From 98650e1b0901605d79a06e8878825eeb0e7ca51a Mon Sep 17 00:00:00 2001 From: Gareth Tribello <gareth.tribello@gmail.com> Date: Sat, 16 Sep 2017 12:02:56 +0200 Subject: [PATCH] Python interface (#262) * Added first working python interface * Tidied up python interface * Further simplification of python * Added example which should be deleted later * Added functions for getting values from plumed to python * Added regression test for python interface * Added mechanism to return exceptions from plumed to python * First commit of experimental stuff to catch exceptions in python correctly * Got rid of unecessarily duplicated method in PlumedMain * Fixed crazy MAC input encoding * Oops, had also broken the script.. * Removed debug messages. Works on Ubuntu Linux Linus rules. Apple sucks. * Fixed PlumedMain passing of data from plumed to outside code * Hard coded real precision for python interface - this should have been with the last commit * Added first go at working makefile for python interface * Added options to configure to build python interface from makefile * Small changes to where loading of python interface is done * Removed unecessary wrapper c++ function from python interface * Made python install work in a way that is consistent with the rest of plumed * Added pythonpath to travis.yml * Added installation of Cython to travis.yml * Added ifdef block to stop cppcheck throwing an error * Using uniqu_ptr for DataFetching object in PlumedMain * Added install command for numpy to travis * Added string to tell me whether plumed+python is being built * Small change in travis.yml file to see if I can get python compile working * Compilers for cython are now specified from Makefile.conf * Now printing stuff on environment to try to work out why linking doesn't work * A new attempt to fix the travis-ci issues * Got rid of troubling TRAVIS_PYTHON_FLAG * Small change to see if we can get this to work on travis * Now setting LDSHARED from LDSO in makefile * Added something to print everything in the python path when we run the python test * Fixed python path in travis.yml * Removed stuff for debugging configuration on travis * Customized conda install (for python) in travis.yml so that osx version is installed for osx and linux version is installed for linux * Set TMPDIR in .travis.yml to hopefully get osx to compile PLUMED + Python * Made it so that python interface is rebuilt when user does make install so that correct paths are used * Made it so that python interface is rebuilt in staging area during install procedure * Corrected regtest script so that python tests are dealt with the same as everything else --- .travis.yml | 14 + Makefile | 3 +- configure | 105 + configure.ac | 10 + python/.gitignore | 9 + python/Makefile | 34 + python/buildPythonInterface.py | 79 + python/cplumed.pxd | 29 + python/plumed.pyx | 80 + regtest/.gitignore | 1 + regtest/python/Makefile | 2 + regtest/python/rt-protein/Makefile | 1 + regtest/python/rt-protein/colvar.ref | 75 + regtest/python/rt-protein/config | 4 + regtest/python/rt-protein/logfile.reference | 10 + regtest/python/rt-protein/python-script.py | 149 ++ regtest/python/rt-protein/template.pdb | 258 ++ regtest/python/rt-protein/traj.xyz | 2580 +++++++++++++++++++ regtest/scripts/run | 3 + sourceme.sh.in | 1 + src/.gitignore | 1 + src/cltools/Info.cpp | 3 + src/core/DataFetchingObject.cpp | 158 ++ src/core/DataFetchingObject.h | 65 + src/core/PlumedMain.cpp | 25 +- src/core/PlumedMain.h | 4 + src/lib/Makefile | 11 + src/lib/modulefile.in | 1 + 28 files changed, 3713 insertions(+), 2 deletions(-) create mode 100644 python/.gitignore create mode 100644 python/Makefile create mode 100644 python/buildPythonInterface.py create mode 100644 python/cplumed.pxd create mode 100644 python/plumed.pyx create mode 100644 regtest/python/Makefile create mode 100644 regtest/python/rt-protein/Makefile create mode 100644 regtest/python/rt-protein/colvar.ref create mode 100644 regtest/python/rt-protein/config create mode 100644 regtest/python/rt-protein/logfile.reference create mode 100644 regtest/python/rt-protein/python-script.py create mode 100644 regtest/python/rt-protein/template.pdb create mode 100644 regtest/python/rt-protein/traj.xyz create mode 100644 src/core/DataFetchingObject.cpp create mode 100644 src/core/DataFetchingObject.h diff --git a/.travis.yml b/.travis.yml index 94edbd1b9..605deb06b 100644 --- a/.travis.yml +++ b/.travis.yml @@ -92,6 +92,10 @@ install: - export INCLUDE="$HOME/opt/include:$INCLUDE" - export LIBRARY_PATH="$HOME/opt/lib:$LIBRARY_PATH" - export LD_LIBRARY_PATH="$HOME/opt/lib:$LD_LIBRARY_PATH" + - export PYTHONPATH="$HOME/opt/lib/plumed/python:$PYTHONPATH" +# Setting the TMPDIR in this way allegedly prevents problems with the compilation of +#Â PLUMED + Python on macos + - export TMPDIR="/tmp" # on travis, better dump stack trace in case there is an error - export PLUMED_STACK_TRACE=yes # build the manual, only if log contains string [makedoc] @@ -124,6 +128,16 @@ install: - if test "$MAKEDOC" == yes ; then sudo apt-get install -y doxygen-latex ; fi # install lcov - if test "$MAKEDOC" == yes ; then ./.travis/install.lcov v1.13 ; fi +# install numpy and cython for python interface + - if test "$TRAVIS_OS_NAME" == "linux" ; then wget https://repo.continuum.io/miniconda/Miniconda3-latest-Linux-x86_64.sh -O miniconda.sh ; fi + - if test "$TRAVIS_OS_NAME" == "osx" ; then wget https://repo.continuum.io/miniconda/Miniconda3-latest-MacOSX-x86_64.sh -O miniconda.sh ; fi + - bash miniconda.sh -b -p $HOME/miniconda + - export PATH="$HOME/miniconda/bin:$PATH" + - hash -r + - conda config --set always_yes yes --set changeps1 no + - conda update -q conda + - conda create -q -n test-environment python=3.6 numpy Cython + - source activate test-environment # then replace doxygen with the desided version # I use 1.8.10 instead of 1.8.11 since it looks like 1.8.11 have troubles with # non case sensitive files (it writes capitalized filenames) diff --git a/Makefile b/Makefile index 7be10652d..4aba51e10 100644 --- a/Makefile +++ b/Makefile @@ -8,7 +8,7 @@ endif SRCDIRS := src test -SUBDIRS := $(SRCDIRS) user-doc developer-doc regtest macports vim astyle +SUBDIRS := $(SRCDIRS) user-doc developer-doc regtest macports vim astyle python SUBDIRSCLEAN:=$(addsuffix .clean,$(SUBDIRS)) @@ -20,6 +20,7 @@ ifdef GCCDEP all: $(MAKE) lib $(MAKE) -C vim + $(MAKE) -C python # target useful for macports # it builds the code then the documentation diff --git a/configure b/configure index 3e7320705..971a7188e 100755 --- a/configure +++ b/configure @@ -632,6 +632,8 @@ doxygen make_doc readelf LD +cython +py OPENMP_CXXFLAGS EGREP GREP @@ -724,6 +726,7 @@ enable_xdrfile enable_boost_graph enable_boost_serialization enable_fftw +enable_python enable_openmp ' ac_precious_vars='build_alias @@ -1395,6 +1398,7 @@ Optional Features: --enable-boost_serialization enable search for boost serialization, default: no --enable-fftw enable search for fftw, default: no + --enable-python enable search for python, default: yes --disable-openmp do not use OpenMP Some influential environment variables: @@ -2957,6 +2961,24 @@ fi +python= +# Check whether --enable-python was given. +if test "${enable_python+set}" = set; then : + enableval=$enable_python; case "${enableval}" in + (yes) python=true ;; + (no) python=false ;; + (*) as_fn_error $? "wrong argument to --enable-python" "$LINENO" 5 ;; + esac +else + case "yes" in + (yes) python=true ;; + (no) python=false ;; + esac + +fi + + + @@ -7546,6 +7568,89 @@ fi fi +if test $python == true ; then + # Extract the first word of "python", so it can be a program name with args. +set dummy python; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_py+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$py"; then + ac_cv_prog_py="$py" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_py="found" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +py=$ac_cv_prog_py +if test -n "$py"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $py" >&5 +$as_echo "$py" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + # Extract the first word of "cython", so it can be a program name with args. +set dummy cython; ac_word=$2 +{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5 +$as_echo_n "checking for $ac_word... " >&6; } +if ${ac_cv_prog_cython+:} false; then : + $as_echo_n "(cached) " >&6 +else + if test -n "$cython"; then + ac_cv_prog_cython="$cython" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_cython="found" + $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done + done +IFS=$as_save_IFS + +fi +fi +cython=$ac_cv_prog_cython +if test -n "$cython"; then + { $as_echo "$as_me:${as_lineno-$LINENO}: result: $cython" >&5 +$as_echo "$cython" >&6; } +else + { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5 +$as_echo "no" >&6; } +fi + + + if test "$py" == found && test "$cython" == found ; then + $as_echo "#define __PLUMED_HAS_PYTHON 1" >>confdefs.h + + else + { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cannot enable python" >&5 +$as_echo "$as_me: WARNING: cannot enable python" >&2;} + fi +fi diff --git a/configure.ac b/configure.ac index 708bc405c..5b580c56c 100644 --- a/configure.ac +++ b/configure.ac @@ -249,6 +249,7 @@ PLUMED_CONFIG_ENABLE([xdrfile],[search for xdrfile],[yes]) PLUMED_CONFIG_ENABLE([boost_graph],[search for boost graph],[no]) PLUMED_CONFIG_ENABLE([boost_serialization],[search for boost serialization],[no]) PLUMED_CONFIG_ENABLE([fftw],[search for fftw],[no]) +PLUMED_CONFIG_ENABLE([python],[search for python],[yes]) AC_ARG_VAR(SOEXT,[extension of dynamic libraries (so/dylib)]) AC_ARG_VAR(STATIC_LIBS,[variables that should be linked statically directly to MD code - configure will add here -ldl if necessary ]) @@ -585,6 +586,15 @@ fi if test $zlib == true ; then PLUMED_CHECK_PACKAGE([zlib.h],[gzopen],[__PLUMED_HAS_ZLIB],[z]) fi +if test $python == true ; then + AC_CHECK_PROG([py],[python],[found]) + AC_CHECK_PROG([cython],[cython],[found]) + if test "$py" == found && test "$cython" == found ; then + AC_DEFINE([__PLUMED_HAS_PYTHON]) + else + AC_MSG_WARN([cannot enable python]) + fi +fi if test $gsl == true ; then found=ko diff --git a/python/.gitignore b/python/.gitignore new file mode 100644 index 000000000..bac163535 --- /dev/null +++ b/python/.gitignore @@ -0,0 +1,9 @@ +/* +# in this directory, only accept source, Makefile and README +!/.gitignore +!/*.pxd +!/*.py +!/*.pyx +!/Makefile +!/README +!/module.type diff --git a/python/Makefile b/python/Makefile new file mode 100644 index 000000000..0877e8893 --- /dev/null +++ b/python/Makefile @@ -0,0 +1,34 @@ +# include the machine dependent configuration +ifneq ($(MAKECMDGOALS),clean) + -include ../Makefile.conf +endif + +.PHONY: all clean install + +plumed_compiled := $(wildcard ../src/lib/plumed) + +ifeq ($(strip $(plumed_compiled)),) + +all: + @echo You must compile plumed before building the cython interface + +else + +ifneq (,$(findstring __PLUMED_HAS_PYTHON,$(CPPFLAGS))) + +all: + @echo Building python interface for PLUMED + python buildPythonInterface.py build_ext -i + +else + +all: + @echo Did not find __PLUMED_HAS_PYTHON + @echo $(CPPFLAGS) + +endif + +endif + +clean: + rm -fr *.so plumed.cpp build diff --git a/python/buildPythonInterface.py b/python/buildPythonInterface.py new file mode 100644 index 000000000..72e853f69 --- /dev/null +++ b/python/buildPythonInterface.py @@ -0,0 +1,79 @@ +#/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ +# Copyright (c) 2011-2016 The plumed team +# (see the PEOPLE file at the root of the distribution for a list of names) +# +# See http://www.plumed.org for more information. +# +# This file is part of plumed, version 2. +# +# plumed is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# plumed is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public License +# along with plumed. If not, see <http://www.gnu.org/licenses/>. +#+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */ +# +# This python routine builds an interface between plumed and python using cython +# +from distutils.core import setup +from distutils.extension import Extension +from Cython.Build import cythonize +import numpy +import subprocess +import os + +# Function for checking if PLUMED is in path +def is_exe(fpath): + return os.path.isfile(fpath) and os.access(fpath, os.X_OK) + +# Check if PLUMED is in PATH +plumedexe = '../src/lib/plumed' +for path in os.environ["PATH"].split(os.pathsep): + path = path.strip('"') + exe_file = os.path.join(path, 'plumed') + if is_exe(exe_file) : + plumedexe=exe_file + break + +#Â Get information on where plumed headers and libraries are installed and the version number +print( "Plumedexe is " + plumedexe ) +plumedroot = subprocess.check_output([plumedexe, 'info', '--root']).decode("utf-8").strip("\n") +print( "Creating interface for plumed version in " + plumedroot ) +plumedhead = subprocess.check_output([plumedexe, 'info', '--include-dir']).decode("utf-8").strip("\n") + "/plumed/wrapper/" +print( "Using headers in " + plumedhead ) +plumedversion = subprocess.check_output([plumedexe, 'info', '--version']).decode("utf-8") +print( "Version number for this plumed is " + plumedversion ) +# Get list containing all config variables so we can extract information on compilers to use during cython build +plumedconfig = subprocess.check_output([plumedexe, 'info', '--configuration']).decode("utf-8").split("\n") + +for line in plumedconfig : + if "CC=" in line : os.environ["CC"] = line.replace("CC=","").replace("\n","") + if "CXX=" in line : os.environ["CXX"] = line.replace("CXX=","").replace("\n","") + if "LDSO=" in line : os.environ["LDSHARED"] = line.replace("LDSO=","").replace("\n","") + +print( "Building interface using CC=" + os.environ["CC"] + " , CXX=" + os.environ["CXX"] + " and LDSHARED=" + os.environ["LDSHARED"] ) + +setup( + name='plumed', + version=plumedversion, + description='Python interface to PLUMED', + author='Gareth A. Tribello', + author_email='plumed-users@googlegroups.com', + url='http://www.plumed.org', + ext_modules = cythonize([ + Extension( name="plumed", + sources=["plumed.pyx"], + library_dirs=[plumedroot, plumedroot + "/src/lib/"], + libraries=["plumed"], + language="c++", + include_dirs=[plumedhead, numpy.get_include()] + ) + ]) +) diff --git a/python/cplumed.pxd b/python/cplumed.pxd new file mode 100644 index 000000000..e0f58c121 --- /dev/null +++ b/python/cplumed.pxd @@ -0,0 +1,29 @@ +#/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ +# Copyright (c) 2011-2016 The plumed team +# (see the PEOPLE file at the root of the distribution for a list of names) +# +# See http://www.plumed.org for more information. +# +# This file is part of plumed, version 2. +# +# plumed is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# plumed is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public License +# along with plumed. If not, see <http://www.gnu.org/licenses/>. +#+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */ +# +# This create cython wrappers to the main bits of the PLUMED libraray +# +cdef extern from "Plumed.h" : + ctypedef struct plumed: + pass + plumed plumed_create() + void plumed_cmd(plumed p, const char*key, const void*val) except + diff --git a/python/plumed.pyx b/python/plumed.pyx new file mode 100644 index 000000000..de2767157 --- /dev/null +++ b/python/plumed.pyx @@ -0,0 +1,80 @@ +#/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ +# Copyright (c) 2011-2016 The plumed team +# (see the PEOPLE file at the root of the distribution for a list of names) +# +# See http://www.plumed.org for more information. +# +# This file is part of plumed, version 2. +# +# plumed is free software: you can redistribute it and/or modify +# it under the terms of the GNU Lesser General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# plumed is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU Lesser General Public License for more details. +# +# You should have received a copy of the GNU Lesser General Public License +# along with plumed. If not, see <http://www.gnu.org/licenses/>. +#+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */ +# +# This is a cython wrapper for the main parts of the PLUMED interface - the constructor and cmd +# The main purpose of this is to convert the python types to C types that PLUMED understands +# + +cimport cplumed # This imports information from pxd file - including contents of this file here causes name clashes +import numpy as np +cimport numpy as np + +cdef class Plumed: + cdef cplumed.plumed c_plumed + def __cinit__(self): + self.c_plumed = cplumed.plumed_create() #new cplumed.Plumed() + cdef int pres = 8 + cplumed.plumed_cmd(self.c_plumed, "setRealPrecision", <void*>&pres ) + def __dealloc__(self): + pass + #del self.c_plumed + + def cmd_ndarray_real(self, ckey, val): + cdef double [:] abuffer = val.ravel() + cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&abuffer[0]) + def cmd_ndarray_int(self, ckey, val): + cdef long [:] abuffer = val.ravel() + cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&abuffer[0]) + cdef cmd_float(self, ckey, double val ): + cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&val ) + cdef cmd_int(self, ckey, int val): + cplumed.plumed_cmd(self.c_plumed, ckey, <void*>&val) + + def cmd( self, key, val=None ): + cdef bytes py_bytes = key.encode() + cdef char* ckey = py_bytes + cdef char* cval + cdef np.int_t[:] ibuffer + cdef np.float64_t[:] dbuffer + if val is None : + cplumed.plumed_cmd( self.c_plumed, ckey, NULL ) + elif isinstance(val, (int,long) ): + if key=="getDataRank" : + raise ValueError("when using cmd with getDataRank option value must a size one ndarray") + self.cmd_int(ckey, val) + elif isinstance(val, float ) : + if key=="getBias" : + raise ValueError("when using cmd with getBias option value must be a size one ndarray") + self.cmd_float(ckey, val) + elif isinstance(val, np.ndarray) : + if( val.dtype=="float64" ): + self.cmd_ndarray_real(ckey, val) + elif( val.dtype=="int64" ) : + self.cmd_ndarray_int(ckey, val) + else : + raise ValueError("ndarrys should be float64 or int64") + elif isinstance(val, basestring ) : + py_bytes = val.encode() + cval = py_bytes + cplumed.plumed_cmd( self.c_plumed, ckey, <void*>cval ) + else : + raise ValueError("Unknown value type ({})".format(str(type(val)))) diff --git a/regtest/.gitignore b/regtest/.gitignore index a19e9d680..6e747a7ce 100644 --- a/regtest/.gitignore +++ b/regtest/.gitignore @@ -12,6 +12,7 @@ !/drr !/mapping !/multicolvar +!/python !/secondarystructure !/trajectories !/scripts diff --git a/regtest/python/Makefile b/regtest/python/Makefile new file mode 100644 index 000000000..42480767a --- /dev/null +++ b/regtest/python/Makefile @@ -0,0 +1,2 @@ +include ../scripts/module.make + diff --git a/regtest/python/rt-protein/Makefile b/regtest/python/rt-protein/Makefile new file mode 100644 index 000000000..3703b27ce --- /dev/null +++ b/regtest/python/rt-protein/Makefile @@ -0,0 +1 @@ +include ../../scripts/test.make diff --git a/regtest/python/rt-protein/colvar.ref b/regtest/python/rt-protein/colvar.ref new file mode 100644 index 000000000..2749c8676 --- /dev/null +++ b/regtest/python/rt-protein/colvar.ref @@ -0,0 +1,75 @@ +#! FIELDS time t1 t2 t3 t4 t5 t6 t7 t8 t9 t10 t11 t12 t13 t14 t15 t16 t17 t18 t19 t20 t21 t22 t23 t24 t25 t26 t27 t28 t29 t30 t31 t32 +#! SET min_t1 -pi +#! SET max_t1 pi +#! SET min_t2 -pi +#! SET max_t2 pi +#! SET min_t3 -pi +#! SET max_t3 pi +#! SET min_t4 -pi +#! SET max_t4 pi +#! SET min_t5 -pi +#! SET max_t5 pi +#! SET min_t6 -pi +#! SET max_t6 pi +#! SET min_t7 -pi +#! SET max_t7 pi +#! SET min_t8 -pi +#! SET max_t8 pi +#! SET min_t9 -pi +#! SET max_t9 pi +#! SET min_t10 -pi +#! SET max_t10 pi +#! SET min_t11 -pi +#! SET max_t11 pi +#! SET min_t12 -pi +#! SET max_t12 pi +#! SET min_t13 -pi +#! SET max_t13 pi +#! SET min_t14 -pi +#! SET max_t14 pi +#! SET min_t15 -pi +#! SET max_t15 pi +#! SET min_t16 -pi +#! SET max_t16 pi +#! SET min_t17 -pi +#! SET max_t17 pi +#! SET min_t18 -pi +#! SET max_t18 pi +#! SET min_t19 -pi +#! SET max_t19 pi +#! SET min_t20 -pi +#! SET max_t20 pi +#! SET min_t21 -pi +#! SET max_t21 pi +#! SET min_t22 -pi +#! SET max_t22 pi +#! SET min_t23 -pi +#! SET max_t23 pi +#! SET min_t24 -pi +#! SET max_t24 pi +#! SET min_t25 -pi +#! SET max_t25 pi +#! SET min_t26 -pi +#! SET max_t26 pi +#! SET min_t27 -pi +#! SET max_t27 pi +#! SET min_t28 -pi +#! SET max_t28 pi +#! SET min_t29 -pi +#! SET max_t29 pi +#! SET min_t30 -pi +#! SET max_t30 pi +#! SET min_t31 -pi +#! SET max_t31 pi +#! SET min_t32 -pi +#! SET max_t32 pi + 0.000000 2.6673 -2.6079 -2.5276 2.5020 -1.3261 3.0525 -1.8084 -0.0736 -1.3280 2.6118 -2.0303 1.8183 -1.3815 -0.2169 -1.2568 -0.7685 -1.7450 -0.3744 1.2239 0.8575 -2.4660 2.6198 -1.8094 2.9244 -1.5597 2.8624 -1.1022 2.1081 -2.0835 0.6224 -2.1615 2.7653 + 1.000000 2.6673 -2.6079 -2.5276 2.5020 -1.3261 3.0525 -1.8084 -0.0736 -1.3280 2.6118 -2.0303 1.8183 -1.3815 -0.2169 -1.2568 -0.7685 -1.7450 -0.3744 1.2239 0.8575 -2.4660 2.6198 -1.8094 2.9244 -1.5597 2.8624 -1.1022 2.1081 -2.0835 0.6224 -2.1615 2.7653 + 2.000000 -0.9673 2.4119 -2.2418 2.7803 -2.3131 2.3876 -2.3286 2.3327 -1.4141 2.2393 -2.2142 2.2270 -0.9976 -0.3431 -1.0938 -0.3082 -2.2269 -0.2595 0.7807 0.4861 -2.3900 2.7449 -1.4376 2.1693 -2.3192 2.6746 -1.2204 2.4187 -1.4845 -0.1224 -2.6383 -0.5531 + 3.000000 -1.3798 2.7585 -2.3505 2.3231 -2.4228 2.7527 -2.5022 2.4132 -1.0556 2.2403 -2.4706 2.7123 -1.4820 0.2169 -1.1392 -0.7251 -2.1587 -0.0695 1.0791 0.9229 -2.8680 2.8393 -1.0979 2.0346 -2.1888 2.3545 -1.0655 2.3049 -1.3419 0.0942 -1.1673 2.3807 + 4.000000 1.2920 -0.7003 -2.5882 2.4760 -2.4540 2.3686 -1.4398 2.6403 -2.4205 2.0865 -1.3307 1.4736 -1.0424 -0.1993 -1.4950 -0.1059 -2.4983 -0.1105 1.0443 0.4840 -1.7222 2.4065 -1.7269 2.3143 -2.2191 2.3508 -1.1054 2.6893 -1.3528 -0.5495 -2.7595 2.9670 + 5.000000 1.8599 -3.1274 -1.3579 2.4524 -1.9912 2.8062 -2.0123 2.1368 -1.4832 2.4309 -2.0781 2.1238 -1.3223 -0.0961 -1.5850 -0.3327 -1.9738 -0.3105 1.0355 0.7932 -2.2536 2.8352 -1.7773 2.2652 -2.0858 2.6194 -1.2476 2.5713 -1.3721 -0.3135 -2.7986 -0.5437 + 6.000000 -1.5246 -0.2344 -2.7770 2.3525 -2.2150 2.7121 -2.1907 2.7251 -2.1034 2.8239 -2.4138 1.7869 -0.8552 -0.6065 -1.0890 -0.4862 -1.9182 -0.1710 1.1336 0.3106 -1.7386 2.5118 -1.6340 2.4873 -2.3121 2.5220 -1.2814 2.6471 -1.2469 -0.4013 -1.5424 0.0513 + 7.000000 1.3204 2.6070 -2.5673 -3.0655 -2.0904 2.3325 -2.5554 2.6183 -1.8992 2.6116 -1.9680 2.2707 -1.3625 -0.6381 -1.3566 -0.0505 -2.2325 -0.1415 0.9845 0.5160 -1.8538 2.8091 -2.1497 2.1461 -2.3947 2.5541 -2.3627 2.4673 -1.6932 1.0496 -2.6498 2.5858 + 8.000000 -1.0771 -3.0455 -2.5817 2.8269 -1.8861 2.3354 -2.7105 2.4447 -1.6689 2.7067 -2.4288 2.1654 -1.3553 -0.4675 -1.2710 -0.4276 -2.2087 0.0495 0.9547 0.9757 -2.3635 2.8981 -1.8110 2.6522 -2.4328 2.3552 -2.2381 2.1866 -1.0044 -0.3137 -2.0097 0.1108 + 9.000000 1.3122 -0.2812 -1.5467 2.8023 -1.4313 2.3505 -2.4359 2.5426 -1.8438 2.8783 -2.6368 1.9558 -1.2627 -0.5596 -1.0455 -0.2465 -2.1349 -0.1464 0.9422 0.2845 -1.7008 2.9339 -2.1567 2.6516 -2.4158 2.1019 -1.7146 2.0221 -1.2844 0.3707 -1.1716 2.6711 diff --git a/regtest/python/rt-protein/config b/regtest/python/rt-protein/config new file mode 100644 index 000000000..57dff95f9 --- /dev/null +++ b/regtest/python/rt-protein/config @@ -0,0 +1,4 @@ +plumed_needs=python +# this is to test a different name +arg="./python-script.py" +extra_files="../../trajectories/trajectory.xyz" diff --git a/regtest/python/rt-protein/logfile.reference b/regtest/python/rt-protein/logfile.reference new file mode 100644 index 000000000..c46dd449a --- /dev/null +++ b/regtest/python/rt-protein/logfile.reference @@ -0,0 +1,10 @@ +RUNNING ANALYSIS FOR STEP 0 +RUNNING ANALYSIS FOR STEP 1 +RUNNING ANALYSIS FOR STEP 2 +RUNNING ANALYSIS FOR STEP 3 +RUNNING ANALYSIS FOR STEP 4 +RUNNING ANALYSIS FOR STEP 5 +RUNNING ANALYSIS FOR STEP 6 +RUNNING ANALYSIS FOR STEP 7 +RUNNING ANALYSIS FOR STEP 8 +RUNNING ANALYSIS FOR STEP 9 diff --git a/regtest/python/rt-protein/python-script.py b/regtest/python/rt-protein/python-script.py new file mode 100644 index 000000000..88edd6abb --- /dev/null +++ b/regtest/python/rt-protein/python-script.py @@ -0,0 +1,149 @@ +# The numbers calculated by the following python script are compared with those output from this PLUMED input +# +# MOLINFO STRUCTURE=template.pdb +# t1: TORSION ATOMS=@phi-2 +# t2: TORSION ATOMS=@psi-2 +# t3: TORSION ATOMS=@phi-3 +# t4: TORSION ATOMS=@psi-3 +# t5: TORSION ATOMS=@phi-4 +# t6: TORSION ATOMS=@psi-4 +# t7: TORSION ATOMS=@phi-5 +# t8: TORSION ATOMS=@psi-5 +# t9: TORSION ATOMS=@phi-6 +# t10: TORSION ATOMS=@psi-6 +# t11: TORSION ATOMS=@phi-7 +# t12: TORSION ATOMS=@psi-7 +# t13: TORSION ATOMS=@phi-8 +# t14: TORSION ATOMS=@psi-8 +# t15: TORSION ATOMS=@phi-9 +# t16: TORSION ATOMS=@psi-9 +# t17: TORSION ATOMS=@phi-10 +# t18: TORSION ATOMS=@psi-10 +# t19: TORSION ATOMS=@phi-11 +# t20: TORSION ATOMS=@psi-11 +# t21: TORSION ATOMS=@phi-12 +# t22: TORSION ATOMS=@psi-12 +# t23: TORSION ATOMS=@phi-13 +# t24: TORSION ATOMS=@psi-13 +# t25: TORSION ATOMS=@phi-14 +# t26: TORSION ATOMS=@psi-14 +# t27: TORSION ATOMS=@phi-15 +# t28: TORSION ATOMS=@psi-15 +# t29: TORSION ATOMS=@phi-16 +# t30: TORSION ATOMS=@psi-16 +# t31: TORSION ATOMS=@phi-17 +# t32: TORSION ATOMS=@psi-17 +# +# PRINT ARG=t1,t2,t3,t4,t5,t6,t7,t8,t9,t10,t11,t12,t13,t14,t15,t16,t17,t18,t19,t20,t21,t22,t23,t24,t25,t26,t27,t28,t29,t30,t31,t32 FILE=colvar.ref FMT=%8.4f + +import numpy as np +import plumed + +def read_xyz(filename): + xyz = open(filename) + n_atoms = int(xyz.readline()) + title, trajectory = xyz.readline(), [] + while True : + atom_type, coordinates = np.zeros(n_atoms).astype(str), np.zeros([n_atoms,3]) + for i in range(0,n_atoms) : + line = xyz.readline() + atom,x,y,z = line.split() + atom_type[i]=atom + coordinates[i,:]=np.array([x,y,z],dtype=np.float64) + trajectory.append( coordinates ) + nextline = xyz.readline() + if( nextline=="" ) : break + c_atoms = int(nextline) + if( c_atoms!=n_atoms ) : break + title = xyz.readline() + xyz.close() + return trajectory + +def create_plumed_var( p, name, command ): + p.cmd("readInputLine", name + ": " + command ) + shape = np.zeros( 1, dtype=np.int_ ) + p.cmd("getDataRank " + name, shape ) + data = np.zeros((1)) + p.cmd("setMemoryForData " + name, data ) + return data + +# Output to four decimal places only +np.set_printoptions(precision=4) +# Read trajectory +traj = read_xyz("traj.xyz") +num_frames = len(traj) +num_atoms = traj[0].shape[0] + +# Create arrays for stuff +box=np.diag(12.41642*np.ones(3,dtype=np.float64)) +virial=np.zeros((3,3),dtype=np.float64) +masses=np.ones(num_atoms,dtype=np.float64) +forces=np.random.rand(num_atoms,3) +charges=np.zeros(num_atoms,dtype=np.float64) + +# Create PLUMED object and read input +p = plumed.Plumed() +p.cmd("setMDEngine","python") +p.cmd("setTimestep", 1.) +p.cmd("setKbT", 1.) +p.cmd("setNatoms",num_atoms) +p.cmd("setLogFile","test.log") +p.cmd("init") +p.cmd("readInputLine","MOLINFO STRUCTURE=template.pdb") +t1 = create_plumed_var( p, "t1", "TORSION ATOMS=@phi-2" ) +t2 = create_plumed_var( p, "t2", "TORSION ATOMS=@psi-2" ) +t3 = create_plumed_var( p, "t3", "TORSION ATOMS=@phi-3" ) +t4 = create_plumed_var( p, "t4", "TORSION ATOMS=@psi-3" ) +t5 = create_plumed_var( p, "t5", "TORSION ATOMS=@phi-4" ) +t6 = create_plumed_var( p, "t6", "TORSION ATOMS=@psi-4" ) +t7 = create_plumed_var( p, "t7", "TORSION ATOMS=@phi-5" ) +t8 = create_plumed_var( p, "t8", "TORSION ATOMS=@psi-5" ) +t9 = create_plumed_var( p, "t9", "TORSION ATOMS=@phi-6" ) +t10 = create_plumed_var( p, "t10", "TORSION ATOMS=@psi-6" ) +t11 = create_plumed_var( p, "t11", "TORSION ATOMS=@phi-7" ) +t12 = create_plumed_var( p, "t12", "TORSION ATOMS=@psi-7" ) +t13 = create_plumed_var( p, "t13", "TORSION ATOMS=@phi-8" ) +t14 = create_plumed_var( p, "t14", "TORSION ATOMS=@psi-8" ) +t15 = create_plumed_var( p, "t15", "TORSION ATOMS=@phi-9" ) +t16 = create_plumed_var( p, "t16", "TORSION ATOMS=@psi-9" ) +t17 = create_plumed_var( p, "t17", "TORSION ATOMS=@phi-10" ) +t18 = create_plumed_var( p, "t18", "TORSION ATOMS=@psi-10" ) +t19 = create_plumed_var( p, "t19", "TORSION ATOMS=@phi-11" ) +t20 = create_plumed_var( p, "t20", "TORSION ATOMS=@psi-11" ) +t21 = create_plumed_var( p, "t21", "TORSION ATOMS=@phi-12" ) +t22 = create_plumed_var( p, "t22", "TORSION ATOMS=@psi-12" ) +t23 = create_plumed_var( p, "t23", "TORSION ATOMS=@phi-13" ) +t24 = create_plumed_var( p, "t24", "TORSION ATOMS=@psi-13" ) +t25 = create_plumed_var( p, "t25", "TORSION ATOMS=@phi-14" ) +t26 = create_plumed_var( p, "t26", "TORSION ATOMS=@psi-14" ) +t27 = create_plumed_var( p, "t27", "TORSION ATOMS=@phi-15" ) +t28 = create_plumed_var( p, "t28", "TORSION ATOMS=@psi-15" ) +t29 = create_plumed_var( p, "t29", "TORSION ATOMS=@phi-16" ) +t30 = create_plumed_var( p, "t30", "TORSION ATOMS=@psi-16" ) +t31 = create_plumed_var( p, "t31", "TORSION ATOMS=@phi-17" ) +t32 = create_plumed_var( p, "t32", "TORSION ATOMS=@psi-17" ) + +# Read in the correct answers that were calculated directly using PLUMED +correct_torsions = np.loadtxt("colvar.ref") +# Open an output file +of = open("logfile", "w+") + +# Now analyze the trajectory +for step in range(0,num_frames) : + of.write("RUNNING ANALYSIS FOR STEP " + str(step) + "\n" ) + p.cmd("setStep",step ) + p.cmd("setBox",box ) + p.cmd("setMasses", masses ) + p.cmd("setCharges", charges ) + p.cmd("setPositions", traj[step]) + p.cmd("setForces", forces ) + p.cmd("setVirial", virial ) + p.cmd("calc") + bias = np.zeros((1),dtype=np.float64) + p.cmd("getBias", bias ) + variables = np.array([t1,t2,t3,t4,t5,t6,t7,t8,t9,t10,t11,t12,t13,t14,t15,t16,t17,t18,t19,t20,t21,t22,t23,t24,t25,t26,t27,t28,t29,t30,t31,t32]).ravel() + zeros = variables - correct_torsions[step,1:] + for data in zeros : + if abs(data)>1E-4 : of.write("MISMATCH BETWEEN VALUE FROM PLUMED AND VALUE FROM PYTHON") + +of.close() diff --git a/regtest/python/rt-protein/template.pdb b/regtest/python/rt-protein/template.pdb new file mode 100644 index 000000000..d6c5b487d --- /dev/null +++ b/regtest/python/rt-protein/template.pdb @@ -0,0 +1,258 @@ +CRYST1 54.082 55.003 54.078 90.00 90.00 90.00 P 1 1 +ATOM 1 HH31 ACE X 1 18.200 28.300 38.920 1.01 0.00 +ATOM 2 CH3 ACE X 1 19.200 28.640 38.660 12.01 0.00 +ATOM 3 HH32 ACE X 1 19.800 28.800 39.560 1.01 0.00 +ATOM 4 HH33 ACE X 1 19.260 29.480 37.940 1.01 0.00 +ATOM 5 C ACE X 1 19.940 27.420 38.000 12.01 0.00 +ATOM 6 O ACE X 1 19.260 26.460 37.780 16.00 0.00 +ATOM 7 N GLY X 2 21.180 27.540 37.660 14.01 0.00 +ATOM 8 H GLY X 2 21.620 28.380 38.000 1.01 0.00 +ATOM 9 CA GLY X 2 21.860 26.700 36.720 12.01 0.00 +ATOM 10 HA1 GLY X 2 22.220 25.740 37.100 1.01 0.00 +ATOM 11 HA2 GLY X 2 21.140 26.460 35.940 1.01 0.00 +ATOM 12 C GLY X 2 23.020 27.380 36.020 12.01 0.00 +ATOM 13 O GLY X 2 23.580 28.360 36.460 16.00 0.00 +ATOM 14 N GLU X 3 23.260 26.960 34.800 14.01 0.00 +ATOM 15 H GLU X 3 22.780 26.180 34.400 1.01 0.00 +ATOM 16 CA GLU X 3 24.380 27.480 33.960 12.01 0.00 +ATOM 17 HA GLU X 3 24.560 28.520 34.200 1.01 0.00 +ATOM 18 CB GLU X 3 25.580 26.560 34.280 12.01 0.00 +ATOM 19 HB1 GLU X 3 25.640 26.340 35.340 1.01 0.00 +ATOM 20 HB2 GLU X 3 25.400 25.620 33.760 1.01 0.00 +ATOM 21 CG GLU X 3 26.860 27.220 33.760 12.01 0.00 +ATOM 22 HG1 GLU X 3 26.740 27.400 32.700 1.01 0.00 +ATOM 23 HG2 GLU X 3 27.040 28.160 34.260 1.01 0.00 +ATOM 24 CD GLU X 3 28.020 26.240 33.960 12.01 0.00 +ATOM 25 OE1 GLU X 3 28.580 26.180 35.060 16.00 0.00 +ATOM 26 OE2 GLU X 3 28.340 25.460 33.100 16.00 0.00 +ATOM 27 C GLU X 3 23.920 27.520 32.500 12.01 0.00 +ATOM 28 O GLU X 3 23.320 26.540 32.080 16.00 0.00 +ATOM 29 N TRP X 4 24.300 28.520 31.640 14.01 0.00 +ATOM 30 H TRP X 4 24.900 29.220 32.060 1.01 0.00 +ATOM 31 CA TRP X 4 24.140 28.600 30.160 12.01 0.00 +ATOM 32 HA TRP X 4 23.180 28.120 29.920 1.01 0.00 +ATOM 33 CB TRP X 4 24.060 30.080 29.800 12.01 0.00 +ATOM 34 HB1 TRP X 4 25.040 30.580 29.760 1.01 0.00 +ATOM 35 HB2 TRP X 4 23.600 30.140 28.820 1.01 0.00 +ATOM 36 CG TRP X 4 23.100 30.900 30.600 12.01 0.00 +ATOM 37 CD1 TRP X 4 23.420 32.100 31.160 12.01 0.00 +ATOM 38 HD1 TRP X 4 24.400 32.520 30.980 1.01 0.00 +ATOM 39 NE1 TRP X 4 22.400 32.480 32.000 14.01 0.00 +ATOM 40 HE1 TRP X 4 22.340 33.380 32.460 1.01 0.00 +ATOM 41 CE2 TRP X 4 21.360 31.680 31.720 12.01 0.00 +ATOM 42 CZ2 TRP X 4 20.060 31.700 32.240 12.01 0.00 +ATOM 43 HZ2 TRP X 4 19.760 32.500 32.880 1.01 0.00 +ATOM 44 CH2 TRP X 4 19.160 30.740 31.760 12.01 0.00 +ATOM 45 HH2 TRP X 4 18.140 30.800 32.100 1.01 0.00 +ATOM 46 CZ3 TRP X 4 19.500 29.740 30.800 12.01 0.00 +ATOM 47 HZ3 TRP X 4 18.820 29.000 30.400 1.01 0.00 +ATOM 48 CE3 TRP X 4 20.820 29.720 30.340 12.01 0.00 +ATOM 49 HE3 TRP X 4 21.160 29.000 29.600 1.01 0.00 +ATOM 50 CD2 TRP X 4 21.800 30.640 30.880 12.01 0.00 +ATOM 51 C TRP X 4 25.140 27.720 29.320 12.01 0.00 +ATOM 52 O TRP X 4 26.160 27.320 29.800 16.00 0.00 +ATOM 53 N THR X 5 24.940 27.700 28.000 14.01 0.00 +ATOM 54 H THR X 5 24.020 27.860 27.640 1.01 0.00 +ATOM 55 CA THR X 5 25.960 27.380 26.960 12.01 0.00 +ATOM 56 HA THR X 5 26.800 26.860 27.420 1.01 0.00 +ATOM 57 CB THR X 5 25.340 26.340 26.040 12.01 0.00 +ATOM 58 HB THR X 5 26.020 26.080 25.220 1.01 0.00 +ATOM 59 CG2 THR X 5 25.080 25.000 26.720 12.01 0.00 +ATOM 60 HG21 THR X 5 24.820 24.320 25.900 1.01 0.00 +ATOM 61 HG22 THR X 5 26.040 24.740 27.160 1.01 0.00 +ATOM 62 HG23 THR X 5 24.300 25.140 27.480 1.01 0.00 +ATOM 63 OG1 THR X 5 24.100 26.780 25.600 16.00 0.00 +ATOM 64 HG1 THR X 5 23.880 26.680 24.660 1.01 0.00 +ATOM 65 C THR X 5 26.540 28.580 26.180 12.01 0.00 +ATOM 66 O THR X 5 27.360 28.340 25.280 16.00 0.00 +ATOM 67 N TYR X 6 26.080 29.800 26.380 14.01 0.00 +ATOM 68 H TYR X 6 25.280 29.900 26.980 1.01 0.00 +ATOM 69 CA TYR X 6 26.500 30.960 25.620 12.01 0.00 +ATOM 70 HA TYR X 6 26.640 30.580 24.600 1.01 0.00 +ATOM 71 CB TYR X 6 25.460 32.060 25.820 12.01 0.00 +ATOM 72 HB1 TYR X 6 24.540 31.620 25.440 1.01 0.00 +ATOM 73 HB2 TYR X 6 25.300 32.200 26.880 1.01 0.00 +ATOM 74 CG TYR X 6 25.720 33.340 25.140 12.01 0.00 +ATOM 75 CD1 TYR X 6 25.760 33.500 23.740 12.01 0.00 +ATOM 76 HD1 TYR X 6 25.560 32.600 23.180 1.01 0.00 +ATOM 77 CE1 TYR X 6 25.940 34.720 23.100 12.01 0.00 +ATOM 78 HE1 TYR X 6 25.860 34.780 22.020 1.01 0.00 +ATOM 79 CZ TYR X 6 26.200 35.860 23.860 12.01 0.00 +ATOM 80 OH TYR X 6 26.400 37.080 23.280 16.00 0.00 +ATOM 81 HH TYR X 6 25.940 37.060 22.420 1.01 0.00 +ATOM 82 CE2 TYR X 6 26.260 35.780 25.260 12.01 0.00 +ATOM 83 HE2 TYR X 6 26.440 36.640 25.880 1.01 0.00 +ATOM 84 CD2 TYR X 6 26.140 34.500 25.880 12.01 0.00 +ATOM 85 HD2 TYR X 6 26.100 34.400 26.960 1.01 0.00 +ATOM 86 C TYR X 6 27.900 31.380 26.120 12.01 0.00 +ATOM 87 O TYR X 6 28.260 31.300 27.280 16.00 0.00 +ATOM 88 N ASP X 7 28.680 31.960 25.180 14.01 0.00 +ATOM 89 H ASP X 7 28.300 32.020 24.240 1.01 0.00 +ATOM 90 CA ASP X 7 30.080 32.480 25.360 12.01 0.00 +ATOM 91 HA ASP X 7 30.400 32.400 26.400 1.01 0.00 +ATOM 92 CB ASP X 7 31.160 31.680 24.580 12.01 0.00 +ATOM 93 HB1 ASP X 7 31.220 30.620 24.880 1.01 0.00 +ATOM 94 HB2 ASP X 7 30.980 31.820 23.500 1.01 0.00 +ATOM 95 CG ASP X 7 32.600 32.180 24.860 12.01 0.00 +ATOM 96 OD1 ASP X 7 33.400 32.320 23.880 16.00 0.00 +ATOM 97 OD2 ASP X 7 32.920 32.600 26.040 16.00 0.00 +ATOM 98 C ASP X 7 30.140 33.980 25.140 12.01 0.00 +ATOM 99 O ASP X 7 30.320 34.360 24.000 16.00 0.00 +ATOM 100 N ASP X 8 30.240 34.740 26.200 14.01 0.00 +ATOM 101 H ASP X 8 30.200 34.460 27.180 1.01 0.00 +ATOM 102 CA ASP X 8 30.080 36.200 25.920 12.01 0.00 +ATOM 103 HA ASP X 8 29.280 36.320 25.200 1.01 0.00 +ATOM 104 CB ASP X 8 29.580 36.880 27.180 12.01 0.00 +ATOM 105 HB1 ASP X 8 28.700 36.380 27.580 1.01 0.00 +ATOM 106 HB2 ASP X 8 30.360 36.840 27.940 1.01 0.00 +ATOM 107 CG ASP X 8 29.180 38.320 26.840 12.01 0.00 +ATOM 108 OD1 ASP X 8 28.240 38.600 26.060 16.00 0.00 +ATOM 109 OD2 ASP X 8 29.720 39.240 27.440 16.00 0.00 +ATOM 110 C ASP X 8 31.360 36.920 25.320 12.01 0.00 +ATOM 111 O ASP X 8 31.160 37.960 24.680 16.00 0.00 +ATOM 112 N ALA X 9 32.520 36.240 25.360 14.01 0.00 +ATOM 113 H ALA X 9 32.560 35.340 25.800 1.01 0.00 +ATOM 114 CA ALA X 9 33.780 36.720 24.660 12.01 0.00 +ATOM 115 HA ALA X 9 34.020 37.740 24.940 1.01 0.00 +ATOM 116 CB ALA X 9 34.980 35.960 25.160 12.01 0.00 +ATOM 117 HB1 ALA X 9 35.940 36.240 24.720 1.01 0.00 +ATOM 118 HB2 ALA X 9 35.140 36.240 26.200 1.01 0.00 +ATOM 119 HB3 ALA X 9 34.740 34.900 25.060 1.01 0.00 +ATOM 120 C ALA X 9 33.680 36.580 23.200 12.01 0.00 +ATOM 121 O ALA X 9 34.000 37.540 22.500 16.00 0.00 +ATOM 122 N THR X 10 33.160 35.420 22.640 14.01 0.00 +ATOM 123 H THR X 10 33.000 34.680 23.320 1.01 0.00 +ATOM 124 CA THR X 10 33.080 35.080 21.220 12.01 0.00 +ATOM 125 HA THR X 10 33.800 35.620 20.600 1.01 0.00 +ATOM 126 CB THR X 10 33.400 33.580 21.020 12.01 0.00 +ATOM 127 HB THR X 10 32.520 33.080 21.400 1.01 0.00 +ATOM 128 CG2 THR X 10 33.520 33.060 19.640 12.01 0.00 +ATOM 129 HG21 THR X 10 32.720 33.300 18.960 1.01 0.00 +ATOM 130 HG22 THR X 10 34.360 33.540 19.160 1.01 0.00 +ATOM 131 HG23 THR X 10 33.640 31.980 19.820 1.01 0.00 +ATOM 132 OG1 THR X 10 34.600 33.280 21.740 16.00 0.00 +ATOM 133 HG1 THR X 10 34.240 32.800 22.480 1.01 0.00 +ATOM 134 C THR X 10 31.700 35.320 20.620 12.01 0.00 +ATOM 135 O THR X 10 31.680 35.500 19.420 16.00 0.00 +ATOM 136 N LYS X 11 30.620 35.380 21.380 14.01 0.00 +ATOM 137 H LYS X 11 30.780 35.260 22.380 1.01 0.00 +ATOM 138 CA LYS X 11 29.160 35.520 20.960 12.01 0.00 +ATOM 139 HA LYS X 11 28.620 35.520 21.900 1.01 0.00 +ATOM 140 CB LYS X 11 28.920 36.860 20.140 12.01 0.00 +ATOM 141 HB1 LYS X 11 29.340 36.700 19.140 1.01 0.00 +ATOM 142 HB2 LYS X 11 27.820 36.940 20.180 1.01 0.00 +ATOM 143 CG LYS X 11 29.500 38.100 20.680 12.01 0.00 +ATOM 144 HG1 LYS X 11 30.580 37.960 20.720 1.01 0.00 +ATOM 145 HG2 LYS X 11 29.240 38.960 20.060 1.01 0.00 +ATOM 146 CD LYS X 11 28.880 38.480 22.000 12.01 0.00 +ATOM 147 HD1 LYS X 11 27.840 38.740 21.820 1.01 0.00 +ATOM 148 HD2 LYS X 11 29.000 37.620 22.660 1.01 0.00 +ATOM 149 CE LYS X 11 29.660 39.640 22.660 12.01 0.00 +ATOM 150 HE1 LYS X 11 30.600 39.140 22.840 1.01 0.00 +ATOM 151 HE2 LYS X 11 29.800 40.460 21.980 1.01 0.00 +ATOM 152 NZ LYS X 11 29.140 40.020 23.960 14.01 0.00 +ATOM 153 HZ1 LYS X 11 28.200 40.380 23.980 1.01 0.00 +ATOM 154 HZ2 LYS X 11 29.180 39.300 24.680 1.01 0.00 +ATOM 155 HZ3 LYS X 11 29.740 40.720 24.400 1.01 0.00 +ATOM 156 C LYS X 11 28.560 34.300 20.280 12.01 0.00 +ATOM 157 O LYS X 11 27.860 34.400 19.260 16.00 0.00 +ATOM 158 N THR X 12 28.780 33.160 20.940 14.01 0.00 +ATOM 159 H THR X 12 29.380 33.160 21.760 1.01 0.00 +ATOM 160 CA THR X 12 28.480 31.820 20.360 12.01 0.00 +ATOM 161 HA THR X 12 27.660 32.000 19.660 1.01 0.00 +ATOM 162 CB THR X 12 29.660 31.240 19.640 12.01 0.00 +ATOM 163 HB THR X 12 29.480 30.240 19.240 1.01 0.00 +ATOM 164 CG2 THR X 12 29.980 32.180 18.440 12.01 0.00 +ATOM 165 HG21 THR X 12 30.820 31.800 17.860 1.01 0.00 +ATOM 166 HG22 THR X 12 29.200 32.340 17.720 1.01 0.00 +ATOM 167 HG23 THR X 12 30.340 33.100 18.900 1.01 0.00 +ATOM 168 OG1 THR X 12 30.820 31.160 20.440 16.00 0.00 +ATOM 169 HG1 THR X 12 31.440 30.500 20.060 1.01 0.00 +ATOM 170 C THR X 12 27.900 30.780 21.320 12.01 0.00 +ATOM 171 O THR X 12 28.200 30.740 22.460 16.00 0.00 +ATOM 172 N PHE X 13 27.120 29.920 20.760 14.01 0.00 +ATOM 173 H PHE X 13 26.940 29.940 19.760 1.01 0.00 +ATOM 174 CA PHE X 13 26.460 28.820 21.400 12.01 0.00 +ATOM 175 HA PHE X 13 26.440 28.900 22.480 1.01 0.00 +ATOM 176 CB PHE X 13 24.980 28.900 21.000 12.01 0.00 +ATOM 177 HB1 PHE X 13 24.900 28.780 19.920 1.01 0.00 +ATOM 178 HB2 PHE X 13 24.380 28.100 21.420 1.01 0.00 +ATOM 179 CG PHE X 13 24.260 30.140 21.420 12.01 0.00 +ATOM 180 CD1 PHE X 13 24.100 31.300 20.580 12.01 0.00 +ATOM 181 HD1 PHE X 13 24.740 31.300 19.720 1.01 0.00 +ATOM 182 CE1 PHE X 13 23.400 32.420 21.020 12.01 0.00 +ATOM 183 HE1 PHE X 13 23.580 33.380 20.560 1.01 0.00 +ATOM 184 CZ PHE X 13 22.780 32.320 22.220 12.01 0.00 +ATOM 185 HZ PHE X 13 22.280 33.200 22.600 1.01 0.00 +ATOM 186 CE2 PHE X 13 22.700 31.140 23.000 12.01 0.00 +ATOM 187 HE2 PHE X 13 22.300 31.140 24.000 1.01 0.00 +ATOM 188 CD2 PHE X 13 23.520 30.060 22.600 12.01 0.00 +ATOM 189 HD2 PHE X 13 23.520 29.100 23.080 1.01 0.00 +ATOM 190 C PHE X 13 27.040 27.400 21.180 12.01 0.00 +ATOM 191 O PHE X 13 27.840 27.200 20.280 16.00 0.00 +ATOM 192 N THR X 14 26.600 26.340 21.980 14.01 0.00 +ATOM 193 H THR X 14 25.780 26.360 22.560 1.01 0.00 +ATOM 194 CA THR X 14 27.100 24.900 21.680 12.01 0.00 +ATOM 195 HA THR X 14 28.140 24.900 21.340 1.01 0.00 +ATOM 196 CB THR X 14 27.120 23.960 22.920 12.01 0.00 +ATOM 197 HB THR X 14 27.240 22.900 22.680 1.01 0.00 +ATOM 198 CG2 THR X 14 28.240 24.340 23.960 12.01 0.00 +ATOM 199 HG21 THR X 14 28.300 23.660 24.820 1.01 0.00 +ATOM 200 HG22 THR X 14 29.200 24.180 23.480 1.01 0.00 +ATOM 201 HG23 THR X 14 28.220 25.360 24.340 1.01 0.00 +ATOM 202 OG1 THR X 14 25.880 24.100 23.580 16.00 0.00 +ATOM 203 HG1 THR X 14 26.080 23.480 24.300 1.01 0.00 +ATOM 204 C THR X 14 26.180 24.180 20.680 12.01 0.00 +ATOM 205 O THR X 14 25.140 24.720 20.380 16.00 0.00 +ATOM 206 N VAL X 15 26.560 23.080 20.040 14.01 0.00 +ATOM 207 H VAL X 15 27.480 22.740 20.280 1.01 0.00 +ATOM 208 CA VAL X 15 25.600 22.200 19.300 12.01 0.00 +ATOM 209 HA VAL X 15 25.120 22.800 18.520 1.01 0.00 +ATOM 210 CB VAL X 15 26.480 21.120 18.640 12.01 0.00 +ATOM 211 HB VAL X 15 27.060 20.520 19.340 1.01 0.00 +ATOM 212 CG1 VAL X 15 25.680 20.160 17.800 12.01 0.00 +ATOM 213 HG11 VAL X 15 25.300 19.340 18.400 1.01 0.00 +ATOM 214 HG12 VAL X 15 24.800 20.620 17.320 1.01 0.00 +ATOM 215 HG13 VAL X 15 26.320 19.700 17.060 1.01 0.00 +ATOM 216 CG2 VAL X 15 27.500 21.840 17.720 12.01 0.00 +ATOM 217 HG21 VAL X 15 28.260 22.400 18.260 1.01 0.00 +ATOM 218 HG22 VAL X 15 27.940 21.120 17.040 1.01 0.00 +ATOM 219 HG23 VAL X 15 27.020 22.580 17.060 1.01 0.00 +ATOM 220 C VAL X 15 24.540 21.560 20.240 12.01 0.00 +ATOM 221 O VAL X 15 24.900 20.840 21.120 16.00 0.00 +ATOM 222 N THR X 16 23.280 21.840 19.960 14.01 0.00 +ATOM 223 H THR X 16 23.140 22.480 19.200 1.01 0.00 +ATOM 224 CA THR X 16 22.120 21.280 20.660 12.01 0.00 +ATOM 225 HA THR X 16 22.520 20.560 21.380 1.01 0.00 +ATOM 226 CB THR X 16 21.380 22.280 21.540 12.01 0.00 +ATOM 227 HB THR X 16 20.500 21.800 21.980 1.01 0.00 +ATOM 228 CG2 THR X 16 22.060 22.840 22.780 12.01 0.00 +ATOM 229 HG21 THR X 16 22.980 23.400 22.580 1.01 0.00 +ATOM 230 HG22 THR X 16 21.440 23.640 23.180 1.01 0.00 +ATOM 231 HG23 THR X 16 22.200 22.080 23.560 1.01 0.00 +ATOM 232 OG1 THR X 16 20.960 23.380 20.840 16.00 0.00 +ATOM 233 HG1 THR X 16 20.040 23.520 21.100 1.01 0.00 +ATOM 234 C THR X 16 21.160 20.460 19.740 12.01 0.00 +ATOM 235 O THR X 16 19.920 20.460 19.880 16.00 0.00 +ATOM 236 N GLU X 17 21.740 19.760 18.780 14.01 0.00 +ATOM 237 H GLU X 17 22.740 19.620 18.820 1.01 0.00 +ATOM 238 CA GLU X 17 21.080 18.840 17.820 12.01 0.00 +ATOM 239 HA GLU X 17 20.040 18.660 18.080 1.01 0.00 +ATOM 240 CB GLU X 17 21.060 19.600 16.460 12.01 0.00 +ATOM 241 HB1 GLU X 17 22.120 19.740 16.240 1.01 0.00 +ATOM 242 HB2 GLU X 17 20.720 19.140 15.540 1.01 0.00 +ATOM 243 CG GLU X 17 20.260 20.940 16.520 12.01 0.00 +ATOM 244 HG1 GLU X 17 19.320 20.760 17.060 1.01 0.00 +ATOM 245 HG2 GLU X 17 20.900 21.620 17.080 1.01 0.00 +ATOM 246 CD GLU X 17 20.000 21.520 15.140 12.01 0.00 +ATOM 247 OE1 GLU X 17 20.780 22.260 14.580 16.00 0.00 +ATOM 248 OE2 GLU X 17 19.020 21.140 14.500 16.00 0.00 +ATOM 249 C GLU X 17 21.740 17.440 17.920 12.01 0.00 +ATOM 250 O GLU X 17 22.860 17.280 18.420 16.00 0.00 +ATOM 251 N NME X 18 21.020 16.380 17.480 14.01 0.00 +ATOM 252 H NME X 18 20.140 16.580 17.040 1.01 0.00 +ATOM 253 CH3 NME X 18 21.320 14.940 17.660 12.01 0.00 +ATOM 254 HH31 NME X 18 22.360 14.740 17.380 1.01 0.00 +ATOM 255 HH32 NME X 18 20.620 14.280 17.160 1.01 0.00 +ATOM 256 HH33 NME X 18 21.340 14.700 18.720 1.01 0.00 +END diff --git a/regtest/python/rt-protein/traj.xyz b/regtest/python/rt-protein/traj.xyz new file mode 100644 index 000000000..0ee888100 --- /dev/null +++ b/regtest/python/rt-protein/traj.xyz @@ -0,0 +1,2580 @@ +256 + 100.0 100.0 100.0 + HH31 18.200001 28.299999 38.919998 + CH3 19.200001 28.639999 38.660000 + HH32 19.799999 28.799999 39.560001 + HH33 19.260000 29.480000 37.939999 + C 19.940001 27.420000 38.000000 + O 19.260000 26.459999 37.779999 + N 21.180000 27.540001 37.660000 + H 21.620001 28.379999 38.000000 + CA 21.860001 26.700001 36.720001 + HA1 22.219999 25.740000 37.099998 + HA2 21.139999 26.459999 35.939999 + C 23.020000 27.379999 36.020000 + O 23.580000 28.360001 36.459999 + N 23.260000 26.959999 34.799999 + H 22.780001 26.180000 34.400002 + CA 24.379999 27.480000 33.959999 + HA 24.559999 28.520000 34.200001 + CB 25.580000 26.559999 34.279999 + HB1 25.639999 26.340000 35.340000 + HB2 25.400000 25.620001 33.759998 + CG 26.860001 27.219999 33.759998 + HG1 26.740000 27.400000 32.700001 + HG2 27.040001 28.160000 34.259998 + CD 28.020000 26.240000 33.959999 + OE1 28.580000 26.180000 35.060001 + OE2 28.340000 25.459999 33.099998 + C 23.920000 27.520000 32.500000 + O 23.320000 26.540001 32.080002 + N 24.299999 28.520000 31.639999 + H 24.900000 29.219999 32.060001 + CA 24.139999 28.600000 30.160000 + HA 23.180000 28.120001 29.920000 + CB 24.059999 30.080000 29.799999 + HB1 25.040001 30.580000 29.760000 + HB2 23.600000 30.139999 28.820000 + CG 23.100000 30.900000 30.600000 + CD1 23.420000 32.099998 31.160000 + HD1 24.400000 32.520000 30.980000 + NE1 22.400000 32.480000 32.000000 + HE1 22.340000 33.380001 32.459999 + CE2 21.360001 31.680000 31.719999 + CZ2 20.059999 31.700001 32.240002 + HZ2 19.760000 32.500000 32.880001 + CH2 19.160000 30.740000 31.760000 + HH2 18.139999 30.799999 32.099998 + CZ3 19.500000 29.740000 30.799999 + HZ3 18.820000 29.000000 30.400000 + CE3 20.820000 29.719999 30.340000 + HE3 21.160000 29.000000 29.600000 + CD2 21.799999 30.639999 30.879999 + C 25.139999 27.719999 29.320000 + O 26.160000 27.320000 29.799999 + N 24.940001 27.700001 28.000000 + H 24.020000 27.860001 27.639999 + CA 25.959999 27.379999 26.959999 + HA 26.799999 26.860001 27.420000 + CB 25.340000 26.340000 26.040001 + HB 26.020000 26.080000 25.219999 + CG2 25.080000 25.000000 26.719999 + HG21 24.820000 24.320000 25.900000 + HG22 26.040001 24.740000 27.160000 + HG23 24.299999 25.139999 27.480000 + OG1 24.100000 26.780001 25.600000 + HG1 23.879999 26.680000 24.660000 + C 26.540001 28.580000 26.180000 + O 27.360001 28.340000 25.280001 + N 26.080000 29.799999 26.379999 + H 25.280001 29.900000 26.980000 + CA 26.500000 30.959999 25.620001 + HA 26.639999 30.580000 24.600000 + CB 25.459999 32.060001 25.820000 + HB1 24.540001 31.620001 25.440001 + HB2 25.299999 32.200001 26.879999 + CG 25.719999 33.340000 25.139999 + CD1 25.760000 33.500000 23.740000 + HD1 25.559999 32.599998 23.180000 + CE1 25.940001 34.720001 23.100000 + HE1 25.860001 34.779999 22.020000 + CZ 26.200001 35.860001 23.860001 + OH 26.400000 37.080002 23.280001 + HH 25.940001 37.060001 22.420000 + CE2 26.260000 35.779999 25.260000 + HE2 26.440001 36.639999 25.879999 + CD2 26.139999 34.500000 25.879999 + HD2 26.100000 34.400002 26.959999 + C 27.900000 31.379999 26.120001 + O 28.260000 31.299999 27.280001 + N 28.680000 31.959999 25.180000 + H 28.299999 32.020000 24.240000 + CA 30.080000 32.480000 25.360001 + HA 30.400000 32.400002 26.400000 + CB 31.160000 31.680000 24.580000 + HB1 31.219999 30.620001 24.879999 + HB2 30.980000 31.820000 23.500000 + CG 32.599998 32.180000 24.860001 + OD1 33.400002 32.320000 23.879999 + OD2 32.919998 32.599998 26.040001 + C 30.139999 33.980000 25.139999 + O 30.320000 34.360001 24.000000 + N 30.240000 34.740002 26.200001 + H 30.200001 34.459999 27.180000 + CA 30.080000 36.200001 25.920000 + HA 29.280001 36.320000 25.200001 + CB 29.580000 36.880001 27.180000 + HB1 28.700001 36.380001 27.580000 + HB2 30.360001 36.840000 27.940001 + CG 29.180000 38.320000 26.840000 + OD1 28.240000 38.599998 26.059999 + OD2 29.719999 39.240002 27.440001 + C 31.360001 36.919998 25.320000 + O 31.160000 37.959999 24.680000 + N 32.520000 36.240002 25.360001 + H 32.560001 35.340000 25.799999 + CA 33.779999 36.720001 24.660000 + HA 34.020000 37.740002 24.940001 + CB 34.980000 35.959999 25.160000 + HB1 35.939999 36.240002 24.719999 + HB2 35.139999 36.240002 26.200001 + HB3 34.740002 34.900002 25.059999 + C 33.680000 36.580002 23.200001 + O 34.000000 37.540001 22.500000 + N 33.160000 35.419998 22.639999 + H 33.000000 34.680000 23.320000 + CA 33.080002 35.080002 21.219999 + HA 33.799999 35.619999 20.600000 + CB 33.400002 33.580002 21.020000 + HB 32.520000 33.080002 21.400000 + CG2 33.520000 33.060001 19.639999 + HG21 32.720001 33.299999 18.959999 + HG22 34.360001 33.540001 19.160000 + HG23 33.639999 31.980000 19.820000 + OG1 34.599998 33.279999 21.740000 + HG1 34.240002 32.799999 22.480000 + C 31.700001 35.320000 20.620001 + O 31.680000 35.500000 19.420000 + N 30.620001 35.380001 21.379999 + H 30.780001 35.259998 22.379999 + CA 29.160000 35.520000 20.959999 + HA 28.620001 35.520000 21.900000 + CB 28.920000 36.860001 20.139999 + HB1 29.340000 36.700001 19.139999 + HB2 27.820000 36.939999 20.180000 + CG 29.500000 38.099998 20.680000 + HG1 30.580000 37.959999 20.719999 + HG2 29.240000 38.959999 20.059999 + CD 28.879999 38.480000 22.000000 + HD1 27.840000 38.740002 21.820000 + HD2 29.000000 37.619999 22.660000 + CE 29.660000 39.639999 22.660000 + HE1 30.600000 39.139999 22.840000 + HE2 29.799999 40.459999 21.980000 + NZ 29.139999 40.020000 23.959999 + HZ1 28.200001 40.380001 23.980000 + HZ2 29.180000 39.299999 24.680000 + HZ3 29.740000 40.720001 24.400000 + C 28.559999 34.299999 20.280001 + O 27.860001 34.400002 19.260000 + N 28.780001 33.160000 20.940001 + H 29.379999 33.160000 21.760000 + CA 28.480000 31.820000 20.360001 + HA 27.660000 32.000000 19.660000 + CB 29.660000 31.240000 19.639999 + HB 29.480000 30.240000 19.240000 + CG2 29.980000 32.180000 18.440001 + HG21 30.820000 31.799999 17.860001 + HG22 29.200001 32.340000 17.719999 + HG23 30.340000 33.099998 18.900000 + OG1 30.820000 31.160000 20.440001 + HG1 31.440001 30.500000 20.059999 + C 27.900000 30.780001 21.320000 + O 28.200001 30.740000 22.459999 + N 27.120001 29.920000 20.760000 + H 26.940001 29.940001 19.760000 + CA 26.459999 28.820000 21.400000 + HA 26.440001 28.900000 22.480000 + CB 24.980000 28.900000 21.000000 + HB1 24.900000 28.780001 19.920000 + HB2 24.379999 28.100000 21.420000 + CG 24.260000 30.139999 21.420000 + CD1 24.100000 31.299999 20.580000 + HD1 24.740000 31.299999 19.719999 + CE1 23.400000 32.419998 21.020000 + HE1 23.580000 33.380001 20.559999 + CZ 22.780001 32.320000 22.219999 + HZ 22.280001 33.200001 22.600000 + CE2 22.700001 31.139999 23.000000 + HE2 22.299999 31.139999 24.000000 + CD2 23.520000 30.059999 22.600000 + HD2 23.520000 29.100000 23.080000 + C 27.040001 27.400000 21.180000 + O 27.840000 27.200001 20.280001 + N 26.600000 26.340000 21.980000 + H 25.780001 26.360001 22.559999 + CA 27.100000 24.900000 21.680000 + HA 28.139999 24.900000 21.340000 + CB 27.120001 23.959999 22.920000 + HB 27.240000 22.900000 22.680000 + CG2 28.240000 24.340000 23.959999 + HG21 28.299999 23.660000 24.820000 + HG22 29.200001 24.180000 23.480000 + HG23 28.219999 25.360001 24.340000 + OG1 25.879999 24.100000 23.580000 + HG1 26.080000 23.480000 24.299999 + C 26.180000 24.180000 20.680000 + O 25.139999 24.719999 20.379999 + N 26.559999 23.080000 20.040001 + H 27.480000 22.740000 20.280001 + CA 25.600000 22.200001 19.299999 + HA 25.120001 22.799999 18.520000 + CB 26.480000 21.120001 18.639999 + HB 27.059999 20.520000 19.340000 + CG1 25.680000 20.160000 17.799999 + HG11 25.299999 19.340000 18.400000 + HG12 24.799999 20.620001 17.320000 + HG13 26.320000 19.700001 17.059999 + CG2 27.500000 21.840000 17.719999 + HG21 28.260000 22.400000 18.260000 + HG22 27.940001 21.120001 17.040001 + HG23 27.020000 22.580000 17.059999 + C 24.540001 21.559999 20.240000 + O 24.900000 20.840000 21.120001 + N 23.280001 21.840000 19.959999 + H 23.139999 22.480000 19.200001 + CA 22.120001 21.280001 20.660000 + HA 22.520000 20.559999 21.379999 + CB 21.379999 22.280001 21.540001 + HB 20.500000 21.799999 21.980000 + CG2 22.059999 22.840000 22.780001 + HG21 22.980000 23.400000 22.580000 + HG22 21.440001 23.639999 23.180000 + HG23 22.200001 22.080000 23.559999 + OG1 20.959999 23.379999 20.840000 + HG1 20.040001 23.520000 21.100000 + C 21.160000 20.459999 19.740000 + O 19.920000 20.459999 19.879999 + N 21.740000 19.760000 18.780001 + H 22.740000 19.620001 18.820000 + CA 21.080000 18.840000 17.820000 + HA 20.040001 18.660000 18.080000 + CB 21.059999 19.600000 16.459999 + HB1 22.120001 19.740000 16.240000 + HB2 20.719999 19.139999 15.540000 + CG 20.260000 20.940001 16.520000 + HG1 19.320000 20.760000 17.059999 + HG2 20.900000 21.620001 17.080000 + CD 20.000000 21.520000 15.140000 + OE1 20.780001 22.260000 14.580000 + OE2 19.020000 21.139999 14.500000 + C 21.740000 17.440001 17.920000 + O 22.860001 17.280001 18.420000 + N 21.020000 16.379999 17.480000 + H 20.139999 16.580000 17.040001 + CH3 21.320000 14.940000 17.660000 + HH31 22.360001 14.740000 17.379999 + HH32 20.620001 14.280000 17.160000 + HH33 21.340000 14.700000 18.719999 +256 + 100.0 100.0 100.0 + HH31 18.200001 28.299999 38.919998 + CH3 19.200001 28.639999 38.660000 + HH32 19.799999 28.799999 39.560001 + HH33 19.260000 29.480000 37.939999 + C 19.940001 27.420000 38.000000 + O 19.260000 26.459999 37.779999 + N 21.180000 27.540001 37.660000 + H 21.620001 28.379999 38.000000 + CA 21.860001 26.700001 36.720001 + HA1 22.219999 25.740000 37.099998 + HA2 21.139999 26.459999 35.939999 + C 23.020000 27.379999 36.020000 + O 23.580000 28.360001 36.459999 + N 23.260000 26.959999 34.799999 + H 22.780001 26.180000 34.400002 + CA 24.379999 27.480000 33.959999 + HA 24.559999 28.520000 34.200001 + CB 25.580000 26.559999 34.279999 + HB1 25.639999 26.340000 35.340000 + HB2 25.400000 25.620001 33.759998 + CG 26.860001 27.219999 33.759998 + HG1 26.740000 27.400000 32.700001 + HG2 27.040001 28.160000 34.259998 + CD 28.020000 26.240000 33.959999 + OE1 28.580000 26.180000 35.060001 + OE2 28.340000 25.459999 33.099998 + C 23.920000 27.520000 32.500000 + O 23.320000 26.540001 32.080002 + N 24.299999 28.520000 31.639999 + H 24.900000 29.219999 32.060001 + CA 24.139999 28.600000 30.160000 + HA 23.180000 28.120001 29.920000 + CB 24.059999 30.080000 29.799999 + HB1 25.040001 30.580000 29.760000 + HB2 23.600000 30.139999 28.820000 + CG 23.100000 30.900000 30.600000 + CD1 23.420000 32.099998 31.160000 + HD1 24.400000 32.520000 30.980000 + NE1 22.400000 32.480000 32.000000 + HE1 22.340000 33.380001 32.459999 + CE2 21.360001 31.680000 31.719999 + CZ2 20.059999 31.700001 32.240002 + HZ2 19.760000 32.500000 32.880001 + CH2 19.160000 30.740000 31.760000 + HH2 18.139999 30.799999 32.099998 + CZ3 19.500000 29.740000 30.799999 + HZ3 18.820000 29.000000 30.400000 + CE3 20.820000 29.719999 30.340000 + HE3 21.160000 29.000000 29.600000 + CD2 21.799999 30.639999 30.879999 + C 25.139999 27.719999 29.320000 + O 26.160000 27.320000 29.799999 + N 24.940001 27.700001 28.000000 + H 24.020000 27.860001 27.639999 + CA 25.959999 27.379999 26.959999 + HA 26.799999 26.860001 27.420000 + CB 25.340000 26.340000 26.040001 + HB 26.020000 26.080000 25.219999 + CG2 25.080000 25.000000 26.719999 + HG21 24.820000 24.320000 25.900000 + HG22 26.040001 24.740000 27.160000 + HG23 24.299999 25.139999 27.480000 + OG1 24.100000 26.780001 25.600000 + HG1 23.879999 26.680000 24.660000 + C 26.540001 28.580000 26.180000 + O 27.360001 28.340000 25.280001 + N 26.080000 29.799999 26.379999 + H 25.280001 29.900000 26.980000 + CA 26.500000 30.959999 25.620001 + HA 26.639999 30.580000 24.600000 + CB 25.459999 32.060001 25.820000 + HB1 24.540001 31.620001 25.440001 + HB2 25.299999 32.200001 26.879999 + CG 25.719999 33.340000 25.139999 + CD1 25.760000 33.500000 23.740000 + HD1 25.559999 32.599998 23.180000 + CE1 25.940001 34.720001 23.100000 + HE1 25.860001 34.779999 22.020000 + CZ 26.200001 35.860001 23.860001 + OH 26.400000 37.080002 23.280001 + HH 25.940001 37.060001 22.420000 + CE2 26.260000 35.779999 25.260000 + HE2 26.440001 36.639999 25.879999 + CD2 26.139999 34.500000 25.879999 + HD2 26.100000 34.400002 26.959999 + C 27.900000 31.379999 26.120001 + O 28.260000 31.299999 27.280001 + N 28.680000 31.959999 25.180000 + H 28.299999 32.020000 24.240000 + CA 30.080000 32.480000 25.360001 + HA 30.400000 32.400002 26.400000 + CB 31.160000 31.680000 24.580000 + HB1 31.219999 30.620001 24.879999 + HB2 30.980000 31.820000 23.500000 + CG 32.599998 32.180000 24.860001 + OD1 33.400002 32.320000 23.879999 + OD2 32.919998 32.599998 26.040001 + C 30.139999 33.980000 25.139999 + O 30.320000 34.360001 24.000000 + N 30.240000 34.740002 26.200001 + H 30.200001 34.459999 27.180000 + CA 30.080000 36.200001 25.920000 + HA 29.280001 36.320000 25.200001 + CB 29.580000 36.880001 27.180000 + HB1 28.700001 36.380001 27.580000 + HB2 30.360001 36.840000 27.940001 + CG 29.180000 38.320000 26.840000 + OD1 28.240000 38.599998 26.059999 + OD2 29.719999 39.240002 27.440001 + C 31.360001 36.919998 25.320000 + O 31.160000 37.959999 24.680000 + N 32.520000 36.240002 25.360001 + H 32.560001 35.340000 25.799999 + CA 33.779999 36.720001 24.660000 + HA 34.020000 37.740002 24.940001 + CB 34.980000 35.959999 25.160000 + HB1 35.939999 36.240002 24.719999 + HB2 35.139999 36.240002 26.200001 + HB3 34.740002 34.900002 25.059999 + C 33.680000 36.580002 23.200001 + O 34.000000 37.540001 22.500000 + N 33.160000 35.419998 22.639999 + H 33.000000 34.680000 23.320000 + CA 33.080002 35.080002 21.219999 + HA 33.799999 35.619999 20.600000 + CB 33.400002 33.580002 21.020000 + HB 32.520000 33.080002 21.400000 + CG2 33.520000 33.060001 19.639999 + HG21 32.720001 33.299999 18.959999 + HG22 34.360001 33.540001 19.160000 + HG23 33.639999 31.980000 19.820000 + OG1 34.599998 33.279999 21.740000 + HG1 34.240002 32.799999 22.480000 + C 31.700001 35.320000 20.620001 + O 31.680000 35.500000 19.420000 + N 30.620001 35.380001 21.379999 + H 30.780001 35.259998 22.379999 + CA 29.160000 35.520000 20.959999 + HA 28.620001 35.520000 21.900000 + CB 28.920000 36.860001 20.139999 + HB1 29.340000 36.700001 19.139999 + HB2 27.820000 36.939999 20.180000 + CG 29.500000 38.099998 20.680000 + HG1 30.580000 37.959999 20.719999 + HG2 29.240000 38.959999 20.059999 + CD 28.879999 38.480000 22.000000 + HD1 27.840000 38.740002 21.820000 + HD2 29.000000 37.619999 22.660000 + CE 29.660000 39.639999 22.660000 + HE1 30.600000 39.139999 22.840000 + HE2 29.799999 40.459999 21.980000 + NZ 29.139999 40.020000 23.959999 + HZ1 28.200001 40.380001 23.980000 + HZ2 29.180000 39.299999 24.680000 + HZ3 29.740000 40.720001 24.400000 + C 28.559999 34.299999 20.280001 + O 27.860001 34.400002 19.260000 + N 28.780001 33.160000 20.940001 + H 29.379999 33.160000 21.760000 + CA 28.480000 31.820000 20.360001 + HA 27.660000 32.000000 19.660000 + CB 29.660000 31.240000 19.639999 + HB 29.480000 30.240000 19.240000 + CG2 29.980000 32.180000 18.440001 + HG21 30.820000 31.799999 17.860001 + HG22 29.200001 32.340000 17.719999 + HG23 30.340000 33.099998 18.900000 + OG1 30.820000 31.160000 20.440001 + HG1 31.440001 30.500000 20.059999 + C 27.900000 30.780001 21.320000 + O 28.200001 30.740000 22.459999 + N 27.120001 29.920000 20.760000 + H 26.940001 29.940001 19.760000 + CA 26.459999 28.820000 21.400000 + HA 26.440001 28.900000 22.480000 + CB 24.980000 28.900000 21.000000 + HB1 24.900000 28.780001 19.920000 + HB2 24.379999 28.100000 21.420000 + CG 24.260000 30.139999 21.420000 + CD1 24.100000 31.299999 20.580000 + HD1 24.740000 31.299999 19.719999 + CE1 23.400000 32.419998 21.020000 + HE1 23.580000 33.380001 20.559999 + CZ 22.780001 32.320000 22.219999 + HZ 22.280001 33.200001 22.600000 + CE2 22.700001 31.139999 23.000000 + HE2 22.299999 31.139999 24.000000 + CD2 23.520000 30.059999 22.600000 + HD2 23.520000 29.100000 23.080000 + C 27.040001 27.400000 21.180000 + O 27.840000 27.200001 20.280001 + N 26.600000 26.340000 21.980000 + H 25.780001 26.360001 22.559999 + CA 27.100000 24.900000 21.680000 + HA 28.139999 24.900000 21.340000 + CB 27.120001 23.959999 22.920000 + HB 27.240000 22.900000 22.680000 + CG2 28.240000 24.340000 23.959999 + HG21 28.299999 23.660000 24.820000 + HG22 29.200001 24.180000 23.480000 + HG23 28.219999 25.360001 24.340000 + OG1 25.879999 24.100000 23.580000 + HG1 26.080000 23.480000 24.299999 + C 26.180000 24.180000 20.680000 + O 25.139999 24.719999 20.379999 + N 26.559999 23.080000 20.040001 + H 27.480000 22.740000 20.280001 + CA 25.600000 22.200001 19.299999 + HA 25.120001 22.799999 18.520000 + CB 26.480000 21.120001 18.639999 + HB 27.059999 20.520000 19.340000 + CG1 25.680000 20.160000 17.799999 + HG11 25.299999 19.340000 18.400000 + HG12 24.799999 20.620001 17.320000 + HG13 26.320000 19.700001 17.059999 + CG2 27.500000 21.840000 17.719999 + HG21 28.260000 22.400000 18.260000 + HG22 27.940001 21.120001 17.040001 + HG23 27.020000 22.580000 17.059999 + C 24.540001 21.559999 20.240000 + O 24.900000 20.840000 21.120001 + N 23.280001 21.840000 19.959999 + H 23.139999 22.480000 19.200001 + CA 22.120001 21.280001 20.660000 + HA 22.520000 20.559999 21.379999 + CB 21.379999 22.280001 21.540001 + HB 20.500000 21.799999 21.980000 + CG2 22.059999 22.840000 22.780001 + HG21 22.980000 23.400000 22.580000 + HG22 21.440001 23.639999 23.180000 + HG23 22.200001 22.080000 23.559999 + OG1 20.959999 23.379999 20.840000 + HG1 20.040001 23.520000 21.100000 + C 21.160000 20.459999 19.740000 + O 19.920000 20.459999 19.879999 + N 21.740000 19.760000 18.780001 + H 22.740000 19.620001 18.820000 + CA 21.080000 18.840000 17.820000 + HA 20.040001 18.660000 18.080000 + CB 21.059999 19.600000 16.459999 + HB1 22.120001 19.740000 16.240000 + HB2 20.719999 19.139999 15.540000 + CG 20.260000 20.940001 16.520000 + HG1 19.320000 20.760000 17.059999 + HG2 20.900000 21.620001 17.080000 + CD 20.000000 21.520000 15.140000 + OE1 20.780001 22.260000 14.580000 + OE2 19.020000 21.139999 14.500000 + C 21.740000 17.440001 17.920000 + O 22.860001 17.280001 18.420000 + N 21.020000 16.379999 17.480000 + H 20.139999 16.580000 17.040001 + CH3 21.320000 14.940000 17.660000 + HH31 22.360001 14.740000 17.379999 + HH32 20.620001 14.280000 17.160000 + HH33 21.340000 14.700000 18.719999 +256 + 100.0 100.0 100.0 + HH31 17.747999 18.909000 30.774000 + CH3 18.612000 18.334999 30.423000 + HH32 18.121000 17.434000 30.027000 + HH33 19.239000 18.073999 31.271999 + C 19.364000 19.246000 29.549999 + O 20.521000 19.552000 29.834999 + N 18.806999 19.613001 28.386999 + H 17.833000 19.452000 28.222000 + CA 19.513000 20.502001 27.410999 + HA1 20.393000 20.054001 26.962999 + HA2 18.917999 20.843000 26.573000 + C 19.943001 21.808001 28.063000 + O 19.163000 22.344999 28.908001 + N 21.138000 22.327999 27.806000 + H 21.764999 21.820999 27.208000 + CA 21.660999 23.593000 28.353001 + HA 20.885000 24.208000 28.837999 + CB 22.750000 23.298000 29.297001 + HB1 23.384001 22.521000 28.875000 + HB2 23.320999 24.216000 29.495001 + CG 22.249001 22.691000 30.641001 + HG1 21.568001 23.415001 31.084000 + HG2 21.774000 21.729000 30.465000 + CD 23.530001 22.330999 31.561001 + OE1 23.778999 22.985001 32.623001 + OE2 24.372999 21.437000 31.252001 + C 22.215000 24.565001 27.231001 + O 22.639999 24.122999 26.156000 + N 22.356001 25.886999 27.427999 + H 22.037001 26.238001 28.334000 + CA 22.933001 26.858000 26.506001 + HA 23.440001 26.229000 25.761999 + CB 21.952999 27.631001 25.742001 + HB1 22.488001 28.115999 24.938999 + HB2 21.337999 26.875999 25.252001 + CG 21.122999 28.723000 26.379000 + CD1 20.900000 28.825001 27.735001 + HD1 21.208000 28.153999 28.528000 + NE1 20.212000 29.983999 27.952999 + HE1 19.979000 30.379999 28.864000 + CE2 20.066000 30.712000 26.797001 + CZ2 19.437000 31.936001 26.482000 + HZ2 19.047001 32.526001 27.292000 + CH2 19.341000 32.308998 25.134001 + HH2 18.875999 33.242001 24.892000 + CZ3 19.888000 31.563999 24.146000 + HZ3 19.889999 32.018002 23.152000 + CE3 20.521000 30.367001 24.465000 + HE3 21.042999 29.861000 23.653000 + CD2 20.493000 29.829000 25.775999 + C 23.962999 27.829000 27.112000 + O 23.825001 28.294001 28.261000 + N 25.089001 28.052999 26.357000 + H 25.072001 27.756001 25.402000 + CA 26.400000 28.421000 26.879000 + HA 26.212999 28.839001 27.893999 + CB 27.302000 27.162001 26.962000 + HB 27.176001 26.492001 26.098000 + CG2 28.822001 27.358000 26.959999 + HG21 29.396999 26.495001 27.212000 + HG22 29.125999 27.655001 25.973000 + HG23 29.104000 28.159000 27.656000 + OG1 27.077000 26.517000 28.200001 + HG1 27.707001 25.784000 28.298000 + C 27.021999 29.548000 26.136000 + O 27.018999 29.542000 24.936001 + N 27.548000 30.507000 26.910999 + H 27.572001 30.396000 27.895000 + CA 28.231001 31.749001 26.426001 + HA 27.653000 32.080002 25.544001 + CB 28.281000 32.882000 27.454000 + HB1 27.271999 33.139999 27.733000 + HB2 28.778999 32.557999 28.365999 + CG 28.908001 34.162998 26.945999 + CD1 30.309000 34.359001 27.059000 + HD1 30.868000 33.514999 27.399000 + CE1 30.915001 35.478001 26.600000 + HE1 31.965000 35.612000 26.775000 + CZ 30.155001 36.516998 25.987000 + OH 30.785999 37.668999 25.575001 + HH 31.716999 37.658001 25.774000 + CE2 28.771999 36.313999 25.802000 + HE2 28.143999 37.110001 25.355000 + CD2 28.118999 35.137001 26.309999 + HD2 27.056000 35.061001 26.143000 + C 29.664000 31.506001 26.035000 + O 30.393000 30.815001 26.768000 + N 30.003000 31.945999 24.811001 + H 29.298000 32.344002 24.195999 + CA 31.372999 32.153999 24.240000 + HA 32.001999 32.063000 25.113001 + CB 31.596001 30.941000 23.316000 + HB1 31.266001 30.059999 23.865000 + HB2 30.996000 31.105000 22.410000 + CG 33.067001 30.677000 22.936001 + OD1 33.952000 31.516001 23.181000 + OD2 33.231998 29.577999 22.384001 + C 31.740000 33.470001 23.636999 + O 30.855000 33.898998 22.868999 + N 32.806999 34.155998 23.975000 + H 33.388000 33.719002 24.684999 + CA 33.245998 35.404999 23.363001 + HA 32.462002 36.148998 23.551001 + CB 34.569000 35.998001 24.016001 + HB1 35.327999 35.209000 23.864000 + HB2 34.816002 36.862000 23.464001 + CG 34.243999 36.230999 25.461000 + OD1 34.375999 35.285999 26.330000 + OD2 33.754002 37.341000 25.844000 + C 33.500999 35.407001 21.849001 + O 33.366001 36.451000 21.209000 + N 33.692001 34.200001 21.325001 + H 33.896000 33.384998 21.912001 + CA 33.598000 33.845001 19.920000 + HA 34.293999 34.451000 19.333000 + CB 34.049999 32.419998 19.780001 + HB1 33.626999 31.726000 20.525999 + HB2 33.889000 31.955999 18.816000 + HB3 35.101002 32.393002 20.076000 + C 32.233002 34.004002 19.184999 + O 32.168999 33.986000 18.027000 + N 31.131001 34.112000 19.914000 + H 31.215000 34.146999 20.933001 + CA 29.878000 34.479000 19.337000 + HA 29.941999 34.799000 18.311001 + CB 28.886999 33.264000 19.312000 + HB 28.073999 33.473999 18.598000 + CG2 29.631001 31.947001 18.929001 + HG21 30.069000 32.040001 17.929001 + HG22 30.332001 31.509001 19.625000 + HG23 28.825001 31.219000 18.843000 + OG1 28.430000 32.988998 20.601000 + HG1 27.868000 32.237999 20.754999 + C 29.240999 35.646000 20.070000 + O 28.351999 36.314999 19.549000 + N 29.712999 35.988998 21.288000 + H 30.490999 35.417999 21.622999 + CA 29.136000 36.803001 22.329000 + HA 29.589001 36.439999 23.249001 + CB 29.438000 38.312000 22.266001 + HB1 28.694000 38.722000 21.594999 + HB2 29.344000 38.673000 23.287001 + CG 30.854000 38.692001 21.862000 + HG1 31.665001 38.069000 22.233000 + HG2 30.878000 38.727001 20.753000 + CD 31.079000 40.173000 22.181000 + HD1 31.804001 40.556999 21.506001 + HD2 30.114000 40.650002 22.190001 + CE 31.836000 40.358002 23.535000 + HE1 31.455000 39.667000 24.323999 + HE2 32.889000 40.095001 23.455000 + NZ 31.746000 41.736000 23.968000 + HZ1 30.839001 42.178001 24.072001 + HZ2 32.132999 41.931999 24.881001 + HZ3 32.230999 42.285000 23.273001 + C 27.650000 36.519001 22.618000 + O 26.900000 37.333000 23.101999 + N 27.250999 35.243000 22.341999 + H 27.857000 34.727001 21.726999 + CA 25.822001 34.794998 22.521999 + HA 25.364000 35.493999 23.233000 + CB 25.045000 34.750000 21.216999 + HB 24.041000 34.332001 21.273001 + CG2 24.825001 36.194000 20.688999 + HG21 25.785000 36.619999 20.405001 + HG22 24.245001 36.214001 19.764000 + HG23 24.271000 36.771999 21.426001 + OG1 25.789000 33.955002 20.292999 + HG1 25.207001 33.939999 19.520000 + C 25.792000 33.425999 23.174999 + O 26.695000 32.634998 23.208000 + N 24.665001 33.056000 23.837999 + H 23.861000 33.668999 23.951000 + CA 24.436001 31.722000 24.438000 + HA 25.367001 31.370001 24.917999 + CB 23.468000 31.867001 25.601000 + HB1 22.493000 32.306999 25.362000 + HB2 23.194000 30.847000 25.844999 + CG 24.040001 32.491001 26.872000 + CD1 24.334999 31.683001 27.945000 + HD1 24.132999 30.648001 27.816000 + CE1 24.747999 32.340000 29.135000 + HE1 24.768999 31.764999 30.041000 + CZ 24.915001 33.723000 29.184000 + HZ 25.322001 34.069000 30.131001 + CE2 24.757000 34.507999 28.037001 + HE2 24.959999 35.570999 28.069000 + CD2 24.254000 33.928001 26.900000 + HD2 24.118000 34.542000 26.028000 + C 23.965000 30.767000 23.378000 + O 22.945999 31.084999 22.708000 + N 24.657000 29.631001 23.191999 + H 25.483000 29.544001 23.737000 + CA 24.277000 28.594999 22.205999 + HA 23.254999 28.698000 21.850000 + CB 25.108999 28.662001 20.902000 + HB 24.761999 27.809000 20.327000 + CG2 24.813000 29.997999 20.288000 + HG21 23.764000 30.296000 20.315001 + HG22 25.268000 30.739000 20.933001 + HG23 24.973000 30.139999 19.208000 + OG1 26.497000 28.441000 21.128000 + HG1 26.819000 29.103001 21.747999 + C 24.292999 27.131001 22.775000 + O 25.073999 26.816999 23.645000 + N 23.502001 26.282000 22.200001 + H 22.986000 26.605000 21.417000 + CA 23.297001 24.957001 22.916000 + HA 23.083000 25.173000 23.959999 + CB 22.013000 24.181999 22.395000 + HB 22.045000 23.292999 22.957001 + CG1 20.639999 24.885000 22.735001 + HG11 20.563999 24.917000 23.825001 + HG12 20.528000 25.907000 22.334000 + HG13 19.872000 24.167000 22.436001 + CG2 22.055000 23.958000 20.851000 + HG21 21.028000 23.723000 20.547001 + HG22 22.358999 24.806000 20.254000 + HG23 22.569000 23.011999 20.620001 + C 24.544001 24.023001 22.915001 + O 25.209999 24.017000 21.886000 + N 24.952999 23.323999 23.917999 + H 24.518000 23.565001 24.792999 + CA 26.094999 22.489000 24.030001 + HA 26.971001 22.780001 23.457001 + CB 26.589001 22.365999 25.469999 + HB 27.375999 21.607000 25.493000 + CG2 27.080999 23.695999 25.996000 + HG21 27.900000 24.164000 25.447001 + HG22 26.259001 24.374001 25.761999 + HG23 27.309999 23.601999 27.068001 + OG1 25.506001 21.988001 26.360001 + HG1 25.775999 22.070000 27.270000 + C 25.794001 21.077999 23.492001 + O 26.719000 20.330999 23.289000 + N 24.584999 20.688999 23.125000 + H 23.862000 21.264000 23.533001 + CA 24.337000 19.406000 22.333000 + HA 25.205999 19.201000 21.705000 + CB 24.184000 18.282000 23.320000 + HB1 24.558001 18.524000 24.323999 + HB2 23.122999 18.163000 23.559999 + CG 24.658001 16.908001 22.886999 + HG1 24.084000 16.511999 22.047001 + HG2 25.625000 17.115000 22.415001 + CD 24.798000 15.846000 23.966999 + OE1 23.674000 15.524000 24.493999 + OE2 25.856001 15.278000 24.216999 + C 23.051001 19.573999 21.457001 + O 22.964001 19.075001 20.360001 + N 22.049000 20.320000 21.846001 + H 22.072001 20.660999 22.792999 + CH3 20.709000 20.507999 21.187000 + HH31 20.733000 20.684999 20.098000 + HH32 20.229000 21.370001 21.677000 + HH33 20.110001 19.625000 21.393000 +256 + 100.0 100.0 100.0 + HH31 15.326000 19.707001 28.507999 + CH3 16.124001 19.739000 29.243000 + HH32 16.097000 18.858000 29.879999 + HH33 15.877000 20.590000 29.882999 + C 17.427999 20.063000 28.719000 + O 18.434999 19.580000 29.207001 + N 17.473000 21.037001 27.832001 + H 16.622999 21.559999 27.674999 + CA 18.596001 21.582001 27.073999 + HA1 19.156000 20.740000 26.694000 + HA2 18.205000 22.087999 26.226999 + C 19.520000 22.562000 27.834999 + O 19.128000 23.195000 28.834000 + N 20.785000 22.731001 27.358000 + H 21.018999 22.299000 26.497999 + CA 21.775000 23.417999 28.174999 + HA 21.275999 23.934000 29.000999 + CB 22.694000 22.315001 28.759001 + HB1 22.139000 21.450001 29.075001 + HB2 23.264000 21.839001 27.962999 + CG 23.587999 22.702999 29.889000 + HG1 23.993000 23.702999 29.677000 + HG2 22.948000 22.656000 30.735001 + CD 24.806000 21.790001 30.145000 + OE1 24.686001 20.598000 30.546000 + OE2 25.875999 22.322001 29.929001 + C 22.570000 24.465000 27.296000 + O 23.014000 24.046000 26.268999 + N 22.716999 25.670000 27.816000 + H 22.483000 25.642000 28.795000 + CA 23.455000 26.697001 27.070999 + HA 24.142000 26.082001 26.431000 + CB 22.481001 27.514999 26.113001 + HB1 23.093000 28.275000 25.673000 + HB2 22.177999 26.837999 25.298000 + CG 21.292999 28.247999 26.673000 + CD1 21.160999 28.905001 27.799000 + HD1 21.816999 28.902000 28.653000 + NE1 19.926001 29.599001 27.802999 + HE1 19.537001 29.996000 28.638000 + CE2 19.207001 29.382999 26.608999 + CZ2 17.920000 29.664000 26.230000 + HZ2 17.313999 30.233000 26.930000 + CH2 17.605000 29.461000 24.863001 + HH2 16.650000 29.761000 24.461000 + CZ3 18.466000 28.827000 23.971001 + HZ3 18.187000 28.683001 22.931999 + CE3 19.702000 28.375000 24.436001 + HE3 20.375000 27.848000 23.785999 + CD2 20.153999 28.618000 25.823999 + C 24.363001 27.497999 28.048000 + O 24.173000 27.629999 29.267000 + N 25.371000 28.107000 27.528999 + H 25.612000 27.839001 26.575001 + CA 26.257999 29.075001 28.141001 + HA 25.674000 29.535000 28.976999 + CB 27.474001 28.511000 28.938999 + HB 27.980000 29.347000 29.431999 + CG2 27.219999 27.589001 30.090000 + HG21 26.385000 28.101000 30.569000 + HG22 27.004999 26.556999 29.747000 + HG23 28.013000 27.601999 30.823999 + OG1 28.334000 27.834999 28.090000 + HG1 28.962999 27.327999 28.613001 + C 26.707001 30.190001 27.174000 + O 26.847000 30.032000 25.948000 + N 26.729000 31.392000 27.671000 + H 26.438999 31.507999 28.628000 + CA 27.344000 32.457001 26.860001 + HA 26.893000 32.623001 25.886999 + CB 27.180000 33.872002 27.549999 + HB1 26.118000 34.092999 27.747000 + HB2 27.555000 33.773998 28.584999 + CG 27.846001 35.092999 26.938999 + CD1 29.184000 35.278000 27.270000 + HD1 29.666000 34.762001 28.073000 + CE1 29.862000 36.347000 26.572001 + HE1 30.863001 36.535000 26.881001 + CZ 29.167000 37.137001 25.565001 + OH 29.768000 37.953999 24.750999 + HH 30.702000 38.075001 24.870001 + CE2 27.768000 36.952999 25.325001 + HE2 27.246000 37.525002 24.591999 + CD2 27.170000 35.813999 25.941999 + HD2 26.117001 35.707001 25.698000 + C 28.836000 32.075001 26.612000 + O 29.643000 31.771999 27.517000 + N 29.295000 32.087002 25.348000 + H 28.660000 32.359001 24.599001 + CA 30.627001 31.836000 24.938000 + HA 31.275999 32.066002 25.771000 + CB 30.715000 30.350000 24.606001 + HB1 30.288000 29.750000 25.434000 + HB2 30.129999 30.139000 23.701000 + CG 32.119999 29.827000 24.354000 + OD1 32.241001 28.568001 24.316000 + OD2 33.141998 30.525999 24.320000 + C 31.048000 32.786999 23.754000 + O 30.231001 33.285999 22.993000 + N 32.341000 33.078999 23.537001 + H 33.081001 32.535000 23.981001 + CA 32.769001 34.076000 22.594999 + HA 32.066002 34.910999 22.521999 + CB 34.054001 34.785000 23.056999 + HB1 34.324001 35.585999 22.367001 + HB2 33.845001 35.294998 24.017000 + CG 35.240002 33.887001 23.489000 + OD1 35.619999 33.896000 24.658001 + OD2 35.700001 33.109001 22.657000 + C 32.901001 33.599998 21.129000 + O 33.466000 34.280998 20.278999 + N 32.370998 32.396999 20.804001 + H 31.802000 31.945999 21.513000 + CA 32.424000 31.802000 19.434999 + HA 33.432999 31.698999 19.056000 + CB 31.740000 30.410000 19.669001 + HB1 30.695999 30.417999 19.968000 + HB2 31.848000 29.870001 18.733000 + HB3 32.410000 29.829000 20.287001 + C 31.597000 32.679001 18.479000 + O 32.087002 33.042000 17.396000 + N 30.440001 33.126999 18.966000 + H 30.124001 32.680000 19.801001 + CA 29.474001 34.056999 18.448999 + HA 29.750000 34.408001 17.451000 + CB 28.224001 33.237999 18.268000 + HB 27.308001 33.824001 18.115000 + CG2 28.247999 32.299999 17.125000 + HG21 29.094999 31.604000 17.030001 + HG22 27.391001 31.612000 17.209000 + HG23 28.257000 32.779999 16.170000 + OG1 27.843000 32.462002 19.424999 + HG1 27.122000 32.894001 19.850000 + C 29.166000 35.229000 19.358000 + O 28.304001 36.046001 18.990999 + N 29.738001 35.283001 20.599001 + H 30.340000 34.591999 20.969000 + CA 29.441999 36.325001 21.562000 + HA 29.872000 36.019001 22.521999 + CB 29.980000 37.699001 21.180000 + HB1 29.681999 37.981998 20.165001 + HB2 29.546000 38.483002 21.792000 + CG 31.538000 37.786999 21.334000 + HG1 31.802000 37.259998 22.240999 + HG2 32.035000 37.354000 20.440001 + CD 31.934999 39.259998 21.469999 + HD1 31.466000 39.813999 20.666000 + HD2 31.614000 39.638000 22.461000 + CE 33.492001 39.431999 21.555000 + HE1 33.890999 38.773998 22.334000 + HE2 33.952000 39.050999 20.610001 + NZ 33.840000 40.839001 21.830000 + HZ1 33.471001 41.146999 22.737000 + HZ2 34.825001 41.029999 22.014000 + HZ3 33.577999 41.473999 21.077999 + C 27.943001 36.313999 21.962999 + O 27.275999 37.327000 21.881001 + N 27.412001 35.192001 22.386000 + H 28.025999 34.477001 22.760000 + CA 26.004000 34.876999 22.705999 + HA 25.490999 35.685001 23.219999 + CB 25.209999 34.493999 21.410000 + HB 24.193001 34.240002 21.695000 + CG2 25.113001 35.679001 20.399000 + HG21 26.084999 35.987000 20.000000 + HG22 24.403999 35.365002 19.622000 + HG23 24.664000 36.570000 20.836000 + OG1 25.813000 33.483002 20.665001 + HG1 25.186001 33.292000 19.995001 + C 25.837000 33.603001 23.514000 + O 26.724001 32.750999 23.603001 + N 24.674999 33.446999 24.131001 + H 23.954000 34.115002 23.885000 + CA 24.273001 32.161999 24.816000 + HA 25.066000 31.858000 25.474001 + CB 22.982000 32.409000 25.642000 + HB1 22.329000 32.918999 24.931000 + HB2 22.531000 31.423000 25.783001 + CG 23.186001 33.110001 26.966999 + CD1 23.417000 32.389000 28.149000 + HD1 23.568001 31.312000 28.243999 + CE1 23.636999 33.039001 29.319000 + HE1 23.723000 32.507000 30.254999 + CZ 23.552999 34.474998 29.350000 + HZ 23.598000 35.028999 30.291000 + CE2 23.388000 35.195000 28.159000 + HE2 23.322001 36.266998 28.162001 + CD2 23.212999 34.507999 26.919001 + HD2 23.291000 35.136002 26.066000 + C 24.160999 30.978001 23.851999 + O 23.237000 30.816000 23.004000 + N 25.002001 29.997000 24.065001 + H 25.632000 30.000000 24.851999 + CA 25.330000 28.964001 23.066999 + HA 24.775000 29.101000 22.139000 + CB 26.799999 29.049000 22.715000 + HB 27.306999 28.990999 23.688999 + CG2 27.483000 27.990000 21.927000 + HG21 27.537001 27.083000 22.541000 + HG22 26.854000 27.732000 21.059000 + HG23 28.447001 28.323000 21.606001 + OG1 27.188000 30.191000 22.080999 + HG1 26.705000 30.862000 22.549999 + C 25.077999 27.566999 23.686001 + O 25.424999 27.334000 24.849001 + N 24.452000 26.639999 23.014999 + H 24.225000 26.900999 22.035000 + CA 24.167999 25.249001 23.485001 + HA 23.648001 25.291000 24.407000 + CB 23.305000 24.370001 22.482000 + HB 23.264999 23.362000 22.882999 + CG1 21.889000 24.975000 22.500999 + HG11 21.872999 26.025000 22.229000 + HG12 21.209999 24.381001 21.875999 + HG13 21.576000 24.995001 23.524000 + CG2 23.865000 24.261999 21.063000 + HG21 23.863001 25.240000 20.615999 + HG22 24.934000 24.023001 21.114000 + HG23 23.289000 23.593000 20.441999 + C 25.510000 24.591000 23.742001 + O 26.475000 24.660999 23.014999 + N 25.677999 23.931999 24.908001 + H 24.872000 23.552999 25.424000 + CA 26.987000 23.223000 25.243999 + HA 27.872000 23.770000 24.912001 + CB 27.191999 23.107000 26.759001 + HB 28.018999 22.424999 26.986000 + CG2 27.430000 24.452999 27.365999 + HG21 28.393999 24.848000 27.040001 + HG22 26.600000 25.114000 27.120001 + HG23 27.459000 24.384001 28.458000 + OG1 26.039000 22.547001 27.330000 + HG1 25.999001 22.749001 28.243999 + C 27.198000 21.877001 24.535999 + O 28.145000 21.091999 24.752001 + N 26.212999 21.628000 23.643000 + H 25.525000 22.330999 23.500999 + CA 26.216999 20.472000 22.780001 + HA 26.368000 19.531000 23.292000 + CB 24.941000 20.341000 22.028000 + HB1 24.670000 21.302000 21.615000 + HB2 25.042000 19.597000 21.230000 + CG 23.808001 19.888000 22.980000 + HG1 24.031000 18.944000 23.445000 + HG2 23.714001 20.652000 23.778000 + CD 22.525000 19.674000 22.132000 + OE1 21.563999 20.474001 22.422001 + OE2 22.298000 18.618000 21.504000 + C 27.374001 20.537001 21.740999 + O 27.613001 21.559999 21.129999 + N 28.070000 19.424000 21.530001 + H 28.009001 18.660000 22.193001 + CH3 29.073000 19.308001 20.539000 + HH31 28.846001 19.886999 19.635000 + HH32 29.275000 18.289000 20.170000 + HH33 30.070000 19.584000 20.902000 +256 + 100.0 100.0 100.0 + HH31 16.577999 25.819000 24.798000 + CH3 17.455999 25.149000 24.768000 + HH32 18.365000 25.695999 24.545000 + HH33 17.323999 24.326000 24.055000 + C 17.763000 24.580999 26.129000 + O 18.333000 23.507000 26.214001 + N 17.306000 25.268999 27.186001 + H 16.830999 26.124001 26.934000 + CA 17.399000 24.816999 28.628000 + HA1 16.711000 25.489000 29.167000 + HA2 16.986000 23.811001 28.753000 + C 18.813000 24.926001 29.216999 + O 18.922001 25.509001 30.299000 + N 19.822001 24.584999 28.437000 + H 19.577999 24.052999 27.622999 + CA 21.194000 24.754000 28.806000 + HA 21.302999 25.562000 29.518999 + CB 21.598000 23.451000 29.368999 + HB1 20.773001 22.934999 29.871000 + HB2 21.875999 22.778000 28.532000 + CG 22.740999 23.537001 30.398001 + HG1 23.559000 24.115999 30.004999 + HG2 22.396999 23.981001 31.340000 + CD 23.448999 22.212000 30.804001 + OE1 23.933001 21.434000 29.903000 + OE2 23.511000 21.981001 32.021999 + C 22.115999 25.045000 27.563000 + O 21.868000 24.641001 26.419001 + N 23.077999 25.948000 27.848000 + H 23.247999 26.211000 28.820000 + CA 23.811001 26.721001 26.805000 + HA 23.701000 26.167000 25.860001 + CB 23.073999 28.042000 26.677000 + HB1 23.072001 28.511000 27.657000 + HB2 23.601000 28.671000 25.980000 + CG 21.646999 27.979000 26.207001 + CD1 20.573999 27.833000 27.013000 + HD1 20.604000 27.646999 28.079000 + NE1 19.372000 27.837999 26.285999 + HE1 18.447001 27.746000 26.677000 + CE2 19.688000 28.115000 24.950001 + CZ2 18.934999 28.209000 23.794001 + HZ2 17.865000 28.076000 23.804001 + CH2 19.660000 28.742001 22.653999 + HH2 19.041000 28.941999 21.774000 + CZ3 21.039000 28.997999 22.622999 + HZ3 21.511999 29.172001 21.672001 + CE3 21.778999 28.695000 23.738001 + HE3 22.865000 28.704000 23.771000 + CD2 21.131001 28.302000 24.920000 + C 25.294001 26.829000 27.216999 + O 25.466000 27.117001 28.408001 + N 26.193001 26.624001 26.315001 + H 25.792999 26.424000 25.403000 + CA 27.604000 27.112000 26.292999 + HA 27.917999 27.212000 27.316000 + CB 28.603001 26.229000 25.473000 + HB 29.511999 26.775999 25.250000 + CG2 29.007000 24.979000 26.261000 + HG21 29.778999 24.385000 25.785000 + HG22 29.245001 25.141001 27.308001 + HG23 28.122999 24.344000 26.424999 + OG1 28.195999 25.858000 24.204000 + HG1 27.900999 26.646000 23.768000 + C 27.667999 28.580000 25.754999 + O 26.930000 28.855000 24.764999 + N 28.653000 29.400000 26.163000 + H 29.277000 29.089001 26.888000 + CA 28.712000 30.827999 25.808001 + HA 28.084999 30.938999 24.934999 + CB 28.181000 31.702000 26.855000 + HB1 27.107000 31.473000 26.906000 + HB2 28.658001 31.382999 27.778999 + CG 28.348000 33.223999 26.695000 + CD1 29.347000 33.798000 27.443001 + HD1 29.926001 33.276001 28.190001 + CE1 29.473000 35.230000 27.353001 + HE1 30.320000 35.749001 27.778000 + CZ 28.638000 35.955002 26.472000 + OH 28.857000 37.298000 26.278999 + HH 29.464001 37.719002 26.896999 + CE2 27.632999 35.312000 25.639000 + HE2 26.945999 35.844002 25.017000 + CD2 27.518999 33.938000 25.798000 + HD2 26.700001 33.403000 25.319000 + C 30.162001 31.305000 25.444000 + O 31.066999 31.235001 26.261000 + N 30.289000 31.785999 24.191000 + H 29.426001 31.721001 23.673000 + CA 31.539000 32.380001 23.570999 + HA 32.348999 31.712000 23.848000 + CB 31.450001 32.243999 22.101000 + HB1 31.389999 31.191999 21.795000 + HB2 30.509001 32.728001 21.840000 + CG 32.688999 32.701000 21.311001 + OD1 33.633999 33.252998 21.941999 + OD2 32.651001 32.669998 20.106001 + C 31.891001 33.812000 24.007999 + O 31.400999 34.734001 23.306999 + N 32.571999 34.000000 25.115000 + H 32.905998 33.154999 25.556999 + CA 32.939999 35.331001 25.552999 + HA 31.983000 35.817001 25.676001 + CB 33.602001 35.299000 26.938000 + HB1 33.872002 36.318001 27.183001 + HB2 32.839001 34.945000 27.643999 + CG 34.812000 34.389999 26.892000 + OD1 34.573002 33.148998 26.871000 + OD2 35.986000 34.821999 26.798000 + C 33.834000 36.146999 24.555000 + O 34.068001 37.319000 24.753000 + N 34.418999 35.570999 23.479000 + H 34.058998 34.660000 23.246000 + CA 35.110001 36.358002 22.431999 + HA 35.645000 37.187000 22.884001 + CB 36.188999 35.431999 21.759001 + HB1 35.749001 34.637001 21.169001 + HB2 36.819000 35.959000 21.025000 + HB3 36.777000 34.948002 22.535999 + C 34.087002 36.852001 21.363001 + O 34.540001 37.691002 20.614000 + N 32.823002 36.476002 21.375999 + H 32.556999 35.738998 22.035999 + CA 31.916000 36.925999 20.340000 + HA 32.287998 37.837002 19.844000 + CB 31.764000 35.950001 19.122000 + HB 31.037001 36.287998 18.382000 + CG2 33.090000 35.646000 18.386000 + HG21 33.492001 36.589001 18.011999 + HG22 33.853001 35.178001 18.999001 + HG23 32.903000 34.928001 17.573000 + OG1 31.129999 34.769001 19.528999 + HG1 31.836000 34.126999 19.660999 + C 30.502001 37.207001 20.893000 + O 29.796000 37.791000 20.094000 + N 30.191000 36.922001 22.131001 + H 30.892000 36.571999 22.788000 + CA 28.844999 36.976002 22.745001 + HA 28.920000 36.547001 23.740999 + CB 28.287001 38.416000 23.115999 + HB1 28.000000 38.933998 22.193001 + HB2 27.447001 38.327999 23.781000 + CG 29.226000 39.356998 23.757999 + HG1 29.917000 38.922001 24.471001 + HG2 29.820999 39.782001 22.948999 + CD 28.729000 40.632999 24.431000 + HD1 28.601000 40.452999 25.497000 + HD2 29.461000 41.417999 24.271999 + CE 27.296000 41.110001 23.943001 + HE1 27.381001 41.303001 22.874001 + HE2 26.516001 40.396999 24.160000 + NZ 26.846001 42.366001 24.653000 + HZ1 27.409000 43.174000 24.476000 + HZ2 25.884001 42.500000 24.393000 + HZ3 27.013000 42.306000 25.641001 + C 27.825001 36.029999 22.042999 + O 26.681000 36.384998 21.987000 + N 28.198000 34.911999 21.409000 + H 29.176001 34.675999 21.406000 + CA 27.207001 33.923000 20.907000 + HA 26.209000 34.366001 20.754000 + CB 27.555000 33.418999 19.511999 + HB 26.896999 32.546001 19.426001 + CG2 27.080999 34.389000 18.389999 + HG21 27.778000 35.228001 18.438000 + HG22 26.987000 33.861000 17.459000 + HG23 26.136000 34.858002 18.662001 + OG1 28.822001 33.002998 19.274000 + HG1 29.400000 33.766998 19.372000 + C 27.049999 32.748001 21.877001 + O 28.007999 32.193001 22.407000 + N 25.798000 32.331001 22.082001 + H 25.035999 32.799000 21.601000 + CA 25.375000 31.195000 22.872000 + HA 26.259001 30.902000 23.444000 + CB 24.184000 31.478001 23.739000 + HB1 23.357000 31.788000 23.103001 + HB2 24.038000 30.510000 24.225000 + CG 24.316999 32.455002 24.816000 + CD1 24.601999 32.046001 26.107000 + HD1 24.670000 30.983999 26.341000 + CE1 24.624001 32.959999 27.177000 + HE1 24.811001 32.564999 28.174999 + CZ 24.504000 34.351002 26.948000 + HZ 24.583000 34.974998 27.830000 + CE2 24.288000 34.758999 25.611000 + HE2 24.245001 35.833000 25.459999 + CD2 24.225000 33.830002 24.533001 + HD2 24.018000 34.125999 23.517000 + C 25.096001 29.980000 21.921000 + O 24.290001 30.181000 21.056999 + N 25.599001 28.756001 22.212000 + H 26.163000 28.610001 23.028000 + CA 25.346001 27.555000 21.474001 + HA 24.485001 27.712000 20.799000 + CB 26.532000 26.976999 20.761000 + HB 27.344000 26.919001 21.500000 + CG2 26.372000 25.565001 20.216000 + HG21 26.473000 24.841000 21.040001 + HG22 25.367001 25.457001 19.792999 + HG23 27.042000 25.422001 19.372999 + OG1 26.943001 27.823999 19.698000 + HG1 27.440001 28.583000 19.997000 + C 24.837000 26.473000 22.527000 + O 25.302000 26.351000 23.672001 + N 23.767000 25.754000 22.165001 + H 23.663000 25.645000 21.167999 + CA 23.035000 24.825001 23.056000 + HA 22.867001 25.413000 23.978001 + CB 21.631001 24.372000 22.584000 + HB 21.261000 23.766001 23.417999 + CG1 20.774000 25.565001 22.149000 + HG11 19.809000 25.146000 21.834000 + HG12 20.606001 26.177000 23.028000 + HG13 21.163000 26.143000 21.318001 + CG2 21.726000 23.386000 21.410999 + HG21 20.746000 23.039000 21.090000 + HG22 22.118000 24.087999 20.677999 + HG23 22.365000 22.514000 21.516001 + C 23.976000 23.635000 23.503000 + O 24.846001 23.299000 22.733000 + N 23.745001 22.976999 24.674999 + H 22.964001 23.306999 25.229000 + CA 24.664000 21.923000 25.226000 + HA 25.691999 22.243000 25.010000 + CB 24.621000 21.850000 26.754000 + HB 25.347000 21.105000 27.100000 + CG2 25.148001 23.198999 27.280001 + HG21 25.084999 23.969000 26.520000 + HG22 24.580999 23.594000 28.125000 + HG23 26.212000 23.090000 27.518000 + OG1 23.361000 21.472000 27.242001 + HG1 23.431999 21.301001 28.184999 + C 24.473000 20.580000 24.485001 + O 25.408001 19.823999 24.333000 + N 23.263000 20.271000 24.003000 + H 22.534000 20.997000 24.011000 + CA 22.929001 19.011999 23.372000 + HA 23.698000 18.698999 22.670000 + CB 22.743999 17.955999 24.454000 + HB1 22.959999 17.024000 23.930000 + HB2 23.518999 18.004000 25.232000 + CG 21.326000 17.966999 25.118000 + HG1 21.111000 18.997999 25.389000 + HG2 20.566999 17.643999 24.412001 + CD 21.271999 17.048000 26.400999 + OE1 21.243000 15.799000 26.275000 + OE2 21.398001 17.629999 27.493000 + C 21.722000 19.150999 22.495001 + O 21.018000 20.195999 22.577999 + N 21.459000 18.091000 21.704000 + H 22.070000 17.285000 21.697001 + CH3 20.427000 17.916000 20.712000 + HH31 20.379999 16.868999 20.381001 + HH32 20.474001 18.445000 19.754000 + HH33 19.489000 18.200001 21.171000 +256 + 100.0 100.0 100.0 + HH31 16.431999 26.389999 24.245001 + CH3 16.035999 25.403999 24.527000 + HH32 15.695000 25.162001 23.521000 + HH33 15.253000 25.601999 25.267000 + C 17.202000 24.565001 24.966999 + O 18.090000 24.306000 24.218000 + N 17.191999 24.223000 26.242001 + H 16.361000 24.480000 26.785999 + CA 18.195999 23.392000 26.833000 + HA1 17.784000 22.716999 27.566000 + HA2 18.820999 22.834000 26.174999 + C 19.070999 24.330000 27.701000 + O 18.818001 25.476000 27.969000 + N 20.021000 23.749001 28.283001 + H 20.122000 22.756001 28.089001 + CA 21.197001 24.457001 28.823000 + HA 20.868000 25.362000 29.309999 + CB 21.924000 23.556000 29.853001 + HB1 21.198000 23.346001 30.638000 + HB2 22.212000 22.558001 29.486000 + CG 23.155001 24.222000 30.528000 + HG1 24.007999 24.382999 29.872999 + HG2 22.879000 25.254999 30.714001 + CD 23.513000 23.684999 31.913000 + OE1 24.044001 22.554001 32.007999 + OE2 23.195000 24.389000 32.916000 + C 22.198000 24.846001 27.742001 + O 22.487000 24.091999 26.879999 + N 22.757000 26.073999 27.916000 + H 22.486000 26.705999 28.653000 + CA 23.641001 26.718000 26.951000 + HA 23.700001 26.099001 26.048000 + CB 22.889999 28.021000 26.594999 + HB1 22.792999 28.593000 27.499001 + HB2 23.625999 28.511999 25.955999 + CG 21.562000 28.083000 25.985001 + CD1 20.389000 27.691999 26.615999 + HD1 20.349001 27.525000 27.697001 + NE1 19.316000 27.872999 25.731001 + HE1 18.360001 27.968000 26.059999 + CE2 19.754999 28.017000 24.382000 + CZ2 19.171000 28.044001 23.118999 + HZ2 18.122000 27.789000 23.023001 + CH2 19.997999 28.289000 21.986000 + HH2 19.690001 28.278999 20.964001 + CZ3 21.381001 28.478001 22.077000 + HZ3 21.959000 28.676001 21.201000 + CE3 21.962000 28.350000 23.358000 + HE3 23.023001 28.363001 23.486000 + CD2 21.205000 28.152000 24.547001 + C 25.091999 26.914000 27.438000 + O 25.306999 26.980000 28.649000 + N 26.038000 27.121000 26.537001 + H 25.798000 26.771999 25.601999 + CA 27.486000 27.413000 26.687000 + HA 27.608000 27.474001 27.783001 + CB 28.454000 26.392000 26.013000 + HB 29.434000 26.856001 26.018000 + CG2 28.524000 25.011000 26.714001 + HG21 27.524000 24.614000 26.731001 + HG22 29.201000 24.386000 26.110001 + HG23 28.923000 25.101000 27.732000 + OG1 28.106001 26.146000 24.666000 + HG1 28.673000 26.620001 24.039000 + C 27.721001 28.833000 26.125999 + O 27.535999 29.052999 24.941999 + N 28.252001 29.740000 26.916000 + H 28.613001 29.419001 27.806000 + CA 28.646999 31.086000 26.503000 + HA 27.902000 31.337000 25.738001 + CB 28.566999 32.063999 27.636999 + HB1 27.691000 31.818001 28.232000 + HB2 29.384001 31.697001 28.254000 + CG 28.709000 33.513000 27.224001 + CD1 29.777000 34.256001 27.691999 + HD1 30.507000 33.806999 28.372999 + CE1 29.990999 35.596001 27.332001 + HE1 30.804001 36.158001 27.771999 + CZ 29.058001 36.257999 26.490000 + OH 29.249001 37.540001 26.129999 + HH 30.086000 37.821999 26.500999 + CE2 28.004000 35.449001 25.919001 + HE2 27.382999 35.938000 25.212000 + CD2 27.834000 34.098999 26.275999 + HD2 27.004999 33.501999 25.976000 + C 30.059000 31.100000 25.906000 + O 30.888000 30.329000 26.311001 + N 30.254000 31.865000 24.830000 + H 29.507000 32.497002 24.597000 + CA 31.530001 32.195999 24.150000 + HA 32.376999 31.750000 24.662001 + CB 31.429001 31.693001 22.719999 + HB1 31.476000 30.618999 22.669001 + HB2 30.459999 32.037998 22.354000 + CG 32.535999 32.312000 21.858999 + OD1 33.763000 32.066002 22.170000 + OD2 32.334999 33.174999 20.973000 + C 31.742001 33.680000 24.195000 + O 30.969000 34.477001 23.606001 + N 32.845001 34.138000 24.773001 + H 33.372002 33.542999 25.403000 + CA 33.176998 35.521000 24.767000 + HA 32.266998 36.066002 24.962999 + CB 34.082001 35.824001 25.996000 + HB1 35.105000 35.445999 25.816999 + HB2 34.148998 36.909000 26.059999 + CG 33.688999 35.412998 27.416000 + OD1 33.441002 34.201000 27.662001 + OD2 33.757000 36.313999 28.297001 + C 33.703999 36.166000 23.565001 + O 33.813999 37.444000 23.490000 + N 33.987999 35.460999 22.483999 + H 33.769001 34.474998 22.433001 + CA 34.520000 36.049999 21.280001 + HA 35.148998 36.912998 21.540001 + CB 35.535000 35.018002 20.642000 + HB1 36.351002 34.678001 21.280001 + HB2 34.845001 34.205002 20.407000 + HB3 35.918999 35.398998 19.704000 + C 33.480000 36.508999 20.240000 + O 33.733002 37.231998 19.319000 + N 32.278999 35.945999 20.407000 + H 32.227001 35.181000 21.052000 + CA 31.049999 36.335999 19.618999 + HA 31.299000 37.039001 18.837999 + CB 30.452999 35.195999 18.787001 + HB 29.476999 35.442001 18.379000 + CG2 31.364000 34.752998 17.671000 + HG21 32.289001 34.236000 17.955000 + HG22 30.773001 34.207001 16.955000 + HG23 31.653000 35.665001 17.153999 + OG1 30.235001 34.054001 19.594999 + HG1 31.093000 33.854000 19.992001 + C 30.047001 36.977001 20.506001 + O 29.285000 37.743000 20.035999 + N 30.253000 36.742001 21.768999 + H 30.906000 35.977001 21.885000 + CA 29.332001 37.115002 22.844000 + HA 29.813999 36.721001 23.724001 + CB 29.301001 38.671001 22.987000 + HB1 28.959999 39.235001 22.122999 + HB2 28.541000 38.928001 23.728001 + CG 30.681000 39.334999 23.312000 + HG1 31.180000 38.900002 24.188999 + HG2 31.409000 39.103001 22.554001 + CD 30.569000 40.854000 23.479000 + HD1 30.084000 41.277000 22.580999 + HD2 29.945000 41.105999 24.330999 + CE 31.915001 41.490002 23.684999 + HE1 32.124001 41.375999 24.750999 + HE2 32.723999 41.018002 23.136000 + NZ 32.016998 42.893002 23.233999 + HZ1 31.858999 42.966999 22.243999 + HZ2 31.320000 43.479000 23.698000 + HZ3 32.882999 43.278999 23.566000 + C 27.947001 36.432999 22.620001 + O 26.938999 37.138000 22.868000 + N 27.896000 35.146000 22.289000 + H 28.723000 34.618999 22.159000 + CA 26.698000 34.359001 21.929001 + HA 25.802999 34.945000 22.205999 + CB 26.632999 34.030998 20.441000 + HB 25.688000 33.533001 20.271999 + CG2 26.760000 35.269001 19.482000 + HG21 27.038000 34.959999 18.472000 + HG22 25.844999 35.863998 19.459999 + HG23 27.629000 35.931999 19.621000 + OG1 27.681999 33.134998 20.105000 + HG1 28.548000 33.589001 20.098000 + C 26.584000 33.027000 22.743999 + O 27.563000 32.659000 23.430000 + N 25.388000 32.456001 22.750000 + H 24.643999 32.842999 22.190001 + CA 25.058001 31.167000 23.361000 + HA 25.844000 30.879000 24.062000 + CB 23.780001 31.284000 24.253000 + HB1 22.962999 31.650999 23.636999 + HB2 23.530001 30.254999 24.524000 + CG 23.929001 32.153999 25.448999 + CD1 24.917000 31.891001 26.438000 + HD1 25.629999 31.143999 26.188999 + CE1 24.830000 32.595001 27.705000 + HE1 25.636999 32.394001 28.407000 + CZ 23.862000 33.575001 27.896999 + HZ 23.841999 34.111000 28.834999 + CE2 22.983999 33.952000 26.802999 + HE2 22.219999 34.712002 26.936001 + CD2 22.903000 33.130001 25.624001 + HD2 22.111000 33.318001 24.900999 + C 24.947001 30.038000 22.356001 + O 24.216000 30.195999 21.427999 + N 25.598000 28.941999 22.584000 + H 26.207001 28.931999 23.385000 + CA 25.349001 27.676001 21.865999 + HA 24.671000 27.948999 21.056999 + CB 26.749001 27.289000 21.340000 + HB 27.388000 26.997000 22.171000 + CG2 26.705999 26.254999 20.212000 + HG21 27.355000 26.475000 19.351999 + HG22 26.914000 25.242001 20.533001 + HG23 25.712000 26.202999 19.737000 + OG1 27.393000 28.341999 20.601000 + HG1 27.789000 28.841000 21.309000 + C 24.922001 26.525999 22.726999 + O 25.181000 26.426001 23.930000 + N 24.118999 25.614000 22.136999 + H 23.820000 25.702000 21.177000 + CA 23.483000 24.503000 22.913000 + HA 23.051001 24.987000 23.797001 + CB 22.294001 24.003000 22.058001 + HB 21.688000 23.301001 22.603001 + CG1 21.327000 25.091999 21.551001 + HG11 20.874001 25.617001 22.398001 + HG12 21.827000 25.747000 20.832001 + HG13 20.546000 24.577999 21.028999 + CG2 22.784000 23.254000 20.782000 + HG21 23.141001 22.271000 21.052999 + HG22 21.929001 23.236000 20.098000 + HG23 23.715000 23.697001 20.450001 + C 24.502001 23.422001 23.357000 + O 25.386999 22.961000 22.683001 + N 24.287001 22.780001 24.538000 + H 23.499001 23.054001 25.100000 + CA 24.993000 21.486000 24.877001 + HA 26.073000 21.452000 24.782000 + CB 25.000999 21.395000 26.378000 + HB 25.471001 20.450001 26.681999 + CG2 25.735001 22.523001 27.118999 + HG21 25.257999 23.504999 26.976999 + HG22 25.697001 22.327000 28.200001 + HG23 26.771999 22.646999 26.830999 + OG1 23.750999 21.481001 26.987000 + HG1 23.509001 22.400000 26.867001 + C 24.464001 20.247000 24.259001 + O 25.155001 19.209999 24.104000 + N 23.216000 20.298000 23.764000 + H 22.726000 21.122000 24.059000 + CA 22.584999 19.313999 22.858000 + HA 23.320000 19.025999 22.118999 + CB 22.096001 18.084999 23.761999 + HB1 21.372000 17.523001 23.155001 + HB2 23.006001 17.582001 24.048000 + CG 21.292999 18.393000 25.007999 + HG1 21.900000 19.101999 25.566999 + HG2 20.391001 18.969000 24.723000 + CD 20.731001 17.247000 25.778000 + OE1 21.452000 16.389000 26.348000 + OE2 19.544001 16.923000 25.650000 + C 21.327000 19.829000 22.055000 + O 21.096001 19.187000 21.031000 + N 20.468000 20.781000 22.559999 + H 20.693001 21.243999 23.438999 + CH3 19.399000 21.245001 21.722000 + HH31 18.851999 21.969000 22.299999 + HH32 18.773001 20.427999 21.362000 + HH33 19.750000 21.917000 20.934000 +256 + 100.0 100.0 100.0 + HH31 17.465000 22.867001 24.410000 + CH3 18.035000 23.754000 24.680000 + HH32 17.884001 24.636000 24.027000 + HH33 19.087000 23.475000 24.632000 + C 17.702999 24.142000 26.105000 + O 17.136999 25.162001 26.452999 + N 17.975000 23.150999 26.870001 + H 18.322001 22.292999 26.441000 + CA 17.745001 23.105000 28.371000 + HA1 16.839001 23.646000 28.636000 + HA2 17.606001 22.082001 28.719000 + C 18.905001 23.662001 29.245001 + O 18.649000 23.912001 30.469999 + N 20.080000 23.868000 28.650999 + H 20.191000 23.570999 27.693001 + CA 21.343000 24.289000 29.316000 + HA 21.129000 24.989000 30.143000 + CB 21.976999 23.028000 30.031000 + HB1 22.104000 22.247000 29.283001 + HB2 22.989000 23.254000 30.318001 + CG 21.198999 22.481001 31.233000 + HG1 20.951000 23.275999 31.938999 + HG2 20.365999 21.888000 30.870001 + CD 22.172001 21.570000 31.961000 + OE1 22.400000 20.405001 31.472000 + OE2 22.611000 21.950001 33.098000 + C 22.316000 24.913000 28.306000 + O 22.492001 24.308001 27.211000 + N 22.958000 26.051001 28.618000 + H 22.716000 26.495001 29.486000 + CA 23.700001 26.892000 27.677000 + HA 23.829000 26.362000 26.723000 + CB 22.931999 28.195999 27.277000 + HB1 22.788000 28.764999 28.194000 + HB2 23.540001 28.777000 26.589001 + CG 21.594000 28.039000 26.622000 + CD1 20.415001 27.868000 27.298000 + HD1 20.372000 27.827999 28.386000 + NE1 19.407000 27.691999 26.334999 + HE1 18.429001 27.679001 26.495001 + CE2 19.870001 27.780001 24.995001 + CZ2 19.316999 27.760000 23.686001 + HZ2 18.264999 27.461000 23.575001 + CH2 20.160999 28.163000 22.648001 + HH2 19.802000 28.318001 21.635000 + CZ3 21.500000 28.441000 22.851999 + HZ3 22.138000 28.636000 22.000000 + CE3 22.073999 28.289000 24.099001 + HE3 23.132000 28.489000 24.253000 + CD2 21.257000 28.016001 25.198999 + C 25.131001 27.174000 28.148001 + O 25.539000 27.235001 29.304001 + N 25.910000 27.452000 27.111000 + H 25.408001 27.589001 26.246000 + CA 27.305000 27.841000 27.153000 + HA 27.562000 28.122999 28.176001 + CB 28.240999 26.707001 26.677999 + HB 29.256001 26.947001 26.978001 + CG2 27.878000 25.311001 27.302999 + HG21 27.900999 25.396000 28.389000 + HG22 26.910000 24.948999 26.940001 + HG23 28.683001 24.631001 27.063000 + OG1 28.181000 26.523001 25.291000 + HG1 28.822001 27.188999 24.976999 + C 27.520000 29.121000 26.424000 + O 26.683001 29.577999 25.695000 + N 28.594999 29.889999 26.743000 + H 29.271000 29.643000 27.441000 + CA 28.862000 31.223000 26.091999 + HA 28.101999 31.448000 25.320000 + CB 28.684000 32.292000 27.230000 + HB1 27.701000 32.143002 27.653000 + HB2 29.421000 32.080002 28.024000 + CG 28.646999 33.741001 26.805000 + CD1 29.709999 34.643002 27.163000 + HD1 30.452999 34.299000 27.858999 + CE1 29.559999 35.960999 26.819000 + HE1 30.305000 36.693001 27.087000 + CZ 28.422001 36.415001 26.084000 + OH 28.340000 37.744999 25.767000 + HH 29.035999 38.219002 26.233000 + CE2 27.459000 35.522999 25.629999 + HE2 26.621000 35.854000 25.003000 + CD2 27.552000 34.187000 25.979000 + HD2 26.714001 33.598000 25.643999 + C 30.236000 31.212000 25.378000 + O 31.142000 30.457001 25.723000 + N 30.500999 32.127998 24.459000 + H 29.752001 32.705002 24.139999 + CA 31.833000 32.508999 23.962999 + HA 32.578999 32.179001 24.672001 + CB 32.030998 31.761000 22.600000 + HB1 32.006001 30.691999 22.788000 + HB2 31.174000 31.941999 21.930000 + CG 33.331001 32.138000 21.792000 + OD1 33.160999 32.638000 20.659000 + OD2 34.424000 32.182999 22.367001 + C 31.930000 34.002998 23.809000 + O 31.391001 34.573002 22.881001 + N 32.560001 34.709999 24.698000 + H 32.883999 34.268002 25.549999 + CA 32.736000 36.181000 24.636000 + HA 31.697001 36.485001 24.684000 + CB 33.575001 36.766998 25.802000 + HB1 34.618999 36.507000 25.646999 + HB2 33.571999 37.852001 25.664000 + CG 33.176998 36.376999 27.267000 + OD1 33.379002 35.158001 27.521999 + OD2 32.962002 37.251999 28.087000 + C 33.229000 36.764000 23.355000 + O 32.756001 37.816002 22.844999 + N 34.137001 35.991001 22.653999 + H 34.448002 35.118000 23.077999 + CA 34.694000 36.317001 21.332001 + HA 35.143002 37.312000 21.403000 + CB 35.877998 35.438000 21.024000 + HB1 36.348000 35.512001 20.049999 + HB2 36.640999 35.722000 21.731001 + HB3 35.529999 34.407001 21.021999 + C 33.738998 36.414001 20.187000 + O 33.950001 37.199001 19.301001 + N 32.598000 35.701000 20.211000 + H 32.494999 34.870998 20.789000 + CA 31.489000 35.786999 19.267000 + HA 31.796000 36.443001 18.462000 + CB 31.164000 34.429001 18.569000 + HB 30.259001 34.477001 17.993000 + CG2 32.345001 33.799000 17.733000 + HG21 32.325001 32.723000 17.719000 + HG22 32.195999 34.131001 16.712999 + HG23 33.285000 34.081001 18.216000 + OG1 30.909000 33.527000 19.649000 + HG1 31.745001 33.207001 19.968000 + C 30.125999 36.410999 19.745001 + O 29.340000 36.758999 18.879999 + N 29.983999 36.648998 21.039000 + H 30.719999 36.275002 21.621000 + CA 28.799000 37.056000 21.728001 + HA 28.997000 37.113998 22.797001 + CB 28.386999 38.574001 21.362000 + HB1 28.056000 38.633999 20.323000 + HB2 27.499001 38.966000 21.867001 + CG 29.461000 39.659000 21.523001 + HG1 30.318001 39.298000 20.934000 + HG2 29.114000 40.598999 21.098000 + CD 29.816999 40.007999 22.982000 + HD1 28.882999 40.296001 23.462000 + HD2 30.153999 39.106998 23.517000 + CE 30.851000 41.112999 23.075001 + HE1 30.660999 41.869999 22.327000 + HE2 30.813999 41.643002 24.034000 + NZ 32.164001 40.456001 22.881001 + HZ1 33.022999 40.921001 23.164000 + HZ2 32.205002 39.597000 23.392000 + HZ3 32.360001 40.305000 21.893000 + C 27.688999 35.959999 21.676001 + O 26.566999 36.375000 21.983999 + N 27.986000 34.714001 21.372000 + H 28.945000 34.450001 21.186001 + CA 26.959999 33.681999 21.054001 + HA 26.077999 34.332001 20.931000 + CB 27.250999 32.792000 19.844000 + HB 26.471001 32.034000 19.819000 + CG2 27.281000 33.601002 18.568001 + HG21 26.243000 33.804001 18.337999 + HG22 27.812000 34.539001 18.737000 + HG23 27.771000 33.154999 17.723000 + OG1 28.468000 32.174000 19.990000 + HG1 29.146000 32.840000 19.874001 + C 26.705999 32.813000 22.275000 + O 27.611000 32.591999 23.033001 + N 25.427999 32.382999 22.482000 + H 24.882000 32.398998 21.636999 + CA 25.153999 31.329000 23.431999 + HA 25.917000 31.341999 24.216999 + CB 23.858999 31.618999 24.214001 + HB1 23.075001 32.033001 23.545000 + HB2 23.297001 30.753000 24.540001 + CG 23.892000 32.720001 25.232000 + CD1 24.030001 32.431000 26.622999 + HD1 24.097000 31.396000 26.958000 + CE1 24.072001 33.462002 27.565001 + HE1 23.973000 33.259998 28.632999 + CZ 23.864000 34.759998 27.138000 + HZ 23.917999 35.556999 27.850000 + CE2 23.702000 35.109001 25.778000 + HE2 23.656000 36.150002 25.462000 + CD2 23.701000 34.056999 24.819000 + HD2 23.639999 34.423000 23.798000 + C 25.132000 30.004000 22.707001 + O 24.617001 30.032000 21.604000 + N 25.625999 28.878000 23.259001 + H 26.082001 28.893999 24.153999 + CA 25.528999 27.591999 22.542000 + HA 24.752001 27.650000 21.774000 + CB 26.851000 27.257000 21.830000 + HB 27.546000 26.955000 22.612000 + CG2 26.719999 26.034000 20.937000 + HG21 26.105000 26.309999 20.073999 + HG22 27.691000 25.665001 20.591999 + HG23 26.353001 25.166000 21.480000 + OG1 27.466000 28.214001 20.979000 + HG1 27.698000 29.011000 21.466000 + C 25.017000 26.502001 23.445999 + O 25.253000 26.510000 24.615999 + N 24.211000 25.558001 22.915001 + H 24.162001 25.423000 21.917000 + CA 23.544001 24.499001 23.680000 + HA 23.172001 24.948000 24.608000 + CB 22.393999 23.858999 22.951000 + HB 22.077999 22.964001 23.507000 + CG1 21.252001 24.916000 22.853001 + HG11 20.392000 24.464001 22.350000 + HG12 21.106001 25.233000 23.889000 + HG13 21.599001 25.778999 22.292000 + CG2 22.808001 23.459999 21.545000 + HG21 22.684000 24.295000 20.874001 + HG22 23.837999 23.094999 21.415001 + HG23 22.195000 22.657000 21.167999 + C 24.546000 23.440001 24.113001 + O 25.517000 23.112000 23.340000 + N 24.243999 22.787001 25.239000 + H 23.671000 23.288000 25.899000 + CA 25.114000 21.702000 25.764000 + HA 26.146000 22.028000 25.910999 + CB 24.688999 21.309000 27.150999 + HB 25.270000 20.436001 27.443001 + CG2 25.084999 22.348000 28.166000 + HG21 24.806000 22.127001 29.184000 + HG22 26.162001 22.440001 28.222000 + HG23 24.791000 23.341000 27.818001 + OG1 23.302000 21.031000 27.287001 + HG1 23.221001 20.414000 28.018000 + C 25.093000 20.375999 24.951000 + O 25.999001 19.569000 25.025999 + N 24.034000 20.183001 24.228001 + H 23.285000 20.849001 24.408001 + CA 23.697001 19.146999 23.254000 + HA 24.238001 18.195000 23.372000 + CB 22.216000 18.884001 23.339001 + HB1 21.938999 18.108000 22.636000 + HB2 21.979000 18.450001 24.305000 + CG 21.280001 20.103001 23.132999 + HG1 21.322001 20.608000 24.097000 + HG2 21.563000 20.740000 22.296000 + CD 19.899000 19.638000 22.813000 + OE1 19.018999 19.666000 23.701000 + OE2 19.584000 19.257000 21.643999 + C 24.194000 19.565001 21.820999 + O 23.872000 18.934999 20.798000 + N 24.879000 20.705000 21.646000 + H 25.197001 21.143000 22.488001 + CH3 25.521999 21.034000 20.356001 + HH31 26.065001 20.201000 19.936001 + HH32 26.230000 21.847000 20.490000 + HH33 24.757999 21.421000 19.650999 +256 + 100.0 100.0 100.0 + HH31 21.662001 15.337000 29.980000 + CH3 20.861000 16.034000 29.716000 + HH32 20.677999 16.533001 30.664000 + HH33 20.056000 15.462000 29.268000 + C 21.186001 17.204000 28.768999 + O 20.469000 17.374001 27.806000 + N 22.339001 17.864000 29.014000 + H 22.980000 17.590000 29.759001 + CA 22.731001 19.159000 28.299999 + HA1 23.795000 19.298000 28.375000 + HA2 22.500999 19.101999 27.235001 + C 22.025000 20.400000 28.745001 + O 20.895000 20.285999 29.214001 + N 22.701000 21.579000 28.660999 + H 23.650999 21.500000 28.393000 + CA 22.240000 22.844000 29.201000 + HA 21.146999 22.915001 29.198999 + CB 22.792000 23.049000 30.577999 + HB1 22.268999 23.870001 31.094999 + HB2 22.517000 22.156000 31.143999 + CG 24.225000 23.362000 30.684999 + HG1 24.518999 24.231001 30.087999 + HG2 24.445000 23.657000 31.712999 + CD 25.121000 22.149000 30.349001 + OE1 24.850000 21.021999 30.808001 + OE2 26.028999 22.242001 29.471001 + C 22.701000 23.959000 28.341999 + O 23.245001 23.743000 27.313000 + N 22.459000 25.237000 28.707001 + H 22.059000 25.475000 29.608000 + CA 22.624001 26.424000 27.872999 + HA 23.131001 26.080999 26.955999 + CB 21.246000 27.082001 27.646000 + HB1 20.549999 26.353001 27.260000 + HB2 20.820000 27.506001 28.577000 + CG 21.223000 28.216999 26.660999 + CD1 20.641001 28.117001 25.486000 + HD1 20.221001 27.215000 25.076000 + NE1 20.617001 29.362000 24.930000 + HE1 20.135000 29.598000 24.073999 + CE2 21.249001 30.334000 25.643999 + CZ2 21.341000 31.726000 25.511999 + HZ2 21.002001 32.237000 24.632999 + CH2 22.098000 32.435001 26.427999 + HH2 22.275000 33.477001 26.253000 + CZ3 22.607000 31.825001 27.538000 + HZ3 23.261000 32.387001 28.202000 + CE3 22.365000 30.448000 27.766001 + HE3 22.898001 30.004999 28.586000 + CD2 21.663000 29.631001 26.802999 + C 23.634001 27.410000 28.458000 + O 23.457001 27.865999 29.556000 + N 24.549999 27.905001 27.577000 + H 24.539000 27.573999 26.632000 + CA 25.538000 28.889000 27.962000 + HA 25.106001 29.329000 28.864000 + CB 26.872000 28.284000 28.459999 + HB 27.482000 29.141001 28.707001 + CG2 26.643999 27.665001 29.836000 + HG21 26.330000 28.423000 30.555000 + HG22 26.028000 26.766001 29.917999 + HG23 27.636000 27.375000 30.181999 + OG1 27.601000 27.452000 27.552999 + HG1 27.164000 26.615000 27.523001 + C 25.874001 29.872999 26.812000 + O 25.768000 29.481001 25.677999 + N 26.242001 31.112000 27.169001 + H 26.371000 31.264999 28.162001 + CA 26.816000 32.131001 26.202999 + HA 26.641001 31.834999 25.177999 + CB 25.948000 33.389000 26.409000 + HB1 24.922001 33.056999 26.242001 + HB2 26.009001 33.748001 27.427000 + CG 26.365999 34.525002 25.544001 + CD1 27.354000 35.396999 26.014999 + HD1 28.017000 35.152000 26.839001 + CE1 27.646000 36.551998 25.284000 + HE1 28.298000 37.303001 25.664000 + CZ 26.938999 36.856998 24.097000 + OH 27.125999 38.067001 23.461000 + HH 27.556000 38.724998 24.025999 + CE2 26.070999 35.931000 23.542000 + HE2 25.558001 36.265999 22.655001 + CD2 25.754999 34.752998 24.238001 + HD2 24.908001 34.123001 23.983999 + C 28.325001 32.254002 26.590000 + O 28.775000 32.096001 27.768000 + N 29.118000 32.566002 25.497000 + H 28.636999 32.698002 24.608999 + CA 30.514999 32.930000 25.504999 + HA 30.754000 32.945000 26.558001 + CB 31.295000 31.825001 24.688000 + HB1 31.167000 30.882000 25.207001 + HB2 30.917000 31.757999 23.677000 + CG 32.797001 32.231998 24.753000 + OD1 33.284000 32.625999 25.832001 + OD2 33.436001 32.317001 23.739000 + C 30.695000 34.463001 25.056000 + O 30.176001 34.841000 24.018000 + N 31.423000 35.292000 25.775000 + H 31.737000 34.966000 26.684000 + CA 31.787001 36.719002 25.495001 + HA 30.944000 37.189999 25.002001 + CB 32.056999 37.539001 26.716999 + HB1 31.225000 37.484001 27.424000 + HB2 32.926998 37.151001 27.238001 + CG 32.172001 39.032001 26.421000 + OD1 32.845001 39.733002 27.242001 + OD2 31.466000 39.449001 25.500999 + C 32.922001 36.868000 24.464001 + O 32.819000 37.721001 23.632999 + N 33.893002 35.921001 24.535000 + H 33.801998 35.176998 25.212999 + CA 34.980999 35.861000 23.597000 + HA 35.448002 36.821999 23.488001 + CB 36.111000 34.974998 24.222000 + HB1 36.798000 34.681000 23.429001 + HB2 36.577000 35.667000 24.922001 + HB3 35.719002 34.071999 24.673000 + C 34.595001 35.222000 22.165001 + O 35.460999 35.075001 21.295000 + N 33.366001 34.778999 22.034000 + H 32.771999 34.849998 22.841999 + CA 32.787998 34.490002 20.629000 + HA 33.519001 34.953999 19.947001 + CB 32.910999 33.005001 20.362000 + HB 32.539001 32.797001 19.350000 + CG2 34.321999 32.452999 20.290001 + HG21 34.303001 31.392000 20.000000 + HG22 34.993000 32.890999 19.552999 + HG23 34.777000 32.375000 21.297001 + OG1 32.195000 32.299999 21.389999 + HG1 32.654999 32.264000 22.229000 + C 31.452999 35.133999 20.289000 + O 30.987000 35.115002 19.148001 + N 30.841999 35.761002 21.364000 + H 31.355000 35.785999 22.226999 + CA 29.504999 36.396999 21.305000 + HA 29.296000 36.701000 22.309999 + CB 29.530001 37.702000 20.583000 + HB1 29.809000 37.570000 19.525000 + HB2 28.523001 38.117001 20.608000 + CG 30.552999 38.791000 21.020000 + HG1 31.548000 38.338001 21.016001 + HG2 30.622999 39.566002 20.256001 + CD 30.344000 39.500999 22.393000 + HD1 29.344000 39.938999 22.444000 + HD2 30.368999 38.812000 23.226000 + CE 31.143999 40.744999 22.725000 + HE1 31.187000 41.319000 21.784000 + HE2 30.545000 41.252998 23.472000 + NZ 32.528999 40.403999 23.077999 + HZ1 33.036999 40.074001 22.275999 + HZ2 32.875999 41.314999 23.372999 + HZ3 32.560001 39.723999 23.820000 + C 28.336000 35.449001 20.830999 + O 27.386999 35.841999 20.167999 + N 28.513000 34.188999 21.128000 + H 29.211000 33.905998 21.815001 + CA 27.580000 33.138000 20.691999 + HA 26.888000 33.514000 19.948999 + CB 28.351000 31.892000 20.216000 + HB 27.691000 31.039000 20.172001 + CG2 28.868000 32.075001 18.812000 + HG21 28.702000 31.051001 18.452999 + HG22 28.150999 32.671001 18.214001 + HG23 29.836000 32.578999 18.711000 + OG1 29.441000 31.597000 21.066000 + HG1 30.212999 31.992001 20.674999 + C 26.759001 32.675999 21.882000 + O 27.187000 32.659000 23.051001 + N 25.606001 32.021999 21.518999 + H 25.290001 32.060001 20.554001 + CA 24.716000 31.250999 22.452000 + HA 25.249001 31.225000 23.403000 + CB 23.368999 31.941000 22.683001 + HB1 22.677000 31.226000 23.117001 + HB2 23.419001 32.714001 23.452000 + CG 22.754999 32.638000 21.429001 + CD1 22.832001 34.005001 21.246000 + HD1 23.054001 34.639999 22.087999 + CE1 22.646999 34.463001 19.950001 + HE1 22.916000 35.478001 19.740000 + CZ 22.056999 33.699001 18.952999 + HZ 21.683001 34.189999 18.056999 + CE2 21.782000 32.355000 19.274000 + HE2 21.466999 31.816999 18.386999 + CD2 22.169001 31.778000 20.471001 + HD2 22.148001 30.702999 20.579000 + C 24.580000 29.846001 21.950001 + O 24.247000 29.700001 20.789000 + N 24.954000 28.912001 22.836000 + H 24.969999 29.167000 23.818001 + CA 25.458000 27.554001 22.545000 + HA 25.195999 27.339001 21.504999 + CB 27.020000 27.437000 22.621000 + HB 27.164000 26.438000 22.208000 + CG2 27.799999 28.430000 21.663000 + HG21 28.858000 28.278999 21.492001 + HG22 27.284000 28.332001 20.691000 + HG23 27.697001 29.440001 22.006001 + OG1 27.618000 27.726999 23.874001 + HG1 26.985001 28.264999 24.362000 + C 24.822001 26.535000 23.497000 + O 24.528999 26.739000 24.653999 + N 24.568001 25.304001 23.066000 + H 25.034000 24.969000 22.216999 + CA 23.833000 24.237000 23.756001 + HA 23.796000 24.444000 24.830000 + CB 22.386000 24.264999 23.292000 + HB 21.958000 23.464001 23.917000 + CG1 21.673000 25.614000 23.624001 + HG11 21.820999 25.931000 24.653000 + HG12 21.966000 26.462000 23.028999 + HG13 20.615000 25.615000 23.371000 + CG2 22.104000 24.016001 21.775999 + HG21 22.462000 24.937000 21.302999 + HG22 22.754000 23.195999 21.476000 + HG23 21.040001 23.812000 21.664000 + C 24.558001 22.893000 23.641001 + O 25.173000 22.530001 22.580000 + N 24.608999 22.006001 24.679001 + H 24.136000 22.357000 25.499001 + CA 25.391001 20.725000 24.777000 + HA 26.223000 20.760000 24.072001 + CB 26.070999 20.605000 26.156000 + HB 26.534000 19.642000 26.302999 + CG2 27.271999 21.618000 26.336000 + HG21 27.730000 21.621000 27.333000 + HG22 28.018000 21.329000 25.600000 + HG23 26.951000 22.641001 26.219000 + OG1 25.280001 20.940001 27.281000 + HG1 25.589001 21.677999 27.809999 + C 24.531000 19.541000 24.424999 + O 24.363001 18.594000 25.247999 + N 24.028000 19.572001 23.186001 + H 24.464001 20.350000 22.708000 + CA 23.198000 18.518000 22.577000 + HA 23.582001 17.528000 22.820000 + CB 21.684000 18.667999 22.969000 + HB1 21.083000 18.193001 22.207001 + HB2 21.516001 18.264000 23.952999 + CG 21.172001 20.146000 22.912001 + HG1 21.655001 20.820000 23.622999 + HG2 21.225000 20.613001 21.921000 + CD 19.632000 20.253000 23.271000 + OE1 19.271000 20.729000 24.327000 + OE2 18.794001 19.777000 22.438999 + C 23.333000 18.455999 21.049000 + O 23.535999 19.521999 20.395000 + N 23.209000 17.260000 20.433001 + H 22.934999 16.511000 21.027000 + CH3 23.129999 17.070000 18.961000 + HH31 23.136999 17.989000 18.374001 + HH32 22.274000 16.462999 18.721001 + HH33 23.973000 16.514999 18.552000 +256 + 100.0 100.0 100.0 + HH31 17.886999 16.448000 27.833000 + CH3 17.636999 17.520000 27.870001 + HH32 17.059000 17.691999 28.773001 + HH33 17.016001 17.743999 27.007999 + C 18.837000 18.336000 28.080000 + O 19.363001 18.289000 29.145000 + N 19.364000 19.045000 27.084000 + H 18.910999 18.929001 26.191999 + CA 20.549999 19.879999 27.107000 + HA1 21.459999 19.308001 27.330999 + HA2 20.844000 20.291000 26.131001 + C 20.478001 21.024000 28.047001 + O 19.534000 21.306999 28.606001 + N 21.548000 21.818001 27.934999 + H 22.367001 21.465000 27.440001 + CA 21.695999 23.129999 28.666000 + HA 20.733000 23.584999 28.864000 + CB 22.440001 22.773001 30.066999 + HB1 22.332001 23.582001 30.796000 + HB2 21.971001 21.872000 30.499001 + CG 23.858000 22.382000 29.868999 + HG1 23.983999 21.792999 28.958000 + HG2 24.336000 23.358000 29.714001 + CD 24.368999 21.622000 31.077999 + OE1 25.186001 22.208000 31.830000 + OE2 24.167000 20.427000 31.037001 + C 22.478001 24.146000 27.906000 + O 23.150000 23.841000 26.933001 + N 22.320000 25.434999 28.326000 + H 21.663000 25.500999 29.090000 + CA 22.657000 26.712000 27.714001 + HA 23.035999 26.478001 26.728001 + CB 21.413000 27.531000 27.517000 + HB1 20.580000 27.011999 27.052999 + HB2 21.007999 27.825001 28.492001 + CG 21.658001 28.722000 26.653000 + CD1 21.271000 28.729000 25.371000 + HD1 20.879999 27.921000 24.766001 + NE1 21.410000 29.990999 24.884001 + HE1 21.066999 30.346001 24.010000 + CE2 21.937000 30.858000 25.778000 + CZ2 22.295000 32.235001 25.761999 + HZ2 22.084000 32.834999 24.893999 + CH2 22.794001 32.810001 26.905001 + HH2 22.962000 33.862999 26.945000 + CZ3 23.024000 32.056000 28.080000 + HZ3 23.348000 32.533001 28.995001 + CE3 22.680000 30.691999 28.101000 + HE3 22.740000 30.160999 29.047001 + CD2 22.129000 30.082001 26.961000 + C 23.868999 27.528999 28.325001 + O 23.903000 27.667000 29.556999 + N 24.754000 28.034000 27.450001 + H 24.451000 28.143000 26.483999 + CA 25.974001 28.705000 27.941000 + HA 25.680000 29.270000 28.826000 + CB 27.159000 27.632999 28.280001 + HB 27.864000 28.205000 28.891001 + CG2 26.858000 26.450001 29.204000 + HG21 26.367001 25.677000 28.622000 + HG22 27.791000 26.122000 29.684000 + HG23 26.250000 26.664000 30.075001 + OG1 27.816999 27.107000 27.221001 + HG1 28.507000 27.742001 26.992001 + C 26.559000 29.693001 26.990999 + O 26.514999 29.569000 25.747999 + N 27.004999 30.778999 27.566999 + H 27.261999 30.740999 28.554001 + CA 27.462999 32.019001 26.871000 + HA 27.028999 31.979000 25.870001 + CB 26.848000 33.264999 27.506001 + HB1 25.768000 33.199001 27.327999 + HB2 27.190001 33.240002 28.542999 + CG 27.261999 34.646999 26.958000 + CD1 28.146000 35.455002 27.632999 + HD1 28.533001 35.063000 28.570999 + CE1 28.566000 36.702000 27.207001 + HE1 29.364000 37.217999 27.698999 + CZ 28.141001 37.136002 25.910999 + OH 28.469999 38.396000 25.545000 + HH 29.236000 38.702000 26.059000 + CE2 27.209000 36.338001 25.177999 + HE2 26.980000 36.626999 24.152000 + CD2 26.743999 35.076000 25.702999 + HD2 26.018000 34.514999 25.124001 + C 29.010000 32.165001 26.608999 + O 29.858000 31.445000 27.111000 + N 29.386000 32.949001 25.590000 + H 28.701000 33.388000 24.987000 + CA 30.851000 33.300999 25.405001 + HA 31.301001 33.155998 26.378000 + CB 31.516001 32.362000 24.410000 + HB1 31.493000 31.339001 24.797001 + HB2 30.882999 32.374001 23.510000 + CG 32.905998 32.875000 23.978001 + OD1 33.223000 32.963001 22.752001 + OD2 33.806999 32.930000 24.905001 + C 31.031000 34.723999 25.014999 + O 30.510000 35.180000 23.945999 + N 31.840000 35.480999 25.806000 + H 32.143002 35.154999 26.718000 + CA 32.117001 36.904999 25.551001 + HA 31.159000 37.216000 25.110001 + CB 32.442001 37.696999 26.757999 + HB1 31.844000 37.456001 27.634001 + HB2 33.466999 37.755001 27.125000 + CG 31.979000 39.183998 26.478001 + OD1 30.770000 39.448002 26.506001 + OD2 32.901001 39.995998 26.413000 + C 33.150002 37.139000 24.415001 + O 32.973999 38.089001 23.629000 + N 34.069000 36.193001 24.150000 + H 33.963001 35.349998 24.695999 + CA 35.150002 36.247002 23.225000 + HA 35.743000 37.162998 23.334999 + CB 36.176998 35.146000 23.521000 + HB1 36.838001 35.047001 22.673000 + HB2 36.623001 35.424000 24.479000 + HB3 35.700001 34.178001 23.649000 + C 34.622002 36.143002 21.740999 + O 35.307999 36.585999 20.784000 + N 33.431999 35.544998 21.466999 + H 33.075001 34.936001 22.172001 + CA 32.813999 35.506001 20.150999 + HA 33.397999 36.195000 19.566000 + CB 32.949001 34.118999 19.476999 + HB 32.469002 34.148998 18.497000 + CG2 34.397999 33.712002 19.230000 + HG21 34.355000 32.910999 18.500999 + HG22 35.042000 34.519001 18.892000 + HG23 34.731998 33.285000 20.170000 + OG1 32.359001 33.127998 20.278000 + HG1 32.694000 33.159000 21.171000 + C 31.354000 36.035999 20.155001 + O 30.771999 36.175999 19.073999 + N 30.819000 36.511002 21.257999 + H 31.242001 36.355999 22.167999 + CA 29.422001 37.039001 21.426001 + HA 29.334999 37.175999 22.506001 + CB 29.319000 38.431000 20.767000 + HB1 29.378000 38.412998 19.679001 + HB2 28.319000 38.794998 20.995001 + CG 30.370001 39.355000 21.289000 + HG1 31.382999 38.987000 21.120001 + HG2 30.200001 40.240002 20.676001 + CD 30.058001 39.771999 22.750999 + HD1 28.996000 40.070000 22.837999 + HD2 30.190001 38.874001 23.344000 + CE 30.902000 40.890999 23.153000 + HE1 31.943001 40.518002 23.174999 + HE2 30.707001 41.706001 22.472000 + NZ 30.426001 41.414001 24.451000 + HZ1 31.091000 42.073002 24.837000 + HZ2 29.593000 41.973000 24.551001 + HZ3 30.309999 40.638000 25.093000 + C 28.358000 36.015999 20.975000 + O 27.566000 36.214001 20.011999 + N 28.434999 34.848000 21.570999 + H 29.049999 34.742001 22.367001 + CA 27.562000 33.685001 21.214001 + HA 26.742001 34.077000 20.638000 + CB 28.368999 32.744999 20.309999 + HB 27.702999 31.899000 20.131001 + CG2 28.638000 33.437000 18.931999 + HG21 27.679001 33.668999 18.466000 + HG22 29.268999 34.280998 19.139000 + HG23 29.094999 32.673000 18.313999 + OG1 29.539000 32.284000 20.812000 + HG1 30.266001 32.854000 20.577000 + C 26.972000 32.923000 22.384001 + O 27.521000 32.944000 23.441000 + N 25.962999 32.084000 22.007999 + H 25.865000 32.021999 21.007000 + CA 25.403999 30.930000 22.757999 + HA 25.906000 30.969000 23.731001 + CB 23.889000 31.089001 22.895000 + HB1 23.617001 30.223000 23.490999 + HB2 23.729000 31.948000 23.549999 + CG 23.031000 31.062000 21.667000 + CD1 22.431000 32.248001 21.125000 + HD1 22.554001 33.136002 21.705000 + CE1 21.669001 32.299999 19.982000 + HE1 21.177000 33.179001 19.583000 + CZ 21.533001 31.052000 19.287001 + HZ 20.934999 31.059000 18.386999 + CE2 21.938999 29.825001 19.841999 + HE2 21.673000 28.896999 19.379000 + CD2 22.771999 29.850000 20.980000 + HD2 23.201000 28.940001 21.399000 + C 25.896999 29.643000 22.183001 + O 26.080999 29.476999 20.976999 + N 25.959999 28.620001 23.091999 + H 25.971001 28.808001 24.070999 + CA 26.261999 27.208000 22.680000 + HA 26.077999 27.054001 21.604000 + CB 27.768000 26.922001 22.948000 + HB 27.993999 27.046000 23.986000 + CG2 28.186001 25.521999 22.409000 + HG21 27.702000 24.667999 22.915001 + HG22 27.896000 25.436001 21.367001 + HG23 29.280001 25.400999 22.483000 + OG1 28.568001 27.728001 22.315001 + HG1 28.482000 28.584999 22.747999 + C 25.395000 26.250000 23.441000 + O 25.070999 26.565001 24.632000 + N 24.757999 25.218000 22.849001 + H 25.002001 25.084999 21.892000 + CA 23.830999 24.202999 23.441999 + HA 23.827999 24.283001 24.521000 + CB 22.398001 24.461000 23.034000 + HB 21.877001 23.511999 23.152000 + CG1 21.677999 25.534000 23.802999 + HG11 21.445999 25.143999 24.788000 + HG12 22.287001 26.436001 23.731001 + HG13 20.702000 25.657000 23.362000 + CG2 22.216000 24.761999 21.566999 + HG21 21.171000 24.646999 21.256001 + HG22 22.603001 25.714001 21.239000 + HG23 22.774000 24.042000 20.950001 + C 24.283001 22.764999 23.084999 + O 24.275999 22.414000 21.964001 + N 24.479000 21.902000 24.077000 + H 24.421000 22.325001 25.011000 + CA 24.857000 20.399000 23.965000 + HA 25.766001 20.344999 23.358000 + CB 24.993000 19.683001 25.313000 + HB 24.937000 18.591999 25.308001 + CG2 26.284000 20.070999 26.160999 + HG21 26.103001 21.076000 26.535000 + HG22 26.541000 19.339001 26.929001 + HG23 27.165001 20.066999 25.496000 + OG1 23.888000 20.103001 26.046000 + HG1 23.966000 19.698000 26.914000 + C 23.861000 19.577000 23.149000 + O 24.201000 18.513000 22.552000 + N 22.613001 20.083000 22.927000 + H 22.277000 20.795000 23.591000 + CA 21.573999 19.452999 22.023001 + HA 21.900000 18.473000 21.660000 + CB 20.421000 19.098000 22.924000 + HB1 20.073999 19.976999 23.478001 + HB2 19.594000 18.708000 22.323000 + CG 20.723000 17.882000 23.851000 + HG1 21.205000 17.117001 23.247999 + HG2 21.367001 18.174999 24.684999 + CD 19.469999 17.253000 24.382000 + OE1 19.549000 16.103001 24.924000 + OE2 18.408001 17.878000 24.290001 + C 21.118999 20.205999 20.753000 + O 20.164000 19.771999 20.061001 + N 21.747999 21.363001 20.391001 + H 22.556000 21.718000 20.891001 + CH3 21.469000 22.047001 19.132999 + HH31 22.375000 22.320999 18.615999 + HH32 20.775999 22.879999 19.308001 + HH33 21.098000 21.313999 18.417999 +256 + 100.0 100.0 100.0 + HH31 24.733000 17.898001 29.659000 + CH3 24.452000 18.396000 28.732000 + HH32 24.849001 17.715000 27.974001 + HH33 24.965000 19.354000 28.670000 + C 22.969000 18.635000 28.725000 + O 22.274000 18.607000 29.781000 + N 22.459999 18.916000 27.489000 + H 23.103001 18.801001 26.731001 + CA 21.139000 19.462999 27.219999 + HA1 20.993000 19.355000 26.146999 + HA2 20.459999 18.827999 27.792999 + C 20.986000 20.922001 27.518999 + O 20.018000 21.545000 27.117001 + N 21.937000 21.503000 28.302999 + H 22.652000 20.903999 28.712000 + CA 21.875999 22.875000 28.879999 + HA 20.823999 23.103001 28.978001 + CB 22.490999 22.930000 30.322001 + HB1 22.283001 23.941999 30.622999 + HB2 21.829000 22.294001 30.936001 + CG 23.952999 22.636000 30.528999 + HG1 24.087000 21.563999 30.480000 + HG2 24.382999 23.082001 29.620001 + CD 24.664000 23.216999 31.731001 + OE1 25.924999 23.066000 31.792000 + OE2 24.062000 23.813000 32.638000 + C 22.455000 23.982000 27.962999 + O 23.288000 23.715000 27.105000 + N 22.066999 25.257999 28.238001 + H 21.582001 25.348000 29.114000 + CA 22.514999 26.488001 27.599001 + HA 22.579000 26.171000 26.551001 + CB 21.296000 27.472000 27.627001 + HB1 20.349001 26.957001 27.518999 + HB2 21.292000 27.892000 28.624001 + CG 21.295000 28.688000 26.698000 + CD1 20.809999 28.739000 25.419001 + HD1 20.245001 27.996000 24.898001 + NE1 21.153000 29.927000 24.822001 + HE1 20.910999 30.128000 23.862000 + CE2 21.830000 30.771000 25.705000 + CZ2 22.299999 32.084000 25.590000 + HZ2 22.004999 32.647999 24.718000 + CH2 22.936001 32.709999 26.669001 + HH2 23.256001 33.729000 26.532000 + CZ3 23.180000 31.929001 27.827000 + HZ3 23.761999 32.296001 28.660000 + CE3 22.704000 30.584000 27.972000 + HE3 22.966000 30.039000 28.858000 + CD2 21.937000 30.024000 26.900000 + C 23.790001 27.049000 28.077000 + O 23.979000 27.245001 29.250000 + N 24.664000 27.459000 27.167999 + H 24.493999 27.230000 26.198000 + CA 25.944000 28.215000 27.511999 + HA 25.858000 28.559000 28.531000 + CB 27.127001 27.233999 27.625000 + HB 28.094000 27.754999 27.599001 + CG2 27.125999 26.485001 28.971001 + HG21 28.070999 25.936001 28.988001 + HG22 27.077999 27.235001 29.771000 + HG23 26.226000 25.895000 29.132999 + OG1 27.122000 26.291000 26.610001 + HG1 26.299000 26.406000 26.128000 + C 26.318001 29.334999 26.612000 + O 25.931000 29.290001 25.406000 + N 26.937000 30.419001 27.214001 + H 27.208000 30.348000 28.184000 + CA 27.393000 31.665001 26.514999 + HA 26.924000 31.650999 25.537001 + CB 26.936001 32.923000 27.348000 + HB1 25.841000 32.842999 27.466000 + HB2 27.365999 32.735001 28.327999 + CG 27.353001 34.301998 26.784000 + CD1 28.195000 35.095001 27.549999 + HD1 28.518000 34.873001 28.552999 + CE1 28.516001 36.407001 27.080999 + HE1 29.082001 37.053001 27.733999 + CZ 27.983999 36.919998 25.889000 + OH 28.358999 38.113998 25.357000 + HH 29.028999 38.589001 25.847000 + CE2 27.202000 36.049999 25.077999 + HE2 26.775999 36.417000 24.158001 + CD2 26.856001 34.779999 25.548000 + HD2 26.242001 34.161999 24.915001 + C 28.908001 31.686001 26.368999 + O 29.594999 30.900999 27.076000 + N 29.541000 32.520000 25.540001 + H 28.945999 33.144001 25.034000 + CA 30.965000 32.807999 25.399000 + HA 31.499001 32.728001 26.368000 + CB 31.775000 31.896000 24.535999 + HB1 32.002998 30.976000 25.030001 + HB2 31.254999 31.729000 23.584000 + CG 33.110001 32.515999 24.207001 + OD1 33.905998 32.730999 25.113001 + OD2 33.334000 32.654999 22.987000 + C 31.105000 34.262001 24.892000 + O 30.858000 34.618000 23.715000 + N 31.629999 35.123001 25.740000 + H 31.801001 34.918999 26.709999 + CA 31.686001 36.534000 25.382000 + HA 30.695000 36.832001 25.011000 + CB 31.891001 37.368000 26.670000 + HB1 31.207001 36.912998 27.393999 + HB2 32.882000 37.275002 27.114000 + CG 31.686001 38.876999 26.488001 + OD1 30.497999 39.277000 26.441999 + OD2 32.632999 39.618999 26.233999 + C 32.693001 36.846001 24.339001 + O 32.523998 37.744999 23.490999 + N 33.800999 36.090000 24.323999 + H 33.880001 35.432999 25.098000 + CA 34.862999 36.185001 23.351000 + HA 35.362000 37.127998 23.506001 + CB 35.958000 35.210999 23.770000 + HB1 35.625999 34.160000 23.805000 + HB2 36.679001 35.311001 22.966000 + HB3 36.372002 35.522999 24.739000 + C 34.466999 35.936001 21.872999 + O 35.224998 36.155998 20.940001 + N 33.238998 35.365002 21.695999 + H 32.812000 34.952000 22.509001 + CA 32.587002 35.181000 20.334999 + HA 33.251999 35.653000 19.600000 + CB 32.472000 33.657001 19.893000 + HB 31.891001 33.698002 18.981001 + CG2 33.896999 33.044998 19.625000 + HG21 34.542999 33.022999 20.490999 + HG22 33.709000 32.033001 19.254000 + HG23 34.313999 33.556000 18.770000 + OG1 31.795000 32.990002 20.917999 + HG1 32.449001 32.827999 21.584000 + C 31.194000 35.888000 20.263000 + O 30.659000 36.123001 19.143000 + N 30.684000 36.381001 21.351999 + H 31.156000 36.174000 22.226999 + CA 29.305000 36.761002 21.459999 + HA 29.184999 36.771000 22.552999 + CB 28.923000 38.148998 20.962000 + HB1 28.908001 38.033001 19.863001 + HB2 27.922001 38.449001 21.261000 + CG 29.847000 39.402000 21.191999 + HG1 30.841999 39.118000 20.856001 + HG2 29.415001 40.252998 20.653000 + CD 29.893000 39.845001 22.681000 + HD1 28.910000 40.095001 23.089001 + HD2 30.285000 39.061001 23.325001 + CE 30.825001 41.063999 22.917000 + HE1 31.714001 40.983002 22.291000 + HE2 30.344000 42.000999 22.671000 + NZ 31.319000 41.192001 24.323000 + HZ1 31.575001 40.334999 24.798000 + HZ2 32.103001 41.823002 24.355000 + HZ3 30.577000 41.567001 24.905001 + C 28.257000 35.695999 21.091999 + O 27.073999 36.021999 20.809000 + N 28.570000 34.408001 21.002001 + H 29.448000 34.092999 21.361000 + CA 27.709999 33.388000 20.556999 + HA 26.907000 33.828999 19.976999 + CB 28.520000 32.305000 19.747999 + HB 27.795000 31.548000 19.447001 + CG2 28.986000 33.018002 18.510000 + HG21 28.219999 33.407001 17.856001 + HG22 29.559999 33.907001 18.740000 + HG23 29.541000 32.311001 17.871000 + OG1 29.524000 31.665001 20.492001 + HG1 30.228001 32.300999 20.673000 + C 26.987000 32.577000 21.724001 + O 27.351999 32.762001 22.864000 + N 25.985001 31.763000 21.419001 + H 25.613001 31.841000 20.490999 + CA 25.412001 30.754000 22.336000 + HA 26.086000 30.739000 23.201000 + CB 24.010000 31.070999 22.820000 + HB1 23.674999 30.299999 23.518999 + HB2 24.129999 32.029999 23.333000 + CG 22.889000 31.415001 21.846001 + CD1 22.771999 32.722000 21.333000 + HD1 23.465000 33.449001 21.714001 + CE1 21.705000 33.063999 20.549999 + HE1 21.652000 34.113998 20.354000 + CZ 20.819000 32.152000 20.070000 + HZ 20.033001 32.436001 19.392000 + CE2 20.902000 30.856001 20.548000 + HE2 20.169001 30.180000 20.174999 + CD2 21.929001 30.468000 21.473000 + HD2 22.025999 29.465000 21.884001 + C 25.471001 29.308001 21.680000 + O 25.422001 29.070999 20.487000 + N 25.547001 28.389999 22.624001 + H 25.438999 28.750999 23.565001 + CA 25.743999 26.962000 22.444000 + HA 25.503000 26.646999 21.423000 + CB 27.216999 26.635000 22.723000 + HB 27.507000 27.037001 23.686001 + CG2 27.459000 25.172001 22.698000 + HG21 27.174000 24.802000 21.704000 + HG22 28.525000 24.992001 22.799000 + HG23 26.974001 24.705000 23.562000 + OG1 28.183001 27.145000 21.778999 + HG1 28.490999 27.962000 22.174000 + C 24.840000 26.252001 23.396000 + O 24.993999 26.368000 24.650000 + N 23.921000 25.407000 22.864000 + H 23.792000 25.363001 21.862000 + CA 23.184999 24.448999 23.674000 + HA 23.176001 24.722000 24.738001 + CB 21.681000 24.237000 23.173000 + HB 21.579000 23.358999 22.538000 + CG1 20.811001 24.122999 24.396000 + HG11 21.056000 23.201000 24.931999 + HG12 20.853001 25.014000 25.046000 + HG13 19.746000 24.146999 24.155001 + CG2 21.216000 25.393000 22.268000 + HG21 21.138000 26.372000 22.688999 + HG22 21.896999 25.462999 21.410999 + HG23 20.205999 25.216999 21.903999 + C 23.813000 23.059999 23.599001 + O 23.926001 22.535000 22.535999 + N 24.299000 22.615999 24.763000 + H 24.115999 23.039000 25.677999 + CA 25.055000 21.367001 24.976000 + HA 25.730000 21.396999 24.101999 + CB 25.955999 21.405001 26.252001 + HB 26.698999 20.606001 26.297001 + CG2 26.799000 22.662001 26.341999 + HG21 26.400000 23.490000 26.900000 + HG22 27.726999 22.270000 26.746000 + HG23 26.997000 23.023001 25.341000 + OG1 25.091999 21.486000 27.341999 + HG1 24.570999 22.270000 27.320999 + C 24.242001 20.051001 24.921000 + O 24.604000 18.999001 25.445000 + N 23.042999 20.115000 24.253000 + H 22.997999 20.992001 23.731001 + CA 22.235001 18.993999 23.775000 + HA 22.077999 18.368000 24.646999 + CB 20.777000 19.410000 23.356001 + HB1 20.219000 18.511000 23.118999 + HB2 20.305000 19.875000 24.226999 + CG 20.764000 20.438000 22.186001 + HG1 20.070999 21.218000 22.458000 + HG2 21.771999 20.841999 22.122000 + CD 20.354000 19.847000 20.841999 + OE1 21.136000 19.959000 19.878000 + OE2 19.327000 19.124001 20.763000 + C 22.938000 18.226999 22.639000 + O 23.724001 18.790001 21.837999 + N 22.670000 16.910000 22.429001 + H 21.915001 16.459000 22.921000 + CH3 23.198000 16.097000 21.344999 + HH31 23.355000 15.066000 21.643999 + HH32 24.146999 16.496000 20.975000 + HH33 22.497999 16.171000 20.511999 diff --git a/regtest/scripts/run b/regtest/scripts/run index a3d6c955a..c45c26ad1 100755 --- a/regtest/scripts/run +++ b/regtest/scripts/run @@ -138,6 +138,9 @@ case "$type" in (plumed) $mpi $valgrind $plumed $arg > out 2> err ;; +(python) + python $arg > out 2> err + ;; (*) echo "unknown test type" ; exit 1 ;; esac diff --git a/sourceme.sh.in b/sourceme.sh.in index a98ab0889..53518dd2e 100644 --- a/sourceme.sh.in +++ b/sourceme.sh.in @@ -4,3 +4,4 @@ export LD_LIBRARY_PATH="@build_dir@/src/lib/:$LD_LIBRARY_PATH" export DYLD_LIBRARY_PATH="@build_dir@/src/lib/:$DYLD_LIBRARY_PATH" export PLUMED_KERNEL="@build_dir@/src/lib/libplumedKernel.@SOEXT@" export PLUMED_VIMPATH="@build_dir@/vim" +export PYTHONPATH="@build_dir@/python:$PYTHONPATH" diff --git a/src/.gitignore b/src/.gitignore index ae3774508..17fcc4e5c 100644 --- a/src/.gitignore +++ b/src/.gitignore @@ -27,6 +27,7 @@ !/manyrestraints !/molfile !/multicolvar +!/python !/pamm !/reference !/secondarystructure diff --git a/src/cltools/Info.cpp b/src/cltools/Info.cpp index 3a8600abd..d23a0f1fb 100644 --- a/src/cltools/Info.cpp +++ b/src/cltools/Info.cpp @@ -72,6 +72,7 @@ void Info::registerKeywords( Keywords& keys ) { keys.addFlag("--version",false,"print the version number"); keys.addFlag("--long-version",false,"print the version number (long version)"); keys.addFlag("--git-version",false,"print the version number (git version, if available)"); + keys.addFlag("--include-dir",false,"print the location of the include dir"); } Info::Info(const CLToolOptions& co ): @@ -89,8 +90,10 @@ int Info::main(FILE* in, FILE*out,Communicator& pc) { bool printversion; parseFlag("--version",printversion); bool printlongversion; parseFlag("--long-version",printlongversion); bool printgitversion; parseFlag("--git-version",printgitversion); + bool printincludedir; parseFlag("--include-dir",printincludedir); if(printroot) fprintf(out,"%s\n",config::getPlumedRoot().c_str()); if(printconfiguration) fprintf(out,"%s",config::getMakefile().c_str()); + if(printincludedir) fprintf(out,"%s\n",config::getPlumedIncludedir().c_str()); if(printuserdoc) { std::string userdoc=config::getPlumedHtmldir()+"/user-doc/html/index.html"; FILE *ff=std::fopen(userdoc.c_str(),"r"); diff --git a/src/core/DataFetchingObject.cpp b/src/core/DataFetchingObject.cpp new file mode 100644 index 000000000..8cb51f349 --- /dev/null +++ b/src/core/DataFetchingObject.cpp @@ -0,0 +1,158 @@ +/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ + Copyright (c) 2011-2015 The plumed team + (see the PEOPLE file at the root of the distribution for a list of names) + + See http://www.plumed-code.org for more information. + + This file is part of plumed, version 2. + + plumed is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + plumed is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public License + along with plumed. If not, see <http://www.gnu.org/licenses/>. ++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */ +#include "DataFetchingObject.h" +#include "PlumedMain.h" +#include "ActionSet.h" +#include "Action.h" +#include "ActionWithValue.h" +#include "Value.h" + +namespace PLMD { + +template <class T> +class DataFetchingObjectTyped : public DataFetchingObject { +private: +/// A map containing the data we are grabbing + std::map<std::string,T*> data; +public: + explicit DataFetchingObjectTyped(PlumedMain&plumed); + ~DataFetchingObjectTyped() {} + void setData( const std::string& key, const std::string& type, void* outval ); + void finishDataGrab(); +}; + +DataFetchingObject* DataFetchingObject::create(unsigned n, PlumedMain& p) { + if(n==sizeof(double)) { + return new DataFetchingObjectTyped<double>(p); + } else if(n==sizeof(float)) { + return new DataFetchingObjectTyped<float>(p); + } + std::string pp; Tools::convert(n,pp); + plumed_merror("cannot create an MD interface with sizeof(real)=="+ pp); + return NULL; +} + +DataFetchingObject::DataFetchingObject(PlumedMain&p): + plumed(p) +{ +} + +bool DataFetchingObject::activate() const { + for(unsigned j=0; j<myactions.size(); ++j) myactions[j]->activate(); + if( myactions.size()>0 ) return true; + return false; +} + +ActionWithValue* DataFetchingObject::findAction( const ActionSet& a, const std::string& key ) { + std::string aname = key; std::size_t dot = key.find("."); + if( dot!=std::string::npos ) aname = key.substr(0,dot); + return a.selectWithLabel<ActionWithValue*>( aname ); +} + +void DataFetchingObject::get_rank( const ActionSet& a, const std::string& key, const std::string& type, long* dims ) { + plumed_assert( Tools::getWords(key,"\t\n ,").size()==1 ); + plumed_massert( key.find("*")==std::string::npos, "cannot use wildcards in python interface"); + + // Find the appropriate action and store value containing quantity of interest + ActionWithValue* myv = findAction( a, key ); + Value* val = myv->copyOutput( key ); + + // Now work out what we are returning for this action + if( type=="" ) { + // Return a single value in this case + dims[0]=1; + } else if( type=="derivatives" ) { + plumed_merror("not yet implemented"); + } else if( type=="forces" ) { + plumed_merror("not yet implemented"); + } else { + plumed_merror("invalid type specifier"); + } +} + +void DataFetchingObject::get_shape( const ActionSet& a, const std::string& key, const std::string& type, long* dims ) { + plumed_assert( Tools::getWords(key,"\t\n ,").size()==1 ); + plumed_massert( key.find("*")==std::string::npos, "cannot use wildcards in python interface"); + + // Find the appropriate action and store value containing quantity of interest + ActionWithValue* myv = findAction( a, key ); + Value* val = myv->copyOutput( key ); + + // Now work out what we are returning for this action + if( type=="" ) { + // Return a single value in this case + dims[0]=1; + } else if( type=="derivatives" ) { + plumed_merror("not yet implemented"); + } else if( type=="forces" ) { + plumed_merror("not yet implemented"); + } else { + plumed_merror("invalid type specifier"); + } +} + +template <class T> +DataFetchingObjectTyped<T>::DataFetchingObjectTyped(PlumedMain&p): + DataFetchingObject(p) +{ +} + +template <class T> +void DataFetchingObjectTyped<T>::setData( const std::string& key, const std::string& type, void* outval ) { + plumed_assert( Tools::getWords(key,"\t\n ,").size()==1 ); + plumed_massert( key.find("*")==std::string::npos, "cannot use wildcards in python interface"); + plumed_massert( !data.count(key + " " + type), "already collecting this data elsewhere"); + // Add the space to store the data to the data map + T* f=static_cast<T*>(outval); + data.insert(std::pair<std::string,T*>(key + " " + type,f)); + + // Find the appropriate action and store value containing quantity of interest + ActionWithValue* myv = DataFetchingObject::findAction( plumed.getActionSet(), key ); + // Store the action if not already stored + bool found=false; + for(const auto & p : myactions) { + if( p->getLabel()==myv->getLabel() ) { found=true; break; } + } + if( !found ) myactions.push_back( myv ); + // Store the value + myvalues.push_back( myv->copyOutput( key ) ); +} + +template <class T> +void DataFetchingObjectTyped<T>::finishDataGrab() { + // Run over all values and collect data + for(const auto & p : myvalues ) { + T* val = static_cast<T*>( data.find(p->getName() + " ")->second ); + if( data.find(p->getName() + " ")!=data.end() ) { + val[0] = static_cast<T>( p->get() ); + } + if( data.find(p->getName() + " derivatives")!=data.end() ) { + plumed_merror("not implemented yet"); + } + if( data.find(p->getName() + " forces")!=data.end() ) { + plumed_merror("not implemented yet"); + } + } +} + +} + diff --git a/src/core/DataFetchingObject.h b/src/core/DataFetchingObject.h new file mode 100644 index 000000000..ab38eab93 --- /dev/null +++ b/src/core/DataFetchingObject.h @@ -0,0 +1,65 @@ +/* +++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ + Copyright (c) 2011-2015 The plumed team + (see the PEOPLE file at the root of the distribution for a list of names) + + See http://www.plumed-code.org for more information. + + This file is part of plumed, version 2. + + plumed is free software: you can redistribute it and/or modify + it under the terms of the GNU Lesser General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + plumed is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public License + along with plumed. If not, see <http://www.gnu.org/licenses/>. ++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ */ +#ifndef __PLUMED_core_DataFetchingObject_h +#define __PLUMED_core_DataFetchingObject_h + +#include <string> +#include <vector> +#include <set> +#include <map> + +namespace PLMD { + +class ActionSet; +class PlumedMain; +class ActionWithValue; +class Value; + +class DataFetchingObject { +protected: +/// Pointers to the various actions required by the grabber + std::vector<ActionWithValue*> myactions; +/// The values required by the user + std::vector<Value*> myvalues; +/// A copy of the plumed main object + PlumedMain & plumed; +public: + static DataFetchingObject* create(unsigned n, PlumedMain& p); +/// A constructor so that we can create the plumed main object + explicit DataFetchingObject(PlumedMain&p); + virtual ~DataFetchingObject() {} +/// + bool activate() const ; +/// Return the rank required for a particular key + static void get_rank( const ActionSet& a, const std::string& key, const std::string& type, long* rank ); +/// Return the shape required for a particular key + static void get_shape( const ActionSet& a, const std::string& key, const std::string& type, long* dims ); +/// Find the action that calculates a particular value + static ActionWithValue* findAction( const ActionSet& a, const std::string& key ); +/// Set the pointer to the data + virtual void setData( const std::string& key, const std::string& type, void* outval )=0; +/// After calc has been performed grab all the data and put it in the relevant arrays + virtual void finishDataGrab()=0; +}; + +} +#endif diff --git a/src/core/PlumedMain.cpp b/src/core/PlumedMain.cpp index 9a28cc0a0..f23f87d11 100644 --- a/src/core/PlumedMain.cpp +++ b/src/core/PlumedMain.cpp @@ -40,6 +40,7 @@ #include "tools/OpenMP.h" #include "tools/Tools.h" #include "tools/Stopwatch.h" +#include "DataFetchingObject.h" #include <cstdlib> #include <cstring> #include <set> @@ -87,6 +88,7 @@ PlumedMain::PlumedMain(): { log.link(comm); log.setLinePrefix("PLUMED: "); + mydatafetcher.reset(DataFetchingObject::create(sizeof(double),*this)); stopwatch.start(); stopwatch.pause(); } @@ -247,6 +249,21 @@ void PlumedMain::cmd(const std::string & word,void*val) { CHECK_INIT(initialized,word); atoms.clearFullList(); break; + case cmd_getDataRank: + CHECK_INIT(initialized,words[0]); plumed_assert(nw==2 || nw==3); + if( nw==2 ) DataFetchingObject::get_rank( actionSet, words[1], "", static_cast<long*>(val) ); + else DataFetchingObject::get_rank( actionSet, words[1], words[2], static_cast<long*>(val) ); + break; + case cmd_getDataShape: + CHECK_INIT(initialized,words[0]); plumed_assert(nw==2 || nw==3); + if( nw==2 ) DataFetchingObject::get_shape( actionSet, words[1], "", static_cast<long*>(val) ); + else DataFetchingObject::get_shape( actionSet, words[1], words[2], static_cast<long*>(val) ); + break; + case cmd_setMemoryForData: + CHECK_INIT(initialized,words[0]); plumed_assert(nw==2 || nw==3); + if( nw==2 ) mydatafetcher->setData( words[1], "", val ); + else mydatafetcher->setData( words[1], words[2], val ); + break; case cmd_read: CHECK_INIT(initialized,word); if(val)readInputFile(static_cast<char*>(val)); @@ -274,6 +291,7 @@ void PlumedMain::cmd(const std::string & word,void*val) { CHECK_NOTINIT(initialized,word); CHECK_NOTNULL(val,word); atoms.setRealPrecision(*static_cast<int*>(val)); + mydatafetcher.reset(DataFetchingObject::create(*static_cast<int*>(val),*this)); break; case cmd_setMDLengthUnits: CHECK_NOTINIT(initialized,word); @@ -586,7 +604,7 @@ void PlumedMain::prepareDependencies() { } // for optimization, an "active" flag remains false if no action at all is active - active=false; + active=mydatafetcher->activate(); for(unsigned i=0; i<pilots.size(); ++i) { if(pilots[i]->onStep()) { pilots[i]->activate(); @@ -623,6 +641,7 @@ void PlumedMain::performCalc() { justCalculate(); backwardPropagate(); update(); + mydatafetcher->finishDataGrab(); } void PlumedMain::waitData() { @@ -826,6 +845,10 @@ void PlumedMain::runJobsAtEndOfCalculation() { } } +#ifdef __PLUMED_HAS_PYTHON +// This is here to stop cppcheck throwing an error +#endif + } ////////////////////////////////////////////////////////////////////////////////////////////////////////////////// diff --git a/src/core/PlumedMain.h b/src/core/PlumedMain.h index 35f4e130a..e19df3b24 100644 --- a/src/core/PlumedMain.h +++ b/src/core/PlumedMain.h @@ -63,6 +63,7 @@ class Stopwatch; class Citations; class ExchangePatterns; class FileBase; +class DataFetchingObject; /** Main plumed object. @@ -130,6 +131,9 @@ private: /// Name of the input file std::string plumedDat; +/// Object containing data we would like to grab and pass back + std::unique_ptr<DataFetchingObject> mydatafetcher; + /// End of input file. /// Set to true to terminate reading bool endPlumed; diff --git a/src/lib/Makefile b/src/lib/Makefile index a86e5ecde..b27f65adc 100644 --- a/src/lib/Makefile +++ b/src/lib/Makefile @@ -200,6 +200,12 @@ endif if test -d ../../vim/syntax ; then mkdir -p "$(DESTDIR)$(libdir)/$(program_name)" && cd ../../ && tar cf - vim/syntax | tar xf - -C "$(DESTDIR)$(libdir)/$(program_name)/" ; fi if test -d ../../vim/help ; then mkdir -p "$(DESTDIR)$(libdir)/$(program_name)" && cd ../../ && tar cf - vim/help | tar xf - -C "$(DESTDIR)$(libdir)/$(program_name)/" ; fi if test -f ../../vim/scripts.vim ; then cp ../../vim/scripts.vim "$(DESTDIR)$(libdir)/$(program_name)/vim/" ; fi +# python installation (rebuild prior to installation so as to discover plumed in path) +ifneq (,$(findstring __PLUMED_HAS_PYTHON,$(CPPFLAGS))) + cp -pr ../../python install + cd install/python && rm -fr *.so plumed.cpp build && python buildPythonInterface.py build_ext -i + cp -pr install/python "$(DESTDIR)$(libdir)/$(program_name)/" +endif # making everything visible: chmod -R go+rX,go-w "$(DESTDIR)$(libdir)/$(program_name)" chmod -R go+rX,go-w "$(DESTDIR)$(includedir)/$(program_name)" @@ -243,6 +249,11 @@ endif @if test -d ../../vim/help ; then echo "- Set this environment variable : PLUMED_VIMPATH=$(libdir)/$(program_name)/vim" ; fi @if test -d ../../vim/help ; then echo "- Add the command 'let &runtimepath.=','.\$$PLUMED_VIMPATH' to your .vimrc file" ; fi @if test -d ../../vim/help ; then echo "From vim, you can use :set syntax=$(program_name) to enable it" ; fi + @if test -d ../../python/build ; then echo "A python plugin can be found here: $(libdir)/$(program_name)/python/" ; fi + @if test -d ../../python/build ; then echo "To use PLUMED through python either : " ; fi + @if test -d ../../python/build ; then echo "- Add $(libdir)/$(program_name)/python/ to your PYTHONPATH" ; fi + @if test -d ../../python/build ; then echo "- Execute the command python buildPythonInterface.py install in the plumed2/python directory"; fi + @if test -d ../../python/build ; then echo "Plumed can be loaded in a python script using the command import plumed" ; fi ifeq ($(program_can_run),no) @echo "WARNING: $(program_name) executable will not run on this machine" @echo "WARNING: to patch an MD code use 'plumed-patch'" diff --git a/src/lib/modulefile.in b/src/lib/modulefile.in index 3f92600ad..3d84958d4 100644 --- a/src/lib/modulefile.in +++ b/src/lib/modulefile.in @@ -43,6 +43,7 @@ if { [module-info mode load] && [ info exists ::env(PLUMED_KERNEL) ] } { prepend-path LIBRARY_PATH $libdir prepend-path LD_LIBRARY_PATH $libdir prepend-path DYLD_LIBRARY_PATH $libdir +prepend-path PYTHONPATH $libdir/$progname/python setenv PLUMED_KERNEL $libdir/lib${progname}Kernel.$soext setenv PLUMED_VIMPATH $libdir/$progname/vim } -- GitLab