639999
+  HB        27.059999       20.520000       19.340000
+  CG1       25.680000       20.160000       17.799999
+ HG11       25.299999       19.340000       18.400000
+ HG12       24.799999       20.620001       17.320000
+ HG13       26.320000       19.700001       17.059999
+  CG2       27.500000       21.840000       17.719999
+ HG21       28.260000       22.400000       18.260000
+ HG22       27.940001       21.120001       17.040001
+ HG23       27.020000       22.580000       17.059999
+  C         24.540001       21.559999       20.240000
+  O         24.900000       20.840000       21.120001
+  N         23.280001       21.840000       19.959999
+  H         23.139999       22.480000       19.200001
+  CA        22.120001       21.280001       20.660000
+  HA        22.520000       20.559999       21.379999
+  CB        21.379999       22.280001       21.540001
+  HB        20.500000       21.799999       21.980000
+  CG2       22.059999       22.840000       22.780001
+ HG21       22.980000       23.400000       22.580000
+ HG22       21.440001       23.639999       23.180000
+ HG23       22.200001       22.080000       23.559999
+  OG1       20.959999       23.379999       20.840000
+  HG1       20.040001       23.520000       21.100000
+  C         21.160000       20.459999       19.740000
+  O         19.920000       20.459999       19.879999
+  N         21.740000       19.760000       18.780001
+  H         22.740000       19.620001       18.820000
+  CA        21.080000       18.840000       17.820000
+  HA        20.040001       18.660000       18.080000
+  CB        21.059999       19.600000       16.459999
+  HB1       22.120001       19.740000       16.240000
+  HB2       20.719999       19.139999       15.540000
+  CG        20.260000       20.940001       16.520000
+  HG1       19.320000       20.760000       17.059999
+  HG2       20.900000       21.620001       17.080000
+  CD        20.000000       21.520000       15.140000
+  OE1       20.780001       22.260000       14.580000
+  OE2       19.020000       21.139999       14.500000
+  C         21.740000       17.440001       17.920000
+  O         22.860001       17.280001       18.420000
+  N         21.020000       16.379999       17.480000
+  H         20.139999       16.580000       17.040001
+  CH3       21.320000       14.940000       17.660000
+ HH31       22.360001       14.740000       17.379999
+ HH32       20.620001       14.280000       17.160000
+ HH33       21.340000       14.700000       18.719999
+256
+ 100.0 100.0 100.0
+ HH31       17.747999       18.909000       30.774000
+  CH3       18.612000       18.334999       30.423000
+ HH32       18.121000       17.434000       30.027000
+ HH33       19.239000       18.073999       31.271999
+  C         19.364000       19.246000       29.549999
+  O         20.521000       19.552000       29.834999
+  N         18.806999       19.613001       28.386999
+  H         17.833000       19.452000       28.222000
+  CA        19.513000       20.502001       27.410999
+  HA1       20.393000       20.054001       26.962999
+  HA2       18.917999       20.843000       26.573000
+  C         19.943001       21.808001       28.063000
+  O         19.163000       22.344999       28.908001
+  N         21.138000       22.327999       27.806000
+  H         21.764999       21.820999       27.208000
+  CA        21.660999       23.593000       28.353001
+  HA        20.885000       24.208000       28.837999
+  CB        22.750000       23.298000       29.297001
+  HB1       23.384001       22.521000       28.875000
+  HB2       23.320999       24.216000       29.495001
+  CG        22.249001       22.691000       30.641001
+  HG1       21.568001       23.415001       31.084000
+  HG2       21.774000       21.729000       30.465000
+  CD        23.530001       22.330999       31.561001
+  OE1       23.778999       22.985001       32.623001
+  OE2       24.372999       21.437000       31.252001
+  C         22.215000       24.565001       27.231001
+  O         22.639999       24.122999       26.156000
+  N         22.356001       25.886999       27.427999
+  H         22.037001       26.238001       28.334000
+  CA        22.933001       26.858000       26.506001
+  HA        23.440001       26.229000       25.761999
+  CB        21.952999       27.631001       25.742001
+  HB1       22.488001       28.115999       24.938999
+  HB2       21.337999       26.875999       25.252001
+  CG        21.122999       28.723000       26.379000
+  CD1       20.900000       28.825001       27.735001
+  HD1       21.208000       28.153999       28.528000
+  NE1       20.212000       29.983999       27.952999
+  HE1       19.979000       30.379999       28.864000
+  CE2       20.066000       30.712000       26.797001
+  CZ2       19.437000       31.936001       26.482000
+  HZ2       19.047001       32.526001       27.292000
+  CH2       19.341000       32.308998       25.134001
+  HH2       18.875999       33.242001       24.892000
+  CZ3       19.888000       31.563999       24.146000
+  HZ3       19.889999       32.018002       23.152000
+  CE3       20.521000       30.367001       24.465000
+  HE3       21.042999       29.861000       23.653000
+  CD2       20.493000       29.829000       25.775999
+  C         23.962999       27.829000       27.112000
+  O         23.825001       28.294001       28.261000
+  N         25.089001       28.052999       26.357000
+  H         25.072001       27.756001       25.402000
+  CA        26.400000       28.421000       26.879000
+  HA        26.212999       28.839001       27.893999
+  CB        27.302000       27.162001       26.962000
+  HB        27.176001       26.492001       26.098000
+  CG2       28.822001       27.358000       26.959999
+ HG21       29.396999       26.495001       27.212000
+ HG22       29.125999       27.655001       25.973000
+ HG23       29.104000       28.159000       27.656000
+  OG1       27.077000       26.517000       28.200001
+  HG1       27.707001       25.784000       28.298000
+  C         27.021999       29.548000       26.136000
+  O         27.018999       29.542000       24.936001
+  N         27.548000       30.507000       26.910999
+  H         27.572001       30.396000       27.895000
+  CA        28.231001       31.749001       26.426001
+  HA        27.653000       32.080002       25.544001
+  CB        28.281000       32.882000       27.454000
+  HB1       27.271999       33.139999       27.733000
+  HB2       28.778999       32.557999       28.365999
+  CG        28.908001       34.162998       26.945999
+  CD1       30.309000       34.359001       27.059000
+  HD1       30.868000       33.514999       27.399000
+  CE1       30.915001       35.478001       26.600000
+  HE1       31.965000       35.612000       26.775000
+  CZ        30.155001       36.516998       25.987000
+  OH        30.785999       37.668999       25.575001
+  HH        31.716999       37.658001       25.774000
+  CE2       28.771999       36.313999       25.802000
+  HE2       28.143999       37.110001       25.355000
+  CD2       28.118999       35.137001       26.309999
+  HD2       27.056000       35.061001       26.143000
+  C         29.664000       31.506001       26.035000
+  O         30.393000       30.815001       26.768000
+  N         30.003000       31.945999       24.811001
+  H         29.298000       32.344002       24.195999
+  CA        31.372999       32.153999       24.240000
+  HA        32.001999       32.063000       25.113001
+  CB        31.596001       30.941000       23.316000
+  HB1       31.266001       30.059999       23.865000
+  HB2       30.996000       31.105000       22.410000
+  CG        33.067001       30.677000       22.936001
+  OD1       33.952000       31.516001       23.181000
+  OD2       33.231998       29.577999       22.384001
+  C         31.740000       33.470001       23.636999
+  O         30.855000       33.898998       22.868999
+  N         32.806999       34.155998       23.975000
+  H         33.388000       33.719002       24.684999
+  CA        33.245998       35.404999       23.363001
+  HA        32.462002       36.148998       23.551001
+  CB        34.569000       35.998001       24.016001
+  HB1       35.327999       35.209000       23.864000
+  HB2       34.816002       36.862000       23.464001
+  CG        34.243999       36.230999       25.461000
+  OD1       34.375999       35.285999       26.330000
+  OD2       33.754002       37.341000       25.844000
+  C         33.500999       35.407001       21.849001
+  O         33.366001       36.451000       21.209000
+  N         33.692001       34.200001       21.325001
+  H         33.896000       33.384998       21.912001
+  CA        33.598000       33.845001       19.920000
+  HA        34.293999       34.451000       19.333000
+  CB        34.049999       32.419998       19.780001
+  HB1       33.626999       31.726000       20.525999
+  HB2       33.889000       31.955999       18.816000
+  HB3       35.101002       32.393002       20.076000
+  C         32.233002       34.004002       19.184999
+  O         32.168999       33.986000       18.027000
+  N         31.131001       34.112000       19.914000
+  H         31.215000       34.146999       20.933001
+  CA        29.878000       34.479000       19.337000
+  HA        29.941999       34.799000       18.311001
+  CB        28.886999       33.264000       19.312000
+  HB        28.073999       33.473999       18.598000
+  CG2       29.631001       31.947001       18.929001
+ HG21       30.069000       32.040001       17.929001
+ HG22       30.332001       31.509001       19.625000
+ HG23       28.825001       31.219000       18.843000
+  OG1       28.430000       32.988998       20.601000
+  HG1       27.868000       32.237999       20.754999
+  C         29.240999       35.646000       20.070000
+  O         28.351999       36.314999       19.549000
+  N         29.712999       35.988998       21.288000
+  H         30.490999       35.417999       21.622999
+  CA        29.136000       36.803001       22.329000
+  HA        29.589001       36.439999       23.249001
+  CB        29.438000       38.312000       22.266001
+  HB1       28.694000       38.722000       21.594999
+  HB2       29.344000       38.673000       23.287001
+  CG        30.854000       38.692001       21.862000
+  HG1       31.665001       38.069000       22.233000
+  HG2       30.878000       38.727001       20.753000
+  CD        31.079000       40.173000       22.181000
+  HD1       31.804001       40.556999       21.506001
+  HD2       30.114000       40.650002       22.190001
+  CE        31.836000       40.358002       23.535000
+  HE1       31.455000       39.667000       24.323999
+  HE2       32.889000       40.095001       23.455000
+  NZ        31.746000       41.736000       23.968000
+  HZ1       30.839001       42.178001       24.072001
+  HZ2       32.132999       41.931999       24.881001
+  HZ3       32.230999       42.285000       23.273001
+  C         27.650000       36.519001       22.618000
+  O         26.900000       37.333000       23.101999
+  N         27.250999       35.243000       22.341999
+  H         27.857000       34.727001       21.726999
+  CA        25.822001       34.794998       22.521999
+  HA        25.364000       35.493999       23.233000
+  CB        25.045000       34.750000       21.216999
+  HB        24.041000       34.332001       21.273001
+  CG2       24.825001       36.194000       20.688999
+ HG21       25.785000       36.619999       20.405001
+ HG22       24.245001       36.214001       19.764000
+ HG23       24.271000       36.771999       21.426001
+  OG1       25.789000       33.955002       20.292999
+  HG1       25.207001       33.939999       19.520000
+  C         25.792000       33.425999       23.174999
+  O         26.695000       32.634998       23.208000
+  N         24.665001       33.056000       23.837999
+  H         23.861000       33.668999       23.951000
+  CA        24.436001       31.722000       24.438000
+  HA        25.367001       31.370001       24.917999
+  CB        23.468000       31.867001       25.601000
+  HB1       22.493000       32.306999       25.362000
+  HB2       23.194000       30.847000       25.844999
+  CG        24.040001       32.491001       26.872000
+  CD1       24.334999       31.683001       27.945000
+  HD1       24.132999       30.648001       27.816000
+  CE1       24.747999       32.340000       29.135000
+  HE1       24.768999       31.764999       30.041000
+  CZ        24.915001       33.723000       29.184000
+  HZ        25.322001       34.069000       30.131001
+  CE2       24.757000       34.507999       28.037001
+  HE2       24.959999       35.570999       28.069000
+  CD2       24.254000       33.928001       26.900000
+  HD2       24.118000       34.542000       26.028000
+  C         23.965000       30.767000       23.378000
+  O         22.945999       31.084999       22.708000
+  N         24.657000       29.631001       23.191999
+  H         25.483000       29.544001       23.737000
+  CA        24.277000       28.594999       22.205999
+  HA        23.254999       28.698000       21.850000
+  CB        25.108999       28.662001       20.902000
+  HB        24.761999       27.809000       20.327000
+  CG2       24.813000       29.997999       20.288000
+ HG21       23.764000       30.296000       20.315001
+ HG22       25.268000       30.739000       20.933001
+ HG23       24.973000       30.139999       19.208000
+  OG1       26.497000       28.441000       21.128000
+  HG1       26.819000       29.103001       21.747999
+  C         24.292999       27.131001       22.775000
+  O         25.073999       26.816999       23.645000
+  N         23.502001       26.282000       22.200001
+  H         22.986000       26.605000       21.417000
+  CA        23.297001       24.957001       22.916000
+  HA        23.083000       25.173000       23.959999
+  CB        22.013000       24.181999       22.395000
+  HB        22.045000       23.292999       22.957001
+  CG1       20.639999       24.885000       22.735001
+ HG11       20.563999       24.917000       23.825001
+ HG12       20.528000       25.907000       22.334000
+ HG13       19.872000       24.167000       22.436001
+  CG2       22.055000       23.958000       20.851000
+ HG21       21.028000       23.723000       20.547001
+ HG22       22.358999       24.806000       20.254000
+ HG23       22.569000       23.011999       20.620001
+  C         24.544001       24.023001       22.915001
+  O         25.209999       24.017000       21.886000
+  N         24.952999       23.323999       23.917999
+  H         24.518000       23.565001       24.792999
+  CA        26.094999       22.489000       24.030001
+  HA        26.971001       22.780001       23.457001
+  CB        26.589001       22.365999       25.469999
+  HB        27.375999       21.607000       25.493000
+  CG2       27.080999       23.695999       25.996000
+ HG21       27.900000       24.164000       25.447001
+ HG22       26.259001       24.374001       25.761999
+ HG23       27.309999       23.601999       27.068001
+  OG1       25.506001       21.988001       26.360001
+  HG1       25.775999       22.070000       27.270000
+  C         25.794001       21.077999       23.492001
+  O         26.719000       20.330999       23.289000
+  N         24.584999       20.688999       23.125000
+  H         23.862000       21.264000       23.533001
+  CA        24.337000       19.406000       22.333000
+  HA        25.205999       19.201000       21.705000
+  CB        24.184000       18.282000       23.320000
+  HB1       24.558001       18.524000       24.323999
+  HB2       23.122999       18.163000       23.559999
+  CG        24.658001       16.908001       22.886999
+  HG1       24.084000       16.511999       22.047001
+  HG2       25.625000       17.115000       22.415001
+  CD        24.798000       15.846000       23.966999
+  OE1       23.674000       15.524000       24.493999
+  OE2       25.856001       15.278000       24.216999
+  C         23.051001       19.573999       21.457001
+  O         22.964001       19.075001       20.360001
+  N         22.049000       20.320000       21.846001
+  H         22.072001       20.660999       22.792999
+  CH3       20.709000       20.507999       21.187000
+ HH31       20.733000       20.684999       20.098000
+ HH32       20.229000       21.370001       21.677000
+ HH33       20.110001       19.625000       21.393000
+256
+ 100.0 100.0 100.0
+ HH31       15.326000       19.707001       28.507999
+  CH3       16.124001       19.739000       29.243000
+ HH32       16.097000       18.858000       29.879999
+ HH33       15.877000       20.590000       29.882999
+  C         17.427999       20.063000       28.719000
+  O         18.434999       19.580000       29.207001
+  N         17.473000       21.037001       27.832001
+  H         16.622999       21.559999       27.674999
+  CA        18.596001       21.582001       27.073999
+  HA1       19.156000       20.740000       26.694000
+  HA2       18.205000       22.087999       26.226999
+  C         19.520000       22.562000       27.834999
+  O         19.128000       23.195000       28.834000
+  N         20.785000       22.731001       27.358000
+  H         21.018999       22.299000       26.497999
+  CA        21.775000       23.417999       28.174999
+  HA        21.275999       23.934000       29.000999
+  CB        22.694000       22.315001       28.759001
+  HB1       22.139000       21.450001       29.075001
+  HB2       23.264000       21.839001       27.962999
+  CG        23.587999       22.702999       29.889000
+  HG1       23.993000       23.702999       29.677000
+  HG2       22.948000       22.656000       30.735001
+  CD        24.806000       21.790001       30.145000
+  OE1       24.686001       20.598000       30.546000
+  OE2       25.875999       22.322001       29.929001
+  C         22.570000       24.465000       27.296000
+  O         23.014000       24.046000       26.268999
+  N         22.716999       25.670000       27.816000
+  H         22.483000       25.642000       28.795000
+  CA        23.455000       26.697001       27.070999
+  HA        24.142000       26.082001       26.431000
+  CB        22.481001       27.514999       26.113001
+  HB1       23.093000       28.275000       25.673000
+  HB2       22.177999       26.837999       25.298000
+  CG        21.292999       28.247999       26.673000
+  CD1       21.160999       28.905001       27.799000
+  HD1       21.816999       28.902000       28.653000
+  NE1       19.926001       29.599001       27.802999
+  HE1       19.537001       29.996000       28.638000
+  CE2       19.207001       29.382999       26.608999
+  CZ2       17.920000       29.664000       26.230000
+  HZ2       17.313999       30.233000       26.930000
+  CH2       17.605000       29.461000       24.863001
+  HH2       16.650000       29.761000       24.461000
+  CZ3       18.466000       28.827000       23.971001
+  HZ3       18.187000       28.683001       22.931999
+  CE3       19.702000       28.375000       24.436001
+  HE3       20.375000       27.848000       23.785999
+  CD2       20.153999       28.618000       25.823999
+  C         24.363001       27.497999       28.048000
+  O         24.173000       27.629999       29.267000
+  N         25.371000       28.107000       27.528999
+  H         25.612000       27.839001       26.575001
+  CA        26.257999       29.075001       28.141001
+  HA        25.674000       29.535000       28.976999
+  CB        27.474001       28.511000       28.938999
+  HB        27.980000       29.347000       29.431999
+  CG2       27.219999       27.589001       30.090000
+ HG21       26.385000       28.101000       30.569000
+ HG22       27.004999       26.556999       29.747000
+ HG23       28.013000       27.601999       30.823999
+  OG1       28.334000       27.834999       28.090000
+  HG1       28.962999       27.327999       28.613001
+  C         26.707001       30.190001       27.174000
+  O         26.847000       30.032000       25.948000
+  N         26.729000       31.392000       27.671000
+  H         26.438999       31.507999       28.628000
+  CA        27.344000       32.457001       26.860001
+  HA        26.893000       32.623001       25.886999
+  CB        27.180000       33.872002       27.549999
+  HB1       26.118000       34.092999       27.747000
+  HB2       27.555000       33.773998       28.584999
+  CG        27.846001       35.092999       26.938999
+  CD1       29.184000       35.278000       27.270000
+  HD1       29.666000       34.762001       28.073000
+  CE1       29.862000       36.347000       26.572001
+  HE1       30.863001       36.535000       26.881001
+  CZ        29.167000       37.137001       25.565001
+  OH        29.768000       37.953999       24.750999
+  HH        30.702000       38.075001       24.870001
+  CE2       27.768000       36.952999       25.325001
+  HE2       27.246000       37.525002       24.591999
+  CD2       27.170000       35.813999       25.941999
+  HD2       26.117001       35.707001       25.698000
+  C         28.836000       32.075001       26.612000
+  O         29.643000       31.771999       27.517000
+  N         29.295000       32.087002       25.348000
+  H         28.660000       32.359001       24.599001
+  CA        30.627001       31.836000       24.938000
+  HA        31.275999       32.066002       25.771000
+  CB        30.715000       30.350000       24.606001
+  HB1       30.288000       29.750000       25.434000
+  HB2       30.129999       30.139000       23.701000
+  CG        32.119999       29.827000       24.354000
+  OD1       32.241001       28.568001       24.316000
+  OD2       33.141998       30.525999       24.320000
+  C         31.048000       32.786999       23.754000
+  O         30.231001       33.285999       22.993000
+  N         32.341000       33.078999       23.537001
+  H         33.081001       32.535000       23.981001
+  CA        32.769001       34.076000       22.594999
+  HA        32.066002       34.910999       22.521999
+  CB        34.054001       34.785000       23.056999
+  HB1       34.324001       35.585999       22.367001
+  HB2       33.845001       35.294998       24.017000
+  CG        35.240002       33.887001       23.489000
+  OD1       35.619999       33.896000       24.658001
+  OD2       35.700001       33.109001       22.657000
+  C         32.901001       33.599998       21.129000
+  O         33.466000       34.280998       20.278999
+  N         32.370998       32.396999       20.804001
+  H         31.802000       31.945999       21.513000
+  CA        32.424000       31.802000       19.434999
+  HA        33.432999       31.698999       19.056000
+  CB        31.740000       30.410000       19.669001
+  HB1       30.695999       30.417999       19.968000
+  HB2       31.848000       29.870001       18.733000
+  HB3       32.410000       29.829000       20.287001
+  C         31.597000       32.679001       18.479000
+  O         32.087002       33.042000       17.396000
+  N         30.440001       33.126999       18.966000
+  H         30.124001       32.680000       19.801001
+  CA        29.474001       34.056999       18.448999
+  HA        29.750000       34.408001       17.451000
+  CB        28.224001       33.237999       18.268000
+  HB        27.308001       33.824001       18.115000
+  CG2       28.247999       32.299999       17.125000
+ HG21       29.094999       31.604000       17.030001
+ HG22       27.391001       31.612000       17.209000
+ HG23       28.257000       32.779999       16.170000
+  OG1       27.843000       32.462002       19.424999
+  HG1       27.122000       32.894001       19.850000
+  C         29.166000       35.229000       19.358000
+  O         28.304001       36.046001       18.990999
+  N         29.738001       35.283001       20.599001
+  H         30.340000       34.591999       20.969000
+  CA        29.441999       36.325001       21.562000
+  HA        29.872000       36.019001       22.521999
+  CB        29.980000       37.699001       21.180000
+  HB1       29.681999       37.981998       20.165001
+  HB2       29.546000       38.483002       21.792000
+  CG        31.538000       37.786999       21.334000
+  HG1       31.802000       37.259998       22.240999
+  HG2       32.035000       37.354000       20.440001
+  CD        31.934999       39.259998       21.469999
+  HD1       31.466000       39.813999       20.666000
+  HD2       31.614000       39.638000       22.461000
+  CE        33.492001       39.431999       21.555000
+  HE1       33.890999       38.773998       22.334000
+  HE2       33.952000       39.050999       20.610001
+  NZ        33.840000       40.839001       21.830000
+  HZ1       33.471001       41.146999       22.737000
+  HZ2       34.825001       41.029999       22.014000
+  HZ3       33.577999       41.473999       21.077999
+  C         27.943001       36.313999       21.962999
+  O         27.275999       37.327000       21.881001
+  N         27.412001       35.192001       22.386000
+  H         28.025999       34.477001       22.760000
+  CA        26.004000       34.876999       22.705999
+  HA        25.490999       35.685001       23.219999
+  CB        25.209999       34.493999       21.410000
+  HB        24.193001       34.240002       21.695000
+  CG2       25.113001       35.679001       20.399000
+ HG21       26.084999       35.987000       20.000000
+ HG22       24.403999       35.365002       19.622000
+ HG23       24.664000       36.570000       20.836000
+  OG1       25.813000       33.483002       20.665001
+  HG1       25.186001       33.292000       19.995001
+  C         25.837000       33.603001       23.514000
+  O         26.724001       32.750999       23.603001
+  N         24.674999       33.446999       24.131001
+  H         23.954000       34.115002       23.885000
+  CA        24.273001       32.161999       24.816000
+  HA        25.066000       31.858000       25.474001
+  CB        22.982000       32.409000       25.642000
+  HB1       22.329000       32.918999       24.931000
+  HB2       22.531000       31.423000       25.783001
+  CG        23.186001       33.110001       26.966999
+  CD1       23.417000       32.389000       28.149000
+  HD1       23.568001       31.312000       28.243999
+  CE1       23.636999       33.039001       29.319000
+  HE1       23.723000       32.507000       30.254999
+  CZ        23.552999       34.474998       29.350000
+  HZ        23.598000       35.028999       30.291000
+  CE2       23.388000       35.195000       28.159000
+  HE2       23.322001       36.266998       28.162001
+  CD2       23.212999       34.507999       26.919001
+  HD2       23.291000       35.136002       26.066000
+  C         24.160999       30.978001       23.851999
+  O         23.237000       30.816000       23.004000
+  N         25.002001       29.997000       24.065001
+  H         25.632000       30.000000       24.851999
+  CA        25.330000       28.964001       23.066999
+  HA        24.775000       29.101000       22.139000
+  CB        26.799999       29.049000       22.715000
+  HB        27.306999       28.990999       23.688999
+  CG2       27.483000       27.990000       21.927000
+ HG21       27.537001       27.083000       22.541000
+ HG22       26.854000       27.732000       21.059000
+ HG23       28.447001       28.323000       21.606001
+  OG1       27.188000       30.191000       22.080999
+  HG1       26.705000       30.862000       22.549999
+  C         25.077999       27.566999       23.686001
+  O         25.424999       27.334000       24.849001
+  N         24.452000       26.639999       23.014999
+  H         24.225000       26.900999       22.035000
+  CA        24.167999       25.249001       23.485001
+  HA        23.648001       25.291000       24.407000
+  CB        23.305000       24.370001       22.482000
+  HB        23.264999       23.362000       22.882999
+  CG1       21.889000       24.975000       22.500999
+ HG11       21.872999       26.025000       22.229000
+ HG12       21.209999       24.381001       21.875999
+ HG13       21.576000       24.995001       23.524000
+  CG2       23.865000       24.261999       21.063000
+ HG21       23.863001       25.240000       20.615999
+ HG22       24.934000       24.023001       21.114000
+ HG23       23.289000       23.593000       20.441999
+  C         25.510000       24.591000       23.742001
+  O         26.475000       24.660999       23.014999
+  N         25.677999       23.931999       24.908001
+  H         24.872000       23.552999       25.424000
+  CA        26.987000       23.223000       25.243999
+  HA        27.872000       23.770000       24.912001
+  CB        27.191999       23.107000       26.759001
+  HB        28.018999       22.424999       26.986000
+  CG2       27.430000       24.452999       27.365999
+ HG21       28.393999       24.848000       27.040001
+ HG22       26.600000       25.114000       27.120001
+ HG23       27.459000       24.384001       28.458000
+  OG1       26.039000       22.547001       27.330000
+  HG1       25.999001       22.749001       28.243999
+  C         27.198000       21.877001       24.535999
+  O         28.145000       21.091999       24.752001
+  N         26.212999       21.628000       23.643000
+  H         25.525000       22.330999       23.500999
+  CA        26.216999       20.472000       22.780001
+  HA        26.368000       19.531000       23.292000
+  CB        24.941000       20.341000       22.028000
+  HB1       24.670000       21.302000       21.615000
+  HB2       25.042000       19.597000       21.230000
+  CG        23.808001       19.888000       22.980000
+  HG1       24.031000       18.944000       23.445000
+  HG2       23.714001       20.652000       23.778000
+  CD        22.525000       19.674000       22.132000
+  OE1       21.563999       20.474001       22.422001
+  OE2       22.298000       18.618000       21.504000
+  C         27.374001       20.537001       21.740999
+  O         27.613001       21.559999       21.129999
+  N         28.070000       19.424000       21.530001
+  H         28.009001       18.660000       22.193001
+  CH3       29.073000       19.308001       20.539000
+ HH31       28.846001       19.886999       19.635000
+ HH32       29.275000       18.289000       20.170000
+ HH33       30.070000       19.584000       20.902000
+256
+ 100.0 100.0 100.0
+ HH31       16.577999       25.819000       24.798000
+  CH3       17.455999       25.149000       24.768000
+ HH32       18.365000       25.695999       24.545000
+ HH33       17.323999       24.326000       24.055000
+  C         17.763000       24.580999       26.129000
+  O         18.333000       23.507000       26.214001
+  N         17.306000       25.268999       27.186001
+  H         16.830999       26.124001       26.934000
+  CA        17.399000       24.816999       28.628000
+  HA1       16.711000       25.489000       29.167000
+  HA2       16.986000       23.811001       28.753000
+  C         18.813000       24.926001       29.216999
+  O         18.922001       25.509001       30.299000
+  N         19.822001       24.584999       28.437000
+  H         19.577999       24.052999       27.622999
+  CA        21.194000       24.754000       28.806000
+  HA        21.302999       25.562000       29.518999
+  CB        21.598000       23.451000       29.368999
+  HB1       20.773001       22.934999       29.871000
+  HB2       21.875999       22.778000       28.532000
+  CG        22.740999       23.537001       30.398001
+  HG1       23.559000       24.115999       30.004999
+  HG2       22.396999       23.981001       31.340000
+  CD        23.448999       22.212000       30.804001
+  OE1       23.933001       21.434000       29.903000
+  OE2       23.511000       21.981001       32.021999
+  C         22.115999       25.045000       27.563000
+  O         21.868000       24.641001       26.419001
+  N         23.077999       25.948000       27.848000
+  H         23.247999       26.211000       28.820000
+  CA        23.811001       26.721001       26.805000
+  HA        23.701000       26.167000       25.860001
+  CB        23.073999       28.042000       26.677000
+  HB1       23.072001       28.511000       27.657000
+  HB2       23.601000       28.671000       25.980000
+  CG        21.646999       27.979000       26.207001
+  CD1       20.573999       27.833000       27.013000
+  HD1       20.604000       27.646999       28.079000
+  NE1       19.372000       27.837999       26.285999
+  HE1       18.447001       27.746000       26.677000
+  CE2       19.688000       28.115000       24.950001
+  CZ2       18.934999       28.209000       23.794001
+  HZ2       17.865000       28.076000       23.804001
+  CH2       19.660000       28.742001       22.653999
+  HH2       19.041000       28.941999       21.774000
+  CZ3       21.039000       28.997999       22.622999
+  HZ3       21.511999       29.172001       21.672001
+  CE3       21.778999       28.695000       23.738001
+  HE3       22.865000       28.704000       23.771000
+  CD2       21.131001       28.302000       24.920000
+  C         25.294001       26.829000       27.216999
+  O         25.466000       27.117001       28.408001
+  N         26.193001       26.624001       26.315001
+  H         25.792999       26.424000       25.403000
+  CA        27.604000       27.112000       26.292999
+  HA        27.917999       27.212000       27.316000
+  CB        28.603001       26.229000       25.473000
+  HB        29.511999       26.775999       25.250000
+  CG2       29.007000       24.979000       26.261000
+ HG21       29.778999       24.385000       25.785000
+ HG22       29.245001       25.141001       27.308001
+ HG23       28.122999       24.344000       26.424999
+  OG1       28.195999       25.858000       24.204000
+  HG1       27.900999       26.646000       23.768000
+  C         27.667999       28.580000       25.754999
+  O         26.930000       28.855000       24.764999
+  N         28.653000       29.400000       26.163000
+  H         29.277000       29.089001       26.888000
+  CA        28.712000       30.827999       25.808001
+  HA        28.084999       30.938999       24.934999
+  CB        28.181000       31.702000       26.855000
+  HB1       27.107000       31.473000       26.906000
+  HB2       28.658001       31.382999       27.778999
+  CG        28.348000       33.223999       26.695000
+  CD1       29.347000       33.798000       27.443001
+  HD1       29.926001       33.276001       28.190001
+  CE1       29.473000       35.230000       27.353001
+  HE1       30.320000       35.749001       27.778000
+  CZ        28.638000       35.955002       26.472000
+  OH        28.857000       37.298000       26.278999
+  HH        29.464001       37.719002       26.896999
+  CE2       27.632999       35.312000       25.639000
+  HE2       26.945999       35.844002       25.017000
+  CD2       27.518999       33.938000       25.798000
+  HD2       26.700001       33.403000       25.319000
+  C         30.162001       31.305000       25.444000
+  O         31.066999       31.235001       26.261000
+  N         30.289000       31.785999       24.191000
+  H         29.426001       31.721001       23.673000
+  CA        31.539000       32.380001       23.570999
+  HA        32.348999       31.712000       23.848000
+  CB        31.450001       32.243999       22.101000
+  HB1       31.389999       31.191999       21.795000
+  HB2       30.509001       32.728001       21.840000
+  CG        32.688999       32.701000       21.311001
+  OD1       33.633999       33.252998       21.941999
+  OD2       32.651001       32.669998       20.106001
+  C         31.891001       33.812000       24.007999
+  O         31.400999       34.734001       23.306999
+  N         32.571999       34.000000       25.115000
+  H         32.905998       33.154999       25.556999
+  CA        32.939999       35.331001       25.552999
+  HA        31.983000       35.817001       25.676001
+  CB        33.602001       35.299000       26.938000
+  HB1       33.872002       36.318001       27.183001
+  HB2       32.839001       34.945000       27.643999
+  CG        34.812000       34.389999       26.892000
+  OD1       34.573002       33.148998       26.871000
+  OD2       35.986000       34.821999       26.798000
+  C         33.834000       36.146999       24.555000
+  O         34.068001       37.319000       24.753000
+  N         34.418999       35.570999       23.479000
+  H         34.058998       34.660000       23.246000
+  CA        35.110001       36.358002       22.431999
+  HA        35.645000       37.187000       22.884001
+  CB        36.188999       35.431999       21.759001
+  HB1       35.749001       34.637001       21.169001
+  HB2       36.819000       35.959000       21.025000
+  HB3       36.777000       34.948002       22.535999
+  C         34.087002       36.852001       21.363001
+  O         34.540001       37.691002       20.614000
+  N         32.823002       36.476002       21.375999
+  H         32.556999       35.738998       22.035999
+  CA        31.916000       36.925999       20.340000
+  HA        32.287998       37.837002       19.844000
+  CB        31.764000       35.950001       19.122000
+  HB        31.037001       36.287998       18.382000
+  CG2       33.090000       35.646000       18.386000
+ HG21       33.492001       36.589001       18.011999
+ HG22       33.853001       35.178001       18.999001
+ HG23       32.903000       34.928001       17.573000
+  OG1       31.129999       34.769001       19.528999
+  HG1       31.836000       34.126999       19.660999
+  C         30.502001       37.207001       20.893000
+  O         29.796000       37.791000       20.094000
+  N         30.191000       36.922001       22.131001
+  H         30.892000       36.571999       22.788000
+  CA        28.844999       36.976002       22.745001
+  HA        28.920000       36.547001       23.740999
+  CB        28.287001       38.416000       23.115999
+  HB1       28.000000       38.933998       22.193001
+  HB2       27.447001       38.327999       23.781000
+  CG        29.226000       39.356998       23.757999
+  HG1       29.917000       38.922001       24.471001
+  HG2       29.820999       39.782001       22.948999
+  CD        28.729000       40.632999       24.431000
+  HD1       28.601000       40.452999       25.497000
+  HD2       29.461000       41.417999       24.271999
+  CE        27.296000       41.110001       23.943001
+  HE1       27.381001       41.303001       22.874001
+  HE2       26.516001       40.396999       24.160000
+  NZ        26.846001       42.366001       24.653000
+  HZ1       27.409000       43.174000       24.476000
+  HZ2       25.884001       42.500000       24.393000
+  HZ3       27.013000       42.306000       25.641001
+  C         27.825001       36.029999       22.042999
+  O         26.681000       36.384998       21.987000
+  N         28.198000       34.911999       21.409000
+  H         29.176001       34.675999       21.406000
+  CA        27.207001       33.923000       20.907000
+  HA        26.209000       34.366001       20.754000
+  CB        27.555000       33.418999       19.511999
+  HB        26.896999       32.546001       19.426001
+  CG2       27.080999       34.389000       18.389999
+ HG21       27.778000       35.228001       18.438000
+ HG22       26.987000       33.861000       17.459000
+ HG23       26.136000       34.858002       18.662001
+  OG1       28.822001       33.002998       19.274000
+  HG1       29.400000       33.766998       19.372000
+  C         27.049999       32.748001       21.877001
+  O         28.007999       32.193001       22.407000
+  N         25.798000       32.331001       22.082001
+  H         25.035999       32.799000       21.601000
+  CA        25.375000       31.195000       22.872000
+  HA        26.259001       30.902000       23.444000
+  CB        24.184000       31.478001       23.739000
+  HB1       23.357000       31.788000       23.103001
+  HB2       24.038000       30.510000       24.225000
+  CG        24.316999       32.455002       24.816000
+  CD1       24.601999       32.046001       26.107000
+  HD1       24.670000       30.983999       26.341000
+  CE1       24.624001       32.959999       27.177000
+  HE1       24.811001       32.564999       28.174999
+  CZ        24.504000       34.351002       26.948000
+  HZ        24.583000       34.974998       27.830000
+  CE2       24.288000       34.758999       25.611000
+  HE2       24.245001       35.833000       25.459999
+  CD2       24.225000       33.830002       24.533001
+  HD2       24.018000       34.125999       23.517000
+  C         25.096001       29.980000       21.921000
+  O         24.290001       30.181000       21.056999
+  N         25.599001       28.756001       22.212000
+  H         26.163000       28.610001       23.028000
+  CA        25.346001       27.555000       21.474001
+  HA        24.485001       27.712000       20.799000
+  CB        26.532000       26.976999       20.761000
+  HB        27.344000       26.919001       21.500000
+  CG2       26.372000       25.565001       20.216000
+ HG21       26.473000       24.841000       21.040001
+ HG22       25.367001       25.457001       19.792999
+ HG23       27.042000       25.422001       19.372999
+  OG1       26.943001       27.823999       19.698000
+  HG1       27.440001       28.583000       19.997000
+  C         24.837000       26.473000       22.527000
+  O         25.302000       26.351000       23.672001
+  N         23.767000       25.754000       22.165001
+  H         23.663000       25.645000       21.167999
+  CA        23.035000       24.825001       23.056000
+  HA        22.867001       25.413000       23.978001
+  CB        21.631001       24.372000       22.584000
+  HB        21.261000       23.766001       23.417999
+  CG1       20.774000       25.565001       22.149000
+ HG11       19.809000       25.146000       21.834000
+ HG12       20.606001       26.177000       23.028000
+ HG13       21.163000       26.143000       21.318001
+  CG2       21.726000       23.386000       21.410999
+ HG21       20.746000       23.039000       21.090000
+ HG22       22.118000       24.087999       20.677999
+ HG23       22.365000       22.514000       21.516001
+  C         23.976000       23.635000       23.503000
+  O         24.846001       23.299000       22.733000
+  N         23.745001       22.976999       24.674999
+  H         22.964001       23.306999       25.229000
+  CA        24.664000       21.923000       25.226000
+  HA        25.691999       22.243000       25.010000
+  CB        24.621000       21.850000       26.754000
+  HB        25.347000       21.105000       27.100000
+  CG2       25.148001       23.198999       27.280001
+ HG21       25.084999       23.969000       26.520000
+ HG22       24.580999       23.594000       28.125000
+ HG23       26.212000       23.090000       27.518000
+  OG1       23.361000       21.472000       27.242001
+  HG1       23.431999       21.301001       28.184999
+  C         24.473000       20.580000       24.485001
+  O         25.408001       19.823999       24.333000
+  N         23.263000       20.271000       24.003000
+  H         22.534000       20.997000       24.011000
+  CA        22.929001       19.011999       23.372000
+  HA        23.698000       18.698999       22.670000
+  CB        22.743999       17.955999       24.454000
+  HB1       22.959999       17.024000       23.930000
+  HB2       23.518999       18.004000       25.232000
+  CG        21.326000       17.966999       25.118000
+  HG1       21.111000       18.997999       25.389000
+  HG2       20.566999       17.643999       24.412001
+  CD        21.271999       17.048000       26.400999
+  OE1       21.243000       15.799000       26.275000
+  OE2       21.398001       17.629999       27.493000
+  C         21.722000       19.150999       22.495001
+  O         21.018000       20.195999       22.577999
+  N         21.459000       18.091000       21.704000
+  H         22.070000       17.285000       21.697001
+  CH3       20.427000       17.916000       20.712000
+ HH31       20.379999       16.868999       20.381001
+ HH32       20.474001       18.445000       19.754000
+ HH33       19.489000       18.200001       21.171000
+256
+ 100.0 100.0 100.0
+ HH31       16.431999       26.389999       24.245001
+  CH3       16.035999       25.403999       24.527000
+ HH32       15.695000       25.162001       23.521000
+ HH33       15.253000       25.601999       25.267000
+  C         17.202000       24.565001       24.966999
+  O         18.090000       24.306000       24.218000
+  N         17.191999       24.223000       26.242001
+  H         16.361000       24.480000       26.785999
+  CA        18.195999       23.392000       26.833000
+  HA1       17.784000       22.716999       27.566000
+  HA2       18.820999       22.834000       26.174999
+  C         19.070999       24.330000       27.701000
+  O         18.818001       25.476000       27.969000
+  N         20.021000       23.749001       28.283001
+  H         20.122000       22.756001       28.089001
+  CA        21.197001       24.457001       28.823000
+  HA        20.868000       25.362000       29.309999
+  CB        21.924000       23.556000       29.853001
+  HB1       21.198000       23.346001       30.638000
+  HB2       22.212000       22.558001       29.486000
+  CG        23.155001       24.222000       30.528000
+  HG1       24.007999       24.382999       29.872999
+  HG2       22.879000       25.254999       30.714001
+  CD        23.513000       23.684999       31.913000
+  OE1       24.044001       22.554001       32.007999
+  OE2       23.195000       24.389000       32.916000
+  C         22.198000       24.846001       27.742001
+  O         22.487000       24.091999       26.879999
+  N         22.757000       26.073999       27.916000
+  H         22.486000       26.705999       28.653000
+  CA        23.641001       26.718000       26.951000
+  HA        23.700001       26.099001       26.048000
+  CB        22.889999       28.021000       26.594999
+  HB1       22.792999       28.593000       27.499001
+  HB2       23.625999       28.511999       25.955999
+  CG        21.562000       28.083000       25.985001
+  CD1       20.389000       27.691999       26.615999
+  HD1       20.349001       27.525000       27.697001
+  NE1       19.316000       27.872999       25.731001
+  HE1       18.360001       27.968000       26.059999
+  CE2       19.754999       28.017000       24.382000
+  CZ2       19.171000       28.044001       23.118999
+  HZ2       18.122000       27.789000       23.023001
+  CH2       19.997999       28.289000       21.986000
+  HH2       19.690001       28.278999       20.964001
+  CZ3       21.381001       28.478001       22.077000
+  HZ3       21.959000       28.676001       21.201000
+  CE3       21.962000       28.350000       23.358000
+  HE3       23.023001       28.363001       23.486000
+  CD2       21.205000       28.152000       24.547001
+  C         25.091999       26.914000       27.438000
+  O         25.306999       26.980000       28.649000
+  N         26.038000       27.121000       26.537001
+  H         25.798000       26.771999       25.601999
+  CA        27.486000       27.413000       26.687000
+  HA        27.608000       27.474001       27.783001
+  CB        28.454000       26.392000       26.013000
+  HB        29.434000       26.856001       26.018000
+  CG2       28.524000       25.011000       26.714001
+ HG21       27.524000       24.614000       26.731001
+ HG22       29.201000       24.386000       26.110001
+ HG23       28.923000       25.101000       27.732000
+  OG1       28.106001       26.146000       24.666000
+  HG1       28.673000       26.620001       24.039000
+  C         27.721001       28.833000       26.125999
+  O         27.535999       29.052999       24.941999
+  N         28.252001       29.740000       26.916000
+  H         28.613001       29.419001       27.806000
+  CA        28.646999       31.086000       26.503000
+  HA        27.902000       31.337000       25.738001
+  CB        28.566999       32.063999       27.636999
+  HB1       27.691000       31.818001       28.232000
+  HB2       29.384001       31.697001       28.254000
+  CG        28.709000       33.513000       27.224001
+  CD1       29.777000       34.256001       27.691999
+  HD1       30.507000       33.806999       28.372999
+  CE1       29.990999       35.596001       27.332001
+  HE1       30.804001       36.158001       27.771999
+  CZ        29.058001       36.257999       26.490000
+  OH        29.249001       37.540001       26.129999
+  HH        30.086000       37.821999       26.500999
+  CE2       28.004000       35.449001       25.919001
+  HE2       27.382999       35.938000       25.212000
+  CD2       27.834000       34.098999       26.275999
+  HD2       27.004999       33.501999       25.976000
+  C         30.059000       31.100000       25.906000
+  O         30.888000       30.329000       26.311001
+  N         30.254000       31.865000       24.830000
+  H         29.507000       32.497002       24.597000
+  CA        31.530001       32.195999       24.150000
+  HA        32.376999       31.750000       24.662001
+  CB        31.429001       31.693001       22.719999
+  HB1       31.476000       30.618999       22.669001
+  HB2       30.459999       32.037998       22.354000
+  CG        32.535999       32.312000       21.858999
+  OD1       33.763000       32.066002       22.170000
+  OD2       32.334999       33.174999       20.973000
+  C         31.742001       33.680000       24.195000
+  O         30.969000       34.477001       23.606001
+  N         32.845001       34.138000       24.773001
+  H         33.372002       33.542999       25.403000
+  CA        33.176998       35.521000       24.767000
+  HA        32.266998       36.066002       24.962999
+  CB        34.082001       35.824001       25.996000
+  HB1       35.105000       35.445999       25.816999
+  HB2       34.148998       36.909000       26.059999
+  CG        33.688999       35.412998       27.416000
+  OD1       33.441002       34.201000       27.662001
+  OD2       33.757000       36.313999       28.297001
+  C         33.703999       36.166000       23.565001
+  O         33.813999       37.444000       23.490000
+  N         33.987999       35.460999       22.483999
+  H         33.769001       34.474998       22.433001
+  CA        34.520000       36.049999       21.280001
+  HA        35.148998       36.912998       21.540001
+  CB        35.535000       35.018002       20.642000
+  HB1       36.351002       34.678001       21.280001
+  HB2       34.845001       34.205002       20.407000
+  HB3       35.918999       35.398998       19.704000
+  C         33.480000       36.508999       20.240000
+  O         33.733002       37.231998       19.319000
+  N         32.278999       35.945999       20.407000
+  H         32.227001       35.181000       21.052000
+  CA        31.049999       36.335999       19.618999
+  HA        31.299000       37.039001       18.837999
+  CB        30.452999       35.195999       18.787001
+  HB        29.476999       35.442001       18.379000
+  CG2       31.364000       34.752998       17.671000
+ HG21       32.289001       34.236000       17.955000
+ HG22       30.773001       34.207001       16.955000
+ HG23       31.653000       35.665001       17.153999
+  OG1       30.235001       34.054001       19.594999
+  HG1       31.093000       33.854000       19.992001
+  C         30.047001       36.977001       20.506001
+  O         29.285000       37.743000       20.035999
+  N         30.253000       36.742001       21.768999
+  H         30.906000       35.977001       21.885000
+  CA        29.332001       37.115002       22.844000
+  HA        29.813999       36.721001       23.724001
+  CB        29.301001       38.671001       22.987000
+  HB1       28.959999       39.235001       22.122999
+  HB2       28.541000       38.928001       23.728001
+  CG        30.681000       39.334999       23.312000
+  HG1       31.180000       38.900002       24.188999
+  HG2       31.409000       39.103001       22.554001
+  CD        30.569000       40.854000       23.479000
+  HD1       30.084000       41.277000       22.580999
+  HD2       29.945000       41.105999       24.330999
+  CE        31.915001       41.490002       23.684999
+  HE1       32.124001       41.375999       24.750999
+  HE2       32.723999       41.018002       23.136000
+  NZ        32.016998       42.893002       23.233999
+  HZ1       31.858999       42.966999       22.243999
+  HZ2       31.320000       43.479000       23.698000
+  HZ3       32.882999       43.278999       23.566000
+  C         27.947001       36.432999       22.620001
+  O         26.938999       37.138000       22.868000
+  N         27.896000       35.146000       22.289000
+  H         28.723000       34.618999       22.159000
+  CA        26.698000       34.359001       21.929001
+  HA        25.802999       34.945000       22.205999
+  CB        26.632999       34.030998       20.441000
+  HB        25.688000       33.533001       20.271999
+  CG2       26.760000       35.269001       19.482000
+ HG21       27.038000       34.959999       18.472000
+ HG22       25.844999       35.863998       19.459999
+ HG23       27.629000       35.931999       19.621000
+  OG1       27.681999       33.134998       20.105000
+  HG1       28.548000       33.589001       20.098000
+  C         26.584000       33.027000       22.743999
+  O         27.563000       32.659000       23.430000
+  N         25.388000       32.456001       22.750000
+  H         24.643999       32.842999       22.190001
+  CA        25.058001       31.167000       23.361000
+  HA        25.844000       30.879000       24.062000
+  CB        23.780001       31.284000       24.253000
+  HB1       22.962999       31.650999       23.636999
+  HB2       23.530001       30.254999       24.524000
+  CG        23.929001       32.153999       25.448999
+  CD1       24.917000       31.891001       26.438000
+  HD1       25.629999       31.143999       26.188999
+  CE1       24.830000       32.595001       27.705000
+  HE1       25.636999       32.394001       28.407000
+  CZ        23.862000       33.575001       27.896999
+  HZ        23.841999       34.111000       28.834999
+  CE2       22.983999       33.952000       26.802999
+  HE2       22.219999       34.712002       26.936001
+  CD2       22.903000       33.130001       25.624001
+  HD2       22.111000       33.318001       24.900999
+  C         24.947001       30.038000       22.356001
+  O         24.216000       30.195999       21.427999
+  N         25.598000       28.941999       22.584000
+  H         26.207001       28.931999       23.385000
+  CA        25.349001       27.676001       21.865999
+  HA        24.671000       27.948999       21.056999
+  CB        26.749001       27.289000       21.340000
+  HB        27.388000       26.997000       22.171000
+  CG2       26.705999       26.254999       20.212000
+ HG21       27.355000       26.475000       19.351999
+ HG22       26.914000       25.242001       20.533001
+ HG23       25.712000       26.202999       19.737000
+  OG1       27.393000       28.341999       20.601000
+  HG1       27.789000       28.841000       21.309000
+  C         24.922001       26.525999       22.726999
+  O         25.181000       26.426001       23.930000
+  N         24.118999       25.614000       22.136999
+  H         23.820000       25.702000       21.177000
+  CA        23.483000       24.503000       22.913000
+  HA        23.051001       24.987000       23.797001
+  CB        22.294001       24.003000       22.058001
+  HB        21.688000       23.301001       22.603001
+  CG1       21.327000       25.091999       21.551001
+ HG11       20.874001       25.617001       22.398001
+ HG12       21.827000       25.747000       20.832001
+ HG13       20.546000       24.577999       21.028999
+  CG2       22.784000       23.254000       20.782000
+ HG21       23.141001       22.271000       21.052999
+ HG22       21.929001       23.236000       20.098000
+ HG23       23.715000       23.697001       20.450001
+  C         24.502001       23.422001       23.357000
+  O         25.386999       22.961000       22.683001
+  N         24.287001       22.780001       24.538000
+  H         23.499001       23.054001       25.100000
+  CA        24.993000       21.486000       24.877001
+  HA        26.073000       21.452000       24.782000
+  CB        25.000999       21.395000       26.378000
+  HB        25.471001       20.450001       26.681999
+  CG2       25.735001       22.523001       27.118999
+ HG21       25.257999       23.504999       26.976999
+ HG22       25.697001       22.327000       28.200001
+ HG23       26.771999       22.646999       26.830999
+  OG1       23.750999       21.481001       26.987000
+  HG1       23.509001       22.400000       26.867001
+  C         24.464001       20.247000       24.259001
+  O         25.155001       19.209999       24.104000
+  N         23.216000       20.298000       23.764000
+  H         22.726000       21.122000       24.059000
+  CA        22.584999       19.313999       22.858000
+  HA        23.320000       19.025999       22.118999
+  CB        22.096001       18.084999       23.761999
+  HB1       21.372000       17.523001       23.155001
+  HB2       23.006001       17.582001       24.048000
+  CG        21.292999       18.393000       25.007999
+  HG1       21.900000       19.101999       25.566999
+  HG2       20.391001       18.969000       24.723000
+  CD        20.731001       17.247000       25.778000
+  OE1       21.452000       16.389000       26.348000
+  OE2       19.544001       16.923000       25.650000
+  C         21.327000       19.829000       22.055000
+  O         21.096001       19.187000       21.031000
+  N         20.468000       20.781000       22.559999
+  H         20.693001       21.243999       23.438999
+  CH3       19.399000       21.245001       21.722000
+ HH31       18.851999       21.969000       22.299999
+ HH32       18.773001       20.427999       21.362000
+ HH33       19.750000       21.917000       20.934000
+256
+ 100.0 100.0 100.0
+ HH31       17.465000       22.867001       24.410000
+  CH3       18.035000       23.754000       24.680000
+ HH32       17.884001       24.636000       24.027000
+ HH33       19.087000       23.475000       24.632000
+  C         17.702999       24.142000       26.105000
+  O         17.136999       25.162001       26.452999
+  N         17.975000       23.150999       26.870001
+  H         18.322001       22.292999       26.441000
+  CA        17.745001       23.105000       28.371000
+  HA1       16.839001       23.646000       28.636000
+  HA2       17.606001       22.082001       28.719000
+  C         18.905001       23.662001       29.245001
+  O         18.649000       23.912001       30.469999
+  N         20.080000       23.868000       28.650999
+  H         20.191000       23.570999       27.693001
+  CA        21.343000       24.289000       29.316000
+  HA        21.129000       24.989000       30.143000
+  CB        21.976999       23.028000       30.031000
+  HB1       22.104000       22.247000       29.283001
+  HB2       22.989000       23.254000       30.318001
+  CG        21.198999       22.481001       31.233000
+  HG1       20.951000       23.275999       31.938999
+  HG2       20.365999       21.888000       30.870001
+  CD        22.172001       21.570000       31.961000
+  OE1       22.400000       20.405001       31.472000
+  OE2       22.611000       21.950001       33.098000
+  C         22.316000       24.913000       28.306000
+  O         22.492001       24.308001       27.211000
+  N         22.958000       26.051001       28.618000
+  H         22.716000       26.495001       29.486000
+  CA        23.700001       26.892000       27.677000
+  HA        23.829000       26.362000       26.723000
+  CB        22.931999       28.195999       27.277000
+  HB1       22.788000       28.764999       28.194000
+  HB2       23.540001       28.777000       26.589001
+  CG        21.594000       28.039000       26.622000
+  CD1       20.415001       27.868000       27.298000
+  HD1       20.372000       27.827999       28.386000
+  NE1       19.407000       27.691999       26.334999
+  HE1       18.429001       27.679001       26.495001
+  CE2       19.870001       27.780001       24.995001
+  CZ2       19.316999       27.760000       23.686001
+  HZ2       18.264999       27.461000       23.575001
+  CH2       20.160999       28.163000       22.648001
+  HH2       19.802000       28.318001       21.635000
+  CZ3       21.500000       28.441000       22.851999
+  HZ3       22.138000       28.636000       22.000000
+  CE3       22.073999       28.289000       24.099001
+  HE3       23.132000       28.489000       24.253000
+  CD2       21.257000       28.016001       25.198999
+  C         25.131001       27.174000       28.148001
+  O         25.539000       27.235001       29.304001
+  N         25.910000       27.452000       27.111000
+  H         25.408001       27.589001       26.246000
+  CA        27.305000       27.841000       27.153000
+  HA        27.562000       28.122999       28.176001
+  CB        28.240999       26.707001       26.677999
+  HB        29.256001       26.947001       26.978001
+  CG2       27.878000       25.311001       27.302999
+ HG21       27.900999       25.396000       28.389000
+ HG22       26.910000       24.948999       26.940001
+ HG23       28.683001       24.631001       27.063000
+  OG1       28.181000       26.523001       25.291000
+  HG1       28.822001       27.188999       24.976999
+  C         27.520000       29.121000       26.424000
+  O         26.683001       29.577999       25.695000
+  N         28.594999       29.889999       26.743000
+  H         29.271000       29.643000       27.441000
+  CA        28.862000       31.223000       26.091999
+  HA        28.101999       31.448000       25.320000
+  CB        28.684000       32.292000       27.230000
+  HB1       27.701000       32.143002       27.653000
+  HB2       29.421000       32.080002       28.024000
+  CG        28.646999       33.741001       26.805000
+  CD1       29.709999       34.643002       27.163000
+  HD1       30.452999       34.299000       27.858999
+  CE1       29.559999       35.960999       26.819000
+  HE1       30.305000       36.693001       27.087000
+  CZ        28.422001       36.415001       26.084000
+  OH        28.340000       37.744999       25.767000
+  HH        29.035999       38.219002       26.233000
+  CE2       27.459000       35.522999       25.629999
+  HE2       26.621000       35.854000       25.003000
+  CD2       27.552000       34.187000       25.979000
+  HD2       26.714001       33.598000       25.643999
+  C         30.236000       31.212000       25.378000
+  O         31.142000       30.457001       25.723000
+  N         30.500999       32.127998       24.459000
+  H         29.752001       32.705002       24.139999
+  CA        31.833000       32.508999       23.962999
+  HA        32.578999       32.179001       24.672001
+  CB        32.030998       31.761000       22.600000
+  HB1       32.006001       30.691999       22.788000
+  HB2       31.174000       31.941999       21.930000
+  CG        33.331001       32.138000       21.792000
+  OD1       33.160999       32.638000       20.659000
+  OD2       34.424000       32.182999       22.367001
+  C         31.930000       34.002998       23.809000
+  O         31.391001       34.573002       22.881001
+  N         32.560001       34.709999       24.698000
+  H         32.883999       34.268002       25.549999
+  CA        32.736000       36.181000       24.636000
+  HA        31.697001       36.485001       24.684000
+  CB        33.575001       36.766998       25.802000
+  HB1       34.618999       36.507000       25.646999
+  HB2       33.571999       37.852001       25.664000
+  CG        33.176998       36.376999       27.267000
+  OD1       33.379002       35.158001       27.521999
+  OD2       32.962002       37.251999       28.087000
+  C         33.229000       36.764000       23.355000
+  O         32.756001       37.816002       22.844999
+  N         34.137001       35.991001       22.653999
+  H         34.448002       35.118000       23.077999
+  CA        34.694000       36.317001       21.332001
+  HA        35.143002       37.312000       21.403000
+  CB        35.877998       35.438000       21.024000
+  HB1       36.348000       35.512001       20.049999
+  HB2       36.640999       35.722000       21.731001
+  HB3       35.529999       34.407001       21.021999
+  C         33.738998       36.414001       20.187000
+  O         33.950001       37.199001       19.301001
+  N         32.598000       35.701000       20.211000
+  H         32.494999       34.870998       20.789000
+  CA        31.489000       35.786999       19.267000
+  HA        31.796000       36.443001       18.462000
+  CB        31.164000       34.429001       18.569000
+  HB        30.259001       34.477001       17.993000
+  CG2       32.345001       33.799000       17.733000
+ HG21       32.325001       32.723000       17.719000
+ HG22       32.195999       34.131001       16.712999
+ HG23       33.285000       34.081001       18.216000
+  OG1       30.909000       33.527000       19.649000
+  HG1       31.745001       33.207001       19.968000
+  C         30.125999       36.410999       19.745001
+  O         29.340000       36.758999       18.879999
+  N         29.983999       36.648998       21.039000
+  H         30.719999       36.275002       21.621000
+  CA        28.799000       37.056000       21.728001
+  HA        28.997000       37.113998       22.797001
+  CB        28.386999       38.574001       21.362000
+  HB1       28.056000       38.633999       20.323000
+  HB2       27.499001       38.966000       21.867001
+  CG        29.461000       39.659000       21.523001
+  HG1       30.318001       39.298000       20.934000
+  HG2       29.114000       40.598999       21.098000
+  CD        29.816999       40.007999       22.982000
+  HD1       28.882999       40.296001       23.462000
+  HD2       30.153999       39.106998       23.517000
+  CE        30.851000       41.112999       23.075001
+  HE1       30.660999       41.869999       22.327000
+  HE2       30.813999       41.643002       24.034000
+  NZ        32.164001       40.456001       22.881001
+  HZ1       33.022999       40.921001       23.164000
+  HZ2       32.205002       39.597000       23.392000
+  HZ3       32.360001       40.305000       21.893000
+  C         27.688999       35.959999       21.676001
+  O         26.566999       36.375000       21.983999
+  N         27.986000       34.714001       21.372000
+  H         28.945000       34.450001       21.186001
+  CA        26.959999       33.681999       21.054001
+  HA        26.077999       34.332001       20.931000
+  CB        27.250999       32.792000       19.844000
+  HB        26.471001       32.034000       19.819000
+  CG2       27.281000       33.601002       18.568001
+ HG21       26.243000       33.804001       18.337999
+ HG22       27.812000       34.539001       18.737000
+ HG23       27.771000       33.154999       17.723000
+  OG1       28.468000       32.174000       19.990000
+  HG1       29.146000       32.840000       19.874001
+  C         26.705999       32.813000       22.275000
+  O         27.611000       32.591999       23.033001
+  N         25.427999       32.382999       22.482000
+  H         24.882000       32.398998       21.636999
+  CA        25.153999       31.329000       23.431999
+  HA        25.917000       31.341999       24.216999
+  CB        23.858999       31.618999       24.214001
+  HB1       23.075001       32.033001       23.545000
+  HB2       23.297001       30.753000       24.540001
+  CG        23.892000       32.720001       25.232000
+  CD1       24.030001       32.431000       26.622999
+  HD1       24.097000       31.396000       26.958000
+  CE1       24.072001       33.462002       27.565001
+  HE1       23.973000       33.259998       28.632999
+  CZ        23.864000       34.759998       27.138000
+  HZ        23.917999       35.556999       27.850000
+  CE2       23.702000       35.109001       25.778000
+  HE2       23.656000       36.150002       25.462000
+  CD2       23.701000       34.056999       24.819000
+  HD2       23.639999       34.423000       23.798000
+  C         25.132000       30.004000       22.707001
+  O         24.617001       30.032000       21.604000
+  N         25.625999       28.878000       23.259001
+  H         26.082001       28.893999       24.153999
+  CA        25.528999       27.591999       22.542000
+  HA        24.752001       27.650000       21.774000
+  CB        26.851000       27.257000       21.830000
+  HB        27.546000       26.955000       22.612000
+  CG2       26.719999       26.034000       20.937000
+ HG21       26.105000       26.309999       20.073999
+ HG22       27.691000       25.665001       20.591999
+ HG23       26.353001       25.166000       21.480000
+  OG1       27.466000       28.214001       20.979000
+  HG1       27.698000       29.011000       21.466000
+  C         25.017000       26.502001       23.445999
+  O         25.253000       26.510000       24.615999
+  N         24.211000       25.558001       22.915001
+  H         24.162001       25.423000       21.917000
+  CA        23.544001       24.499001       23.680000
+  HA        23.172001       24.948000       24.608000
+  CB        22.393999       23.858999       22.951000
+  HB        22.077999       22.964001       23.507000
+  CG1       21.252001       24.916000       22.853001
+ HG11       20.392000       24.464001       22.350000
+ HG12       21.106001       25.233000       23.889000
+ HG13       21.599001       25.778999       22.292000
+  CG2       22.808001       23.459999       21.545000
+ HG21       22.684000       24.295000       20.874001
+ HG22       23.837999       23.094999       21.415001
+ HG23       22.195000       22.657000       21.167999
+  C         24.546000       23.440001       24.113001
+  O         25.517000       23.112000       23.340000
+  N         24.243999       22.787001       25.239000
+  H         23.671000       23.288000       25.899000
+  CA        25.114000       21.702000       25.764000
+  HA        26.146000       22.028000       25.910999
+  CB        24.688999       21.309000       27.150999
+  HB        25.270000       20.436001       27.443001
+  CG2       25.084999       22.348000       28.166000
+ HG21       24.806000       22.127001       29.184000
+ HG22       26.162001       22.440001       28.222000
+ HG23       24.791000       23.341000       27.818001
+  OG1       23.302000       21.031000       27.287001
+  HG1       23.221001       20.414000       28.018000
+  C         25.093000       20.375999       24.951000
+  O         25.999001       19.569000       25.025999
+  N         24.034000       20.183001       24.228001
+  H         23.285000       20.849001       24.408001
+  CA        23.697001       19.146999       23.254000
+  HA        24.238001       18.195000       23.372000
+  CB        22.216000       18.884001       23.339001
+  HB1       21.938999       18.108000       22.636000
+  HB2       21.979000       18.450001       24.305000
+  CG        21.280001       20.103001       23.132999
+  HG1       21.322001       20.608000       24.097000
+  HG2       21.563000       20.740000       22.296000
+  CD        19.899000       19.638000       22.813000
+  OE1       19.018999       19.666000       23.701000
+  OE2       19.584000       19.257000       21.643999
+  C         24.194000       19.565001       21.820999
+  O         23.872000       18.934999       20.798000
+  N         24.879000       20.705000       21.646000
+  H         25.197001       21.143000       22.488001
+  CH3       25.521999       21.034000       20.356001
+ HH31       26.065001       20.201000       19.936001
+ HH32       26.230000       21.847000       20.490000
+ HH33       24.757999       21.421000       19.650999
+256
+ 100.0 100.0 100.0
+ HH31       21.662001       15.337000       29.980000
+  CH3       20.861000       16.034000       29.716000
+ HH32       20.677999       16.533001       30.664000
+ HH33       20.056000       15.462000       29.268000
+  C         21.186001       17.204000       28.768999
+  O         20.469000       17.374001       27.806000
+  N         22.339001       17.864000       29.014000
+  H         22.980000       17.590000       29.759001
+  CA        22.731001       19.159000       28.299999
+  HA1       23.795000       19.298000       28.375000
+  HA2       22.500999       19.101999       27.235001
+  C         22.025000       20.400000       28.745001
+  O         20.895000       20.285999       29.214001
+  N         22.701000       21.579000       28.660999
+  H         23.650999       21.500000       28.393000
+  CA        22.240000       22.844000       29.201000
+  HA        21.146999       22.915001       29.198999
+  CB        22.792000       23.049000       30.577999
+  HB1       22.268999       23.870001       31.094999
+  HB2       22.517000       22.156000       31.143999
+  CG        24.225000       23.362000       30.684999
+  HG1       24.518999       24.231001       30.087999
+  HG2       24.445000       23.657000       31.712999
+  CD        25.121000       22.149000       30.349001
+  OE1       24.850000       21.021999       30.808001
+  OE2       26.028999       22.242001       29.471001
+  C         22.701000       23.959000       28.341999
+  O         23.245001       23.743000       27.313000
+  N         22.459000       25.237000       28.707001
+  H         22.059000       25.475000       29.608000
+  CA        22.624001       26.424000       27.872999
+  HA        23.131001       26.080999       26.955999
+  CB        21.246000       27.082001       27.646000
+  HB1       20.549999       26.353001       27.260000
+  HB2       20.820000       27.506001       28.577000
+  CG        21.223000       28.216999       26.660999
+  CD1       20.641001       28.117001       25.486000
+  HD1       20.221001       27.215000       25.076000
+  NE1       20.617001       29.362000       24.930000
+  HE1       20.135000       29.598000       24.073999
+  CE2       21.249001       30.334000       25.643999
+  CZ2       21.341000       31.726000       25.511999
+  HZ2       21.002001       32.237000       24.632999
+  CH2       22.098000       32.435001       26.427999
+  HH2       22.275000       33.477001       26.253000
+  CZ3       22.607000       31.825001       27.538000
+  HZ3       23.261000       32.387001       28.202000
+  CE3       22.365000       30.448000       27.766001
+  HE3       22.898001       30.004999       28.586000
+  CD2       21.663000       29.631001       26.802999
+  C         23.634001       27.410000       28.458000
+  O         23.457001       27.865999       29.556000
+  N         24.549999       27.905001       27.577000
+  H         24.539000       27.573999       26.632000
+  CA        25.538000       28.889000       27.962000
+  HA        25.106001       29.329000       28.864000
+  CB        26.872000       28.284000       28.459999
+  HB        27.482000       29.141001       28.707001
+  CG2       26.643999       27.665001       29.836000
+ HG21       26.330000       28.423000       30.555000
+ HG22       26.028000       26.766001       29.917999
+ HG23       27.636000       27.375000       30.181999
+  OG1       27.601000       27.452000       27.552999
+  HG1       27.164000       26.615000       27.523001
+  C         25.874001       29.872999       26.812000
+  O         25.768000       29.481001       25.677999
+  N         26.242001       31.112000       27.169001
+  H         26.371000       31.264999       28.162001
+  CA        26.816000       32.131001       26.202999
+  HA        26.641001       31.834999       25.177999
+  CB        25.948000       33.389000       26.409000
+  HB1       24.922001       33.056999       26.242001
+  HB2       26.009001       33.748001       27.427000
+  CG        26.365999       34.525002       25.544001
+  CD1       27.354000       35.396999       26.014999
+  HD1       28.017000       35.152000       26.839001
+  CE1       27.646000       36.551998       25.284000
+  HE1       28.298000       37.303001       25.664000
+  CZ        26.938999       36.856998       24.097000
+  OH        27.125999       38.067001       23.461000
+  HH        27.556000       38.724998       24.025999
+  CE2       26.070999       35.931000       23.542000
+  HE2       25.558001       36.265999       22.655001
+  CD2       25.754999       34.752998       24.238001
+  HD2       24.908001       34.123001       23.983999
+  C         28.325001       32.254002       26.590000
+  O         28.775000       32.096001       27.768000
+  N         29.118000       32.566002       25.497000
+  H         28.636999       32.698002       24.608999
+  CA        30.514999       32.930000       25.504999
+  HA        30.754000       32.945000       26.558001
+  CB        31.295000       31.825001       24.688000
+  HB1       31.167000       30.882000       25.207001
+  HB2       30.917000       31.757999       23.677000
+  CG        32.797001       32.231998       24.753000
+  OD1       33.284000       32.625999       25.832001
+  OD2       33.436001       32.317001       23.739000
+  C         30.695000       34.463001       25.056000
+  O         30.176001       34.841000       24.018000
+  N         31.423000       35.292000       25.775000
+  H         31.737000       34.966000       26.684000
+  CA        31.787001       36.719002       25.495001
+  HA        30.944000       37.189999       25.002001
+  CB        32.056999       37.539001       26.716999
+  HB1       31.225000       37.484001       27.424000
+  HB2       32.926998       37.151001       27.238001
+  CG        32.172001       39.032001       26.421000
+  OD1       32.845001       39.733002       27.242001
+  OD2       31.466000       39.449001       25.500999
+  C         32.922001       36.868000       24.464001
+  O         32.819000       37.721001       23.632999
+  N         33.893002       35.921001       24.535000
+  H         33.801998       35.176998       25.212999
+  CA        34.980999       35.861000       23.597000
+  HA        35.448002       36.821999       23.488001
+  CB        36.111000       34.974998       24.222000
+  HB1       36.798000       34.681000       23.429001
+  HB2       36.577000       35.667000       24.922001
+  HB3       35.719002       34.071999       24.673000
+  C         34.595001       35.222000       22.165001
+  O         35.460999       35.075001       21.295000
+  N         33.366001       34.778999       22.034000
+  H         32.771999       34.849998       22.841999
+  CA        32.787998       34.490002       20.629000
+  HA        33.519001       34.953999       19.947001
+  CB        32.910999       33.005001       20.362000
+  HB        32.539001       32.797001       19.350000
+  CG2       34.321999       32.452999       20.290001
+ HG21       34.303001       31.392000       20.000000
+ HG22       34.993000       32.890999       19.552999
+ HG23       34.777000       32.375000       21.297001
+  OG1       32.195000       32.299999       21.389999
+  HG1       32.654999       32.264000       22.229000
+  C         31.452999       35.133999       20.289000
+  O         30.987000       35.115002       19.148001
+  N         30.841999       35.761002       21.364000
+  H         31.355000       35.785999       22.226999
+  CA        29.504999       36.396999       21.305000
+  HA        29.296000       36.701000       22.309999
+  CB        29.530001       37.702000       20.583000
+  HB1       29.809000       37.570000       19.525000
+  HB2       28.523001       38.117001       20.608000
+  CG        30.552999       38.791000       21.020000
+  HG1       31.548000       38.338001       21.016001
+  HG2       30.622999       39.566002       20.256001
+  CD        30.344000       39.500999       22.393000
+  HD1       29.344000       39.938999       22.444000
+  HD2       30.368999       38.812000       23.226000
+  CE        31.143999       40.744999       22.725000
+  HE1       31.187000       41.319000       21.784000
+  HE2       30.545000       41.252998       23.472000
+  NZ        32.528999       40.403999       23.077999
+  HZ1       33.036999       40.074001       22.275999
+  HZ2       32.875999       41.314999       23.372999
+  HZ3       32.560001       39.723999       23.820000
+  C         28.336000       35.449001       20.830999
+  O         27.386999       35.841999       20.167999
+  N         28.513000       34.188999       21.128000
+  H         29.211000       33.905998       21.815001
+  CA        27.580000       33.138000       20.691999
+  HA        26.888000       33.514000       19.948999
+  CB        28.351000       31.892000       20.216000
+  HB        27.691000       31.039000       20.172001
+  CG2       28.868000       32.075001       18.812000
+ HG21       28.702000       31.051001       18.452999
+ HG22       28.150999       32.671001       18.214001
+ HG23       29.836000       32.578999       18.711000
+  OG1       29.441000       31.597000       21.066000
+  HG1       30.212999       31.992001       20.674999
+  C         26.759001       32.675999       21.882000
+  O         27.187000       32.659000       23.051001
+  N         25.606001       32.021999       21.518999
+  H         25.290001       32.060001       20.554001
+  CA        24.716000       31.250999       22.452000
+  HA        25.249001       31.225000       23.403000
+  CB        23.368999       31.941000       22.683001
+  HB1       22.677000       31.226000       23.117001
+  HB2       23.419001       32.714001       23.452000
+  CG        22.754999       32.638000       21.429001
+  CD1       22.832001       34.005001       21.246000
+  HD1       23.054001       34.639999       22.087999
+  CE1       22.646999       34.463001       19.950001
+  HE1       22.916000       35.478001       19.740000
+  CZ        22.056999       33.699001       18.952999
+  HZ        21.683001       34.189999       18.056999
+  CE2       21.782000       32.355000       19.274000
+  HE2       21.466999       31.816999       18.386999
+  CD2       22.169001       31.778000       20.471001
+  HD2       22.148001       30.702999       20.579000
+  C         24.580000       29.846001       21.950001
+  O         24.247000       29.700001       20.789000
+  N         24.954000       28.912001       22.836000
+  H         24.969999       29.167000       23.818001
+  CA        25.458000       27.554001       22.545000
+  HA        25.195999       27.339001       21.504999
+  CB        27.020000       27.437000       22.621000
+  HB        27.164000       26.438000       22.208000
+  CG2       27.799999       28.430000       21.663000
+ HG21       28.858000       28.278999       21.492001
+ HG22       27.284000       28.332001       20.691000
+ HG23       27.697001       29.440001       22.006001
+  OG1       27.618000       27.726999       23.874001
+  HG1       26.985001       28.264999       24.362000
+  C         24.822001       26.535000       23.497000
+  O         24.528999       26.739000       24.653999
+  N         24.568001       25.304001       23.066000
+  H         25.034000       24.969000       22.216999
+  CA        23.833000       24.237000       23.756001
+  HA        23.796000       24.444000       24.830000
+  CB        22.386000       24.264999       23.292000
+  HB        21.958000       23.464001       23.917000
+  CG1       21.673000       25.614000       23.624001
+ HG11       21.820999       25.931000       24.653000
+ HG12       21.966000       26.462000       23.028999
+ HG13       20.615000       25.615000       23.371000
+  CG2       22.104000       24.016001       21.775999
+ HG21       22.462000       24.937000       21.302999
+ HG22       22.754000       23.195999       21.476000
+ HG23       21.040001       23.812000       21.664000
+  C         24.558001       22.893000       23.641001
+  O         25.173000       22.530001       22.580000
+  N         24.608999       22.006001       24.679001
+  H         24.136000       22.357000       25.499001
+  CA        25.391001       20.725000       24.777000
+  HA        26.223000       20.760000       24.072001
+  CB        26.070999       20.605000       26.156000
+  HB        26.534000       19.642000       26.302999
+  CG2       27.271999       21.618000       26.336000
+ HG21       27.730000       21.621000       27.333000
+ HG22       28.018000       21.329000       25.600000
+ HG23       26.951000       22.641001       26.219000
+  OG1       25.280001       20.940001       27.281000
+  HG1       25.589001       21.677999       27.809999
+  C         24.531000       19.541000       24.424999
+  O         24.363001       18.594000       25.247999
+  N         24.028000       19.572001       23.186001
+  H         24.464001       20.350000       22.708000
+  CA        23.198000       18.518000       22.577000
+  HA        23.582001       17.528000       22.820000
+  CB        21.684000       18.667999       22.969000
+  HB1       21.083000       18.193001       22.207001
+  HB2       21.516001       18.264000       23.952999
+  CG        21.172001       20.146000       22.912001
+  HG1       21.655001       20.820000       23.622999
+  HG2       21.225000       20.613001       21.921000
+  CD        19.632000       20.253000       23.271000
+  OE1       19.271000       20.729000       24.327000
+  OE2       18.794001       19.777000       22.438999
+  C         23.333000       18.455999       21.049000
+  O         23.535999       19.521999       20.395000
+  N         23.209000       17.260000       20.433001
+  H         22.934999       16.511000       21.027000
+  CH3       23.129999       17.070000       18.961000
+ HH31       23.136999       17.989000       18.374001
+ HH32       22.274000       16.462999       18.721001
+ HH33       23.973000       16.514999       18.552000
+256
+ 100.0 100.0 100.0
+ HH31       17.886999       16.448000       27.833000
+  CH3       17.636999       17.520000       27.870001
+ HH32       17.059000       17.691999       28.773001
+ HH33       17.016001       17.743999       27.007999
+  C         18.837000       18.336000       28.080000
+  O         19.363001       18.289000       29.145000
+  N         19.364000       19.045000       27.084000
+  H         18.910999       18.929001       26.191999
+  CA        20.549999       19.879999       27.107000
+  HA1       21.459999       19.308001       27.330999
+  HA2       20.844000       20.291000       26.131001
+  C         20.478001       21.024000       28.047001
+  O         19.534000       21.306999       28.606001
+  N         21.548000       21.818001       27.934999
+  H         22.367001       21.465000       27.440001
+  CA        21.695999       23.129999       28.666000
+  HA        20.733000       23.584999       28.864000
+  CB        22.440001       22.773001       30.066999
+  HB1       22.332001       23.582001       30.796000
+  HB2       21.971001       21.872000       30.499001
+  CG        23.858000       22.382000       29.868999
+  HG1       23.983999       21.792999       28.958000
+  HG2       24.336000       23.358000       29.714001
+  CD        24.368999       21.622000       31.077999
+  OE1       25.186001       22.208000       31.830000
+  OE2       24.167000       20.427000       31.037001
+  C         22.478001       24.146000       27.906000
+  O         23.150000       23.841000       26.933001
+  N         22.320000       25.434999       28.326000
+  H         21.663000       25.500999       29.090000
+  CA        22.657000       26.712000       27.714001
+  HA        23.035999       26.478001       26.728001
+  CB        21.413000       27.531000       27.517000
+  HB1       20.580000       27.011999       27.052999
+  HB2       21.007999       27.825001       28.492001
+  CG        21.658001       28.722000       26.653000
+  CD1       21.271000       28.729000       25.371000
+  HD1       20.879999       27.921000       24.766001
+  NE1       21.410000       29.990999       24.884001
+  HE1       21.066999       30.346001       24.010000
+  CE2       21.937000       30.858000       25.778000
+  CZ2       22.295000       32.235001       25.761999
+  HZ2       22.084000       32.834999       24.893999
+  CH2       22.794001       32.810001       26.905001
+  HH2       22.962000       33.862999       26.945000
+  CZ3       23.024000       32.056000       28.080000
+  HZ3       23.348000       32.533001       28.995001
+  CE3       22.680000       30.691999       28.101000
+  HE3       22.740000       30.160999       29.047001
+  CD2       22.129000       30.082001       26.961000
+  C         23.868999       27.528999       28.325001
+  O         23.903000       27.667000       29.556999
+  N         24.754000       28.034000       27.450001
+  H         24.451000       28.143000       26.483999
+  CA        25.974001       28.705000       27.941000
+  HA        25.680000       29.270000       28.826000
+  CB        27.159000       27.632999       28.280001
+  HB        27.864000       28.205000       28.891001
+  CG2       26.858000       26.450001       29.204000
+ HG21       26.367001       25.677000       28.622000
+ HG22       27.791000       26.122000       29.684000
+ HG23       26.250000       26.664000       30.075001
+  OG1       27.816999       27.107000       27.221001
+  HG1       28.507000       27.742001       26.992001
+  C         26.559000       29.693001       26.990999
+  O         26.514999       29.569000       25.747999
+  N         27.004999       30.778999       27.566999
+  H         27.261999       30.740999       28.554001
+  CA        27.462999       32.019001       26.871000
+  HA        27.028999       31.979000       25.870001
+  CB        26.848000       33.264999       27.506001
+  HB1       25.768000       33.199001       27.327999
+  HB2       27.190001       33.240002       28.542999
+  CG        27.261999       34.646999       26.958000
+  CD1       28.146000       35.455002       27.632999
+  HD1       28.533001       35.063000       28.570999
+  CE1       28.566000       36.702000       27.207001
+  HE1       29.364000       37.217999       27.698999
+  CZ        28.141001       37.136002       25.910999
+  OH        28.469999       38.396000       25.545000
+  HH        29.236000       38.702000       26.059000
+  CE2       27.209000       36.338001       25.177999
+  HE2       26.980000       36.626999       24.152000
+  CD2       26.743999       35.076000       25.702999
+  HD2       26.018000       34.514999       25.124001
+  C         29.010000       32.165001       26.608999
+  O         29.858000       31.445000       27.111000
+  N         29.386000       32.949001       25.590000
+  H         28.701000       33.388000       24.987000
+  CA        30.851000       33.300999       25.405001
+  HA        31.301001       33.155998       26.378000
+  CB        31.516001       32.362000       24.410000
+  HB1       31.493000       31.339001       24.797001
+  HB2       30.882999       32.374001       23.510000
+  CG        32.905998       32.875000       23.978001
+  OD1       33.223000       32.963001       22.752001
+  OD2       33.806999       32.930000       24.905001
+  C         31.031000       34.723999       25.014999
+  O         30.510000       35.180000       23.945999
+  N         31.840000       35.480999       25.806000
+  H         32.143002       35.154999       26.718000
+  CA        32.117001       36.904999       25.551001
+  HA        31.159000       37.216000       25.110001
+  CB        32.442001       37.696999       26.757999
+  HB1       31.844000       37.456001       27.634001
+  HB2       33.466999       37.755001       27.125000
+  CG        31.979000       39.183998       26.478001
+  OD1       30.770000       39.448002       26.506001
+  OD2       32.901001       39.995998       26.413000
+  C         33.150002       37.139000       24.415001
+  O         32.973999       38.089001       23.629000
+  N         34.069000       36.193001       24.150000
+  H         33.963001       35.349998       24.695999
+  CA        35.150002       36.247002       23.225000
+  HA        35.743000       37.162998       23.334999
+  CB        36.176998       35.146000       23.521000
+  HB1       36.838001       35.047001       22.673000
+  HB2       36.623001       35.424000       24.479000
+  HB3       35.700001       34.178001       23.649000
+  C         34.622002       36.143002       21.740999
+  O         35.307999       36.585999       20.784000
+  N         33.431999       35.544998       21.466999
+  H         33.075001       34.936001       22.172001
+  CA        32.813999       35.506001       20.150999
+  HA        33.397999       36.195000       19.566000
+  CB        32.949001       34.118999       19.476999
+  HB        32.469002       34.148998       18.497000
+  CG2       34.397999       33.712002       19.230000
+ HG21       34.355000       32.910999       18.500999
+ HG22       35.042000       34.519001       18.892000
+ HG23       34.731998       33.285000       20.170000
+  OG1       32.359001       33.127998       20.278000
+  HG1       32.694000       33.159000       21.171000
+  C         31.354000       36.035999       20.155001
+  O         30.771999       36.175999       19.073999
+  N         30.819000       36.511002       21.257999
+  H         31.242001       36.355999       22.167999
+  CA        29.422001       37.039001       21.426001
+  HA        29.334999       37.175999       22.506001
+  CB        29.319000       38.431000       20.767000
+  HB1       29.378000       38.412998       19.679001
+  HB2       28.319000       38.794998       20.995001
+  CG        30.370001       39.355000       21.289000
+  HG1       31.382999       38.987000       21.120001
+  HG2       30.200001       40.240002       20.676001
+  CD        30.058001       39.771999       22.750999
+  HD1       28.996000       40.070000       22.837999
+  HD2       30.190001       38.874001       23.344000
+  CE        30.902000       40.890999       23.153000
+  HE1       31.943001       40.518002       23.174999
+  HE2       30.707001       41.706001       22.472000
+  NZ        30.426001       41.414001       24.451000
+  HZ1       31.091000       42.073002       24.837000
+  HZ2       29.593000       41.973000       24.551001
+  HZ3       30.309999       40.638000       25.093000
+  C         28.358000       36.015999       20.975000
+  O         27.566000       36.214001       20.011999
+  N         28.434999       34.848000       21.570999
+  H         29.049999       34.742001       22.367001
+  CA        27.562000       33.685001       21.214001
+  HA        26.742001       34.077000       20.638000
+  CB        28.368999       32.744999       20.309999
+  HB        27.702999       31.899000       20.131001
+  CG2       28.638000       33.437000       18.931999
+ HG21       27.679001       33.668999       18.466000
+ HG22       29.268999       34.280998       19.139000
+ HG23       29.094999       32.673000       18.313999
+  OG1       29.539000       32.284000       20.812000
+  HG1       30.266001       32.854000       20.577000
+  C         26.972000       32.923000       22.384001
+  O         27.521000       32.944000       23.441000
+  N         25.962999       32.084000       22.007999
+  H         25.865000       32.021999       21.007000
+  CA        25.403999       30.930000       22.757999
+  HA        25.906000       30.969000       23.731001
+  CB        23.889000       31.089001       22.895000
+  HB1       23.617001       30.223000       23.490999
+  HB2       23.729000       31.948000       23.549999
+  CG        23.031000       31.062000       21.667000
+  CD1       22.431000       32.248001       21.125000
+  HD1       22.554001       33.136002       21.705000
+  CE1       21.669001       32.299999       19.982000
+  HE1       21.177000       33.179001       19.583000
+  CZ        21.533001       31.052000       19.287001
+  HZ        20.934999       31.059000       18.386999
+  CE2       21.938999       29.825001       19.841999
+  HE2       21.673000       28.896999       19.379000
+  CD2       22.771999       29.850000       20.980000
+  HD2       23.201000       28.940001       21.399000
+  C         25.896999       29.643000       22.183001
+  O         26.080999       29.476999       20.976999
+  N         25.959999       28.620001       23.091999
+  H         25.971001       28.808001       24.070999
+  CA        26.261999       27.208000       22.680000
+  HA        26.077999       27.054001       21.604000
+  CB        27.768000       26.922001       22.948000
+  HB        27.993999       27.046000       23.986000
+  CG2       28.186001       25.521999       22.409000
+ HG21       27.702000       24.667999       22.915001
+ HG22       27.896000       25.436001       21.367001
+ HG23       29.280001       25.400999       22.483000
+  OG1       28.568001       27.728001       22.315001
+  HG1       28.482000       28.584999       22.747999
+  C         25.395000       26.250000       23.441000
+  O         25.070999       26.565001       24.632000
+  N         24.757999       25.218000       22.849001
+  H         25.002001       25.084999       21.892000
+  CA        23.830999       24.202999       23.441999
+  HA        23.827999       24.283001       24.521000
+  CB        22.398001       24.461000       23.034000
+  HB        21.877001       23.511999       23.152000
+  CG1       21.677999       25.534000       23.802999
+ HG11       21.445999       25.143999       24.788000
+ HG12       22.287001       26.436001       23.731001
+ HG13       20.702000       25.657000       23.362000
+  CG2       22.216000       24.761999       21.566999
+ HG21       21.171000       24.646999       21.256001
+ HG22       22.603001       25.714001       21.239000
+ HG23       22.774000       24.042000       20.950001
+  C         24.283001       22.764999       23.084999
+  O         24.275999       22.414000       21.964001
+  N         24.479000       21.902000       24.077000
+  H         24.421000       22.325001       25.011000
+  CA        24.857000       20.399000       23.965000
+  HA        25.766001       20.344999       23.358000
+  CB        24.993000       19.683001       25.313000
+  HB        24.937000       18.591999       25.308001
+  CG2       26.284000       20.070999       26.160999
+ HG21       26.103001       21.076000       26.535000
+ HG22       26.541000       19.339001       26.929001
+ HG23       27.165001       20.066999       25.496000
+  OG1       23.888000       20.103001       26.046000
+  HG1       23.966000       19.698000       26.914000
+  C         23.861000       19.577000       23.149000
+  O         24.201000       18.513000       22.552000
+  N         22.613001       20.083000       22.927000
+  H         22.277000       20.795000       23.591000
+  CA        21.573999       19.452999       22.023001
+  HA        21.900000       18.473000       21.660000
+  CB        20.421000       19.098000       22.924000
+  HB1       20.073999       19.976999       23.478001
+  HB2       19.594000       18.708000       22.323000
+  CG        20.723000       17.882000       23.851000
+  HG1       21.205000       17.117001       23.247999
+  HG2       21.367001       18.174999       24.684999
+  CD        19.469999       17.253000       24.382000
+  OE1       19.549000       16.103001       24.924000
+  OE2       18.408001       17.878000       24.290001
+  C         21.118999       20.205999       20.753000
+  O         20.164000       19.771999       20.061001
+  N         21.747999       21.363001       20.391001
+  H         22.556000       21.718000       20.891001
+  CH3       21.469000       22.047001       19.132999
+ HH31       22.375000       22.320999       18.615999
+ HH32       20.775999       22.879999       19.308001
+ HH33       21.098000       21.313999       18.417999
+256
+ 100.0 100.0 100.0
+ HH31       24.733000       17.898001       29.659000
+  CH3       24.452000       18.396000       28.732000
+ HH32       24.849001       17.715000       27.974001
+ HH33       24.965000       19.354000       28.670000
+  C         22.969000       18.635000       28.725000
+  O         22.274000       18.607000       29.781000
+  N         22.459999       18.916000       27.489000
+  H         23.103001       18.801001       26.731001
+  CA        21.139000       19.462999       27.219999
+  HA1       20.993000       19.355000       26.146999
+  HA2       20.459999       18.827999       27.792999
+  C         20.986000       20.922001       27.518999
+  O         20.018000       21.545000       27.117001
+  N         21.937000       21.503000       28.302999
+  H         22.652000       20.903999       28.712000
+  CA        21.875999       22.875000       28.879999
+  HA        20.823999       23.103001       28.978001
+  CB        22.490999       22.930000       30.322001
+  HB1       22.283001       23.941999       30.622999
+  HB2       21.829000       22.294001       30.936001
+  CG        23.952999       22.636000       30.528999
+  HG1       24.087000       21.563999       30.480000
+  HG2       24.382999       23.082001       29.620001
+  CD        24.664000       23.216999       31.731001
+  OE1       25.924999       23.066000       31.792000
+  OE2       24.062000       23.813000       32.638000
+  C         22.455000       23.982000       27.962999
+  O         23.288000       23.715000       27.105000
+  N         22.066999       25.257999       28.238001
+  H         21.582001       25.348000       29.114000
+  CA        22.514999       26.488001       27.599001
+  HA        22.579000       26.171000       26.551001
+  CB        21.296000       27.472000       27.627001
+  HB1       20.349001       26.957001       27.518999
+  HB2       21.292000       27.892000       28.624001
+  CG        21.295000       28.688000       26.698000
+  CD1       20.809999       28.739000       25.419001
+  HD1       20.245001       27.996000       24.898001
+  NE1       21.153000       29.927000       24.822001
+  HE1       20.910999       30.128000       23.862000
+  CE2       21.830000       30.771000       25.705000
+  CZ2       22.299999       32.084000       25.590000
+  HZ2       22.004999       32.647999       24.718000
+  CH2       22.936001       32.709999       26.669001
+  HH2       23.256001       33.729000       26.532000
+  CZ3       23.180000       31.929001       27.827000
+  HZ3       23.761999       32.296001       28.660000
+  CE3       22.704000       30.584000       27.972000
+  HE3       22.966000       30.039000       28.858000
+  CD2       21.937000       30.024000       26.900000
+  C         23.790001       27.049000       28.077000
+  O         23.979000       27.245001       29.250000
+  N         24.664000       27.459000       27.167999
+  H         24.493999       27.230000       26.198000
+  CA        25.944000       28.215000       27.511999
+  HA        25.858000       28.559000       28.531000
+  CB        27.127001       27.233999       27.625000
+  HB        28.094000       27.754999       27.599001
+  CG2       27.125999       26.485001       28.971001
+ HG21       28.070999       25.936001       28.988001
+ HG22       27.077999       27.235001       29.771000
+ HG23       26.226000       25.895000       29.132999
+  OG1       27.122000       26.291000       26.610001
+  HG1       26.299000       26.406000       26.128000
+  C         26.318001       29.334999       26.612000
+  O         25.931000       29.290001       25.406000
+  N         26.937000       30.419001       27.214001
+  H         27.208000       30.348000       28.184000
+  CA        27.393000       31.665001       26.514999
+  HA        26.924000       31.650999       25.537001
+  CB        26.936001       32.923000       27.348000
+  HB1       25.841000       32.842999       27.466000
+  HB2       27.365999       32.735001       28.327999
+  CG        27.353001       34.301998       26.784000
+  CD1       28.195000       35.095001       27.549999
+  HD1       28.518000       34.873001       28.552999
+  CE1       28.516001       36.407001       27.080999
+  HE1       29.082001       37.053001       27.733999
+  CZ        27.983999       36.919998       25.889000
+  OH        28.358999       38.113998       25.357000
+  HH        29.028999       38.589001       25.847000
+  CE2       27.202000       36.049999       25.077999
+  HE2       26.775999       36.417000       24.158001
+  CD2       26.856001       34.779999       25.548000
+  HD2       26.242001       34.161999       24.915001
+  C         28.908001       31.686001       26.368999
+  O         29.594999       30.900999       27.076000
+  N         29.541000       32.520000       25.540001
+  H         28.945999       33.144001       25.034000
+  CA        30.965000       32.807999       25.399000
+  HA        31.499001       32.728001       26.368000
+  CB        31.775000       31.896000       24.535999
+  HB1       32.002998       30.976000       25.030001
+  HB2       31.254999       31.729000       23.584000
+  CG        33.110001       32.515999       24.207001
+  OD1       33.905998       32.730999       25.113001
+  OD2       33.334000       32.654999       22.987000
+  C         31.105000       34.262001       24.892000
+  O         30.858000       34.618000       23.715000
+  N         31.629999       35.123001       25.740000
+  H         31.801001       34.918999       26.709999
+  CA        31.686001       36.534000       25.382000
+  HA        30.695000       36.832001       25.011000
+  CB        31.891001       37.368000       26.670000
+  HB1       31.207001       36.912998       27.393999
+  HB2       32.882000       37.275002       27.114000
+  CG        31.686001       38.876999       26.488001
+  OD1       30.497999       39.277000       26.441999
+  OD2       32.632999       39.618999       26.233999
+  C         32.693001       36.846001       24.339001
+  O         32.523998       37.744999       23.490999
+  N         33.800999       36.090000       24.323999
+  H         33.880001       35.432999       25.098000
+  CA        34.862999       36.185001       23.351000
+  HA        35.362000       37.127998       23.506001
+  CB        35.958000       35.210999       23.770000
+  HB1       35.625999       34.160000       23.805000
+  HB2       36.679001       35.311001       22.966000
+  HB3       36.372002       35.522999       24.739000
+  C         34.466999       35.936001       21.872999
+  O         35.224998       36.155998       20.940001
+  N         33.238998       35.365002       21.695999
+  H         32.812000       34.952000       22.509001
+  CA        32.587002       35.181000       20.334999
+  HA        33.251999       35.653000       19.600000
+  CB        32.472000       33.657001       19.893000
+  HB        31.891001       33.698002       18.981001
+  CG2       33.896999       33.044998       19.625000
+ HG21       34.542999       33.022999       20.490999
+ HG22       33.709000       32.033001       19.254000
+ HG23       34.313999       33.556000       18.770000
+  OG1       31.795000       32.990002       20.917999
+  HG1       32.449001       32.827999       21.584000
+  C         31.194000       35.888000       20.263000
+  O         30.659000       36.123001       19.143000
+  N         30.684000       36.381001       21.351999
+  H         31.156000       36.174000       22.226999
+  CA        29.305000       36.761002       21.459999
+  HA        29.184999       36.771000       22.552999
+  CB        28.923000       38.148998       20.962000
+  HB1       28.908001       38.033001       19.863001
+  HB2       27.922001       38.449001       21.261000
+  CG        29.847000       39.402000       21.191999
+  HG1       30.841999       39.118000       20.856001
+  HG2       29.415001       40.252998       20.653000
+  CD        29.893000       39.845001       22.681000
+  HD1       28.910000       40.095001       23.089001
+  HD2       30.285000       39.061001       23.325001
+  CE        30.825001       41.063999       22.917000
+  HE1       31.714001       40.983002       22.291000
+  HE2       30.344000       42.000999       22.671000
+  NZ        31.319000       41.192001       24.323000
+  HZ1       31.575001       40.334999       24.798000
+  HZ2       32.103001       41.823002       24.355000
+  HZ3       30.577000       41.567001       24.905001
+  C         28.257000       35.695999       21.091999
+  O         27.073999       36.021999       20.809000
+  N         28.570000       34.408001       21.002001
+  H         29.448000       34.092999       21.361000
+  CA        27.709999       33.388000       20.556999
+  HA        26.907000       33.828999       19.976999
+  CB        28.520000       32.305000       19.747999
+  HB        27.795000       31.548000       19.447001
+  CG2       28.986000       33.018002       18.510000
+ HG21       28.219999       33.407001       17.856001
+ HG22       29.559999       33.907001       18.740000
+ HG23       29.541000       32.311001       17.871000
+  OG1       29.524000       31.665001       20.492001
+  HG1       30.228001       32.300999       20.673000
+  C         26.987000       32.577000       21.724001
+  O         27.351999       32.762001       22.864000
+  N         25.985001       31.763000       21.419001
+  H         25.613001       31.841000       20.490999
+  CA        25.412001       30.754000       22.336000
+  HA        26.086000       30.739000       23.201000
+  CB        24.010000       31.070999       22.820000
+  HB1       23.674999       30.299999       23.518999
+  HB2       24.129999       32.029999       23.333000
+  CG        22.889000       31.415001       21.846001
+  CD1       22.771999       32.722000       21.333000
+  HD1       23.465000       33.449001       21.714001
+  CE1       21.705000       33.063999       20.549999
+  HE1       21.652000       34.113998       20.354000
+  CZ        20.819000       32.152000       20.070000
+  HZ        20.033001       32.436001       19.392000
+  CE2       20.902000       30.856001       20.548000
+  HE2       20.169001       30.180000       20.174999
+  CD2       21.929001       30.468000       21.473000
+  HD2       22.025999       29.465000       21.884001
+  C         25.471001       29.308001       21.680000
+  O         25.422001       29.070999       20.487000
+  N         25.547001       28.389999       22.624001
+  H         25.438999       28.750999       23.565001
+  CA        25.743999       26.962000       22.444000
+  HA        25.503000       26.646999       21.423000
+  CB        27.216999       26.635000       22.723000
+  HB        27.507000       27.037001       23.686001
+  CG2       27.459000       25.172001       22.698000
+ HG21       27.174000       24.802000       21.704000
+ HG22       28.525000       24.992001       22.799000
+ HG23       26.974001       24.705000       23.562000
+  OG1       28.183001       27.145000       21.778999
+  HG1       28.490999       27.962000       22.174000
+  C         24.840000       26.252001       23.396000
+  O         24.993999       26.368000       24.650000
+  N         23.921000       25.407000       22.864000
+  H         23.792000       25.363001       21.862000
+  CA        23.184999       24.448999       23.674000
+  HA        23.176001       24.722000       24.738001
+  CB        21.681000       24.237000       23.173000
+  HB        21.579000       23.358999       22.538000
+  CG1       20.811001       24.122999       24.396000
+ HG11       21.056000       23.201000       24.931999
+ HG12       20.853001       25.014000       25.046000
+ HG13       19.746000       24.146999       24.155001
+  CG2       21.216000       25.393000       22.268000
+ HG21       21.138000       26.372000       22.688999
+ HG22       21.896999       25.462999       21.410999
+ HG23       20.205999       25.216999       21.903999
+  C         23.813000       23.059999       23.599001
+  O         23.926001       22.535000       22.535999
+  N         24.299000       22.615999       24.763000
+  H         24.115999       23.039000       25.677999
+  CA        25.055000       21.367001       24.976000
+  HA        25.730000       21.396999       24.101999
+  CB        25.955999       21.405001       26.252001
+  HB        26.698999       20.606001       26.297001
+  CG2       26.799000       22.662001       26.341999
+ HG21       26.400000       23.490000       26.900000
+ HG22       27.726999       22.270000       26.746000
+ HG23       26.997000       23.023001       25.341000
+  OG1       25.091999       21.486000       27.341999
+  HG1       24.570999       22.270000       27.320999
+  C         24.242001       20.051001       24.921000
+  O         24.604000       18.999001       25.445000
+  N         23.042999       20.115000       24.253000
+  H         22.997999       20.992001       23.731001
+  CA        22.235001       18.993999       23.775000
+  HA        22.077999       18.368000       24.646999
+  CB        20.777000       19.410000       23.356001
+  HB1       20.219000       18.511000       23.118999
+  HB2       20.305000       19.875000       24.226999
+  CG        20.764000       20.438000       22.186001
+  HG1       20.070999       21.218000       22.458000
+  HG2       21.771999       20.841999       22.122000
+  CD        20.354000       19.847000       20.841999
+  OE1       21.136000       19.959000       19.878000
+  OE2       19.327000       19.124001       20.763000
+  C         22.938000       18.226999       22.639000
+  O         23.724001       18.790001       21.837999
+  N         22.670000       16.910000       22.429001
+  H         21.915001       16.459000       22.921000
+  CH3       23.198000       16.097000       21.344999
+ HH31       23.355000       15.066000       21.643999
+ HH32       24.146999       16.496000       20.975000
+ HH33       22.497999       16.171000       20.511999
diff --git a/regtest/scripts/run b/regtest/scripts/run
index a3d6c955a..c45c26ad1 100755
--- a/regtest/scripts/run
+++ b/regtest/scripts/run
@@ -138,6 +138,9 @@ case "$type" in
 (plumed)
   $mpi $valgrind $plumed $arg > out 2> err
   ;;
+(python)
+  python $arg > out 2> err
+  ;;
 (*) echo "unknown test type" ; exit 1 ;;
 esac
 
diff --git a/sourceme.sh.in b/sourceme.sh.in
index a98ab0889..53518dd2e 100644
--- a/sourceme.sh.in
+++ b/sourceme.sh.in
@@ -4,3 +4,4 @@ export LD_LIBRARY_PATH="@build_dir@/src/lib/:$LD_LIBRARY_PATH"
 export DYLD_LIBRARY_PATH="@build_dir@/src/lib/:$DYLD_LIBRARY_PATH"
 export PLUMED_KERNEL="@build_dir@/src/lib/libplumedKernel.@SOEXT@"
 export PLUMED_VIMPATH="@build_dir@/vim"
+export PYTHONPATH="@build_dir@/python:$PYTHONPATH"
diff --git a/src/.gitignore b/src/.gitignore
index ae3774508..17fcc4e5c 100644
--- a/src/.gitignore
+++ b/src/.gitignore
@@ -27,6 +27,7 @@
 !/manyrestraints
 !/molfile
 !/multicolvar
+!/python
 !/pamm
 !/reference
 !/secondarystructure
diff --git a/src/cltools/Info.cpp b/src/cltools/Info.cpp
index 3a8600abd..d23a0f1fb 100644
--- a/src/cltools/Info.cpp
+++ b/src/cltools/Info.cpp
@@ -72,6 +72,7 @@ void Info::registerKeywords( Keywords& keys ) {
   keys.addFlag("--version",false,"print the version number");
   keys.addFlag("--long-version",false,"print the version number (long version)");
   keys.addFlag("--git-version",false,"print the version number (git version, if available)");
+  keys.addFlag("--include-dir",false,"print the location of the include dir");
 }
 
 Info::Info(const CLToolOptions& co ):
@@ -89,8 +90,10 @@ int Info::main(FILE* in, FILE*out,Communicator& pc) {
   bool printversion; parseFlag("--version",printversion);
   bool printlongversion; parseFlag("--long-version",printlongversion);
   bool printgitversion; parseFlag("--git-version",printgitversion);
+  bool printincludedir; parseFlag("--include-dir",printincludedir);
   if(printroot) fprintf(out,"%s\n",config::getPlumedRoot().c_str());
   if(printconfiguration) fprintf(out,"%s",config::getMakefile().c_str());
+  if(printincludedir) fprintf(out,"%s\n",config::getPlumedIncludedir().c_str());
   if(printuserdoc) {
     std::string userdoc=config::getPlumedHtmldir()+"/user-doc/html/index.html";
     FILE *ff=std::fopen(userdoc.c_str(),"r");
diff --git a/src/core/DataFetchingObject.cpp b/src/core/DataFetchingObject.cpp
new file mode 100644
index 000000000..8cb51f349
--- /dev/null
+++ b/src/core/DataFetchingObject.cpp
@@ -0,0 +1,158 @@
+/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
+   Copyright (c) 2011-2015 The plumed team
+   (see the PEOPLE file at the root of the distribution for a list of names)
+
+   See http://www.plumed-code.org for more information.
+
+   This file is part of plumed, version 2.
+
+   plumed is free software: you can redistribute it and/or modify
+   it under the terms of the GNU Lesser General Public License as published by
+   the Free Software Foundation, either version 3 of the License, or
+   (at your option) any later version.
+
+   plumed is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU Lesser General Public License for more details.
+
+   You should have received a copy of the GNU Lesser General Public License
+   along with plumed.  If not, see <http://www.gnu.org/licenses/>.
++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */
+#include "DataFetchingObject.h"
+#include "PlumedMain.h"
+#include "ActionSet.h"
+#include "Action.h"
+#include "ActionWithValue.h"
+#include "Value.h"
+
+namespace PLMD {
+
+template <class T>
+class DataFetchingObjectTyped : public DataFetchingObject {
+private:
+/// A map containing the data we are grabbing
+  std::map<std::string,T*> data;
+public:
+  explicit DataFetchingObjectTyped(PlumedMain&plumed);
+  ~DataFetchingObjectTyped() {}
+  void setData( const std::string& key, const std::string& type, void* outval );
+  void finishDataGrab();
+};
+
+DataFetchingObject* DataFetchingObject::create(unsigned n, PlumedMain& p) {
+  if(n==sizeof(double)) {
+    return new DataFetchingObjectTyped<double>(p);
+  } else  if(n==sizeof(float)) {
+    return new DataFetchingObjectTyped<float>(p);
+  }
+  std::string pp; Tools::convert(n,pp);
+  plumed_merror("cannot create an MD interface with sizeof(real)=="+ pp);
+  return NULL;
+}
+
+DataFetchingObject::DataFetchingObject(PlumedMain&p):
+  plumed(p)
+{
+}
+
+bool DataFetchingObject::activate() const {
+  for(unsigned j=0; j<myactions.size(); ++j) myactions[j]->activate();
+  if( myactions.size()>0 ) return true;
+  return false;
+}
+
+ActionWithValue* DataFetchingObject::findAction( const ActionSet& a, const std::string& key ) {
+  std::string aname = key; std::size_t dot = key.find(".");
+  if( dot!=std::string::npos ) aname = key.substr(0,dot);
+  return a.selectWithLabel<ActionWithValue*>( aname );
+}
+
+void DataFetchingObject::get_rank( const ActionSet& a, const std::string& key, const std::string& type, long* dims ) {
+  plumed_assert( Tools::getWords(key,"\t\n ,").size()==1 );
+  plumed_massert( key.find("*")==std::string::npos, "cannot use wildcards in python interface");
+
+  // Find the appropriate action and store value containing quantity of interest
+  ActionWithValue* myv = findAction( a, key );
+  Value* val = myv->copyOutput( key );
+
+  // Now work out what we are returning for this action
+  if( type=="" ) {
+    // Return a single value in this case
+    dims[0]=1;
+  } else if( type=="derivatives" ) {
+    plumed_merror("not yet implemented");
+  } else if( type=="forces" ) {
+    plumed_merror("not yet implemented");
+  } else {
+    plumed_merror("invalid type specifier");
+  }
+}
+
+void DataFetchingObject::get_shape( const ActionSet& a, const std::string& key, const std::string& type, long* dims ) {
+  plumed_assert( Tools::getWords(key,"\t\n ,").size()==1 );
+  plumed_massert( key.find("*")==std::string::npos, "cannot use wildcards in python interface");
+
+  // Find the appropriate action and store value containing quantity of interest
+  ActionWithValue* myv = findAction( a, key );
+  Value* val = myv->copyOutput( key );
+
+  // Now work out what we are returning for this action
+  if( type=="" ) {
+    // Return a single value in this case
+    dims[0]=1;
+  } else if( type=="derivatives" ) {
+    plumed_merror("not yet implemented");
+  } else if( type=="forces" ) {
+    plumed_merror("not yet implemented");
+  } else {
+    plumed_merror("invalid type specifier");
+  }
+}
+
+template <class T>
+DataFetchingObjectTyped<T>::DataFetchingObjectTyped(PlumedMain&p):
+  DataFetchingObject(p)
+{
+}
+
+template <class T>
+void DataFetchingObjectTyped<T>::setData( const std::string& key, const std::string& type, void* outval ) {
+  plumed_assert( Tools::getWords(key,"\t\n ,").size()==1 );
+  plumed_massert( key.find("*")==std::string::npos, "cannot use wildcards in python interface");
+  plumed_massert( !data.count(key + " " + type), "already collecting this data elsewhere");
+  // Add the space to store the data to the data map
+  T* f=static_cast<T*>(outval);
+  data.insert(std::pair<std::string,T*>(key + " " + type,f));
+
+  // Find the appropriate action and store value containing quantity of interest
+  ActionWithValue* myv = DataFetchingObject::findAction( plumed.getActionSet(), key );
+  // Store the action if not already stored
+  bool found=false;
+  for(const auto & p : myactions) {
+    if( p->getLabel()==myv->getLabel() ) { found=true; break; }
+  }
+  if( !found ) myactions.push_back( myv );
+  // Store the value
+  myvalues.push_back( myv->copyOutput( key ) );
+}
+
+template <class T>
+void DataFetchingObjectTyped<T>::finishDataGrab() {
+  // Run over all values and collect data
+  for(const auto & p : myvalues ) {
+    T* val = static_cast<T*>( data.find(p->getName() + " ")->second );
+    if( data.find(p->getName() + " ")!=data.end() ) {
+      val[0] = static_cast<T>( p->get() );
+    }
+    if( data.find(p->getName() + " derivatives")!=data.end() ) {
+      plumed_merror("not implemented yet");
+    }
+    if( data.find(p->getName() + " forces")!=data.end() ) {
+      plumed_merror("not implemented yet");
+    }
+  }
+}
+
+}
+
diff --git a/src/core/DataFetchingObject.h b/src/core/DataFetchingObject.h
new file mode 100644
index 000000000..ab38eab93
--- /dev/null
+++ b/src/core/DataFetchingObject.h
@@ -0,0 +1,65 @@
+/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++
+   Copyright (c) 2011-2015 The plumed team
+   (see the PEOPLE file at the root of the distribution for a list of names)
+
+   See http://www.plumed-code.org for more information.
+
+   This file is part of plumed, version 2.
+
+   plumed is free software: you can redistribute it and/or modify
+   it under the terms of the GNU Lesser General Public License as published by
+   the Free Software Foundation, either version 3 of the License, or
+   (at your option) any later version.
+
+   plumed is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU Lesser General Public License for more details.
+
+   You should have received a copy of the GNU Lesser General Public License
+   along with plumed.  If not, see <http://www.gnu.org/licenses/>.
++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */
+#ifndef __PLUMED_core_DataFetchingObject_h
+#define __PLUMED_core_DataFetchingObject_h
+
+#include <string>
+#include <vector>
+#include <set>
+#include <map>
+
+namespace PLMD {
+
+class ActionSet;
+class PlumedMain;
+class ActionWithValue;
+class Value;
+
+class DataFetchingObject {
+protected:
+/// Pointers to the various actions required by the grabber
+  std::vector<ActionWithValue*> myactions;
+/// The values required by the user
+  std::vector<Value*> myvalues;
+/// A copy of the plumed main object
+  PlumedMain & plumed;
+public:
+  static DataFetchingObject* create(unsigned n, PlumedMain& p);
+/// A constructor so that we can create the plumed main object
+  explicit DataFetchingObject(PlumedMain&p);
+  virtual ~DataFetchingObject() {}
+///
+  bool activate() const ;
+/// Return the rank required for a particular key
+  static void get_rank( const ActionSet& a, const std::string& key, const std::string& type, long* rank );
+/// Return the shape required for a particular key
+  static void get_shape( const ActionSet& a, const std::string& key, const std::string& type, long* dims );
+/// Find the action that calculates a particular value
+  static ActionWithValue* findAction( const ActionSet& a, const std::string& key );
+/// Set the pointer to the data
+  virtual void setData( const std::string& key, const std::string& type, void* outval )=0;
+/// After calc has been performed grab all the data and put it in the relevant arrays
+  virtual void finishDataGrab()=0;
+};
+
+}
+#endif
diff --git a/src/core/PlumedMain.cpp b/src/core/PlumedMain.cpp
index 9a28cc0a0..f23f87d11 100644
--- a/src/core/PlumedMain.cpp
+++ b/src/core/PlumedMain.cpp
@@ -40,6 +40,7 @@
 #include "tools/OpenMP.h"
 #include "tools/Tools.h"
 #include "tools/Stopwatch.h"
+#include "DataFetchingObject.h"
 #include <cstdlib>
 #include <cstring>
 #include <set>
@@ -87,6 +88,7 @@ PlumedMain::PlumedMain():
 {
   log.link(comm);
   log.setLinePrefix("PLUMED: ");
+  mydatafetcher.reset(DataFetchingObject::create(sizeof(double),*this));
   stopwatch.start();
   stopwatch.pause();
 }
@@ -247,6 +249,21 @@ void PlumedMain::cmd(const std::string & word,void*val) {
       CHECK_INIT(initialized,word);
       atoms.clearFullList();
       break;
+    case cmd_getDataRank:
+      CHECK_INIT(initialized,words[0]); plumed_assert(nw==2 || nw==3);
+      if( nw==2 ) DataFetchingObject::get_rank( actionSet, words[1], "", static_cast<long*>(val) );
+      else DataFetchingObject::get_rank( actionSet, words[1], words[2], static_cast<long*>(val) );
+      break;
+    case cmd_getDataShape:
+      CHECK_INIT(initialized,words[0]); plumed_assert(nw==2 || nw==3);
+      if( nw==2 ) DataFetchingObject::get_shape( actionSet, words[1], "", static_cast<long*>(val) );
+      else DataFetchingObject::get_shape( actionSet, words[1], words[2], static_cast<long*>(val) );
+      break;
+    case cmd_setMemoryForData:
+      CHECK_INIT(initialized,words[0]); plumed_assert(nw==2 || nw==3);
+      if( nw==2 ) mydatafetcher->setData( words[1], "", val );
+      else mydatafetcher->setData( words[1], words[2], val );
+      break;
     case cmd_read:
       CHECK_INIT(initialized,word);
       if(val)readInputFile(static_cast<char*>(val));
@@ -274,6 +291,7 @@ void PlumedMain::cmd(const std::string & word,void*val) {
       CHECK_NOTINIT(initialized,word);
       CHECK_NOTNULL(val,word);
       atoms.setRealPrecision(*static_cast<int*>(val));
+      mydatafetcher.reset(DataFetchingObject::create(*static_cast<int*>(val),*this));
       break;
     case cmd_setMDLengthUnits:
       CHECK_NOTINIT(initialized,word);
@@ -586,7 +604,7 @@ void PlumedMain::prepareDependencies() {
   }
 
 // for optimization, an "active" flag remains false if no action at all is active
-  active=false;
+  active=mydatafetcher->activate();
   for(unsigned i=0; i<pilots.size(); ++i) {
     if(pilots[i]->onStep()) {
       pilots[i]->activate();
@@ -623,6 +641,7 @@ void PlumedMain::performCalc() {
   justCalculate();
   backwardPropagate();
   update();
+  mydatafetcher->finishDataGrab();
 }
 
 void PlumedMain::waitData() {
@@ -826,6 +845,10 @@ void PlumedMain::runJobsAtEndOfCalculation() {
   }
 }
 
+#ifdef __PLUMED_HAS_PYTHON
+// This is here to stop cppcheck throwing an error
+#endif
+
 }
 
 //////////////////////////////////////////////////////////////////////////////////////////////////////////////////
diff --git a/src/core/PlumedMain.h b/src/core/PlumedMain.h
index 35f4e130a..e19df3b24 100644
--- a/src/core/PlumedMain.h
+++ b/src/core/PlumedMain.h
@@ -63,6 +63,7 @@ class Stopwatch;
 class Citations;
 class ExchangePatterns;
 class FileBase;
+class DataFetchingObject;
 
 /**
 Main plumed object.
@@ -130,6 +131,9 @@ private:
 /// Name of the input file
   std::string plumedDat;
 
+/// Object containing data we would like to grab and pass back
+  std::unique_ptr<DataFetchingObject> mydatafetcher;
+
 /// End of input file.
 /// Set to true to terminate reading
   bool endPlumed;
diff --git a/src/lib/Makefile b/src/lib/Makefile
index a86e5ecde..b27f65adc 100644
--- a/src/lib/Makefile
+++ b/src/lib/Makefile
@@ -200,6 +200,12 @@ endif
 	if test -d ../../vim/syntax ; then mkdir -p "$(DESTDIR)$(libdir)/$(program_name)" && cd ../../ && tar cf - vim/syntax | tar xf - -C "$(DESTDIR)$(libdir)/$(program_name)/" ; fi
 	if test -d ../../vim/help ; then mkdir -p "$(DESTDIR)$(libdir)/$(program_name)" && cd ../../ && tar cf - vim/help | tar xf - -C "$(DESTDIR)$(libdir)/$(program_name)/" ; fi
 	if test -f ../../vim/scripts.vim ; then cp ../../vim/scripts.vim  "$(DESTDIR)$(libdir)/$(program_name)/vim/" ; fi
+# python installation (rebuild prior to installation so as to discover plumed in path)
+ifneq (,$(findstring __PLUMED_HAS_PYTHON,$(CPPFLAGS)))
+	cp -pr ../../python install 
+	cd install/python && rm -fr *.so plumed.cpp build && python buildPythonInterface.py build_ext -i
+	cp -pr install/python "$(DESTDIR)$(libdir)/$(program_name)/" 
+endif
 # making everything visible:
 	chmod -R go+rX,go-w "$(DESTDIR)$(libdir)/$(program_name)"
 	chmod -R go+rX,go-w "$(DESTDIR)$(includedir)/$(program_name)"
@@ -243,6 +249,11 @@ endif
 	@if test -d ../../vim/help ; then echo "- Set this environment variable         : PLUMED_VIMPATH=$(libdir)/$(program_name)/vim" ; fi
 	@if test -d ../../vim/help ; then echo "- Add the command 'let &runtimepath.=','.\$$PLUMED_VIMPATH' to your .vimrc file" ; fi
 	@if test -d ../../vim/help ; then echo "From vim, you can use :set syntax=$(program_name) to enable it" ; fi
+	@if test -d ../../python/build ; then echo "A python plugin can be found here: $(libdir)/$(program_name)/python/" ; fi
+	@if test -d ../../python/build ; then echo "To use PLUMED through python either : " ; fi
+	@if test -d ../../python/build ; then echo "- Add $(libdir)/$(program_name)/python/ to your PYTHONPATH" ; fi
+	@if test -d ../../python/build ; then echo "- Execute the command python buildPythonInterface.py install in the plumed2/python directory"; fi
+	@if test -d ../../python/build ; then echo "Plumed can be loaded in a python script using the command import plumed" ; fi
 ifeq ($(program_can_run),no)
 	@echo "WARNING: $(program_name) executable will not run on this machine"
 	@echo "WARNING: to patch an MD code use 'plumed-patch'"
diff --git a/src/lib/modulefile.in b/src/lib/modulefile.in
index 3f92600ad..3d84958d4 100644
--- a/src/lib/modulefile.in
+++ b/src/lib/modulefile.in
@@ -43,6 +43,7 @@ if { [module-info mode load] && [ info exists ::env(PLUMED_KERNEL) ] } {
 prepend-path  LIBRARY_PATH       $libdir
 prepend-path  LD_LIBRARY_PATH    $libdir
 prepend-path  DYLD_LIBRARY_PATH  $libdir
+prepend-path  PYTHONPATH         $libdir/$progname/python
 setenv        PLUMED_KERNEL      $libdir/lib${progname}Kernel.$soext
 setenv        PLUMED_VIMPATH     $libdir/$progname/vim
 }
-- 
GitLab